FI57416C - Foerfarande foer framstaellning av terapeutiskt anvaendbara nya 5,5,7,7-tetrametylfuro(3,4-e)-as-triaziner - Google Patents
Foerfarande foer framstaellning av terapeutiskt anvaendbara nya 5,5,7,7-tetrametylfuro(3,4-e)-as-triaziner Download PDFInfo
- Publication number
- FI57416C FI57416C FI751205A FI751205A FI57416C FI 57416 C FI57416 C FI 57416C FI 751205 A FI751205 A FI 751205A FI 751205 A FI751205 A FI 751205A FI 57416 C FI57416 C FI 57416C
- Authority
- FI
- Finland
- Prior art keywords
- formula
- compounds
- tetramethyl
- compound
- hydrogen
- Prior art date
Links
- 230000001225 therapeutic effect Effects 0.000 title 1
- 150000001875 compounds Chemical class 0.000 claims description 29
- 125000004432 carbon atom Chemical group C* 0.000 claims description 10
- 239000001257 hydrogen Substances 0.000 claims description 8
- 229910052739 hydrogen Inorganic materials 0.000 claims description 8
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims description 8
- 239000002253 acid Substances 0.000 claims description 6
- 239000012298 atmosphere Substances 0.000 claims description 6
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 5
- 239000000460 chlorine Substances 0.000 claims description 5
- 229910052801 chlorine Inorganic materials 0.000 claims description 5
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 claims description 4
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 4
- 125000000217 alkyl group Chemical group 0.000 claims description 4
- 239000011737 fluorine Substances 0.000 claims description 4
- 229910052731 fluorine Inorganic materials 0.000 claims description 4
- 150000002431 hydrogen Chemical class 0.000 claims description 4
- 229910052799 carbon Inorganic materials 0.000 claims description 3
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 claims description 3
- 150000002148 esters Chemical class 0.000 claims description 2
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims description 2
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 2
- 229910002651 NO3 Inorganic materials 0.000 claims 1
- NHNBFGGVMKEFGY-UHFFFAOYSA-N Nitrate Chemical compound [O-][N+]([O-])=O NHNBFGGVMKEFGY-UHFFFAOYSA-N 0.000 claims 1
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 21
- 239000000203 mixture Substances 0.000 description 11
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 8
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 8
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 8
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 7
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 6
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 6
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 6
- 238000006243 chemical reaction Methods 0.000 description 6
- 238000000034 method Methods 0.000 description 6
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 5
- -1 benzene or toluene Chemical class 0.000 description 5
- 229910052757 nitrogen Inorganic materials 0.000 description 5
- XKRFYHLGVUSROY-UHFFFAOYSA-N Argon Chemical compound [Ar] XKRFYHLGVUSROY-UHFFFAOYSA-N 0.000 description 4
- GRYLNZFGIOXLOG-UHFFFAOYSA-N Nitric acid Chemical compound O[N+]([O-])=O GRYLNZFGIOXLOG-UHFFFAOYSA-N 0.000 description 4
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 4
- 125000003545 alkoxy group Chemical group 0.000 description 4
- 239000003054 catalyst Substances 0.000 description 4
- HGCIXCUEYOPUTN-UHFFFAOYSA-N cyclohexene Chemical compound C1CCC=CC1 HGCIXCUEYOPUTN-UHFFFAOYSA-N 0.000 description 4
- 230000035484 reaction time Effects 0.000 description 4
- 150000003839 salts Chemical class 0.000 description 4
- 239000002904 solvent Substances 0.000 description 4
- 150000004945 aromatic hydrocarbons Chemical class 0.000 description 3
- 238000009835 boiling Methods 0.000 description 3
- 238000002474 experimental method Methods 0.000 description 3
- 239000000706 filtrate Substances 0.000 description 3
- 239000003960 organic solvent Substances 0.000 description 3
- 239000002244 precipitate Substances 0.000 description 3
- 239000000932 sedative agent Substances 0.000 description 3
- 230000001624 sedative effect Effects 0.000 description 3
- ITMCEJHCFYSIIV-UHFFFAOYSA-N triflic acid Chemical compound OS(=O)(=O)C(F)(F)F ITMCEJHCFYSIIV-UHFFFAOYSA-N 0.000 description 3
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 description 3
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 2
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 2
- GQPLMRYTRLFLPF-UHFFFAOYSA-N Nitrous Oxide Chemical compound [O-][N+]#N GQPLMRYTRLFLPF-UHFFFAOYSA-N 0.000 description 2
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 2
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 2
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 2
- 150000007513 acids Chemical class 0.000 description 2
- 229910052786 argon Inorganic materials 0.000 description 2
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid Chemical compound OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 2
- 239000001307 helium Substances 0.000 description 2
- 229910052734 helium Inorganic materials 0.000 description 2
- SWQJXJOGLNCZEY-UHFFFAOYSA-N helium atom Chemical compound [He] SWQJXJOGLNCZEY-UHFFFAOYSA-N 0.000 description 2
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 2
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 2
- ZGEGCLOFRBLKSE-UHFFFAOYSA-N methylene hexane Natural products CCCCCC=C ZGEGCLOFRBLKSE-UHFFFAOYSA-N 0.000 description 2
- 230000000802 nitrating effect Effects 0.000 description 2
- 238000006396 nitration reaction Methods 0.000 description 2
- 239000012299 nitrogen atmosphere Substances 0.000 description 2
- 229910000510 noble metal Inorganic materials 0.000 description 2
- 239000012044 organic layer Substances 0.000 description 2
- BASFCYQUMIYNBI-UHFFFAOYSA-N platinum Chemical compound [Pt] BASFCYQUMIYNBI-UHFFFAOYSA-N 0.000 description 2
- 238000002360 preparation method Methods 0.000 description 2
- 229940125723 sedative agent Drugs 0.000 description 2
- BMYNFMYTOJXKLE-UHFFFAOYSA-N 3-azaniumyl-2-hydroxypropanoate Chemical compound NCC(O)C(O)=O BMYNFMYTOJXKLE-UHFFFAOYSA-N 0.000 description 1
- 239000005711 Benzoic acid Substances 0.000 description 1
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 1
- 101100246550 Caenorhabditis elegans pyr-1 gene Proteins 0.000 description 1
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 1
- KRHYYFGTRYWZRS-UHFFFAOYSA-N Fluorane Chemical compound F KRHYYFGTRYWZRS-UHFFFAOYSA-N 0.000 description 1
- VRDJHWPWOGKRMU-UHFFFAOYSA-N N-(4-hydrazinylidene-2,2,5,5-tetramethyloxolan-3-ylidene)hydroxylamine Chemical compound CC1(C)OC(C)(C)C(=NO)C1=NN VRDJHWPWOGKRMU-UHFFFAOYSA-N 0.000 description 1
- 125000000815 N-oxide group Chemical group 0.000 description 1
- OFOBLEOULBTSOW-UHFFFAOYSA-N Propanedioic acid Natural products OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 description 1
- KDYFGRWQOYBRFD-UHFFFAOYSA-N Succinic acid Natural products OC(=O)CCC(O)=O KDYFGRWQOYBRFD-UHFFFAOYSA-N 0.000 description 1
- 241000906446 Theraps Species 0.000 description 1
- 235000010233 benzoic acid Nutrition 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 1
- 229910052794 bromium Inorganic materials 0.000 description 1
- KDYFGRWQOYBRFD-NUQCWPJISA-N butanedioic acid Chemical compound O[14C](=O)CC[14C](O)=O KDYFGRWQOYBRFD-NUQCWPJISA-N 0.000 description 1
- 239000002775 capsule Substances 0.000 description 1
- 150000001721 carbon Chemical group 0.000 description 1
- 239000003153 chemical reaction reagent Substances 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- OMBRFUXPXNIUCZ-UHFFFAOYSA-N dioxidonitrogen(1+) Chemical compound O=[N+]=O OMBRFUXPXNIUCZ-UHFFFAOYSA-N 0.000 description 1
- 239000003814 drug Substances 0.000 description 1
- 229940079593 drug Drugs 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 239000007789 gas Substances 0.000 description 1
- 239000008241 heterogeneous mixture Substances 0.000 description 1
- UYXAWHWODHRRMR-UHFFFAOYSA-N hexobarbital Chemical compound O=C1N(C)C(=O)NC(=O)C1(C)C1=CCCCC1 UYXAWHWODHRRMR-UHFFFAOYSA-N 0.000 description 1
- 229960002456 hexobarbital Drugs 0.000 description 1
- 229910000040 hydrogen fluoride Inorganic materials 0.000 description 1
- 230000000147 hypnotic effect Effects 0.000 description 1
- 230000001939 inductive effect Effects 0.000 description 1
- 229910052500 inorganic mineral Inorganic materials 0.000 description 1
- 239000010410 layer Substances 0.000 description 1
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 1
- 235000019341 magnesium sulphate Nutrition 0.000 description 1
- VZCYOOQTPOCHFL-UPHRSURJSA-N maleic acid Chemical compound OC(=O)\C=C/C(O)=O VZCYOOQTPOCHFL-UPHRSURJSA-N 0.000 description 1
- 239000011976 maleic acid Substances 0.000 description 1
- 239000000155 melt Substances 0.000 description 1
- 238000002844 melting Methods 0.000 description 1
- UKVIEHSSVKSQBA-UHFFFAOYSA-N methane;palladium Chemical compound C.[Pd] UKVIEHSSVKSQBA-UHFFFAOYSA-N 0.000 description 1
- 239000011707 mineral Substances 0.000 description 1
- 235000010755 mineral Nutrition 0.000 description 1
- 239000003158 myorelaxant agent Substances 0.000 description 1
- 229910017604 nitric acid Inorganic materials 0.000 description 1
- LYGJENNIWJXYER-UHFFFAOYSA-N nitromethane Chemical compound C[N+]([O-])=O LYGJENNIWJXYER-UHFFFAOYSA-N 0.000 description 1
- 125000006501 nitrophenyl group Chemical group 0.000 description 1
- 239000001272 nitrous oxide Substances 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- 235000005985 organic acids Nutrition 0.000 description 1
- 150000002923 oximes Chemical class 0.000 description 1
- 229910052763 palladium Inorganic materials 0.000 description 1
- 230000003285 pharmacodynamic effect Effects 0.000 description 1
- 239000006187 pill Substances 0.000 description 1
- 229910052697 platinum Inorganic materials 0.000 description 1
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 1
- BPGBAEXPBQHBSV-UHFFFAOYSA-N pyr1 Chemical compound C1=C2C3=C(C)C(C(NC=C4)=O)=C4C(C)=C3NC2=CC=C1OC(=O)C1=CC=CC=C1 BPGBAEXPBQHBSV-UHFFFAOYSA-N 0.000 description 1
- 239000012429 reaction media Substances 0.000 description 1
- 230000011514 reflex Effects 0.000 description 1
- 229910052703 rhodium Inorganic materials 0.000 description 1
- 239000010948 rhodium Substances 0.000 description 1
- MHOVAHRLVXNVSD-UHFFFAOYSA-N rhodium atom Chemical compound [Rh] MHOVAHRLVXNVSD-UHFFFAOYSA-N 0.000 description 1
- 229920006395 saturated elastomer Polymers 0.000 description 1
- 235000017557 sodium bicarbonate Nutrition 0.000 description 1
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 1
- 239000011780 sodium chloride Substances 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 125000001424 substituent group Chemical group 0.000 description 1
- LMBFAGIMSUYTBN-MPZNNTNKSA-N teixobactin Chemical compound C([C@H](C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H](CCC(N)=O)C(=O)N[C@H]([C@@H](C)CC)C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H]1C(N[C@@H](C)C(=O)N[C@@H](C[C@@H]2NC(=N)NC2)C(=O)N[C@H](C(=O)O[C@H]1C)[C@@H](C)CC)=O)NC)C1=CC=CC=C1 LMBFAGIMSUYTBN-MPZNNTNKSA-N 0.000 description 1
- 230000001988 toxicity Effects 0.000 description 1
- 231100000419 toxicity Toxicity 0.000 description 1
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 1
- BDZBKCUKTQZUTL-UHFFFAOYSA-N triethyl phosphite Chemical compound CCOP(OCC)OCC BDZBKCUKTQZUTL-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D491/00—Heterocyclic compounds containing in the condensed ring system both one or more rings having oxygen atoms as the only ring hetero atoms and one or more rings having nitrogen atoms as the only ring hetero atoms, not provided for by groups C07D451/00 - C07D459/00, C07D463/00, C07D477/00 or C07D489/00
- C07D491/02—Heterocyclic compounds containing in the condensed ring system both one or more rings having oxygen atoms as the only ring hetero atoms and one or more rings having nitrogen atoms as the only ring hetero atoms, not provided for by groups C07D451/00 - C07D459/00, C07D463/00, C07D477/00 or C07D489/00 in which the condensed system contains two hetero rings
- C07D491/04—Ortho-condensed systems
- C07D491/044—Ortho-condensed systems with only one oxygen atom as ring hetero atom in the oxygen-containing ring
- C07D491/048—Ortho-condensed systems with only one oxygen atom as ring hetero atom in the oxygen-containing ring the oxygen-containing ring being five-membered
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Nitrogen Condensed Heterocyclic Rings (AREA)
- Low-Molecular Organic Synthesis Reactions Using Catalysts (AREA)
Applications Claiming Priority (4)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US46575974A | 1974-05-01 | 1974-05-01 | |
| US46575974 | 1974-05-01 | ||
| US49657874A | 1974-08-12 | 1974-08-12 | |
| US49657874 | 1974-08-12 |
Publications (3)
| Publication Number | Publication Date |
|---|---|
| FI751205A7 FI751205A7 (enExample) | 1975-11-02 |
| FI57416B FI57416B (fi) | 1980-04-30 |
| FI57416C true FI57416C (fi) | 1980-08-11 |
Family
ID=27041399
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| FI751205A FI57416C (fi) | 1974-05-01 | 1975-04-22 | Foerfarande foer framstaellning av terapeutiskt anvaendbara nya 5,5,7,7-tetrametylfuro(3,4-e)-as-triaziner |
Country Status (18)
| Country | Link |
|---|---|
| JP (1) | JPS50149696A (enExample) |
| AT (1) | AT357545B (enExample) |
| BE (1) | BE828548A (enExample) |
| CA (1) | CA1033734A (enExample) |
| CH (1) | CH617435A5 (enExample) |
| DD (1) | DD119792A5 (enExample) |
| DE (1) | DE2517994A1 (enExample) |
| DK (1) | DK139301B (enExample) |
| ES (3) | ES437214A1 (enExample) |
| FI (1) | FI57416C (enExample) |
| FR (1) | FR2269347B1 (enExample) |
| GB (1) | GB1496709A (enExample) |
| HU (1) | HU171171B (enExample) |
| IL (2) | IL47192A (enExample) |
| NL (1) | NL7504919A (enExample) |
| NO (1) | NO751455L (enExample) |
| SE (1) | SE7504692L (enExample) |
| SU (1) | SU588919A3 (enExample) |
Families Citing this family (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2810224A1 (de) * | 1977-03-18 | 1978-09-28 | Sandoz Ag | As-triazinderivate und verfahren zu ihrer herstellung |
| CH644863A5 (de) * | 1978-02-03 | 1984-08-31 | Sandoz Ag | Aethanopyrano-(4,3-e)-as-triazine, ihre herstellung und diese enthaltende beruhigungs- und schlafeinleitungsmittel. |
-
1975
- 1975-04-22 FI FI751205A patent/FI57416C/fi not_active IP Right Cessation
- 1975-04-22 DK DK172775AA patent/DK139301B/da active IP Right Grant
- 1975-04-22 CH CH514275A patent/CH617435A5/de not_active IP Right Cessation
- 1975-04-23 DE DE19752517994 patent/DE2517994A1/de not_active Withdrawn
- 1975-04-23 SE SE7504692A patent/SE7504692L/xx unknown
- 1975-04-23 NO NO751455A patent/NO751455L/no unknown
- 1975-04-25 NL NL7504919A patent/NL7504919A/xx not_active Application Discontinuation
- 1975-04-28 GB GB17647/75A patent/GB1496709A/en not_active Expired
- 1975-04-29 DD DD185757A patent/DD119792A5/xx unknown
- 1975-04-29 BE BE155916A patent/BE828548A/fr unknown
- 1975-04-29 ES ES437214A patent/ES437214A1/es not_active Expired
- 1975-04-29 HU HU75SA00002784A patent/HU171171B/hu unknown
- 1975-04-29 IL IL47192A patent/IL47192A/xx unknown
- 1975-04-30 FR FR7513539A patent/FR2269347B1/fr not_active Expired
- 1975-04-30 AT AT332475A patent/AT357545B/de not_active IP Right Cessation
- 1975-04-30 CA CA225,868A patent/CA1033734A/en not_active Expired
- 1975-04-30 JP JP50051568A patent/JPS50149696A/ja active Pending
-
1976
- 1976-03-05 SU SU762331170A patent/SU588919A3/ru active
- 1976-12-16 ES ES454313A patent/ES454313A1/es not_active Expired
- 1976-12-16 ES ES454312A patent/ES454312A1/es not_active Expired
-
1977
- 1977-08-17 IL IL52763A patent/IL52763A0/xx unknown
Also Published As
| Publication number | Publication date |
|---|---|
| IL47192A (en) | 1978-04-30 |
| DK172775A (enExample) | 1975-11-02 |
| DK139301B (da) | 1979-01-29 |
| FR2269347A1 (enExample) | 1975-11-28 |
| DE2517994A1 (de) | 1975-11-13 |
| IL52763A0 (en) | 1977-10-31 |
| ES454312A1 (es) | 1977-12-01 |
| NL7504919A (nl) | 1975-11-04 |
| AT357545B (de) | 1980-07-10 |
| ATA332475A (de) | 1979-12-15 |
| FI751205A7 (enExample) | 1975-11-02 |
| SE7504692L (sv) | 1975-11-03 |
| AU8064075A (en) | 1976-11-04 |
| DK139301C (enExample) | 1979-07-02 |
| FI57416B (fi) | 1980-04-30 |
| NO751455L (enExample) | 1975-11-04 |
| FR2269347B1 (enExample) | 1978-08-18 |
| SU588919A3 (ru) | 1978-01-15 |
| BE828548A (fr) | 1975-10-29 |
| CA1033734A (en) | 1978-06-27 |
| ES437214A1 (es) | 1977-05-16 |
| HU171171B (hu) | 1977-11-28 |
| CH617435A5 (en) | 1980-05-30 |
| GB1496709A (en) | 1977-12-30 |
| ES454313A1 (es) | 1977-12-01 |
| IL47192A0 (en) | 1975-07-28 |
| JPS50149696A (enExample) | 1975-11-29 |
| DD119792A5 (enExample) | 1976-05-12 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| KR100242398B1 (ko) | 축합 이미다조피리딘 유도체 | |
| WO1996028446A1 (en) | SUBSTITUTED N-CYCLOALKYLMETHYL-1H-PYRAZOLO[3,4-b]QUINOLIN-4 AMINES AND COMPOSITIONS AND METHODS OF USE THEREOF | |
| DK157615B (da) | Analogifremgangsmaade til fremstilling af terapeutisk aktive imidazo oe1,5-aaaoe1,4aa diazepin-forbindelser eller farmaceutisk acceptable syreadditionssalte deraf | |
| US3694456A (en) | 1-disubstituted aminopyrazoles | |
| SI9600186A (en) | Tricyclic 5,6-dihydro-9h-pyrazolo (3,4-c)-1,2,4-triazolo (4,3-alpha) pyridines | |
| ITMI960338A1 (it) | Derivati della camptotecina e loro uso come agenti antitumorali | |
| FI57416C (fi) | Foerfarande foer framstaellning av terapeutiskt anvaendbara nya 5,5,7,7-tetrametylfuro(3,4-e)-as-triaziner | |
| EP0167901A2 (en) | Active compounds | |
| Atwell et al. | Synthesis and cytotoxicity of amino analogues of the potent DNA alkylating agent seco-CBI-TMI | |
| US4016170A (en) | Oxadiazolyl benzamides | |
| Axenrod et al. | Synthesis of 3, 3-bis (difluoramino) octahydro-1, 5, 7, 7-tetranitro-1, 5-diazocine (TNFX), a diversified energetic heterocycle | |
| Hehir et al. | Synthesis of dimethyl substituted benzimidazoles containing cyclopropane fused onto five to eight membered [1, 2-a] alicyclic rings and influence of methyl group substituents on cytotoxicity of benzimidazolequinones | |
| US3891666A (en) | 6-Phenyl-s-triazolo{8 4,3-a{9 {8 1,3,4{9 -benzotriazepines and their preparation | |
| US3734912A (en) | Certain pyrimido(1,2-a)(1,4)benzodiazepin-1(5h)-ones | |
| FI62837C (fi) | Foerfarande foer framstaellning av nya terapeutiskt anvaendbara pyrano(4,3-e)-as-triaziner och deras 4-oxider | |
| US4170599A (en) | Process for the preparation of 1,3,3-trimethyl-2-oxabicyclo[2,2,2]octan-6-ones | |
| Grol et al. | Synthesis and neuroleptic activity of isomeric thieno [1, 4] benzothiazines | |
| US3995048A (en) | Isoxazolyl benzamides useful as tranquilizers and sleep-inducers | |
| WO2009140467A1 (en) | Oxobenzindolizinoquinolines and uses thereof | |
| US3963713A (en) | Furo(3,4-e)-as-triazines and corresponding 4-oxides | |
| Shiotani | Synthesis of B/C-cis and-trans-6-hydroxy-12-methyl-1, 3, 4, 9, 10, 10a-hexahydro-2H-10, 4a-methanoiminoethanophenanthrene | |
| US3541151A (en) | Preparation of tertiary-butylamino-benzophenones | |
| US4055643A (en) | Furo(3,4-E)-as-triazines and corresponding 4-oxides as sleep inducers and minor tranquilizers | |
| GB1563336A (en) | 3-iminoalkyl-2(1h)-pyridones | |
| US3857854A (en) | 6-phenyl-1h,4h-{8 1,2,4{9 oxadiazalo{8 4,3-2{9 {8 1,4{9 benzodiazepin-1-ones |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| MM | Patent lapsed |
Owner name: SANDOZ AG |