ES2567256T3 - Polialcanolaminas alcoxiladas - Google Patents
Polialcanolaminas alcoxiladas Download PDFInfo
- Publication number
- ES2567256T3 ES2567256T3 ES08847336.8T ES08847336T ES2567256T3 ES 2567256 T3 ES2567256 T3 ES 2567256T3 ES 08847336 T ES08847336 T ES 08847336T ES 2567256 T3 ES2567256 T3 ES 2567256T3
- Authority
- ES
- Spain
- Prior art keywords
- formulas
- compounds
- hydroxyalkyl
- compound selected
- amines
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Active
Links
- 150000001875 compounds Chemical class 0.000 claims abstract description 81
- 229920000642 polymer Polymers 0.000 claims abstract description 47
- 150000001412 amines Chemical class 0.000 claims abstract description 40
- 238000009833 condensation Methods 0.000 claims abstract description 33
- 230000005494 condensation Effects 0.000 claims abstract description 33
- 125000002768 hydroxyalkyl group Chemical group 0.000 claims abstract description 32
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims abstract description 31
- 125000002947 alkylene group Chemical group 0.000 claims abstract description 21
- IAYPIBMASNFSPL-UHFFFAOYSA-N Ethylene oxide Chemical compound C1CO1 IAYPIBMASNFSPL-UHFFFAOYSA-N 0.000 claims abstract description 18
- 239000001257 hydrogen Substances 0.000 claims abstract description 16
- 229910052739 hydrogen Inorganic materials 0.000 claims abstract description 16
- 229920000570 polyether Polymers 0.000 claims abstract description 15
- 229920005862 polyol Polymers 0.000 claims abstract description 15
- 239000004721 Polyphenylene oxide Substances 0.000 claims abstract description 14
- 150000003077 polyols Chemical class 0.000 claims abstract description 14
- GOOHAUXETOMSMM-UHFFFAOYSA-N Propylene oxide Chemical compound CC1CO1 GOOHAUXETOMSMM-UHFFFAOYSA-N 0.000 claims abstract description 12
- 125000004432 carbon atom Chemical group C* 0.000 claims abstract description 12
- 125000000753 cycloalkyl group Chemical group 0.000 claims abstract description 12
- 238000005956 quaternization reaction Methods 0.000 claims abstract description 12
- 125000000217 alkyl group Chemical group 0.000 claims abstract description 11
- 125000000467 secondary amino group Chemical group [H]N([*:1])[*:2] 0.000 claims abstract description 11
- 125000003118 aryl group Chemical group 0.000 claims abstract description 9
- 230000005588 protonation Effects 0.000 claims abstract description 9
- 125000001931 aliphatic group Chemical group 0.000 claims abstract description 8
- RBACIKXCRWGCBB-UHFFFAOYSA-N 1,2-Epoxybutane Chemical compound CCC1CO1 RBACIKXCRWGCBB-UHFFFAOYSA-N 0.000 claims abstract description 7
- GELKGHVAFRCJNA-UHFFFAOYSA-N 2,2-Dimethyloxirane Chemical compound CC1(C)CO1 GELKGHVAFRCJNA-UHFFFAOYSA-N 0.000 claims abstract description 7
- QPBYBLZYMNWGMO-UHFFFAOYSA-N 2,2,3-trimethyloxirane Chemical compound CC1OC1(C)C QPBYBLZYMNWGMO-UHFFFAOYSA-N 0.000 claims abstract description 6
- PCGTXZMDZGOMJG-UHFFFAOYSA-N 2,3-diethyloxirane Chemical compound CCC1OC1CC PCGTXZMDZGOMJG-UHFFFAOYSA-N 0.000 claims abstract description 6
- PQXKWPLDPFFDJP-UHFFFAOYSA-N 2,3-dimethyloxirane Chemical compound CC1OC1C PQXKWPLDPFFDJP-UHFFFAOYSA-N 0.000 claims abstract description 6
- WHNBDXQTMPYBAT-UHFFFAOYSA-N 2-butyloxirane Chemical compound CCCCC1CO1 WHNBDXQTMPYBAT-UHFFFAOYSA-N 0.000 claims abstract description 6
- BCJPEZMFAKOJPM-UHFFFAOYSA-N 2-ethyl-3-methyloxirane Chemical compound CCC1OC1C BCJPEZMFAKOJPM-UHFFFAOYSA-N 0.000 claims abstract description 6
- LIESJAYIOKBLIL-UHFFFAOYSA-N 2-methyl-3-propyloxirane Chemical compound CCCC1OC1C LIESJAYIOKBLIL-UHFFFAOYSA-N 0.000 claims abstract description 6
- SYURNNNQIFDVCA-UHFFFAOYSA-N 2-propyloxirane Chemical compound CCCC1CO1 SYURNNNQIFDVCA-UHFFFAOYSA-N 0.000 claims abstract description 6
- OBALOCVLTHUBMB-UHFFFAOYSA-N benzene;oxirene Chemical compound O1C=C1.C1=CC=CC=C1 OBALOCVLTHUBMB-UHFFFAOYSA-N 0.000 claims abstract description 6
- QZXUQPKFNQQQAJ-UHFFFAOYSA-N 2-ethyl-2-methyloxirane Chemical compound CCC1(C)CO1 QZXUQPKFNQQQAJ-UHFFFAOYSA-N 0.000 claims abstract description 5
- 150000001408 amides Chemical class 0.000 claims abstract description 3
- 238000006243 chemical reaction Methods 0.000 claims description 26
- 238000000034 method Methods 0.000 claims description 24
- 230000019635 sulfation Effects 0.000 claims description 16
- 238000005670 sulfation reaction Methods 0.000 claims description 16
- 125000004178 (C1-C4) alkyl group Chemical group 0.000 claims description 10
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 9
- 238000002360 preparation method Methods 0.000 claims description 8
- 229920000768 polyamine Polymers 0.000 claims description 7
- 150000002431 hydrogen Chemical class 0.000 claims description 5
- 125000001570 methylene group Chemical group [H]C([H])([*:1])[*:2] 0.000 claims description 5
- 125000001424 substituent group Chemical group 0.000 claims description 2
- 125000004435 hydrogen atom Chemical class [H]* 0.000 abstract description 6
- 125000003161 (C1-C6) alkylene group Chemical group 0.000 abstract description 2
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 48
- -1 aromatic radical Chemical class 0.000 description 35
- 239000000203 mixture Substances 0.000 description 28
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 26
- GSEJCLTVZPLZKY-UHFFFAOYSA-N Triethanolamine Chemical compound OCCN(CCO)CCO GSEJCLTVZPLZKY-UHFFFAOYSA-N 0.000 description 15
- 238000001542 size-exclusion chromatography Methods 0.000 description 15
- 239000007864 aqueous solution Substances 0.000 description 13
- 229910052757 nitrogen Inorganic materials 0.000 description 13
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 12
- ACVYVLVWPXVTIT-UHFFFAOYSA-N phosphinic acid Chemical compound O[PH2]=O ACVYVLVWPXVTIT-UHFFFAOYSA-N 0.000 description 12
- PEDCQBHIVMGVHV-UHFFFAOYSA-N Glycerine Chemical compound OCC(O)CO PEDCQBHIVMGVHV-UHFFFAOYSA-N 0.000 description 11
- 239000011541 reaction mixture Substances 0.000 description 11
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 11
- 239000003795 chemical substances by application Substances 0.000 description 10
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 9
- 239000002253 acid Substances 0.000 description 9
- 239000007859 condensation product Substances 0.000 description 9
- 238000007046 ethoxylation reaction Methods 0.000 description 9
- 239000007787 solid Substances 0.000 description 9
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 8
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 6
- 239000003054 catalyst Substances 0.000 description 6
- 238000003756 stirring Methods 0.000 description 6
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 5
- 235000011187 glycerol Nutrition 0.000 description 5
- 239000007788 liquid Substances 0.000 description 5
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 5
- 150000003254 radicals Chemical group 0.000 description 5
- 239000004215 Carbon black (E152) Substances 0.000 description 4
- 239000002585 base Substances 0.000 description 4
- 229930195733 hydrocarbon Natural products 0.000 description 4
- 238000004519 manufacturing process Methods 0.000 description 4
- XHXFXVLFKHQFAL-UHFFFAOYSA-N phosphoryl trichloride Chemical compound ClP(Cl)(Cl)=O XHXFXVLFKHQFAL-UHFFFAOYSA-N 0.000 description 4
- 229920006395 saturated elastomer Polymers 0.000 description 4
- ISIJQEHRDSCQIU-UHFFFAOYSA-N tert-butyl 2,7-diazaspiro[4.5]decane-7-carboxylate Chemical compound C1N(C(=O)OC(C)(C)C)CCCC11CNCC1 ISIJQEHRDSCQIU-UHFFFAOYSA-N 0.000 description 4
- 125000000229 (C1-C4)alkoxy group Chemical group 0.000 description 3
- DNIAPMSPPWPWGF-UHFFFAOYSA-N Propylene glycol Chemical compound CC(O)CO DNIAPMSPPWPWGF-UHFFFAOYSA-N 0.000 description 3
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 3
- 150000007513 acids Chemical class 0.000 description 3
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 3
- 229910052799 carbon Inorganic materials 0.000 description 3
- 238000006482 condensation reaction Methods 0.000 description 3
- 125000004093 cyano group Chemical group *C#N 0.000 description 3
- ZBCBWPMODOFKDW-UHFFFAOYSA-N diethanolamine Chemical class OCCNCCO ZBCBWPMODOFKDW-UHFFFAOYSA-N 0.000 description 3
- VAYGXNSJCAHWJZ-UHFFFAOYSA-N dimethyl sulfate Chemical compound COS(=O)(=O)OC VAYGXNSJCAHWJZ-UHFFFAOYSA-N 0.000 description 3
- 125000003700 epoxy group Chemical group 0.000 description 3
- 229910052736 halogen Inorganic materials 0.000 description 3
- 150000002367 halogens Chemical class 0.000 description 3
- 239000000314 lubricant Substances 0.000 description 3
- WFDIJRYMOXRFFG-UHFFFAOYSA-N Acetic anhydride Chemical compound CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 description 2
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical group [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 2
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 2
- 229910019213 POCl3 Inorganic materials 0.000 description 2
- GLUUGHFHXGJENI-UHFFFAOYSA-N Piperazine Chemical compound C1CNCCN1 GLUUGHFHXGJENI-UHFFFAOYSA-N 0.000 description 2
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 2
- 239000003513 alkali Substances 0.000 description 2
- 229910001854 alkali hydroxide Inorganic materials 0.000 description 2
- 150000008044 alkali metal hydroxides Chemical class 0.000 description 2
- 125000002877 alkyl aryl group Chemical group 0.000 description 2
- 230000015572 biosynthetic process Effects 0.000 description 2
- GZUXJHMPEANEGY-UHFFFAOYSA-N bromomethane Chemical compound BrC GZUXJHMPEANEGY-UHFFFAOYSA-N 0.000 description 2
- BVKZGUZCCUSVTD-UHFFFAOYSA-N carbonic acid Chemical class OC(O)=O BVKZGUZCCUSVTD-UHFFFAOYSA-N 0.000 description 2
- 150000004649 carbonic acid derivatives Chemical class 0.000 description 2
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 2
- 125000002091 cationic group Chemical group 0.000 description 2
- 239000000460 chlorine Substances 0.000 description 2
- 229910052801 chlorine Inorganic materials 0.000 description 2
- 229920001577 copolymer Polymers 0.000 description 2
- 230000001186 cumulative effect Effects 0.000 description 2
- 239000000839 emulsion Substances 0.000 description 2
- RTZKZFJDLAIYFH-UHFFFAOYSA-N ether Substances CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 2
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 2
- 238000010438 heat treatment Methods 0.000 description 2
- 230000007062 hydrolysis Effects 0.000 description 2
- 238000006460 hydrolysis reaction Methods 0.000 description 2
- 150000004679 hydroxides Chemical class 0.000 description 2
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 2
- JVTAAEKCZFNVCJ-UHFFFAOYSA-N lactic acid Chemical compound CC(O)C(O)=O JVTAAEKCZFNVCJ-UHFFFAOYSA-N 0.000 description 2
- 239000012299 nitrogen atmosphere Substances 0.000 description 2
- WXZMFSXDPGVJKK-UHFFFAOYSA-N pentaerythritol Chemical compound OCC(CO)(CO)CO WXZMFSXDPGVJKK-UHFFFAOYSA-N 0.000 description 2
- VLTRZXGMWDSKGL-UHFFFAOYSA-N perchloric acid Chemical compound OCl(=O)(=O)=O VLTRZXGMWDSKGL-UHFFFAOYSA-N 0.000 description 2
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 2
- 125000001453 quaternary ammonium group Chemical group 0.000 description 2
- 125000002914 sec-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 2
- 239000002904 solvent Substances 0.000 description 2
- 230000001180 sulfating effect Effects 0.000 description 2
- 150000003467 sulfuric acid derivatives Chemical class 0.000 description 2
- XTHPWXDJESJLNJ-UHFFFAOYSA-N sulfurochloridic acid Chemical compound OS(Cl)(=O)=O XTHPWXDJESJLNJ-UHFFFAOYSA-N 0.000 description 2
- YBBRCQOCSYXUOC-UHFFFAOYSA-N sulfuryl dichloride Chemical compound ClS(Cl)(=O)=O YBBRCQOCSYXUOC-UHFFFAOYSA-N 0.000 description 2
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 2
- 125000000383 tetramethylene group Chemical group [H]C([H])([*:1])C([H])([H])C([H])([H])C([H])([H])[*:2] 0.000 description 2
- DLYUQMMRRRQYAE-UHFFFAOYSA-N tetraphosphorus decaoxide Chemical compound O1P(O2)(=O)OP3(=O)OP1(=O)OP2(=O)O3 DLYUQMMRRRQYAE-UHFFFAOYSA-N 0.000 description 2
- 238000004448 titration Methods 0.000 description 2
- XFNJVJPLKCPIBV-UHFFFAOYSA-N trimethylenediamine Chemical compound NCCCN XFNJVJPLKCPIBV-UHFFFAOYSA-N 0.000 description 2
- 229910052725 zinc Inorganic materials 0.000 description 2
- 239000011701 zinc Substances 0.000 description 2
- PUPZLCDOIYMWBV-UHFFFAOYSA-N (+/-)-1,3-Butanediol Chemical compound CC(O)CCO PUPZLCDOIYMWBV-UHFFFAOYSA-N 0.000 description 1
- AFINAILKDBCXMX-PBHICJAKSA-N (2s,3r)-2-amino-3-hydroxy-n-(4-octylphenyl)butanamide Chemical compound CCCCCCCCC1=CC=C(NC(=O)[C@@H](N)[C@@H](C)O)C=C1 AFINAILKDBCXMX-PBHICJAKSA-N 0.000 description 1
- BYEAHWXPCBROCE-UHFFFAOYSA-N 1,1,1,3,3,3-hexafluoropropan-2-ol Chemical compound FC(F)(F)C(O)C(F)(F)F BYEAHWXPCBROCE-UHFFFAOYSA-N 0.000 description 1
- GXMPGTXMVQAVAL-UHFFFAOYSA-N 1-[2-hydroxybutyl(methyl)amino]butan-2-ol Chemical compound CCC(O)CN(C)CC(O)CC GXMPGTXMVQAVAL-UHFFFAOYSA-N 0.000 description 1
- XKQMKMVTDKYWOX-UHFFFAOYSA-N 1-[2-hydroxypropyl(methyl)amino]propan-2-ol Chemical compound CC(O)CN(C)CC(C)O XKQMKMVTDKYWOX-UHFFFAOYSA-N 0.000 description 1
- XNIOWJUQPMKCIJ-UHFFFAOYSA-N 2-(benzylamino)ethanol Chemical compound OCCNCC1=CC=CC=C1 XNIOWJUQPMKCIJ-UHFFFAOYSA-N 0.000 description 1
- NSUHEKKWYUZSQN-UHFFFAOYSA-N 2-[butan-2-yl(2-hydroxyethyl)amino]ethanol Chemical compound CCC(C)N(CCO)CCO NSUHEKKWYUZSQN-UHFFFAOYSA-N 0.000 description 1
- HHPDFYDITNAMAM-UHFFFAOYSA-N 2-[cyclohexyl(2-hydroxyethyl)amino]ethanol Chemical compound OCCN(CCO)C1CCCCC1 HHPDFYDITNAMAM-UHFFFAOYSA-N 0.000 description 1
- JUVSRZCUMWZBFK-UHFFFAOYSA-N 2-[n-(2-hydroxyethyl)-4-methylanilino]ethanol Chemical compound CC1=CC=C(N(CCO)CCO)C=C1 JUVSRZCUMWZBFK-UHFFFAOYSA-N 0.000 description 1
- OJPDDQSCZGTACX-UHFFFAOYSA-N 2-[n-(2-hydroxyethyl)anilino]ethanol Chemical compound OCCN(CCO)C1=CC=CC=C1 OJPDDQSCZGTACX-UHFFFAOYSA-N 0.000 description 1
- FBPFZTCFMRRESA-FSIIMWSLSA-N D-Glucitol Natural products OC[C@H](O)[C@H](O)[C@@H](O)[C@H](O)CO FBPFZTCFMRRESA-FSIIMWSLSA-N 0.000 description 1
- FBPFZTCFMRRESA-JGWLITMVSA-N D-glucitol Chemical compound OC[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO FBPFZTCFMRRESA-JGWLITMVSA-N 0.000 description 1
- PIICEJLVQHRZGT-UHFFFAOYSA-N Ethylenediamine Chemical compound NCCN PIICEJLVQHRZGT-UHFFFAOYSA-N 0.000 description 1
- CJKRXEBLWJVYJD-UHFFFAOYSA-N N,N'-diethylethylenediamine Chemical compound CCNCCNCC CJKRXEBLWJVYJD-UHFFFAOYSA-N 0.000 description 1
- 229910019142 PO4 Inorganic materials 0.000 description 1
- AWMVMTVKBNGEAK-UHFFFAOYSA-N Styrene oxide Chemical class C1OC1C1=CC=CC=C1 AWMVMTVKBNGEAK-UHFFFAOYSA-N 0.000 description 1
- SLINHMUFWFWBMU-UHFFFAOYSA-N Triisopropanolamine Chemical compound CC(O)CN(CC(C)O)CC(C)O SLINHMUFWFWBMU-UHFFFAOYSA-N 0.000 description 1
- ZJCCRDAZUWHFQH-UHFFFAOYSA-N Trimethylolpropane Chemical compound CCC(CO)(CO)CO ZJCCRDAZUWHFQH-UHFFFAOYSA-N 0.000 description 1
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Chemical compound NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 description 1
- BWVAOONFBYYRHY-UHFFFAOYSA-N [4-(hydroxymethyl)phenyl]methanol Chemical compound OCC1=CC=C(CO)C=C1 BWVAOONFBYYRHY-UHFFFAOYSA-N 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- 239000000654 additive Substances 0.000 description 1
- 229910000272 alkali metal oxide Inorganic materials 0.000 description 1
- 229910000287 alkaline earth metal oxide Inorganic materials 0.000 description 1
- 125000003545 alkoxy group Chemical group 0.000 description 1
- 229940100198 alkylating agent Drugs 0.000 description 1
- 239000002168 alkylating agent Substances 0.000 description 1
- 125000005529 alkyleneoxy group Chemical group 0.000 description 1
- 229920005603 alternating copolymer Polymers 0.000 description 1
- DIZPMCHEQGEION-UHFFFAOYSA-H aluminium sulfate (anhydrous) Chemical compound [Al+3].[Al+3].[O-]S([O-])(=O)=O.[O-]S([O-])(=O)=O.[O-]S([O-])(=O)=O DIZPMCHEQGEION-UHFFFAOYSA-H 0.000 description 1
- 238000007098 aminolysis reaction Methods 0.000 description 1
- 238000005915 ammonolysis reaction Methods 0.000 description 1
- 238000004458 analytical method Methods 0.000 description 1
- 150000005840 aryl radicals Chemical class 0.000 description 1
- 125000004429 atom Chemical group 0.000 description 1
- 229920001400 block copolymer Polymers 0.000 description 1
- RDHPKYGYEGBMSE-UHFFFAOYSA-N bromoethane Chemical compound CCBr RDHPKYGYEGBMSE-UHFFFAOYSA-N 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 239000011575 calcium Substances 0.000 description 1
- 239000004202 carbamide Substances 0.000 description 1
- 150000001735 carboxylic acids Chemical class 0.000 description 1
- 230000003197 catalytic effect Effects 0.000 description 1
- NEHMKBQYUWJMIP-NJFSPNSNSA-N chloro(114C)methane Chemical compound [14CH3]Cl NEHMKBQYUWJMIP-NJFSPNSNSA-N 0.000 description 1
- HRYZWHHZPQKTII-UHFFFAOYSA-N chloroethane Chemical compound CCCl HRYZWHHZPQKTII-UHFFFAOYSA-N 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 125000001995 cyclobutyl group Chemical group [H]C1([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- 125000000582 cycloheptyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- SSJXIUAHEKJCMH-UHFFFAOYSA-N cyclohexane-1,2-diamine Chemical compound NC1CCCCC1N SSJXIUAHEKJCMH-UHFFFAOYSA-N 0.000 description 1
- GEQHKFFSPGPGLN-UHFFFAOYSA-N cyclohexane-1,3-diamine Chemical compound NC1CCCC(N)C1 GEQHKFFSPGPGLN-UHFFFAOYSA-N 0.000 description 1
- VKIRRGRTJUUZHS-UHFFFAOYSA-N cyclohexane-1,4-diamine Chemical compound NC1CCC(N)CC1 VKIRRGRTJUUZHS-UHFFFAOYSA-N 0.000 description 1
- VKONPUDBRVKQLM-UHFFFAOYSA-N cyclohexane-1,4-diol Chemical compound OC1CCC(O)CC1 VKONPUDBRVKQLM-UHFFFAOYSA-N 0.000 description 1
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- 125000000640 cyclooctyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C([H])([H])C1([H])[H] 0.000 description 1
- 125000001511 cyclopentyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- 125000001559 cyclopropyl group Chemical group [H]C1([H])C([H])([H])C1([H])* 0.000 description 1
- 238000006297 dehydration reaction Methods 0.000 description 1
- 239000003599 detergent Substances 0.000 description 1
- 150000004985 diamines Chemical class 0.000 description 1
- DENRZWYUOJLTMF-UHFFFAOYSA-N diethyl sulfate Chemical compound CCOS(=O)(=O)OCC DENRZWYUOJLTMF-UHFFFAOYSA-N 0.000 description 1
- 229940008406 diethyl sulfate Drugs 0.000 description 1
- GPLRAVKSCUXZTP-UHFFFAOYSA-N diglycerol Chemical compound OCC(O)COCC(O)CO GPLRAVKSCUXZTP-UHFFFAOYSA-N 0.000 description 1
- 150000002009 diols Chemical class 0.000 description 1
- 238000004821 distillation Methods 0.000 description 1
- 239000000975 dye Substances 0.000 description 1
- 239000003480 eluent Substances 0.000 description 1
- 238000006266 etherification reaction Methods 0.000 description 1
- 229960003750 ethyl chloride Drugs 0.000 description 1
- 230000001747 exhibiting effect Effects 0.000 description 1
- 125000000524 functional group Chemical group 0.000 description 1
- 150000002430 hydrocarbons Chemical group 0.000 description 1
- 230000002209 hydrophobic effect Effects 0.000 description 1
- WGCNASOHLSPBMP-UHFFFAOYSA-N hydroxyacetaldehyde Natural products OCC=O WGCNASOHLSPBMP-UHFFFAOYSA-N 0.000 description 1
- 239000011261 inert gas Substances 0.000 description 1
- 239000003112 inhibitor Substances 0.000 description 1
- 229910052500 inorganic mineral Chemical class 0.000 description 1
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 1
- QWTDNUCVQCZILF-UHFFFAOYSA-N isopentane Chemical compound CCC(C)C QWTDNUCVQCZILF-UHFFFAOYSA-N 0.000 description 1
- 239000004310 lactic acid Substances 0.000 description 1
- 235000014655 lactic acid Nutrition 0.000 description 1
- 229910052751 metal Inorganic materials 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- 229940102396 methyl bromide Drugs 0.000 description 1
- CRVGTESFCCXCTH-UHFFFAOYSA-N methyl diethanolamine Chemical compound OCCN(C)CCO CRVGTESFCCXCTH-UHFFFAOYSA-N 0.000 description 1
- 239000011707 mineral Chemical class 0.000 description 1
- KVKFRMCSXWQSNT-UHFFFAOYSA-N n,n'-dimethylethane-1,2-diamine Chemical compound CNCCNC KVKFRMCSXWQSNT-UHFFFAOYSA-N 0.000 description 1
- 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000001624 naphthyl group Chemical group 0.000 description 1
- 125000004433 nitrogen atom Chemical group N* 0.000 description 1
- 229950004864 olamine Drugs 0.000 description 1
- 235000021317 phosphate Nutrition 0.000 description 1
- OJMIONKXNSYLSR-UHFFFAOYSA-N phosphorous acid Chemical compound OP(O)O OJMIONKXNSYLSR-UHFFFAOYSA-N 0.000 description 1
- 229920000137 polyphosphoric acid Polymers 0.000 description 1
- 150000003141 primary amines Chemical class 0.000 description 1
- 239000000047 product Substances 0.000 description 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- AOHJOMMDDJHIJH-UHFFFAOYSA-N propylenediamine Chemical compound CC(N)CN AOHJOMMDDJHIJH-UHFFFAOYSA-N 0.000 description 1
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 1
- 230000035484 reaction time Effects 0.000 description 1
- 150000003839 salts Chemical class 0.000 description 1
- 150000003384 small molecules Chemical class 0.000 description 1
- 239000000243 solution Substances 0.000 description 1
- 239000000600 sorbitol Substances 0.000 description 1
- 238000001228 spectrum Methods 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 125000000547 substituted alkyl group Chemical group 0.000 description 1
- 125000003107 substituted aryl group Chemical group 0.000 description 1
- 125000005346 substituted cycloalkyl group Chemical group 0.000 description 1
- IIACRCGMVDHOTQ-UHFFFAOYSA-N sulfamic acid Chemical compound NS(O)(=O)=O IIACRCGMVDHOTQ-UHFFFAOYSA-N 0.000 description 1
- AKEJUJNQAAGONA-UHFFFAOYSA-N sulfur trioxide Chemical compound O=S(=O)=O AKEJUJNQAAGONA-UHFFFAOYSA-N 0.000 description 1
- 239000004753 textile Substances 0.000 description 1
- 239000002562 thickening agent Substances 0.000 description 1
- 125000003258 trimethylene group Chemical group [H]C([H])([*:2])C([H])([H])C([H])([H])[*:1] 0.000 description 1
- QXJQHYBHAIHNGG-UHFFFAOYSA-N trimethylolethane Chemical compound OCC(C)(CO)CO QXJQHYBHAIHNGG-UHFFFAOYSA-N 0.000 description 1
- 150000003673 urethanes Chemical class 0.000 description 1
- 239000004034 viscosity adjusting agent Substances 0.000 description 1
- 125000006839 xylylene group Chemical group 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08G—MACROMOLECULAR COMPOUNDS OBTAINED OTHERWISE THAN BY REACTIONS ONLY INVOLVING UNSATURATED CARBON-TO-CARBON BONDS
- C08G73/00—Macromolecular compounds obtained by reactions forming a linkage containing nitrogen with or without oxygen or carbon in the main chain of the macromolecule, not provided for in groups C08G12/00 - C08G71/00
- C08G73/02—Polyamines
- C08G73/024—Polyamines containing oxygen in the form of ether bonds in the main chain
Landscapes
- Chemical & Material Sciences (AREA)
- Health & Medical Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Medicinal Chemistry (AREA)
- Polymers & Plastics (AREA)
- Organic Chemistry (AREA)
- Polyethers (AREA)
- Macromolecular Compounds Obtained By Forming Nitrogen-Containing Linkages In General (AREA)
- Polymers With Sulfur, Phosphorus Or Metals In The Main Chain (AREA)
- Polysaccharides And Polysaccharide Derivatives (AREA)
- Addition Polymer Or Copolymer, Post-Treatments, Or Chemical Modifications (AREA)
Applications Claiming Priority (3)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| EP07120393 | 2007-11-09 | ||
| EP07120393 | 2007-11-09 | ||
| PCT/EP2008/065113 WO2009060060A1 (en) | 2007-11-09 | 2008-11-07 | Alkoxylated polyalkanolamines |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| ES2567256T3 true ES2567256T3 (es) | 2016-04-21 |
Family
ID=40342343
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| ES08847336.8T Active ES2567256T3 (es) | 2007-11-09 | 2008-11-07 | Polialcanolaminas alcoxiladas |
Country Status (12)
| Country | Link |
|---|---|
| US (1) | US8129326B2 (https=) |
| EP (1) | EP2209836B1 (https=) |
| JP (1) | JP5725863B2 (https=) |
| CN (1) | CN101855273B (https=) |
| AR (1) | AR069242A1 (https=) |
| BR (1) | BRPI0819182B8 (https=) |
| CL (1) | CL2008003334A1 (https=) |
| ES (1) | ES2567256T3 (https=) |
| MX (1) | MX306402B (https=) |
| PL (1) | PL2209836T3 (https=) |
| TW (1) | TW200936644A (https=) |
| WO (1) | WO2009060060A1 (https=) |
Families Citing this family (29)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| WO2009060409A1 (en) * | 2007-11-09 | 2009-05-14 | The Procter & Gamble Company | Cleaning compositions with alkoxylated polyalkanolamines |
| EP2209836B1 (en) * | 2007-11-09 | 2016-02-24 | Basf Se | Alkoxylated polyalkanolamines |
| WO2009112379A1 (de) * | 2008-03-04 | 2009-09-17 | Basf Se | Verwendung von alkoxylierten polyalkanolaminen zum spalten von öl-wasser-emulsionen |
| US8475538B2 (en) | 2008-08-11 | 2013-07-02 | Basf Se | Method for gently aftertreating dyed textiles |
| EP2199315B1 (en) | 2008-12-19 | 2013-12-11 | Basf Se | Composition for metal electroplating comprising leveling agent |
| DE102009041983A1 (de) | 2009-09-17 | 2011-04-07 | Clariant International Ltd. | Alkoxylierte Trialkanolaminkondensate und deren Verwendung als Emulsionsspalter |
| US9296896B2 (en) | 2010-11-23 | 2016-03-29 | Basf Se | Polyamides with nanoparticles on the surface |
| WO2013010788A2 (de) * | 2011-07-15 | 2013-01-24 | Basf Se | Polyetheramine als beschleuniger in epoxid-systemen |
| PL2961822T3 (pl) | 2013-02-28 | 2017-09-29 | Basf Se | Preparaty, ich zastosowanie jako środków do zmywania naczyń lub do wytwarzania środków do zmywania naczyń i ich wytwarzanie |
| EP2961819B1 (en) | 2013-02-28 | 2017-08-30 | Basf Se | Aqueous formulations, their manufacture, and their use in hard surface cleaning |
| WO2016120141A1 (en) * | 2015-01-26 | 2016-08-04 | Basf Se | Polyetheramines with low melting point |
| WO2016141050A1 (en) * | 2015-03-04 | 2016-09-09 | Ecolab Usa Inc. | Reverse emulsion breaker polymers |
| CA2978434C (en) | 2015-03-06 | 2023-03-28 | Ecolab Usa Inc. | Reverse emulsion breaker polymers |
| BR112018000250A2 (pt) * | 2015-07-09 | 2018-09-04 | Basf Se | processo para limpeza de louça suja com resíduo de gordura, e, formulação |
| US9701791B2 (en) | 2015-09-08 | 2017-07-11 | Jacam Chemical Company 2013, Llc | Poly alkanolamine emulsion breakers |
| US9701830B1 (en) | 2015-12-17 | 2017-07-11 | Jacam Chemical Company 2013, Llc | Emulsified polyol acrylate polymeric emulsion breakers |
| US10808075B2 (en) | 2015-12-18 | 2020-10-20 | Basf Se | Substoichiometric alkoxylated polyethers |
| US11377625B2 (en) * | 2015-12-18 | 2022-07-05 | Basf Se | Cleaning compositions with polyalkanolamines |
| US10266795B2 (en) * | 2015-12-18 | 2019-04-23 | The Procter & Gamble Company | Cleaning compositions with alkoxylated polyalkanolamines |
| WO2019145265A1 (en) | 2018-01-23 | 2019-08-01 | Basf Se | Aqueous binder compositions |
| BR112021003603A2 (pt) * | 2018-08-27 | 2021-05-18 | Basf Se | uso de polímeros, e, método para remover sujeira sensível a tensoativo ou enzima de têxteis. |
| MX2021014996A (es) | 2019-06-06 | 2022-01-24 | Basf Se | Colectores para proceso de flotacion. |
| EP3922662A1 (en) * | 2020-06-10 | 2021-12-15 | Basf Se | Polyalkanolamine |
| CN116113657A (zh) * | 2020-12-16 | 2023-05-12 | 巴斯夫欧洲公司 | 作为润湿剂以及作为消泡剂组合物的组分的烷氧基化聚合n-(羟烷基)胺 |
| EP4067410A1 (de) | 2021-03-29 | 2022-10-05 | Evonik Operations GmbH | Verwendung von polyamin- und/oder polyalkanolamin-basierten carbonsäurederivaten in wässrigen polyurethandispersionen |
| US20250289974A1 (en) | 2022-05-06 | 2025-09-18 | Basf Se | Coating composition and preparation for the same |
| WO2024240172A2 (en) | 2023-05-23 | 2024-11-28 | Basf Se | Aqueous binder compositions and water-borne coating compositions comprising the same |
| WO2025125067A1 (de) | 2023-12-15 | 2025-06-19 | Basf Se | Schnellhärtende, wässrige, intumeszierende brandschutzzusammensetzung mit hoher anwendungsschichtdicke auf oberflächen beliebiger neigung |
| EP4570865A1 (de) | 2023-12-15 | 2025-06-18 | Hilti Aktiengesellschaft | Wässrige brandschutzzusammensetzung mit hoher anwendungsschichtdicke und brandschutzbeschichtung mit verbesserter widerstandsfähigkeit gegen schimmelbildung |
Family Cites Families (35)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2407895A (en) * | 1944-10-05 | 1946-09-17 | Petrolite Corp | Processes for resolving oil-in-water emulsions |
| DE2227546C3 (de) * | 1972-06-07 | 1979-04-05 | Basf Ag, 6700 Ludwigshafen | Verwendung von oxalkylierten PoIyalkylenpolyaminen zur SchneUentwässening von Rohölen |
| DE2529939C3 (de) * | 1975-07-04 | 1980-10-09 | Chemische Fabrik Stockhausen & Cie, 4150 Krefeld | Antistatik-Zubereitung für Beschichtungsmassen von textlien Flächengebilden |
| DE3103815A1 (de) | 1981-02-04 | 1982-09-09 | Bayer Ag, 5090 Leverkusen | Verfahren zur nachbehandlung von gefaerbten, filzfrei ausgeruesteten fasermaterialien |
| US4840748A (en) * | 1981-05-18 | 1989-06-20 | Petrolite Corporation | Polyalkanolamines |
| US4505839A (en) * | 1981-05-18 | 1985-03-19 | Petrolite Corporation | Polyalkanolamines |
| US4731481A (en) * | 1981-05-18 | 1988-03-15 | Petrolite Corporation | Polyalkanolamines |
| DE3136281A1 (de) * | 1981-09-12 | 1983-03-24 | Hoechst Ag, 6000 Frankfurt | Additionsprodukte aus triaethanolaminkondensaten und bis-glycidylethern und ihre verwendung |
| US4404362A (en) * | 1981-12-14 | 1983-09-13 | Petrolite Corporation | Block polymers of alkanolamines |
| DE3206459A1 (de) * | 1982-02-23 | 1983-09-01 | Hoechst Ag, 6230 Frankfurt | Quaternaere vernetzungsprodukte von xylylendichloriden mit triaethanolaminkondensaten und deren verwendung |
| DE3416693A1 (de) * | 1984-05-05 | 1985-11-07 | Bayer Ag, 5090 Leverkusen | Verfahren zur behandlung von cellulosischen fasermaterialien |
| US4939182A (en) * | 1988-07-27 | 1990-07-03 | The Dow Chemical Company | Melamine-alkanolamine condensates and polyurethanes prepared therefrom |
| DE3829974A1 (de) * | 1988-09-03 | 1990-03-15 | Basf Ag | Quaternierte kondensationsprodukte |
| DE4003243A1 (de) * | 1990-02-03 | 1991-08-08 | Basf Ag | Verwendung von trialkanolaminpolyethern als demulgatoren von oel-in-wasser-emulsionen |
| DE4006255A1 (de) | 1990-02-28 | 1991-08-29 | Basf Ag | Als emulgatoren von oel-in-wasser-emulsionen geeignete kondensationsprodukte |
| US5059244A (en) * | 1990-07-18 | 1991-10-22 | Milliken Research Corporation | Fugitive colorant and washable ink compositions |
| TW320784B (https=) * | 1994-05-13 | 1997-11-21 | Gould Electronics Inc | |
| DE19643281A1 (de) | 1996-10-21 | 1998-04-23 | Basf Ag | Verwendung von polykationischen Kondensationsprodukten als farbfixierenden Zusatz zu Waschmitteln und Wäschenachbehandlungsmitteln |
| US6075168A (en) * | 1997-08-22 | 2000-06-13 | Huntsman Petrochemical Corporation | Selective production of diethanolamine |
| DE19754314A1 (de) * | 1997-12-08 | 1999-06-10 | Henkel Kgaa | Hilfsmittel für die Herstellung von Cellulosefasern |
| FR2779149B1 (fr) * | 1998-05-29 | 2000-09-15 | Witco | Procede de fabrication de mousse de polyurethane, polyester polyol amine utilise dans ce procede et mousse obtenue |
| US20030171245A1 (en) * | 1998-07-10 | 2003-09-11 | The Procter & Gamble Company | Surfactant agglomerates |
| CZ301020B6 (cs) * | 1998-09-10 | 2009-10-14 | The Dow Chemical Company | Zpusob výroby Mannichova polyolu |
| US6053438A (en) * | 1998-10-13 | 2000-04-25 | Eastman Kodak Company | Process for making an ink jet ink |
| FR2804109B1 (fr) * | 2000-01-24 | 2002-08-16 | Bp Chemicals Snc | Procede de fabrication en continu de triethanolamine, et produit obtenu |
| US7247606B2 (en) * | 2001-11-05 | 2007-07-24 | Cognis Corporation | Branched reaction products |
| AU2002349450A1 (en) * | 2001-11-22 | 2003-06-10 | Gtl Co., Ltd. | Fluorosurfactant-free foam fire-extinguisher |
| DE10250274A1 (de) * | 2002-10-28 | 2004-05-13 | Basf Ag | Übergangsmetall-verbrückte Polymere |
| US20090209441A1 (en) * | 2004-01-09 | 2009-08-20 | The Lubrizol Corporation | Maleated vegetable oils and derivatives, as self-emulsifying lubricants in metalworking |
| US7629386B2 (en) * | 2004-08-26 | 2009-12-08 | Bausch + Lomb Incorporated | Compositions containing trialkanolamine alkoxylate buffer |
| KR20080106276A (ko) * | 2006-03-01 | 2008-12-04 | 바스프 에스이 | 액체용 마커로서의 릴렌의 용도 |
| EP1996549A1 (de) * | 2006-03-15 | 2008-12-03 | Basf Se | Verwendung von aryl- oder alkyloxy-substituierten phthalocyaninen als markierungsstoffe für flüssigkeiten |
| ATE474906T1 (de) * | 2006-05-31 | 2010-08-15 | Procter & Gamble | Reinigungsmittel mit amphiphilen pfropfpolymeren auf basis von polyalkylenoxiden und vinylestern |
| EP2209836B1 (en) * | 2007-11-09 | 2016-02-24 | Basf Se | Alkoxylated polyalkanolamines |
| WO2009060409A1 (en) * | 2007-11-09 | 2009-05-14 | The Procter & Gamble Company | Cleaning compositions with alkoxylated polyalkanolamines |
-
2008
- 2008-11-07 EP EP08847336.8A patent/EP2209836B1/en active Active
- 2008-11-07 AR ARP080104897A patent/AR069242A1/es unknown
- 2008-11-07 BR BRPI0819182A patent/BRPI0819182B8/pt not_active IP Right Cessation
- 2008-11-07 US US12/740,050 patent/US8129326B2/en active Active
- 2008-11-07 CL CL2008003334A patent/CL2008003334A1/es unknown
- 2008-11-07 MX MX2010004600A patent/MX306402B/es active IP Right Grant
- 2008-11-07 CN CN2008801152540A patent/CN101855273B/zh active Active
- 2008-11-07 ES ES08847336.8T patent/ES2567256T3/es active Active
- 2008-11-07 JP JP2010532601A patent/JP5725863B2/ja not_active Expired - Fee Related
- 2008-11-07 PL PL08847336.8T patent/PL2209836T3/pl unknown
- 2008-11-07 TW TW097143254A patent/TW200936644A/zh unknown
- 2008-11-07 WO PCT/EP2008/065113 patent/WO2009060060A1/en not_active Ceased
Also Published As
| Publication number | Publication date |
|---|---|
| JP5725863B2 (ja) | 2015-05-27 |
| EP2209836A1 (en) | 2010-07-28 |
| PL2209836T3 (pl) | 2016-09-30 |
| CN101855273B (zh) | 2013-01-30 |
| US8129326B2 (en) | 2012-03-06 |
| MX2010004600A (es) | 2010-05-10 |
| BRPI0819182B8 (pt) | 2019-08-20 |
| WO2009060060A1 (en) | 2009-05-14 |
| US20100234631A1 (en) | 2010-09-16 |
| CN101855273A (zh) | 2010-10-06 |
| EP2209836B1 (en) | 2016-02-24 |
| TW200936644A (en) | 2009-09-01 |
| JP2011503281A (ja) | 2011-01-27 |
| BRPI0819182A2 (pt) | 2015-05-05 |
| BRPI0819182B1 (pt) | 2018-12-11 |
| MX306402B (es) | 2013-01-04 |
| CL2008003334A1 (es) | 2010-02-12 |
| AR069242A1 (es) | 2010-01-06 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| ES2567256T3 (es) | Polialcanolaminas alcoxiladas | |
| US12172954B2 (en) | Alkoxylated secondary alcohol | |
| CN1361805A (zh) | 两性离子多胺及其生产方法 | |
| WO2016094199A1 (en) | Compounds comprising modified diorganosiloxane polymers | |
| US11802179B2 (en) | Polyesteramines and polyesterquats | |
| ZA200401323B (en) | Optical brighteners, their composition, their production and their use. | |
| KR20200061404A (ko) | 알콕시화된 2 차 알코올 술페이트 | |
| US20230331748A1 (en) | Secondary alcohol phosphate ester | |
| US4178434A (en) | Amine-coupled polyepichlorohydrin and polyamines derived therefrom | |
| US3660452A (en) | Siloxane amino hydroxy sulfonates | |
| EP0426177A1 (en) | Process for preparing quaternary ammonium compounds | |
| US6703523B1 (en) | Zwitterionic polyetherpolyamines and process for their production | |
| US10266649B2 (en) | Polyetheramines with low melting point | |
| WO2001009223A1 (en) | Zwitterionic polyamines and a process for their production | |
| JP2018505954A5 (https=) | ||
| CA1262145A (en) | Sulfonate surfactants | |
| CN105198923A (zh) | 一种脂肪胺-磷酸酯盐超支化表面活性剂及其制备方法 | |
| JP2006518776A5 (https=) | ||
| CN103951702A (zh) | 1,1′-二烷基-3,3′-(2-磷酸酯-1,3-亚丙基)咪唑内盐化合物及其制备方法 | |
| CA1119199A (en) | Amine-coupled polyepichlorohydrin and polyamines derived therefrom | |
| BR102020027066A2 (pt) | Processo para preparar ésteres funcionais de amina de um ácido aminocarboxílico; ésteres funcionais de amina; uso de ésteres funcionais de amina; e polímeros, preferencialmente poliureia, poliepóxido ou poliamida | |
| WO2006025738A1 (en) | Polyester prepared from phosphoric acid or its oligomers | |
| PL215497B1 (pl) | Sposób otrzymywania sześciofunkcyjnych polieteroli z pierścieniem karbazolu | |
| KR20020045222A (ko) | 분자 내에 에스테르기를 갖는 양이온성 계면활성제의제조방법 |