ES2245803T3 - Compuestos bencenicos sustituidos como agentes antiproliferativos reductores. - Google Patents
Compuestos bencenicos sustituidos como agentes antiproliferativos reductores.Info
- Publication number
- ES2245803T3 ES2245803T3 ES98939384T ES98939384T ES2245803T3 ES 2245803 T3 ES2245803 T3 ES 2245803T3 ES 98939384 T ES98939384 T ES 98939384T ES 98939384 T ES98939384 T ES 98939384T ES 2245803 T3 ES2245803 T3 ES 2245803T3
- Authority
- ES
- Spain
- Prior art keywords
- aminosulfonyl
- methoxyphenyl
- alkyl
- ocf
- benzene
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired - Lifetime
Links
- 150000001875 compounds Chemical class 0.000 title claims abstract description 124
- 230000001028 anti-proliverative effect Effects 0.000 title description 6
- 150000003839 salts Chemical class 0.000 claims abstract description 26
- 229910052736 halogen Inorganic materials 0.000 claims abstract description 23
- 229910052739 hydrogen Inorganic materials 0.000 claims abstract description 23
- 239000001257 hydrogen Substances 0.000 claims abstract description 23
- 150000002367 halogens Chemical group 0.000 claims abstract description 22
- 125000001424 substituent group Chemical group 0.000 claims abstract description 21
- 125000004169 (C1-C6) alkyl group Chemical group 0.000 claims abstract description 20
- 201000010099 disease Diseases 0.000 claims abstract description 12
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 claims abstract description 12
- 239000003814 drug Substances 0.000 claims abstract description 11
- 125000004191 (C1-C6) alkoxy group Chemical group 0.000 claims abstract description 8
- 230000004663 cell proliferation Effects 0.000 claims abstract description 7
- 238000004519 manufacturing process Methods 0.000 claims abstract description 6
- 125000001072 heteroaryl group Chemical group 0.000 claims abstract description 5
- 239000000126 substance Substances 0.000 claims abstract description 4
- 239000000460 chlorine Substances 0.000 claims description 49
- 239000000203 mixture Substances 0.000 claims description 41
- 229910052801 chlorine Inorganic materials 0.000 claims description 40
- 229910052794 bromium Inorganic materials 0.000 claims description 33
- 229910052731 fluorine Inorganic materials 0.000 claims description 29
- 125000000217 alkyl group Chemical group 0.000 claims description 20
- 150000002431 hydrogen Chemical class 0.000 claims description 20
- 229910002091 carbon monoxide Inorganic materials 0.000 claims description 18
- 229910052757 nitrogen Inorganic materials 0.000 claims description 18
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 17
- 206010028980 Neoplasm Diseases 0.000 claims description 11
- 125000004404 heteroalkyl group Chemical group 0.000 claims description 9
- 201000011510 cancer Diseases 0.000 claims description 8
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 7
- 201000004681 Psoriasis Diseases 0.000 claims description 7
- 125000003118 aryl group Chemical group 0.000 claims description 6
- 230000002062 proliferating effect Effects 0.000 claims description 5
- 239000000546 pharmaceutical excipient Substances 0.000 claims description 4
- 229940002612 prodrug Drugs 0.000 claims description 4
- 239000000651 prodrug Substances 0.000 claims description 4
- 229910052727 yttrium Inorganic materials 0.000 claims description 4
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 3
- 239000002246 antineoplastic agent Substances 0.000 claims description 3
- 230000000973 chemotherapeutic effect Effects 0.000 claims description 3
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 3
- 239000008194 pharmaceutical composition Substances 0.000 claims description 3
- 208000037803 restenosis Diseases 0.000 claims description 3
- 208000015181 infectious disease Diseases 0.000 claims description 2
- 230000002792 vascular Effects 0.000 claims description 2
- 229940127089 cytotoxic agent Drugs 0.000 claims 2
- 239000002254 cytotoxic agent Substances 0.000 claims 1
- 231100000599 cytotoxic agent Toxicity 0.000 claims 1
- 244000005700 microbiome Species 0.000 claims 1
- 125000000876 trifluoromethoxy group Chemical group FC(F)(F)O* 0.000 abstract description 3
- JCXJVPUVTGWSNB-UHFFFAOYSA-N Nitrogen dioxide Chemical group O=[N]=O JCXJVPUVTGWSNB-UHFFFAOYSA-N 0.000 abstract description 2
- 125000003107 substituted aryl group Chemical group 0.000 abstract description 2
- 125000006716 (C1-C6) heteroalkyl group Chemical group 0.000 abstract 1
- 125000004435 hydrogen atom Chemical group [H]* 0.000 abstract 1
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 abstract 1
- -1 hydrocarbon radical Chemical class 0.000 description 62
- 239000002253 acid Substances 0.000 description 39
- 125000004494 ethyl ester group Chemical group 0.000 description 30
- 238000005160 1H NMR spectroscopy Methods 0.000 description 24
- 238000000034 method Methods 0.000 description 24
- 238000002330 electrospray ionisation mass spectrometry Methods 0.000 description 22
- 238000004458 analytical method Methods 0.000 description 20
- 125000004397 aminosulfonyl group Chemical group NS(=O)(=O)* 0.000 description 19
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid group Chemical group C(C1=CC=CC=C1)(=O)O WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 19
- 210000004027 cell Anatomy 0.000 description 16
- RRONENSZKCGROA-UHFFFAOYSA-N 4-fluoro-3-nitrobenzenesulfonyl chloride Chemical compound [O-][N+](=O)C1=CC(S(Cl)(=O)=O)=CC=C1F RRONENSZKCGROA-UHFFFAOYSA-N 0.000 description 15
- 238000006243 chemical reaction Methods 0.000 description 14
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 11
- 239000003795 chemical substances by application Substances 0.000 description 11
- IAPZMOXNDIVGNQ-UHFFFAOYSA-N 3-bromo-2,4,5,6-tetrafluoro-n-(4-methoxyphenyl)benzenesulfonamide Chemical compound C1=CC(OC)=CC=C1NS(=O)(=O)C1=C(F)C(F)=C(F)C(Br)=C1F IAPZMOXNDIVGNQ-UHFFFAOYSA-N 0.000 description 8
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 8
- 125000004432 carbon atom Chemical group C* 0.000 description 8
- 125000005842 heteroatom Chemical group 0.000 description 8
- HIPCPVSKULEHBJ-UHFFFAOYSA-N 2-bromo-3,4,5-trifluoro-n-(3-hydroxy-4-methoxyphenyl)benzenesulfonamide Chemical compound C1=C(O)C(OC)=CC=C1NS(=O)(=O)C1=CC(F)=C(F)C(F)=C1Br HIPCPVSKULEHBJ-UHFFFAOYSA-N 0.000 description 7
- OQUWAOHSHWXMPX-UHFFFAOYSA-N 2-bromo-3,4,5-trifluoro-n-(4-methoxyphenyl)benzenesulfonamide Chemical compound C1=CC(OC)=CC=C1NS(=O)(=O)C1=CC(F)=C(F)C(F)=C1Br OQUWAOHSHWXMPX-UHFFFAOYSA-N 0.000 description 7
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical class CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 7
- BHAAPTBBJKJZER-UHFFFAOYSA-N p-anisidine Chemical group COC1=CC=C(N)C=C1 BHAAPTBBJKJZER-UHFFFAOYSA-N 0.000 description 7
- 238000003786 synthesis reaction Methods 0.000 description 7
- FTIFAPZODKUUQX-UHFFFAOYSA-N 5-bromo-2,3,4-trifluoro-n-(3-hydroxy-4-methoxyphenyl)benzenesulfonamide Chemical compound C1=C(O)C(OC)=CC=C1NS(=O)(=O)C1=CC(Br)=C(F)C(F)=C1F FTIFAPZODKUUQX-UHFFFAOYSA-N 0.000 description 6
- RCTCBSDWAUCMEI-UHFFFAOYSA-N 5-bromo-2,3,4-trifluoro-n-(4-methoxyphenyl)benzenesulfonamide Chemical compound C1=CC(OC)=CC=C1NS(=O)(=O)C1=CC(Br)=C(F)C(F)=C1F RCTCBSDWAUCMEI-UHFFFAOYSA-N 0.000 description 6
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 6
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 6
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 6
- 230000015572 biosynthetic process Effects 0.000 description 6
- 150000003254 radicals Chemical class 0.000 description 6
- 239000007787 solid Substances 0.000 description 6
- 238000011282 treatment Methods 0.000 description 6
- BLQFHJKRTDIZLX-UHFFFAOYSA-N 5-amino-2-methoxyphenol Chemical compound COC1=CC=C(N)C=C1O BLQFHJKRTDIZLX-UHFFFAOYSA-N 0.000 description 5
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 5
- 239000000243 solution Substances 0.000 description 5
- YBBRCQOCSYXUOC-UHFFFAOYSA-N sulfuryl dichloride Chemical class ClS(Cl)(=O)=O YBBRCQOCSYXUOC-UHFFFAOYSA-N 0.000 description 5
- 230000001225 therapeutic effect Effects 0.000 description 5
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical class ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 5
- XFTDZYFHXRZLEF-UHFFFAOYSA-N 2,3,4-trifluorobenzenesulfonyl chloride Chemical compound FC1=CC=C(S(Cl)(=O)=O)C(F)=C1F XFTDZYFHXRZLEF-UHFFFAOYSA-N 0.000 description 4
- IAYLRIOAUQKCBY-UHFFFAOYSA-N 2-bromo-3,4,5,6-tetrafluoro-n-(3-hydroxy-4-methoxyphenyl)benzenesulfonamide Chemical compound C1=C(O)C(OC)=CC=C1NS(=O)(=O)C1=C(F)C(F)=C(F)C(F)=C1Br IAYLRIOAUQKCBY-UHFFFAOYSA-N 0.000 description 4
- GGPCFSHQXLVTSO-UHFFFAOYSA-N 2-bromo-3,4,5,6-tetrafluoro-n-(4-methoxyphenyl)benzenesulfonamide Chemical compound C1=CC(OC)=CC=C1NS(=O)(=O)C1=C(F)C(F)=C(F)C(F)=C1Br GGPCFSHQXLVTSO-UHFFFAOYSA-N 0.000 description 4
- PAYRUJLWNCNPSJ-UHFFFAOYSA-N Aniline Chemical compound NC1=CC=CC=C1 PAYRUJLWNCNPSJ-UHFFFAOYSA-N 0.000 description 4
- AOJJSUZBOXZQNB-TZSSRYMLSA-N Doxorubicin Chemical compound O([C@H]1C[C@@](O)(CC=2C(O)=C3C(=O)C=4C=CC=C(C=4C(=O)C3=C(O)C=21)OC)C(=O)CO)[C@H]1C[C@H](N)[C@H](O)[C@H](C)O1 AOJJSUZBOXZQNB-TZSSRYMLSA-N 0.000 description 4
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 4
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 4
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 4
- RAHZWNYVWXNFOC-UHFFFAOYSA-N Sulphur dioxide Chemical compound O=S=O RAHZWNYVWXNFOC-UHFFFAOYSA-N 0.000 description 4
- NKANXQFJJICGDU-QPLCGJKRSA-N Tamoxifen Chemical compound C=1C=CC=CC=1C(/CC)=C(C=1C=CC(OCCN(C)C)=CC=1)/C1=CC=CC=C1 NKANXQFJJICGDU-QPLCGJKRSA-N 0.000 description 4
- 238000003556 assay Methods 0.000 description 4
- 125000004429 atom Chemical group 0.000 description 4
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Chemical compound BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 4
- 235000019439 ethyl acetate Nutrition 0.000 description 4
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 description 4
- 229910052760 oxygen Inorganic materials 0.000 description 4
- 230000002285 radioactive effect Effects 0.000 description 4
- 239000011541 reaction mixture Substances 0.000 description 4
- 229910052717 sulfur Inorganic materials 0.000 description 4
- KEQGZUUPPQEDPF-UHFFFAOYSA-N 1,3-dichloro-5,5-dimethylimidazolidine-2,4-dione Chemical compound CC1(C)N(Cl)C(=O)N(Cl)C1=O KEQGZUUPPQEDPF-UHFFFAOYSA-N 0.000 description 3
- COVHFELBSZZSOI-UHFFFAOYSA-N 2,3,4,5-tetrafluoro-n-(3-hydroxy-4-methoxyphenyl)benzenesulfonamide Chemical compound C1=C(O)C(OC)=CC=C1NS(=O)(=O)C1=CC(F)=C(F)C(F)=C1F COVHFELBSZZSOI-UHFFFAOYSA-N 0.000 description 3
- QITZCKFTLJUUKY-UHFFFAOYSA-N 2,3,4,5-tetrafluoro-n-(4-methoxyphenyl)benzenesulfonamide Chemical compound C1=CC(OC)=CC=C1NS(=O)(=O)C1=CC(F)=C(F)C(F)=C1F QITZCKFTLJUUKY-UHFFFAOYSA-N 0.000 description 3
- SLXGUUYOJAEVJS-UHFFFAOYSA-N 3,4,5-trifluoro-n-(3-hydroxy-4-methoxyphenyl)benzenesulfonamide Chemical compound C1=C(O)C(OC)=CC=C1NS(=O)(=O)C1=CC(F)=C(F)C(F)=C1 SLXGUUYOJAEVJS-UHFFFAOYSA-N 0.000 description 3
- VNGDFXNFUBUXKA-UHFFFAOYSA-N 3,4,5-trifluoro-n-(4-methoxyphenyl)benzenesulfonamide Chemical compound C1=CC(OC)=CC=C1NS(=O)(=O)C1=CC(F)=C(F)C(F)=C1 VNGDFXNFUBUXKA-UHFFFAOYSA-N 0.000 description 3
- 125000003762 3,4-dimethoxyphenyl group Chemical group [H]C1=C([H])C(OC([H])([H])[H])=C(OC([H])([H])[H])C([H])=C1* 0.000 description 3
- PTAPWFLHAVOUHJ-UHFFFAOYSA-N 3,5-dichloro-2,4,6-trifluoro-n-(3-hydroxy-4-methoxyphenyl)benzenesulfonamide Chemical compound C1=C(O)C(OC)=CC=C1NS(=O)(=O)C1=C(F)C(Cl)=C(F)C(Cl)=C1F PTAPWFLHAVOUHJ-UHFFFAOYSA-N 0.000 description 3
- JAOHKGJZZPPKCS-UHFFFAOYSA-N 3,5-dichloro-2,4,6-trifluoro-n-(4-methoxyphenyl)benzenesulfonamide Chemical compound C1=CC(OC)=CC=C1NS(=O)(=O)C1=C(F)C(Cl)=C(F)C(Cl)=C1F JAOHKGJZZPPKCS-UHFFFAOYSA-N 0.000 description 3
- BBBAYGJTRRZKTC-UHFFFAOYSA-N 4-bromo-2,3,5,6-tetrafluoro-n-(4-methoxyphenyl)benzenesulfonamide Chemical compound C1=CC(OC)=CC=C1NS(=O)(=O)C1=C(F)C(F)=C(Br)C(F)=C1F BBBAYGJTRRZKTC-UHFFFAOYSA-N 0.000 description 3
- MEZPAKLVSGAERH-UHFFFAOYSA-N 4-chloro-2,3,5,6-tetrafluoro-n-(4-methoxyphenyl)benzenesulfonamide Chemical compound C1=CC(OC)=CC=C1NS(=O)(=O)C1=C(F)C(F)=C(Cl)C(F)=C1F MEZPAKLVSGAERH-UHFFFAOYSA-N 0.000 description 3
- XZDWZZHAPIJEDQ-UHFFFAOYSA-N 4-fluoro-n-(3-hydroxy-4-methoxyphenyl)-3-nitrobenzenesulfonamide Chemical compound C1=C(O)C(OC)=CC=C1NS(=O)(=O)C1=CC=C(F)C([N+]([O-])=O)=C1 XZDWZZHAPIJEDQ-UHFFFAOYSA-N 0.000 description 3
- XMRWHKXOGDGNHJ-UHFFFAOYSA-N 4-fluoro-n-(4-methoxyphenyl)-3-nitrobenzenesulfonamide Chemical compound C1=CC(OC)=CC=C1NS(=O)(=O)C1=CC=C(F)C([N+]([O-])=O)=C1 XMRWHKXOGDGNHJ-UHFFFAOYSA-N 0.000 description 3
- 125000004172 4-methoxyphenyl group Chemical group [H]C1=C([H])C(OC([H])([H])[H])=C([H])C([H])=C1* 0.000 description 3
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 3
- FBOZXECLQNJBKD-ZDUSSCGKSA-N L-methotrexate Chemical compound C=1N=C2N=C(N)N=C(N)C2=NC=1CN(C)C1=CC=C(C(=O)N[C@@H](CCC(O)=O)C(O)=O)C=C1 FBOZXECLQNJBKD-ZDUSSCGKSA-N 0.000 description 3
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 3
- 230000002159 abnormal effect Effects 0.000 description 3
- 150000001491 aromatic compounds Chemical class 0.000 description 3
- 238000004364 calculation method Methods 0.000 description 3
- 229910052799 carbon Inorganic materials 0.000 description 3
- XTHPWXDJESJLNJ-UHFFFAOYSA-N chlorosulfonic acid Substances OS(Cl)(=O)=O XTHPWXDJESJLNJ-UHFFFAOYSA-N 0.000 description 3
- 238000004587 chromatography analysis Methods 0.000 description 3
- 230000001472 cytotoxic effect Effects 0.000 description 3
- 125000000623 heterocyclic group Chemical group 0.000 description 3
- 239000000543 intermediate Substances 0.000 description 3
- 229910052740 iodine Inorganic materials 0.000 description 3
- 229960000485 methotrexate Drugs 0.000 description 3
- 230000007935 neutral effect Effects 0.000 description 3
- 231100000252 nontoxic Toxicity 0.000 description 3
- 230000003000 nontoxic effect Effects 0.000 description 3
- 230000000144 pharmacologic effect Effects 0.000 description 3
- UHZYTMXLRWXGPK-UHFFFAOYSA-N phosphorus pentachloride Chemical compound ClP(Cl)(Cl)(Cl)Cl UHZYTMXLRWXGPK-UHFFFAOYSA-N 0.000 description 3
- 238000000746 purification Methods 0.000 description 3
- 239000000741 silica gel Substances 0.000 description 3
- 229910002027 silica gel Inorganic materials 0.000 description 3
- 239000002904 solvent Substances 0.000 description 3
- 239000007858 starting material Substances 0.000 description 3
- 238000003756 stirring Methods 0.000 description 3
- 229940124530 sulfonamide Drugs 0.000 description 3
- 150000003456 sulfonamides Chemical class 0.000 description 3
- IAKHMKGGTNLKSZ-INIZCTEOSA-N (S)-colchicine Chemical compound C1([C@@H](NC(C)=O)CC2)=CC(=O)C(OC)=CC=C1C1=C2C=C(OC)C(OC)=C1OC IAKHMKGGTNLKSZ-INIZCTEOSA-N 0.000 description 2
- PCGXALSKZRHXOX-UHFFFAOYSA-N 2,3,4,5-tetrafluoro-n-(3-fluoro-4-methoxyphenyl)benzenesulfonamide Chemical compound C1=C(F)C(OC)=CC=C1NS(=O)(=O)C1=CC(F)=C(F)C(F)=C1F PCGXALSKZRHXOX-UHFFFAOYSA-N 0.000 description 2
- WCPZRJPXQPEWOJ-UHFFFAOYSA-N 2,3,4,6-tetrafluoro-5-[(3-fluoro-4-methoxyphenyl)sulfamoyl]benzoic acid Chemical compound C1=C(F)C(OC)=CC=C1NS(=O)(=O)C1=C(F)C(F)=C(F)C(C(O)=O)=C1F WCPZRJPXQPEWOJ-UHFFFAOYSA-N 0.000 description 2
- FBAXNZWDMOJIFL-UHFFFAOYSA-N 2,3,4,6-tetrafluoro-5-[(4-methoxyphenyl)sulfamoyl]benzoic acid Chemical compound C1=CC(OC)=CC=C1NS(=O)(=O)C1=C(F)C(F)=C(F)C(C(O)=O)=C1F FBAXNZWDMOJIFL-UHFFFAOYSA-N 0.000 description 2
- ILLJRJUJVYZWEZ-UHFFFAOYSA-N 2,3,4,6-tetrafluoro-n-(4-methoxyphenyl)benzenesulfonamide Chemical compound C1=CC(OC)=CC=C1NS(=O)(=O)C1=C(F)C=C(F)C(F)=C1F ILLJRJUJVYZWEZ-UHFFFAOYSA-N 0.000 description 2
- UHYIENZZAVUHSX-UHFFFAOYSA-N 2,3,4-trifluoro-5-[(4-methoxyphenyl)sulfamoyl]benzoic acid Chemical compound C1=CC(OC)=CC=C1NS(=O)(=O)C1=CC(C(O)=O)=C(F)C(F)=C1F UHYIENZZAVUHSX-UHFFFAOYSA-N 0.000 description 2
- AYUOWVFSPKPEMA-UHFFFAOYSA-N 2,3,4-trifluoro-n-(3-fluoro-4-methoxyphenyl)benzenesulfonamide Chemical compound C1=C(F)C(OC)=CC=C1NS(=O)(=O)C1=CC=C(F)C(F)=C1F AYUOWVFSPKPEMA-UHFFFAOYSA-N 0.000 description 2
- ZEGWRALLTDGCBL-UHFFFAOYSA-N 2,3,4-trifluoro-n-(3-hydroxy-4-methoxyphenyl)benzenesulfonamide Chemical compound C1=C(O)C(OC)=CC=C1NS(=O)(=O)C1=CC=C(F)C(F)=C1F ZEGWRALLTDGCBL-UHFFFAOYSA-N 0.000 description 2
- LBSHLAUHXYJGJZ-UHFFFAOYSA-N 2,3,4-trifluoro-n-(4-methoxyphenyl)benzenesulfonamide Chemical compound C1=CC(OC)=CC=C1NS(=O)(=O)C1=CC=C(F)C(F)=C1F LBSHLAUHXYJGJZ-UHFFFAOYSA-N 0.000 description 2
- XINCBNCLCIQIJM-UHFFFAOYSA-N 2,4,6-trifluorobenzenesulfonyl chloride Chemical compound FC1=CC(F)=C(S(Cl)(=O)=O)C(F)=C1 XINCBNCLCIQIJM-UHFFFAOYSA-N 0.000 description 2
- KZMVSDGUYVLTTH-UHFFFAOYSA-N 2-bromo-3,4,5,6-tetrafluoro-n-(3-fluoro-4-methoxyphenyl)benzenesulfonamide Chemical compound C1=C(F)C(OC)=CC=C1NS(=O)(=O)C1=C(F)C(F)=C(F)C(F)=C1Br KZMVSDGUYVLTTH-UHFFFAOYSA-N 0.000 description 2
- GVUZWQXNPLQRKC-UHFFFAOYSA-N 2-bromo-3,4,5,6-tetrafluorobenzenesulfonic acid Chemical compound OS(=O)(=O)C1=C(F)C(F)=C(F)C(F)=C1Br GVUZWQXNPLQRKC-UHFFFAOYSA-N 0.000 description 2
- GRBJVYGMFKVYOF-UHFFFAOYSA-N 3,4,5-trifluoro-n-(3-fluoro-4-methoxyphenyl)benzenesulfonamide Chemical compound C1=C(F)C(OC)=CC=C1NS(=O)(=O)C1=CC(F)=C(F)C(F)=C1 GRBJVYGMFKVYOF-UHFFFAOYSA-N 0.000 description 2
- ADUDCACBCWTINI-UHFFFAOYSA-N 3,4-difluoro-n-(3-fluoro-4-methoxyphenyl)-5-nitrobenzenesulfonamide Chemical compound C1=C(F)C(OC)=CC=C1NS(=O)(=O)C1=CC(F)=C(F)C([N+]([O-])=O)=C1 ADUDCACBCWTINI-UHFFFAOYSA-N 0.000 description 2
- GLRMXHFJNKBGHG-UHFFFAOYSA-N 3,4-difluoro-n-(3-hydroxy-4-methoxyphenyl)-5-nitrobenzenesulfonamide Chemical compound C1=C(O)C(OC)=CC=C1NS(=O)(=O)C1=CC(F)=C(F)C([N+]([O-])=O)=C1 GLRMXHFJNKBGHG-UHFFFAOYSA-N 0.000 description 2
- FEBSNZXLIFIQMR-UHFFFAOYSA-N 3,4-difluoro-n-(4-methoxyphenyl)-5-nitrobenzenesulfonamide Chemical compound C1=CC(OC)=CC=C1NS(=O)(=O)C1=CC(F)=C(F)C([N+]([O-])=O)=C1 FEBSNZXLIFIQMR-UHFFFAOYSA-N 0.000 description 2
- SGYIKNJQNYKZNO-UHFFFAOYSA-N 3,5-dichloro-2,4,6-trifluoro-n-(3-fluoro-4-methoxyphenyl)benzenesulfonamide Chemical compound C1=C(F)C(OC)=CC=C1NS(=O)(=O)C1=C(F)C(Cl)=C(F)C(Cl)=C1F SGYIKNJQNYKZNO-UHFFFAOYSA-N 0.000 description 2
- AGQBGLPVAIJCBB-UHFFFAOYSA-N 3-bromo-2,4,5,6-tetrafluoro-n-(3-fluoro-4-methoxyphenyl)benzenesulfonamide Chemical compound C1=C(F)C(OC)=CC=C1NS(=O)(=O)C1=C(F)C(F)=C(F)C(Br)=C1F AGQBGLPVAIJCBB-UHFFFAOYSA-N 0.000 description 2
- WNLGUDNTEMSHRL-UHFFFAOYSA-N 3-bromo-2,4,5,6-tetrafluoro-n-(3-hydroxy-4-methoxyphenyl)benzenesulfonamide Chemical compound C1=C(O)C(OC)=CC=C1NS(=O)(=O)C1=C(F)C(F)=C(F)C(Br)=C1F WNLGUDNTEMSHRL-UHFFFAOYSA-N 0.000 description 2
- PVNSHPIVBJKRBD-UHFFFAOYSA-N 3-cyano-4-fluoro-n-(3-fluoro-4-methoxyphenyl)benzenesulfonamide Chemical compound C1=C(F)C(OC)=CC=C1NS(=O)(=O)C1=CC=C(F)C(C#N)=C1 PVNSHPIVBJKRBD-UHFFFAOYSA-N 0.000 description 2
- KBQYBGLDOTXZHB-UHFFFAOYSA-N 3-cyano-4-fluoro-n-(3-hydroxy-4-methoxyphenyl)benzenesulfonamide Chemical compound C1=C(O)C(OC)=CC=C1NS(=O)(=O)C1=CC=C(F)C(C#N)=C1 KBQYBGLDOTXZHB-UHFFFAOYSA-N 0.000 description 2
- XEGJDKCSTPMARO-UHFFFAOYSA-N 3-cyano-4-fluoro-n-(4-methoxyphenyl)benzenesulfonamide Chemical compound C1=CC(OC)=CC=C1NS(=O)(=O)C1=CC=C(F)C(C#N)=C1 XEGJDKCSTPMARO-UHFFFAOYSA-N 0.000 description 2
- PYMSZTUXRNONSA-UHFFFAOYSA-N 4-bromo-2,3,5,6-tetrafluoro-n-(3-fluoro-4-methoxyphenyl)benzenesulfonamide Chemical compound C1=C(F)C(OC)=CC=C1NS(=O)(=O)C1=C(F)C(F)=C(Br)C(F)=C1F PYMSZTUXRNONSA-UHFFFAOYSA-N 0.000 description 2
- AYCKUVTUMLLKRS-UHFFFAOYSA-N 4-bromo-2,3,5,6-tetrafluoro-n-(3-hydroxy-4-methoxyphenyl)benzenesulfonamide Chemical compound C1=C(O)C(OC)=CC=C1NS(=O)(=O)C1=C(F)C(F)=C(Br)C(F)=C1F AYCKUVTUMLLKRS-UHFFFAOYSA-N 0.000 description 2
- RLPCCVFJVXAXTH-UHFFFAOYSA-N 4-chloro-2,3,5,6-tetrafluoro-n-(3-fluoro-4-methoxyphenyl)benzenesulfonamide Chemical compound C1=C(F)C(OC)=CC=C1NS(=O)(=O)C1=C(F)C(F)=C(Cl)C(F)=C1F RLPCCVFJVXAXTH-UHFFFAOYSA-N 0.000 description 2
- FPAYYLJPZRQTAF-UHFFFAOYSA-N 4-chloro-2,3,5,6-tetrafluoro-n-(3-hydroxy-4-methoxyphenyl)benzenesulfonamide Chemical compound C1=C(O)C(OC)=CC=C1NS(=O)(=O)C1=C(F)C(F)=C(Cl)C(F)=C1F FPAYYLJPZRQTAF-UHFFFAOYSA-N 0.000 description 2
- WQDYDAHEDDHZMY-UHFFFAOYSA-N 4-chloro-3-cyano-n-(3-fluoro-4-methoxyphenyl)benzenesulfonamide Chemical compound C1=C(F)C(OC)=CC=C1NS(=O)(=O)C1=CC=C(Cl)C(C#N)=C1 WQDYDAHEDDHZMY-UHFFFAOYSA-N 0.000 description 2
- ACFAKOFFBCKARI-UHFFFAOYSA-N 4-chloro-3-cyano-n-(3-hydroxy-4-methoxyphenyl)benzenesulfonamide Chemical compound C1=C(O)C(OC)=CC=C1NS(=O)(=O)C1=CC=C(Cl)C(C#N)=C1 ACFAKOFFBCKARI-UHFFFAOYSA-N 0.000 description 2
- JHVYDXJPFRSREL-UHFFFAOYSA-N 4-chloro-3-cyano-n-(4-methoxyphenyl)benzenesulfonamide Chemical compound C1=CC(OC)=CC=C1NS(=O)(=O)C1=CC=C(Cl)C(C#N)=C1 JHVYDXJPFRSREL-UHFFFAOYSA-N 0.000 description 2
- VFAHHOBFWSSXLM-UHFFFAOYSA-N 4-chloro-n-(3-fluoro-4-methoxyphenyl)-3-nitrobenzenesulfonamide Chemical compound C1=C(F)C(OC)=CC=C1NS(=O)(=O)C1=CC=C(Cl)C([N+]([O-])=O)=C1 VFAHHOBFWSSXLM-UHFFFAOYSA-N 0.000 description 2
- MIGZZSMCMSIQLP-UHFFFAOYSA-N 4-chloro-n-(3-hydroxy-4-methoxyphenyl)-3-nitrobenzenesulfonamide Chemical compound C1=C(O)C(OC)=CC=C1NS(=O)(=O)C1=CC=C(Cl)C([N+]([O-])=O)=C1 MIGZZSMCMSIQLP-UHFFFAOYSA-N 0.000 description 2
- ZARAKCIKPBGLMM-UHFFFAOYSA-N 4-chloro-n-(4-methoxyphenyl)-3-nitrobenzenesulfonamide Chemical compound C1=CC(OC)=CC=C1NS(=O)(=O)C1=CC=C(Cl)C([N+]([O-])=O)=C1 ZARAKCIKPBGLMM-UHFFFAOYSA-N 0.000 description 2
- JMVWMQHIHCXUPR-UHFFFAOYSA-N 4-fluoro-n-(3-fluoro-4-methoxyphenyl)-3-nitrobenzenesulfonamide Chemical compound C1=C(F)C(OC)=CC=C1NS(=O)(=O)C1=CC=C(F)C([N+]([O-])=O)=C1 JMVWMQHIHCXUPR-UHFFFAOYSA-N 0.000 description 2
- SCUYULHGUMPWCG-UHFFFAOYSA-N 5-bromo-2,3,4-trifluoro-n-(3-fluoro-4-methoxyphenyl)benzenesulfonamide Chemical compound C1=C(F)C(OC)=CC=C1NS(=O)(=O)C1=CC(Br)=C(F)C(F)=C1F SCUYULHGUMPWCG-UHFFFAOYSA-N 0.000 description 2
- KHQZEUYAHWDICF-UHFFFAOYSA-N 6-bromo-2,3,4-trifluoro-n-(3-fluoro-4-methoxyphenyl)benzenesulfonamide Chemical compound C1=C(F)C(OC)=CC=C1NS(=O)(=O)C1=C(Br)C=C(F)C(F)=C1F KHQZEUYAHWDICF-UHFFFAOYSA-N 0.000 description 2
- SZFPXQCSQIPGPG-UHFFFAOYSA-N 6-bromo-2,3,4-trifluoro-n-(3-hydroxy-4-methoxyphenyl)benzenesulfonamide Chemical compound C1=C(O)C(OC)=CC=C1NS(=O)(=O)C1=C(F)C(F)=C(F)C=C1Br SZFPXQCSQIPGPG-UHFFFAOYSA-N 0.000 description 2
- VFMLEDLVUDSUAX-UHFFFAOYSA-N 6-bromo-2,3,4-trifluoro-n-(4-methoxyphenyl)benzenesulfonamide Chemical compound C1=CC(OC)=CC=C1NS(=O)(=O)C1=C(Br)C=C(F)C(F)=C1F VFMLEDLVUDSUAX-UHFFFAOYSA-N 0.000 description 2
- STQGQHZAVUOBTE-UHFFFAOYSA-N 7-Cyan-hept-2t-en-4,6-diinsaeure Natural products C1=2C(O)=C3C(=O)C=4C(OC)=CC=CC=4C(=O)C3=C(O)C=2CC(O)(C(C)=O)CC1OC1CC(N)C(O)C(C)O1 STQGQHZAVUOBTE-UHFFFAOYSA-N 0.000 description 2
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical group [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 2
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 2
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical group [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 2
- 239000004215 Carbon black (E152) Substances 0.000 description 2
- OKTJSMMVPCPJKN-NJFSPNSNSA-N Carbon-14 Chemical compound [14C] OKTJSMMVPCPJKN-NJFSPNSNSA-N 0.000 description 2
- CMSMOCZEIVJLDB-UHFFFAOYSA-N Cyclophosphamide Chemical compound ClCCN(CCCl)P1(=O)NCCCO1 CMSMOCZEIVJLDB-UHFFFAOYSA-N 0.000 description 2
- WEAHRLBPCANXCN-UHFFFAOYSA-N Daunomycin Natural products CCC1(O)CC(OC2CC(N)C(O)C(C)O2)c3cc4C(=O)c5c(OC)cccc5C(=O)c4c(O)c3C1 WEAHRLBPCANXCN-UHFFFAOYSA-N 0.000 description 2
- YZCKVEUIGOORGS-UHFFFAOYSA-N Hydrogen atom Chemical class [H] YZCKVEUIGOORGS-UHFFFAOYSA-N 0.000 description 2
- MHAJPDPJQMAIIY-UHFFFAOYSA-N Hydrogen peroxide Chemical compound OO MHAJPDPJQMAIIY-UHFFFAOYSA-N 0.000 description 2
- VSNHCAURESNICA-UHFFFAOYSA-N Hydroxyurea Chemical compound NC(=O)NO VSNHCAURESNICA-UHFFFAOYSA-N 0.000 description 2
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 2
- 102000029749 Microtubule Human genes 0.000 description 2
- 108091022875 Microtubule Proteins 0.000 description 2
- MZRVEZGGRBJDDB-UHFFFAOYSA-N N-Butyllithium Chemical compound [Li]CCCC MZRVEZGGRBJDDB-UHFFFAOYSA-N 0.000 description 2
- 229930012538 Paclitaxel Natural products 0.000 description 2
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 2
- YZCKVEUIGOORGS-NJFSPNSNSA-N Tritium Chemical compound [3H] YZCKVEUIGOORGS-NJFSPNSNSA-N 0.000 description 2
- JXLYSJRDGCGARV-WWYNWVTFSA-N Vinblastine Natural products O=C(O[C@H]1[C@](O)(C(=O)OC)[C@@H]2N(C)c3c(cc(c(OC)c3)[C@]3(C(=O)OC)c4[nH]c5c(c4CCN4C[C@](O)(CC)C[C@H](C3)C4)cccc5)[C@@]32[C@H]2[C@@]1(CC)C=CCN2CC3)C JXLYSJRDGCGARV-WWYNWVTFSA-N 0.000 description 2
- 229960000583 acetic acid Drugs 0.000 description 2
- 150000007513 acids Chemical class 0.000 description 2
- 239000013543 active substance Substances 0.000 description 2
- 150000001448 anilines Chemical class 0.000 description 2
- 230000000340 anti-metabolite Effects 0.000 description 2
- 229940100197 antimetabolite Drugs 0.000 description 2
- 239000002256 antimetabolite Substances 0.000 description 2
- 239000007864 aqueous solution Substances 0.000 description 2
- 230000001580 bacterial effect Effects 0.000 description 2
- 239000002775 capsule Substances 0.000 description 2
- 230000010261 cell growth Effects 0.000 description 2
- 150000001805 chlorine compounds Chemical class 0.000 description 2
- DQLATGHUWYMOKM-UHFFFAOYSA-L cisplatin Chemical compound N[Pt](N)(Cl)Cl DQLATGHUWYMOKM-UHFFFAOYSA-L 0.000 description 2
- 229960004316 cisplatin Drugs 0.000 description 2
- 238000004440 column chromatography Methods 0.000 description 2
- 125000004122 cyclic group Chemical group 0.000 description 2
- 125000000753 cycloalkyl group Chemical group 0.000 description 2
- 229960004397 cyclophosphamide Drugs 0.000 description 2
- 231100000433 cytotoxic Toxicity 0.000 description 2
- 230000003013 cytotoxicity Effects 0.000 description 2
- 231100000135 cytotoxicity Toxicity 0.000 description 2
- STQGQHZAVUOBTE-VGBVRHCVSA-N daunorubicin Chemical compound O([C@H]1C[C@@](O)(CC=2C(O)=C3C(=O)C=4C=CC=C(C=4C(=O)C3=C(O)C=21)OC)C(C)=O)[C@H]1C[C@H](N)[C@H](O)[C@H](C)O1 STQGQHZAVUOBTE-VGBVRHCVSA-N 0.000 description 2
- 239000012954 diazonium Substances 0.000 description 2
- 150000001989 diazonium salts Chemical class 0.000 description 2
- 230000004069 differentiation Effects 0.000 description 2
- 229940079593 drug Drugs 0.000 description 2
- 230000000694 effects Effects 0.000 description 2
- 210000002889 endothelial cell Anatomy 0.000 description 2
- MKXKFYHWDHIYRV-UHFFFAOYSA-N flutamide Chemical compound CC(C)C(=O)NC1=CC=C([N+]([O-])=O)C(C(F)(F)F)=C1 MKXKFYHWDHIYRV-UHFFFAOYSA-N 0.000 description 2
- 229960002074 flutamide Drugs 0.000 description 2
- 238000009472 formulation Methods 0.000 description 2
- 230000012010 growth Effects 0.000 description 2
- 229940093915 gynecological organic acid Drugs 0.000 description 2
- 125000000592 heterocycloalkyl group Chemical group 0.000 description 2
- 229930195733 hydrocarbon Natural products 0.000 description 2
- 150000002430 hydrocarbons Chemical group 0.000 description 2
- 229960001330 hydroxycarbamide Drugs 0.000 description 2
- 238000000338 in vitro Methods 0.000 description 2
- 238000000099 in vitro assay Methods 0.000 description 2
- 238000005462 in vivo assay Methods 0.000 description 2
- 239000012442 inert solvent Substances 0.000 description 2
- 208000027866 inflammatory disease Diseases 0.000 description 2
- 229910052744 lithium Inorganic materials 0.000 description 2
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 2
- 235000019341 magnesium sulphate Nutrition 0.000 description 2
- 230000036210 malignancy Effects 0.000 description 2
- 230000003211 malignant effect Effects 0.000 description 2
- 210000004688 microtubule Anatomy 0.000 description 2
- ORPIWKMLDXEMKB-UHFFFAOYSA-N n-(3,4-dimethoxyphenyl)-3,4-difluoro-5-nitrobenzenesulfonamide Chemical compound C1=C(OC)C(OC)=CC=C1NS(=O)(=O)C1=CC(F)=C(F)C([N+]([O-])=O)=C1 ORPIWKMLDXEMKB-UHFFFAOYSA-N 0.000 description 2
- RBBZTWAVGFETGR-UHFFFAOYSA-N n-(3,4-dimethoxyphenyl)-4-fluoro-3-nitrobenzenesulfonamide Chemical compound C1=C(OC)C(OC)=CC=C1NS(=O)(=O)C1=CC=C(F)C([N+]([O-])=O)=C1 RBBZTWAVGFETGR-UHFFFAOYSA-N 0.000 description 2
- JOFIGGTZBGSBKO-UHFFFAOYSA-N n-(3-chloro-4-methoxyphenyl)-2,3,4-trifluorobenzenesulfonamide Chemical compound C1=C(Cl)C(OC)=CC=C1NS(=O)(=O)C1=CC=C(F)C(F)=C1F JOFIGGTZBGSBKO-UHFFFAOYSA-N 0.000 description 2
- QJGQUHMNIGDVPM-UHFFFAOYSA-N nitrogen group Chemical group [N] QJGQUHMNIGDVPM-UHFFFAOYSA-N 0.000 description 2
- 230000000269 nucleophilic effect Effects 0.000 description 2
- 150000007524 organic acids Chemical class 0.000 description 2
- 235000005985 organic acids Nutrition 0.000 description 2
- 229960001592 paclitaxel Drugs 0.000 description 2
- XHXFXVLFKHQFAL-UHFFFAOYSA-N phosphoryl trichloride Chemical compound ClP(Cl)(Cl)=O XHXFXVLFKHQFAL-UHFFFAOYSA-N 0.000 description 2
- 239000006187 pill Substances 0.000 description 2
- 239000011591 potassium Substances 0.000 description 2
- 229910052700 potassium Inorganic materials 0.000 description 2
- 230000035755 proliferation Effects 0.000 description 2
- 238000011321 prophylaxis Methods 0.000 description 2
- 230000002829 reductive effect Effects 0.000 description 2
- 208000017520 skin disease Diseases 0.000 description 2
- 230000000391 smoking effect Effects 0.000 description 2
- 239000011734 sodium Substances 0.000 description 2
- 229910052708 sodium Inorganic materials 0.000 description 2
- 150000003457 sulfones Chemical class 0.000 description 2
- 125000000472 sulfonyl group Chemical group *S(*)(=O)=O 0.000 description 2
- 150000003462 sulfoxides Chemical class 0.000 description 2
- 125000004434 sulfur atom Chemical group 0.000 description 2
- 229960001603 tamoxifen Drugs 0.000 description 2
- RCINICONZNJXQF-MZXODVADSA-N taxol Chemical compound O([C@@H]1[C@@]2(C[C@@H](C(C)=C(C2(C)C)[C@H](C([C@]2(C)[C@@H](O)C[C@H]3OC[C@]3([C@H]21)OC(C)=O)=O)OC(=O)C)OC(=O)[C@H](O)[C@@H](NC(=O)C=1C=CC=CC=1)C=1C=CC=CC=1)O)C(=O)C1=CC=CC=C1 RCINICONZNJXQF-MZXODVADSA-N 0.000 description 2
- 238000012360 testing method Methods 0.000 description 2
- 210000001519 tissue Anatomy 0.000 description 2
- 230000000699 topical effect Effects 0.000 description 2
- 231100000419 toxicity Toxicity 0.000 description 2
- 230000001988 toxicity Effects 0.000 description 2
- 229910052722 tritium Inorganic materials 0.000 description 2
- 230000004614 tumor growth Effects 0.000 description 2
- HOFQVRTUGATRFI-XQKSVPLYSA-N vinblastine Chemical compound C([C@@H](C[C@]1(C(=O)OC)C=2C(=CC3=C([C@]45[C@H]([C@@]([C@H](OC(C)=O)[C@]6(CC)C=CCN([C@H]56)CC4)(O)C(=O)OC)N3C)C=2)OC)C[C@@](C2)(O)CC)N2CCC2=C1N=C1[C]2C=CC=C1 HOFQVRTUGATRFI-XQKSVPLYSA-N 0.000 description 2
- 229960003048 vinblastine Drugs 0.000 description 2
- OGWKCGZFUXNPDA-XQKSVPLYSA-N vincristine Chemical compound C([N@]1C[C@@H](C[C@]2(C(=O)OC)C=3C(=CC4=C([C@]56[C@H]([C@@]([C@H](OC(C)=O)[C@]7(CC)C=CCN([C@H]67)CC5)(O)C(=O)OC)N4C=O)C=3)OC)C[C@@](C1)(O)CC)CC1=C2NC2=CC=CC=C12 OGWKCGZFUXNPDA-XQKSVPLYSA-N 0.000 description 2
- 229960004528 vincristine Drugs 0.000 description 2
- OGWKCGZFUXNPDA-UHFFFAOYSA-N vincristine Natural products C1C(CC)(O)CC(CC2(C(=O)OC)C=3C(=CC4=C(C56C(C(C(OC(C)=O)C7(CC)C=CCN(C67)CC5)(O)C(=O)OC)N4C=O)C=3)OC)CN1CCC1=C2NC2=CC=CC=C12 OGWKCGZFUXNPDA-UHFFFAOYSA-N 0.000 description 2
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 2
- 125000004209 (C1-C8) alkyl group Chemical group 0.000 description 1
- JXUKFFRPLNTYIV-UHFFFAOYSA-N 1,3,5-trifluorobenzene Chemical compound FC1=CC(F)=CC(F)=C1 JXUKFFRPLNTYIV-UHFFFAOYSA-N 0.000 description 1
- 125000000196 1,4-pentadienyl group Chemical group [H]C([*])=C([H])C([H])([H])C([H])=C([H])[H] 0.000 description 1
- BUYSIDPAOVWMQX-UHFFFAOYSA-N 1-bromo-2,3,4,5-tetrafluorobenzene Chemical compound FC1=CC(Br)=C(F)C(F)=C1F BUYSIDPAOVWMQX-UHFFFAOYSA-N 0.000 description 1
- PWKNBLFSJAVFAB-UHFFFAOYSA-N 1-fluoro-2-nitrobenzene Chemical compound [O-][N+](=O)C1=CC=CC=C1F PWKNBLFSJAVFAB-UHFFFAOYSA-N 0.000 description 1
- 125000001637 1-naphthyl group Chemical group [H]C1=C([H])C([H])=C2C(*)=C([H])C([H])=C([H])C2=C1[H] 0.000 description 1
- 125000001462 1-pyrrolyl group Chemical group [*]N1C([H])=C([H])C([H])=C1[H] 0.000 description 1
- MOSXORPPDAEREV-UHFFFAOYSA-N 2,3,5,6-tetrafluoro-n-(3-fluoro-4-methoxyphenyl)-4-(trifluoromethoxy)benzenesulfonamide Chemical compound C1=C(F)C(OC)=CC=C1NS(=O)(=O)C1=C(F)C(F)=C(OC(F)(F)F)C(F)=C1F MOSXORPPDAEREV-UHFFFAOYSA-N 0.000 description 1
- RXQPRAMLZGQWDI-UHFFFAOYSA-N 2,3,5,6-tetrafluoro-n-(3-hydroxy-4-methoxyphenyl)-4-(trifluoromethoxy)benzenesulfonamide Chemical compound C1=C(O)C(OC)=CC=C1NS(=O)(=O)C1=C(F)C(F)=C(OC(F)(F)F)C(F)=C1F RXQPRAMLZGQWDI-UHFFFAOYSA-N 0.000 description 1
- ZEOCIPNVCGNOIC-UHFFFAOYSA-N 2,3,5,6-tetrafluoro-n-(4-methoxyphenyl)-4-(trifluoromethoxy)benzenesulfonamide Chemical compound C1=CC(OC)=CC=C1NS(=O)(=O)C1=C(F)C(F)=C(OC(F)(F)F)C(F)=C1F ZEOCIPNVCGNOIC-UHFFFAOYSA-N 0.000 description 1
- AUEWWGZMFFWSPB-UHFFFAOYSA-N 2,3,5-trifluoro-n-(3-fluoro-4-methoxyphenyl)-4-(trifluoromethoxy)benzenesulfonamide Chemical compound C1=C(F)C(OC)=CC=C1NS(=O)(=O)C1=CC(F)=C(OC(F)(F)F)C(F)=C1F AUEWWGZMFFWSPB-UHFFFAOYSA-N 0.000 description 1
- UIYXGXNGHNQVBN-UHFFFAOYSA-N 2,3,5-trifluoro-n-(3-hydroxy-4-methoxyphenyl)-4-(trifluoromethoxy)benzenesulfonamide Chemical compound C1=C(O)C(OC)=CC=C1NS(=O)(=O)C1=CC(F)=C(OC(F)(F)F)C(F)=C1F UIYXGXNGHNQVBN-UHFFFAOYSA-N 0.000 description 1
- UAWDEWKCSBZLRG-UHFFFAOYSA-N 2,3,5-trifluoro-n-(4-methoxyphenyl)-4-(trifluoromethoxy)benzenesulfonamide Chemical compound C1=CC(OC)=CC=C1NS(=O)(=O)C1=CC(F)=C(OC(F)(F)F)C(F)=C1F UAWDEWKCSBZLRG-UHFFFAOYSA-N 0.000 description 1
- XQYHEYIPBWAONI-UHFFFAOYSA-N 2,4,5-trifluoro-n-(4-methoxyphenyl)benzenesulfonamide Chemical compound C1=CC(OC)=CC=C1NS(=O)(=O)C1=CC(F)=C(F)C=C1F XQYHEYIPBWAONI-UHFFFAOYSA-N 0.000 description 1
- FXQXDPGFERAWKC-UHFFFAOYSA-N 2,4,6-trifluoro-n-(4-methoxyphenyl)benzenesulfonamide Chemical compound C1=CC(OC)=CC=C1NS(=O)(=O)C1=C(F)C=C(F)C=C1F FXQXDPGFERAWKC-UHFFFAOYSA-N 0.000 description 1
- UOGVNYNJSZHQCN-UHFFFAOYSA-N 2,4-dichloro-1,3,5-trifluorobenzene Chemical compound FC1=CC(F)=C(Cl)C(F)=C1Cl UOGVNYNJSZHQCN-UHFFFAOYSA-N 0.000 description 1
- 125000004174 2-benzimidazolyl group Chemical group [H]N1C(*)=NC2=C([H])C([H])=C([H])C([H])=C12 0.000 description 1
- AHJRONLVHNFUNH-UHFFFAOYSA-N 2-bromo-1,3,4,5-tetrafluorobenzene Chemical compound FC1=CC(F)=C(Br)C(F)=C1F AHJRONLVHNFUNH-UHFFFAOYSA-N 0.000 description 1
- CUBSXTAOVAEONH-UHFFFAOYSA-N 2-bromo-3,4,5,6-tetrafluorobenzenesulfonyl chloride Chemical compound FC1=C(F)C(F)=C(S(Cl)(=O)=O)C(Br)=C1F CUBSXTAOVAEONH-UHFFFAOYSA-N 0.000 description 1
- CJEJAONFCOJFCH-UHFFFAOYSA-N 2-bromo-3,4,5-trifluoro-n-(3-fluoro-4-methoxyphenyl)benzenesulfonamide Chemical compound C1=C(F)C(OC)=CC=C1NS(=O)(=O)C1=CC(F)=C(F)C(F)=C1Br CJEJAONFCOJFCH-UHFFFAOYSA-N 0.000 description 1
- JVGLQWNQRHPZMB-UHFFFAOYSA-N 2-bromo-3,4,5-trifluorobenzenesulfonyl chloride Chemical compound FC1=CC(S(Cl)(=O)=O)=C(Br)C(F)=C1F JVGLQWNQRHPZMB-UHFFFAOYSA-N 0.000 description 1
- DYEWYJDJEBWPMY-UHFFFAOYSA-N 2-bromo-5-[(3-fluoro-4-methoxyphenyl)sulfamoyl]benzoic acid Chemical compound C1=C(F)C(OC)=CC=C1NS(=O)(=O)C1=CC=C(Br)C(C(O)=O)=C1 DYEWYJDJEBWPMY-UHFFFAOYSA-N 0.000 description 1
- IFPBFUBXWYUVJR-UHFFFAOYSA-N 2-bromo-5-[[4-(dimethylamino)phenyl]sulfamoyl]benzoic acid Chemical compound C1=CC(N(C)C)=CC=C1NS(=O)(=O)C1=CC=C(Br)C(C(O)=O)=C1 IFPBFUBXWYUVJR-UHFFFAOYSA-N 0.000 description 1
- OJKIYKLQBVEZSF-UHFFFAOYSA-N 2-bromo-n-(3,4-dimethoxyphenyl)-3,4,5-trifluorobenzenesulfonamide Chemical compound C1=C(OC)C(OC)=CC=C1NS(=O)(=O)C1=CC(F)=C(F)C(F)=C1Br OJKIYKLQBVEZSF-UHFFFAOYSA-N 0.000 description 1
- 125000002941 2-furyl group Chemical group O1C([*])=C([H])C([H])=C1[H] 0.000 description 1
- 125000005916 2-methylpentyl group Chemical class 0.000 description 1
- 125000001622 2-naphthyl group Chemical group [H]C1=C([H])C([H])=C2C([H])=C(*)C([H])=C([H])C2=C1[H] 0.000 description 1
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 description 1
- 125000004105 2-pyridyl group Chemical group N1=C([*])C([H])=C([H])C([H])=C1[H] 0.000 description 1
- 125000000389 2-pyrrolyl group Chemical group [H]N1C([*])=C([H])C([H])=C1[H] 0.000 description 1
- 125000000175 2-thienyl group Chemical group S1C([*])=C([H])C([H])=C1[H] 0.000 description 1
- XDYKWPNNTGMVKV-UHFFFAOYSA-N 3,5-dichloro-2,4,6-trifluorobenzenesulfonyl chloride Chemical compound FC1=C(Cl)C(F)=C(S(Cl)(=O)=O)C(F)=C1Cl XDYKWPNNTGMVKV-UHFFFAOYSA-N 0.000 description 1
- BHPGBZPAKCWOBS-UHFFFAOYSA-N 3-[(3,4-dimethoxyphenyl)sulfamoyl]-2,4,5,6-tetrafluorobenzoic acid Chemical compound C1=C(OC)C(OC)=CC=C1NS(=O)(=O)C1=C(F)C(F)=C(F)C(C(O)=O)=C1F BHPGBZPAKCWOBS-UHFFFAOYSA-N 0.000 description 1
- JYHDUPPDVZPMCG-UHFFFAOYSA-N 3-[[4-(dimethylamino)phenyl]sulfamoyl]-2,4,5,6-tetrafluorobenzoic acid Chemical compound C1=CC(N(C)C)=CC=C1NS(=O)(=O)C1=C(F)C(F)=C(F)C(C(O)=O)=C1F JYHDUPPDVZPMCG-UHFFFAOYSA-N 0.000 description 1
- YHAFCGSUIAFUCX-UHFFFAOYSA-N 3-bromo-1,2,4,5-tetrafluorobenzene Chemical compound FC1=CC(F)=C(F)C(Br)=C1F YHAFCGSUIAFUCX-UHFFFAOYSA-N 0.000 description 1
- LJCQHRGXTOZMKU-UHFFFAOYSA-N 3-bromo-2,4,5,6-tetrafluorobenzenesulfonyl chloride Chemical compound FC1=C(F)C(Br)=C(F)C(S(Cl)(=O)=O)=C1F LJCQHRGXTOZMKU-UHFFFAOYSA-N 0.000 description 1
- QQSGXHYZMIVKJU-UHFFFAOYSA-N 3-bromo-n-(3,4-dimethoxyphenyl)-2,4,5,6-tetrafluorobenzenesulfonamide Chemical compound C1=C(OC)C(OC)=CC=C1NS(=O)(=O)C1=C(F)C(F)=C(F)C(Br)=C1F QQSGXHYZMIVKJU-UHFFFAOYSA-N 0.000 description 1
- LRKHKSCBJCFBGX-UHFFFAOYSA-N 3-bromo-n-[4-(dimethylamino)phenyl]-2,4,5,6-tetrafluorobenzenesulfonamide Chemical compound C1=CC(N(C)C)=CC=C1NS(=O)(=O)C1=C(F)C(F)=C(F)C(Br)=C1F LRKHKSCBJCFBGX-UHFFFAOYSA-N 0.000 description 1
- XQVCBOLNTSUFGD-UHFFFAOYSA-N 3-chloro-4-methoxyaniline Chemical compound COC1=CC=C(N)C=C1Cl XQVCBOLNTSUFGD-UHFFFAOYSA-N 0.000 description 1
- ROXFFMOUAOVREQ-UHFFFAOYSA-N 3-cyano-n-(3,4-dimethoxyphenyl)-4-(trifluoromethoxy)benzenesulfonamide Chemical compound C1=C(OC)C(OC)=CC=C1NS(=O)(=O)C1=CC=C(OC(F)(F)F)C(C#N)=C1 ROXFFMOUAOVREQ-UHFFFAOYSA-N 0.000 description 1
- DRNAVIIHHMGPTJ-UHFFFAOYSA-N 3-cyano-n-(3,4-dimethoxyphenyl)-4-fluorobenzenesulfonamide Chemical compound C1=C(OC)C(OC)=CC=C1NS(=O)(=O)C1=CC=C(F)C(C#N)=C1 DRNAVIIHHMGPTJ-UHFFFAOYSA-N 0.000 description 1
- QBVLJBATAAGWLC-UHFFFAOYSA-N 3-cyano-n-(3-fluoro-4-methoxyphenyl)-4-(trifluoromethoxy)benzenesulfonamide Chemical compound C1=C(F)C(OC)=CC=C1NS(=O)(=O)C1=CC=C(OC(F)(F)F)C(C#N)=C1 QBVLJBATAAGWLC-UHFFFAOYSA-N 0.000 description 1
- WCNUHUOTUVKUMP-UHFFFAOYSA-N 3-cyano-n-(3-hydroxy-4-methoxyphenyl)-4-(trifluoromethoxy)benzenesulfonamide Chemical compound C1=C(O)C(OC)=CC=C1NS(=O)(=O)C1=CC=C(OC(F)(F)F)C(C#N)=C1 WCNUHUOTUVKUMP-UHFFFAOYSA-N 0.000 description 1
- FLFLCMDIPGQWHT-UHFFFAOYSA-N 3-cyano-n-(4-methoxyphenyl)-4-(trifluoromethoxy)benzenesulfonamide Chemical compound C1=CC(OC)=CC=C1NS(=O)(=O)C1=CC=C(OC(F)(F)F)C(C#N)=C1 FLFLCMDIPGQWHT-UHFFFAOYSA-N 0.000 description 1
- CXLIEEZLDLYSND-UHFFFAOYSA-N 3-cyano-n-[4-(dimethylamino)phenyl]-4-(trifluoromethoxy)benzenesulfonamide Chemical compound C1=CC(N(C)C)=CC=C1NS(=O)(=O)C1=CC=C(OC(F)(F)F)C(C#N)=C1 CXLIEEZLDLYSND-UHFFFAOYSA-N 0.000 description 1
- LJWAPDSCYTZUJU-UHFFFAOYSA-N 3-fluoro-4-methoxyaniline Chemical compound COC1=CC=C(N)C=C1F LJWAPDSCYTZUJU-UHFFFAOYSA-N 0.000 description 1
- 125000003682 3-furyl group Chemical group O1C([H])=C([*])C([H])=C1[H] 0.000 description 1
- 125000003349 3-pyridyl group Chemical group N1=C([H])C([*])=C([H])C([H])=C1[H] 0.000 description 1
- 125000001397 3-pyrrolyl group Chemical group [H]N1C([H])=C([*])C([H])=C1[H] 0.000 description 1
- 125000001541 3-thienyl group Chemical group S1C([H])=C([*])C([H])=C1[H] 0.000 description 1
- NENYNUVEKYVIPB-UHFFFAOYSA-N 4-bromo-2,3,5,6-tetrafluorobenzenesulfonyl chloride Chemical compound FC1=C(F)C(S(Cl)(=O)=O)=C(F)C(F)=C1Br NENYNUVEKYVIPB-UHFFFAOYSA-N 0.000 description 1
- NJPGHLCNGFGWCV-UHFFFAOYSA-N 4-bromo-2,3,5-trifluoro-n-(3-fluoro-4-methoxyphenyl)benzenesulfonamide Chemical compound C1=C(F)C(OC)=CC=C1NS(=O)(=O)C1=CC(F)=C(Br)C(F)=C1F NJPGHLCNGFGWCV-UHFFFAOYSA-N 0.000 description 1
- LWTYSTOCHJQJFX-UHFFFAOYSA-N 4-bromo-2,3,5-trifluoro-n-(3-hydroxy-4-methoxyphenyl)benzenesulfonamide Chemical compound C1=C(O)C(OC)=CC=C1NS(=O)(=O)C1=CC(F)=C(Br)C(F)=C1F LWTYSTOCHJQJFX-UHFFFAOYSA-N 0.000 description 1
- HBORMIVSTQLLES-UHFFFAOYSA-N 4-bromo-2,3,5-trifluoro-n-(4-methoxyphenyl)benzenesulfonamide Chemical compound C1=CC(OC)=CC=C1NS(=O)(=O)C1=CC(F)=C(Br)C(F)=C1F HBORMIVSTQLLES-UHFFFAOYSA-N 0.000 description 1
- YGTAWVDYBKYEBR-UHFFFAOYSA-N 4-bromo-3-cyano-n-(3,4-dimethoxyphenyl)benzenesulfonamide Chemical compound C1=C(OC)C(OC)=CC=C1NS(=O)(=O)C1=CC=C(Br)C(C#N)=C1 YGTAWVDYBKYEBR-UHFFFAOYSA-N 0.000 description 1
- YQEADRLEDOALJS-UHFFFAOYSA-N 4-bromo-3-cyano-n-(3-fluoro-4-methoxyphenyl)benzenesulfonamide Chemical compound C1=C(F)C(OC)=CC=C1NS(=O)(=O)C1=CC=C(Br)C(C#N)=C1 YQEADRLEDOALJS-UHFFFAOYSA-N 0.000 description 1
- CFRVSPCGPDWRBD-UHFFFAOYSA-N 4-bromo-3-cyano-n-(3-hydroxy-4-methoxyphenyl)benzenesulfonamide Chemical compound C1=C(O)C(OC)=CC=C1NS(=O)(=O)C1=CC=C(Br)C(C#N)=C1 CFRVSPCGPDWRBD-UHFFFAOYSA-N 0.000 description 1
- IRMKCYYXGDABSY-UHFFFAOYSA-N 4-bromo-3-cyano-n-(4-methoxyphenyl)benzenesulfonamide Chemical compound C1=CC(OC)=CC=C1NS(=O)(=O)C1=CC=C(Br)C(C#N)=C1 IRMKCYYXGDABSY-UHFFFAOYSA-N 0.000 description 1
- OLHKGYBQAZAXEK-UHFFFAOYSA-N 4-bromo-3-cyano-n-[4-(dimethylamino)phenyl]benzenesulfonamide Chemical compound C1=CC(N(C)C)=CC=C1NS(=O)(=O)C1=CC=C(Br)C(C#N)=C1 OLHKGYBQAZAXEK-UHFFFAOYSA-N 0.000 description 1
- VDGOAZFGSWBXBT-UHFFFAOYSA-N 4-bromo-n-(3,4-dimethoxyphenyl)-2,3,5,6-tetrafluorobenzenesulfonamide Chemical compound C1=C(OC)C(OC)=CC=C1NS(=O)(=O)C1=C(F)C(F)=C(Br)C(F)=C1F VDGOAZFGSWBXBT-UHFFFAOYSA-N 0.000 description 1
- BCSHHEPSTQQXHU-UHFFFAOYSA-N 4-bromo-n-(3,4-dimethoxyphenyl)-2,3,5-trifluorobenzenesulfonamide Chemical compound C1=C(OC)C(OC)=CC=C1NS(=O)(=O)C1=CC(F)=C(Br)C(F)=C1F BCSHHEPSTQQXHU-UHFFFAOYSA-N 0.000 description 1
- QLXJAMLIMRFEJJ-UHFFFAOYSA-N 4-bromo-n-(3,4-dimethoxyphenyl)-3-nitrobenzenesulfonamide Chemical compound C1=C(OC)C(OC)=CC=C1NS(=O)(=O)C1=CC=C(Br)C([N+]([O-])=O)=C1 QLXJAMLIMRFEJJ-UHFFFAOYSA-N 0.000 description 1
- BVRSYLSTJVXSAQ-UHFFFAOYSA-N 4-bromo-n-(3-fluoro-4-methoxyphenyl)-3-nitrobenzenesulfonamide Chemical compound C1=C(F)C(OC)=CC=C1NS(=O)(=O)C1=CC=C(Br)C([N+]([O-])=O)=C1 BVRSYLSTJVXSAQ-UHFFFAOYSA-N 0.000 description 1
- HMLJOMYNFYOAFY-UHFFFAOYSA-N 4-bromo-n-(3-hydroxy-4-methoxyphenyl)-3-nitrobenzenesulfonamide Chemical compound C1=C(O)C(OC)=CC=C1NS(=O)(=O)C1=CC=C(Br)C([N+]([O-])=O)=C1 HMLJOMYNFYOAFY-UHFFFAOYSA-N 0.000 description 1
- MZMBDAIFEPVKLN-UHFFFAOYSA-N 4-bromo-n-(4-methoxyphenyl)-3-nitrobenzenesulfonamide Chemical compound C1=CC(OC)=CC=C1NS(=O)(=O)C1=CC=C(Br)C([N+]([O-])=O)=C1 MZMBDAIFEPVKLN-UHFFFAOYSA-N 0.000 description 1
- IXYABTADRMSBNC-UHFFFAOYSA-N 4-bromo-n-[4-(dimethylamino)phenyl]-2,3,5,6-tetrafluorobenzenesulfonamide Chemical compound C1=CC(N(C)C)=CC=C1NS(=O)(=O)C1=C(F)C(F)=C(Br)C(F)=C1F IXYABTADRMSBNC-UHFFFAOYSA-N 0.000 description 1
- DQMVXLIMBAOSHJ-UHFFFAOYSA-N 4-bromo-n-[4-(dimethylamino)phenyl]-2,3,5-trifluorobenzenesulfonamide Chemical compound C1=CC(N(C)C)=CC=C1NS(=O)(=O)C1=CC(F)=C(Br)C(F)=C1F DQMVXLIMBAOSHJ-UHFFFAOYSA-N 0.000 description 1
- JJFQLVHULQCQRF-UHFFFAOYSA-N 4-bromo-n-[4-(dimethylamino)phenyl]-3-nitrobenzenesulfonamide Chemical compound C1=CC(N(C)C)=CC=C1NS(=O)(=O)C1=CC=C(Br)C([N+]([O-])=O)=C1 JJFQLVHULQCQRF-UHFFFAOYSA-N 0.000 description 1
- SDSAPRHTHABGDY-UHFFFAOYSA-N 4-chloro-2,3,5,6-tetrafluorobenzenesulfonyl chloride Chemical compound FC1=C(F)C(S(Cl)(=O)=O)=C(F)C(F)=C1Cl SDSAPRHTHABGDY-UHFFFAOYSA-N 0.000 description 1
- ITKPYFAMBCMGQH-UHFFFAOYSA-N 4-chloro-2,3,5-trifluoro-n-(3-fluoro-4-methoxyphenyl)benzenesulfonamide Chemical compound C1=C(F)C(OC)=CC=C1NS(=O)(=O)C1=CC(F)=C(Cl)C(F)=C1F ITKPYFAMBCMGQH-UHFFFAOYSA-N 0.000 description 1
- JVCGJYIBSYYQQV-UHFFFAOYSA-N 4-chloro-2,3,5-trifluoro-n-(3-hydroxy-4-methoxyphenyl)benzenesulfonamide Chemical compound C1=C(O)C(OC)=CC=C1NS(=O)(=O)C1=CC(F)=C(Cl)C(F)=C1F JVCGJYIBSYYQQV-UHFFFAOYSA-N 0.000 description 1
- JLRDZZSDWCODTE-UHFFFAOYSA-N 4-chloro-2,3,5-trifluoro-n-(4-methoxyphenyl)benzenesulfonamide Chemical compound C1=CC(OC)=CC=C1NS(=O)(=O)C1=CC(F)=C(Cl)C(F)=C1F JLRDZZSDWCODTE-UHFFFAOYSA-N 0.000 description 1
- OILVNLRSJZVLGC-UHFFFAOYSA-N 4-chloro-3-cyano-n-(3,4-dimethoxyphenyl)benzenesulfonamide Chemical compound C1=C(OC)C(OC)=CC=C1NS(=O)(=O)C1=CC=C(Cl)C(C#N)=C1 OILVNLRSJZVLGC-UHFFFAOYSA-N 0.000 description 1
- SDQQFUHZJVEGJZ-UHFFFAOYSA-N 4-chloro-3-cyano-n-[4-(dimethylamino)phenyl]benzenesulfonamide Chemical compound C1=CC(N(C)C)=CC=C1NS(=O)(=O)C1=CC=C(Cl)C(C#N)=C1 SDQQFUHZJVEGJZ-UHFFFAOYSA-N 0.000 description 1
- RXHQROYVYZQDRL-UHFFFAOYSA-N 4-chloro-n-(3,4-dimethoxyphenyl)-2,3,5,6-tetrafluorobenzenesulfonamide Chemical compound C1=C(OC)C(OC)=CC=C1NS(=O)(=O)C1=C(F)C(F)=C(Cl)C(F)=C1F RXHQROYVYZQDRL-UHFFFAOYSA-N 0.000 description 1
- ZDQZOQPJNDXFBT-UHFFFAOYSA-N 4-chloro-n-(3,4-dimethoxyphenyl)-2,3,5-trifluorobenzenesulfonamide Chemical compound C1=C(OC)C(OC)=CC=C1NS(=O)(=O)C1=CC(F)=C(Cl)C(F)=C1F ZDQZOQPJNDXFBT-UHFFFAOYSA-N 0.000 description 1
- VECXZRAVCCVMMM-UHFFFAOYSA-N 4-chloro-n-(3,4-dimethoxyphenyl)-3-nitrobenzenesulfonamide Chemical compound C1=C(OC)C(OC)=CC=C1NS(=O)(=O)C1=CC=C(Cl)C([N+]([O-])=O)=C1 VECXZRAVCCVMMM-UHFFFAOYSA-N 0.000 description 1
- HQMPUGJFXMKKQG-UHFFFAOYSA-N 4-chloro-n-[4-(dimethylamino)phenyl]-2,3,5,6-tetrafluorobenzenesulfonamide Chemical compound C1=CC(N(C)C)=CC=C1NS(=O)(=O)C1=C(F)C(F)=C(Cl)C(F)=C1F HQMPUGJFXMKKQG-UHFFFAOYSA-N 0.000 description 1
- CYEDPCHLRVYTPO-UHFFFAOYSA-N 4-chloro-n-[4-(dimethylamino)phenyl]-2,3,5-trifluorobenzenesulfonamide Chemical compound C1=CC(N(C)C)=CC=C1NS(=O)(=O)C1=CC(F)=C(Cl)C(F)=C1F CYEDPCHLRVYTPO-UHFFFAOYSA-N 0.000 description 1
- ZHIBDXKXHQKCIS-UHFFFAOYSA-N 4-chloro-n-[4-(dimethylamino)phenyl]-3-nitrobenzenesulfonamide Chemical compound C1=CC(N(C)C)=CC=C1NS(=O)(=O)C1=CC=C(Cl)C([N+]([O-])=O)=C1 ZHIBDXKXHQKCIS-UHFFFAOYSA-N 0.000 description 1
- 125000000339 4-pyridyl group Chemical group N1=C([H])C([H])=C([*])C([H])=C1[H] 0.000 description 1
- KDDQRKBRJSGMQE-UHFFFAOYSA-N 4-thiazolyl Chemical group [C]1=CSC=N1 KDDQRKBRJSGMQE-UHFFFAOYSA-N 0.000 description 1
- QNDSWUGMAGXGHB-UHFFFAOYSA-N 5-[(3,4-dimethoxyphenyl)sulfamoyl]-2,3,4-trifluorobenzoic acid Chemical compound C1=C(OC)C(OC)=CC=C1NS(=O)(=O)C1=CC(C(O)=O)=C(F)C(F)=C1F QNDSWUGMAGXGHB-UHFFFAOYSA-N 0.000 description 1
- RJQNZBKNPDZAAQ-UHFFFAOYSA-N 5-[[4-(dimethylamino)phenyl]sulfamoyl]-2,3,4-trifluorobenzoic acid Chemical compound C1=CC(N(C)C)=CC=C1NS(=O)(=O)C1=CC(C(O)=O)=C(F)C(F)=C1F RJQNZBKNPDZAAQ-UHFFFAOYSA-N 0.000 description 1
- JPWPTHYAXFJZEX-UHFFFAOYSA-N 5-bromo-2,3,4-trifluorobenzenesulfonyl chloride Chemical compound FC1=C(F)C(Br)=CC(S(Cl)(=O)=O)=C1F JPWPTHYAXFJZEX-UHFFFAOYSA-N 0.000 description 1
- XVEPWYUGOXMVJU-UHFFFAOYSA-N 5-bromo-n-(3,4-dimethoxyphenyl)-2,3,4-trifluorobenzenesulfonamide Chemical compound C1=C(OC)C(OC)=CC=C1NS(=O)(=O)C1=CC(Br)=C(F)C(F)=C1F XVEPWYUGOXMVJU-UHFFFAOYSA-N 0.000 description 1
- CWDWFSXUQODZGW-UHFFFAOYSA-N 5-thiazolyl Chemical group [C]1=CN=CS1 CWDWFSXUQODZGW-UHFFFAOYSA-N 0.000 description 1
- QGZKDVFQNNGYKY-UHFFFAOYSA-O Ammonium Chemical compound [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 description 1
- 208000023275 Autoimmune disease Diseases 0.000 description 1
- 241000894006 Bacteria Species 0.000 description 1
- 208000035143 Bacterial infection Diseases 0.000 description 1
- LSNNMFCWUKXFEE-UHFFFAOYSA-M Bisulfite Chemical compound OS([O-])=O LSNNMFCWUKXFEE-UHFFFAOYSA-M 0.000 description 1
- COVZYZSDYWQREU-UHFFFAOYSA-N Busulfan Chemical compound CS(=O)(=O)OCCCCOS(C)(=O)=O COVZYZSDYWQREU-UHFFFAOYSA-N 0.000 description 1
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 1
- KZBUYRJDOAKODT-UHFFFAOYSA-N Chlorine Chemical compound ClCl KZBUYRJDOAKODT-UHFFFAOYSA-N 0.000 description 1
- 208000035473 Communicable disease Diseases 0.000 description 1
- 239000012624 DNA alkylating agent Substances 0.000 description 1
- 229940122029 DNA synthesis inhibitor Drugs 0.000 description 1
- 101100441092 Danio rerio crlf3 gene Proteins 0.000 description 1
- 206010012455 Dermatitis exfoliative Diseases 0.000 description 1
- VYZAHLCBVHPDDF-UHFFFAOYSA-N Dinitrochlorobenzene Chemical compound [O-][N+](=O)C1=CC=C(Cl)C([N+]([O-])=O)=C1 VYZAHLCBVHPDDF-UHFFFAOYSA-N 0.000 description 1
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 description 1
- GHASVSINZRGABV-UHFFFAOYSA-N Fluorouracil Chemical compound FC1=CNC(=O)NC1=O GHASVSINZRGABV-UHFFFAOYSA-N 0.000 description 1
- 229940123414 Folate antagonist Drugs 0.000 description 1
- 241000233866 Fungi Species 0.000 description 1
- 108010010803 Gelatin Proteins 0.000 description 1
- 241000026944 Giovanella Species 0.000 description 1
- 206010018364 Glomerulonephritis Diseases 0.000 description 1
- 208000031886 HIV Infections Diseases 0.000 description 1
- 208000037357 HIV infectious disease Diseases 0.000 description 1
- 241000282412 Homo Species 0.000 description 1
- WHXSMMKQMYFTQS-UHFFFAOYSA-N Lithium Chemical compound [Li] WHXSMMKQMYFTQS-UHFFFAOYSA-N 0.000 description 1
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 1
- 206010027476 Metastases Diseases 0.000 description 1
- 241000699670 Mus sp. Species 0.000 description 1
- ZDZOTLJHXYCWBA-VCVYQWHSSA-N N-debenzoyl-N-(tert-butoxycarbonyl)-10-deacetyltaxol Chemical compound O([C@H]1[C@H]2[C@@](C([C@H](O)C3=C(C)[C@@H](OC(=O)[C@H](O)[C@@H](NC(=O)OC(C)(C)C)C=4C=CC=CC=4)C[C@]1(O)C3(C)C)=O)(C)[C@@H](O)C[C@H]1OC[C@]12OC(=O)C)C(=O)C1=CC=CC=C1 ZDZOTLJHXYCWBA-VCVYQWHSSA-N 0.000 description 1
- 238000005481 NMR spectroscopy Methods 0.000 description 1
- IOVCWXUNBOPUCH-UHFFFAOYSA-M Nitrite anion Chemical compound [O-]N=O IOVCWXUNBOPUCH-UHFFFAOYSA-M 0.000 description 1
- 229910019213 POCl3 Inorganic materials 0.000 description 1
- NBIIXXVUZAFLBC-UHFFFAOYSA-L Phosphate ion(2-) Chemical compound OP([O-])([O-])=O NBIIXXVUZAFLBC-UHFFFAOYSA-L 0.000 description 1
- 201000001263 Psoriatic Arthritis Diseases 0.000 description 1
- 208000036824 Psoriatic arthropathy Diseases 0.000 description 1
- 206010037575 Pustular psoriasis Diseases 0.000 description 1
- 206010039509 Scab Diseases 0.000 description 1
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical class [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 1
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 1
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 1
- 244000299461 Theobroma cacao Species 0.000 description 1
- 206010052779 Transplant rejections Diseases 0.000 description 1
- DTQVDTLACAAQTR-UHFFFAOYSA-M Trifluoroacetate Chemical compound [O-]C(=O)C(F)(F)F DTQVDTLACAAQTR-UHFFFAOYSA-M 0.000 description 1
- 102000004243 Tubulin Human genes 0.000 description 1
- 108090000704 Tubulin Proteins 0.000 description 1
- 208000036142 Viral infection Diseases 0.000 description 1
- 238000005263 ab initio calculation Methods 0.000 description 1
- 238000010521 absorption reaction Methods 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- 239000002671 adjuvant Substances 0.000 description 1
- 229940009456 adriamycin Drugs 0.000 description 1
- 230000002411 adverse Effects 0.000 description 1
- 150000001335 aliphatic alkanes Chemical class 0.000 description 1
- 150000001336 alkenes Chemical class 0.000 description 1
- 125000003342 alkenyl group Chemical group 0.000 description 1
- 125000003545 alkoxy group Chemical group 0.000 description 1
- 125000002947 alkylene group Chemical group 0.000 description 1
- 125000000304 alkynyl group Chemical group 0.000 description 1
- HSFWRNGVRCDJHI-UHFFFAOYSA-N alpha-acetylene Natural products C#C HSFWRNGVRCDJHI-UHFFFAOYSA-N 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- 150000001413 amino acids Chemical class 0.000 description 1
- 238000010171 animal model Methods 0.000 description 1
- 230000000118 anti-neoplastic effect Effects 0.000 description 1
- 229940041181 antineoplastic drug Drugs 0.000 description 1
- 125000006615 aromatic heterocyclic group Chemical group 0.000 description 1
- 238000007080 aromatic substitution reaction Methods 0.000 description 1
- 150000001503 aryl iodides Chemical class 0.000 description 1
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 1
- 125000000852 azido group Chemical group *N=[N+]=[N-] 0.000 description 1
- 208000022362 bacterial infectious disease Diseases 0.000 description 1
- 230000004888 barrier function Effects 0.000 description 1
- 125000002619 bicyclic group Chemical group 0.000 description 1
- 230000004071 biological effect Effects 0.000 description 1
- 150000001649 bromium compounds Chemical class 0.000 description 1
- 210000001217 buttock Anatomy 0.000 description 1
- 239000011575 calcium Substances 0.000 description 1
- 229910052791 calcium Inorganic materials 0.000 description 1
- 150000001721 carbon Chemical group 0.000 description 1
- 239000011203 carbon fibre reinforced carbon Substances 0.000 description 1
- 210000004413 cardiac myocyte Anatomy 0.000 description 1
- 239000003054 catalyst Substances 0.000 description 1
- 230000003197 catalytic effect Effects 0.000 description 1
- 238000004113 cell culture Methods 0.000 description 1
- 230000036978 cell physiology Effects 0.000 description 1
- 230000001413 cellular effect Effects 0.000 description 1
- 230000019522 cellular metabolic process Effects 0.000 description 1
- 208000019065 cervical carcinoma Diseases 0.000 description 1
- 239000003610 charcoal Substances 0.000 description 1
- 239000003153 chemical reaction reagent Substances 0.000 description 1
- 238000002512 chemotherapy Methods 0.000 description 1
- 239000012320 chlorinating reagent Substances 0.000 description 1
- 235000019219 chocolate Nutrition 0.000 description 1
- 230000001684 chronic effect Effects 0.000 description 1
- 229960001338 colchicine Drugs 0.000 description 1
- 239000003246 corticosteroid Substances 0.000 description 1
- 229960001334 corticosteroids Drugs 0.000 description 1
- 230000008878 coupling Effects 0.000 description 1
- 238000010168 coupling process Methods 0.000 description 1
- 238000005859 coupling reaction Methods 0.000 description 1
- 239000006071 cream Substances 0.000 description 1
- 238000002425 crystallisation Methods 0.000 description 1
- 230000008025 crystallization Effects 0.000 description 1
- WZHCOOQXZCIUNC-UHFFFAOYSA-N cyclandelate Chemical compound C1C(C)(C)CC(C)CC1OC(=O)C(O)C1=CC=CC=C1 WZHCOOQXZCIUNC-UHFFFAOYSA-N 0.000 description 1
- 125000000582 cycloheptyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- 125000001511 cyclopentyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- 230000002074 deregulated effect Effects 0.000 description 1
- 238000009795 derivation Methods 0.000 description 1
- 238000011161 development Methods 0.000 description 1
- 238000006193 diazotization reaction Methods 0.000 description 1
- 239000003085 diluting agent Substances 0.000 description 1
- 238000006073 displacement reaction Methods 0.000 description 1
- 238000009826 distribution Methods 0.000 description 1
- 229960003668 docetaxel Drugs 0.000 description 1
- 229960004679 doxorubicin Drugs 0.000 description 1
- 239000008298 dragée Substances 0.000 description 1
- 210000001513 elbow Anatomy 0.000 description 1
- 238000003379 elimination reaction Methods 0.000 description 1
- 210000002615 epidermis Anatomy 0.000 description 1
- 210000002919 epithelial cell Anatomy 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 125000002534 ethynyl group Chemical group [H]C#C* 0.000 description 1
- 238000011156 evaluation Methods 0.000 description 1
- 208000004526 exfoliative dermatitis Diseases 0.000 description 1
- 239000000284 extract Substances 0.000 description 1
- 210000004709 eyebrow Anatomy 0.000 description 1
- 239000000706 filtrate Substances 0.000 description 1
- 239000011737 fluorine Substances 0.000 description 1
- 125000001153 fluoro group Chemical group F* 0.000 description 1
- 229960002949 fluorouracil Drugs 0.000 description 1
- 239000004052 folic acid antagonist Substances 0.000 description 1
- 239000012634 fragment Substances 0.000 description 1
- 239000007789 gas Substances 0.000 description 1
- 239000008273 gelatin Substances 0.000 description 1
- 229920000159 gelatin Polymers 0.000 description 1
- 235000019322 gelatine Nutrition 0.000 description 1
- 235000011852 gelatine desserts Nutrition 0.000 description 1
- 210000004392 genitalia Anatomy 0.000 description 1
- 239000012362 glacial acetic acid Substances 0.000 description 1
- 210000003904 glomerular cell Anatomy 0.000 description 1
- 230000005484 gravity Effects 0.000 description 1
- 125000005843 halogen group Chemical group 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 125000004474 heteroalkylene group Chemical group 0.000 description 1
- 238000001794 hormone therapy Methods 0.000 description 1
- 208000033519 human immunodeficiency virus infectious disease Diseases 0.000 description 1
- 229960001101 ifosfamide Drugs 0.000 description 1
- HOMGKSMUEGBAAB-UHFFFAOYSA-N ifosfamide Chemical compound ClCCNP1(=O)OCCCN1CCCl HOMGKSMUEGBAAB-UHFFFAOYSA-N 0.000 description 1
- 210000002865 immune cell Anatomy 0.000 description 1
- 238000001727 in vivo Methods 0.000 description 1
- 239000012678 infectious agent Substances 0.000 description 1
- 210000004969 inflammatory cell Anatomy 0.000 description 1
- 230000004968 inflammatory condition Effects 0.000 description 1
- 230000002401 inhibitory effect Effects 0.000 description 1
- 230000003993 interaction Effects 0.000 description 1
- 238000007918 intramuscular administration Methods 0.000 description 1
- 238000001990 intravenous administration Methods 0.000 description 1
- 150000002500 ions Chemical class 0.000 description 1
- 230000002427 irreversible effect Effects 0.000 description 1
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 230000000155 isotopic effect Effects 0.000 description 1
- 210000002510 keratinocyte Anatomy 0.000 description 1
- 210000003292 kidney cell Anatomy 0.000 description 1
- 210000003127 knee Anatomy 0.000 description 1
- 125000005647 linker group Chemical group 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 159000000003 magnesium salts Chemical class 0.000 description 1
- 201000004792 malaria Diseases 0.000 description 1
- 239000003550 marker Substances 0.000 description 1
- 238000004949 mass spectrometry Methods 0.000 description 1
- 238000001819 mass spectrum Methods 0.000 description 1
- 239000002609 medium Substances 0.000 description 1
- 229910052751 metal Inorganic materials 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- 150000007522 mineralic acids Chemical class 0.000 description 1
- 125000002950 monocyclic group Chemical group 0.000 description 1
- 125000004572 morpholin-3-yl group Chemical group N1C(COCC1)* 0.000 description 1
- 125000004573 morpholin-4-yl group Chemical group N1(CCOCC1)* 0.000 description 1
- 208000010125 myocardial infarction Diseases 0.000 description 1
- ZTFANDLOWOQSPC-UHFFFAOYSA-N n-(3,4-dimethoxyphenyl)-2,3,4,5-tetrafluorobenzenesulfonamide Chemical compound C1=C(OC)C(OC)=CC=C1NS(=O)(=O)C1=CC(F)=C(F)C(F)=C1F ZTFANDLOWOQSPC-UHFFFAOYSA-N 0.000 description 1
- FEKVRRGYZMDXPK-UHFFFAOYSA-N n-(3,4-dimethoxyphenyl)-2,3,5,6-tetrafluoro-4-(trifluoromethoxy)benzenesulfonamide Chemical compound C1=C(OC)C(OC)=CC=C1NS(=O)(=O)C1=C(F)C(F)=C(OC(F)(F)F)C(F)=C1F FEKVRRGYZMDXPK-UHFFFAOYSA-N 0.000 description 1
- ZDTIDINXAXVAGN-UHFFFAOYSA-N n-(3,4-dimethoxyphenyl)-2,3,5-trifluoro-4-(trifluoromethoxy)benzenesulfonamide Chemical compound C1=C(OC)C(OC)=CC=C1NS(=O)(=O)C1=CC(F)=C(OC(F)(F)F)C(F)=C1F ZDTIDINXAXVAGN-UHFFFAOYSA-N 0.000 description 1
- DTTCEAMBTOMSQU-UHFFFAOYSA-N n-(3,4-dimethoxyphenyl)-3,4,5-trifluorobenzenesulfonamide Chemical compound C1=C(OC)C(OC)=CC=C1NS(=O)(=O)C1=CC(F)=C(F)C(F)=C1 DTTCEAMBTOMSQU-UHFFFAOYSA-N 0.000 description 1
- HRGJLHLAYOURMR-UHFFFAOYSA-N n-(3,4-dimethoxyphenyl)-3-nitro-4-(trifluoromethoxy)benzenesulfonamide Chemical compound C1=C(OC)C(OC)=CC=C1NS(=O)(=O)C1=CC=C(OC(F)(F)F)C([N+]([O-])=O)=C1 HRGJLHLAYOURMR-UHFFFAOYSA-N 0.000 description 1
- OIIBQIPDIYGJTQ-UHFFFAOYSA-N n-(3-fluoro-4-methoxyphenyl)-3-nitro-4-(trifluoromethoxy)benzenesulfonamide Chemical compound C1=C(F)C(OC)=CC=C1NS(=O)(=O)C1=CC=C(OC(F)(F)F)C([N+]([O-])=O)=C1 OIIBQIPDIYGJTQ-UHFFFAOYSA-N 0.000 description 1
- AQAMYBLSOUAWLZ-UHFFFAOYSA-N n-(3-fluoro-4-methoxyphenyl)-3-nitro-4-(trifluoromethylsulfonylamino)benzenesulfonamide Chemical compound C1=C(F)C(OC)=CC=C1NS(=O)(=O)C1=CC=C(NS(=O)(=O)C(F)(F)F)C([N+]([O-])=O)=C1 AQAMYBLSOUAWLZ-UHFFFAOYSA-N 0.000 description 1
- AGTXCOQWPYNWDF-UHFFFAOYSA-N n-(3-hydroxy-4-methoxyphenyl)-3-nitro-4-(trifluoromethoxy)benzenesulfonamide Chemical compound C1=C(O)C(OC)=CC=C1NS(=O)(=O)C1=CC=C(OC(F)(F)F)C([N+]([O-])=O)=C1 AGTXCOQWPYNWDF-UHFFFAOYSA-N 0.000 description 1
- VUWRCWXWQBTFRU-UHFFFAOYSA-N n-(3-hydroxy-4-methoxyphenyl)-3-nitro-4-(trifluoromethylsulfonylamino)benzenesulfonamide Chemical compound C1=C(O)C(OC)=CC=C1NS(=O)(=O)C1=CC=C(NS(=O)(=O)C(F)(F)F)C([N+]([O-])=O)=C1 VUWRCWXWQBTFRU-UHFFFAOYSA-N 0.000 description 1
- FLNUTAKRNHKNCQ-UHFFFAOYSA-N n-(4-aminophenyl)-3,4-difluoro-5-nitrobenzenesulfonamide Chemical compound C1=CC(N)=CC=C1NS(=O)(=O)C1=CC(F)=C(F)C([N+]([O-])=O)=C1 FLNUTAKRNHKNCQ-UHFFFAOYSA-N 0.000 description 1
- IYIKRKRESAIXHQ-UHFFFAOYSA-N n-(4-aminophenyl)-4-fluoro-3-nitrobenzenesulfonamide Chemical compound C1=CC(N)=CC=C1NS(=O)(=O)C1=CC=C(F)C([N+]([O-])=O)=C1 IYIKRKRESAIXHQ-UHFFFAOYSA-N 0.000 description 1
- BJJPVOZBTJYQQY-UHFFFAOYSA-N n-(4-methoxyphenyl)-3-nitro-4-(trifluoromethoxy)benzenesulfonamide Chemical compound C1=CC(OC)=CC=C1NS(=O)(=O)C1=CC=C(OC(F)(F)F)C([N+]([O-])=O)=C1 BJJPVOZBTJYQQY-UHFFFAOYSA-N 0.000 description 1
- NVEQEBWRWGITKR-UHFFFAOYSA-N n-(4-methoxyphenyl)-3-nitro-4-(trifluoromethylsulfonylamino)benzenesulfonamide Chemical compound C1=CC(OC)=CC=C1NS(=O)(=O)C1=CC=C(NS(=O)(=O)C(F)(F)F)C([N+]([O-])=O)=C1 NVEQEBWRWGITKR-UHFFFAOYSA-N 0.000 description 1
- IUERVNVXNGPCBB-UHFFFAOYSA-N n-[4-(dimethylamino)phenyl]-2,3,4,5-tetrafluorobenzenesulfonamide Chemical compound C1=CC(N(C)C)=CC=C1NS(=O)(=O)C1=CC(F)=C(F)C(F)=C1F IUERVNVXNGPCBB-UHFFFAOYSA-N 0.000 description 1
- QJTRAYDOBLCRMH-UHFFFAOYSA-N n-[4-(dimethylamino)phenyl]-2,3,5,6-tetrafluoro-4-(trifluoromethoxy)benzenesulfonamide Chemical compound C1=CC(N(C)C)=CC=C1NS(=O)(=O)C1=C(F)C(F)=C(OC(F)(F)F)C(F)=C1F QJTRAYDOBLCRMH-UHFFFAOYSA-N 0.000 description 1
- PDSDYZIRVDPYQV-UHFFFAOYSA-N n-[4-(dimethylamino)phenyl]-2,3,5-trifluoro-4-(trifluoromethoxy)benzenesulfonamide Chemical compound C1=CC(N(C)C)=CC=C1NS(=O)(=O)C1=CC(F)=C(OC(F)(F)F)C(F)=C1F PDSDYZIRVDPYQV-UHFFFAOYSA-N 0.000 description 1
- WXQSLAAJCUXBKF-UHFFFAOYSA-N n-[4-(dimethylamino)phenyl]-3,4,5-trifluorobenzenesulfonamide Chemical compound C1=CC(N(C)C)=CC=C1NS(=O)(=O)C1=CC(F)=C(F)C(F)=C1 WXQSLAAJCUXBKF-UHFFFAOYSA-N 0.000 description 1
- JKBURHGBOJYKRW-UHFFFAOYSA-N n-[4-(dimethylamino)phenyl]-3,4-difluoro-5-nitrobenzenesulfonamide Chemical compound C1=CC(N(C)C)=CC=C1NS(=O)(=O)C1=CC(F)=C(F)C([N+]([O-])=O)=C1 JKBURHGBOJYKRW-UHFFFAOYSA-N 0.000 description 1
- YRROBJUWLVFNEZ-UHFFFAOYSA-N n-[4-(dimethylamino)phenyl]-3-nitro-4-(trifluoromethoxy)benzenesulfonamide Chemical compound C1=CC(N(C)C)=CC=C1NS(=O)(=O)C1=CC=C(OC(F)(F)F)C([N+]([O-])=O)=C1 YRROBJUWLVFNEZ-UHFFFAOYSA-N 0.000 description 1
- HWMJPPODPDDSGB-UHFFFAOYSA-N n-[4-(dimethylamino)phenyl]-4-fluoro-3-nitrobenzenesulfonamide Chemical compound C1=CC(N(C)C)=CC=C1NS(=O)(=O)C1=CC=C(F)C([N+]([O-])=O)=C1 HWMJPPODPDDSGB-UHFFFAOYSA-N 0.000 description 1
- MBGDIAAXPUDULI-UHFFFAOYSA-N n-acetyl-n-[2,3-difluoro-4-[(3-fluoro-4-methoxyphenyl)sulfamoyl]-6-nitrophenyl]acetamide Chemical compound C1=C(F)C(OC)=CC=C1NS(=O)(=O)C1=CC([N+]([O-])=O)=C(N(C(C)=O)C(C)=O)C(F)=C1F MBGDIAAXPUDULI-UHFFFAOYSA-N 0.000 description 1
- 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000001280 n-hexyl group Chemical class C(CCCCC)* 0.000 description 1
- 125000000740 n-pentyl group Chemical class [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 210000000282 nail Anatomy 0.000 description 1
- 230000001613 neoplastic effect Effects 0.000 description 1
- 239000012299 nitrogen atmosphere Substances 0.000 description 1
- 125000004433 nitrogen atom Chemical group N* 0.000 description 1
- 239000012038 nucleophile Substances 0.000 description 1
- 230000003287 optical effect Effects 0.000 description 1
- 238000005457 optimization Methods 0.000 description 1
- 210000000056 organ Anatomy 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- 230000003647 oxidation Effects 0.000 description 1
- 238000007254 oxidation reaction Methods 0.000 description 1
- 239000001301 oxygen Substances 0.000 description 1
- 125000004430 oxygen atom Chemical group O* 0.000 description 1
- 229910052763 palladium Inorganic materials 0.000 description 1
- 244000045947 parasite Species 0.000 description 1
- 230000007170 pathology Effects 0.000 description 1
- 239000002831 pharmacologic agent Substances 0.000 description 1
- OJMIONKXNSYLSR-UHFFFAOYSA-N phosphorous acid Chemical class OP(O)O OJMIONKXNSYLSR-UHFFFAOYSA-N 0.000 description 1
- 230000000704 physical effect Effects 0.000 description 1
- 125000000587 piperidin-1-yl group Chemical group [H]C1([H])N(*)C([H])([H])C([H])([H])C([H])([H])C1([H])[H] 0.000 description 1
- 125000004483 piperidin-3-yl group Chemical group N1CC(CCC1)* 0.000 description 1
- 239000002798 polar solvent Substances 0.000 description 1
- 229940124606 potential therapeutic agent Drugs 0.000 description 1
- 230000003389 potentiating effect Effects 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- 239000002243 precursor Substances 0.000 description 1
- 238000002360 preparation method Methods 0.000 description 1
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 1
- 230000008569 process Effects 0.000 description 1
- 239000000047 product Substances 0.000 description 1
- 230000002035 prolonged effect Effects 0.000 description 1
- 125000004368 propenyl group Chemical group C(=CC)* 0.000 description 1
- 230000000069 prophylactic effect Effects 0.000 description 1
- 238000000425 proton nuclear magnetic resonance spectrum Methods 0.000 description 1
- 230000001185 psoriatic effect Effects 0.000 description 1
- 125000000561 purinyl group Chemical group N1=C(N=C2N=CNC2=C1)* 0.000 description 1
- 125000003373 pyrazinyl group Chemical group 0.000 description 1
- 239000003790 pyrimidine antagonist Substances 0.000 description 1
- 239000002287 radioligand Substances 0.000 description 1
- 238000007127 saponification reaction Methods 0.000 description 1
- 239000012047 saturated solution Substances 0.000 description 1
- 210000004761 scalp Anatomy 0.000 description 1
- 125000002914 sec-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 239000000377 silicon dioxide Substances 0.000 description 1
- 239000011780 sodium chloride Substances 0.000 description 1
- 229910052979 sodium sulfide Inorganic materials 0.000 description 1
- GRVFOGOEDUUMBP-UHFFFAOYSA-N sodium sulfide (anhydrous) Chemical compound [Na+].[Na+].[S-2] GRVFOGOEDUUMBP-UHFFFAOYSA-N 0.000 description 1
- 239000007921 spray Substances 0.000 description 1
- 239000003381 stabilizer Substances 0.000 description 1
- 238000010561 standard procedure Methods 0.000 description 1
- 125000001010 sulfinic acid amide group Chemical group 0.000 description 1
- 238000006277 sulfonation reaction Methods 0.000 description 1
- 239000011593 sulfur Substances 0.000 description 1
- 239000000829 suppository Substances 0.000 description 1
- 239000003826 tablet Substances 0.000 description 1
- 230000008685 targeting Effects 0.000 description 1
- LMBFAGIMSUYTBN-MPZNNTNKSA-N teixobactin Chemical compound C([C@H](C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H](CCC(N)=O)C(=O)N[C@H]([C@@H](C)CC)C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H]1C(N[C@@H](C)C(=O)N[C@@H](C[C@@H]2NC(=N)NC2)C(=O)N[C@H](C(=O)O[C@H]1C)[C@@H](C)CC)=O)NC)C1=CC=CC=C1 LMBFAGIMSUYTBN-MPZNNTNKSA-N 0.000 description 1
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 125000004192 tetrahydrofuran-2-yl group Chemical group [H]C1([H])OC([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- 229940124597 therapeutic agent Drugs 0.000 description 1
- 150000003568 thioethers Chemical class 0.000 description 1
- 125000003396 thiol group Chemical group [H]S* 0.000 description 1
- 150000007944 thiolates Chemical class 0.000 description 1
- 231100000331 toxic Toxicity 0.000 description 1
- 230000002588 toxic effect Effects 0.000 description 1
- 230000007704 transition Effects 0.000 description 1
- GETQZCLCWQTVFV-UHFFFAOYSA-N trimethylamine Chemical compound CN(C)C GETQZCLCWQTVFV-UHFFFAOYSA-N 0.000 description 1
- 210000004509 vascular smooth muscle cell Anatomy 0.000 description 1
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 description 1
- 229920002554 vinyl polymer Polymers 0.000 description 1
- 230000009385 viral infection Effects 0.000 description 1
- 239000012991 xanthate Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C311/00—Amides of sulfonic acids, i.e. compounds having singly-bound oxygen atoms of sulfo groups replaced by nitrogen atoms, not being part of nitro or nitroso groups
- C07C311/15—Sulfonamides having sulfur atoms of sulfonamide groups bound to carbon atoms of six-membered aromatic rings
- C07C311/21—Sulfonamides having sulfur atoms of sulfonamide groups bound to carbon atoms of six-membered aromatic rings having the nitrogen atom of at least one of the sulfonamide groups bound to a carbon atom of a six-membered aromatic ring
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P3/00—Drugs for disorders of the metabolism
- A61P3/06—Antihyperlipidemics
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P35/00—Antineoplastic agents
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Health & Medical Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- General Chemical & Material Sciences (AREA)
- Medicinal Chemistry (AREA)
- Nuclear Medicine, Radiotherapy & Molecular Imaging (AREA)
- Pharmacology & Pharmacy (AREA)
- Life Sciences & Earth Sciences (AREA)
- Animal Behavior & Ethology (AREA)
- General Health & Medical Sciences (AREA)
- Public Health (AREA)
- Veterinary Medicine (AREA)
- Engineering & Computer Science (AREA)
- Bioinformatics & Cheminformatics (AREA)
- Diabetes (AREA)
- Hematology (AREA)
- Obesity (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Acyclic And Carbocyclic Compounds In Medicinal Compositions (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US917025 | 1997-08-22 | ||
| US08/917,025 US6284923B1 (en) | 1997-08-22 | 1997-08-22 | Substituted benzene compounds as antiproliferative and cholesterol lowering action |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| ES2245803T3 true ES2245803T3 (es) | 2006-01-16 |
Family
ID=25438246
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| ES98939384T Expired - Lifetime ES2245803T3 (es) | 1997-08-22 | 1998-08-13 | Compuestos bencenicos sustituidos como agentes antiproliferativos reductores. |
Country Status (10)
| Country | Link |
|---|---|
| US (2) | US6284923B1 (show.php) |
| EP (1) | EP1005453B1 (show.php) |
| JP (1) | JP4309041B2 (show.php) |
| AT (1) | ATE280756T1 (show.php) |
| AU (1) | AU748826B2 (show.php) |
| CA (1) | CA2301842C (show.php) |
| DE (1) | DE69827267T2 (show.php) |
| ES (1) | ES2245803T3 (show.php) |
| PT (1) | PT1005453E (show.php) |
| WO (1) | WO1999010320A1 (show.php) |
Families Citing this family (33)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| EP0896533B1 (en) * | 1996-02-22 | 2003-09-10 | Tularik, Inc. | Pentafluorobenzenesulfonamides and analogs |
| WO1998005315A1 (en) * | 1996-07-19 | 1998-02-12 | Tularik, Inc. | Pentafluorobenzenesulfonamides and analogs |
| US6583157B2 (en) | 1998-01-29 | 2003-06-24 | Tularik Inc. | Quinolinyl and benzothiazolyl modulators |
| ES2317688T3 (es) | 1998-01-29 | 2009-04-16 | Amgen Inc. | Moduladores ppar-gamma. |
| JP2002518506A (ja) * | 1998-06-25 | 2002-06-25 | テュラリク インコーポレイテッド | アリールスルホンアニリドホスフェート |
| HUP0201215A2 (en) * | 1998-12-02 | 2002-08-28 | Pfizer Prod Inc | Methods and compositions for restoring conformational stability of a protein of the p53 family |
| US7041691B1 (en) | 1999-06-30 | 2006-05-09 | Amgen Inc. | Compounds for the modulation of PPARγ activity |
| DK1192137T3 (da) * | 1999-06-30 | 2013-11-11 | Amgen Inc | Forbindelser til modulering af PPAR-gamma aktivitet |
| US6306615B1 (en) | 1999-08-19 | 2001-10-23 | Tularik Inc. | Detection method for monitoring β tubulin isotype specific modification |
| WO2001082916A2 (en) | 2000-05-03 | 2001-11-08 | Tularik Inc. | Combination therapeutic compositions and methods of use |
| US20030171399A1 (en) | 2000-06-28 | 2003-09-11 | Tularik Inc. | Quinolinyl and benzothiazolyl modulators |
| WO2002039958A2 (en) | 2000-11-03 | 2002-05-23 | Tularik Inc. | Combination therapy using pentafluorobenzenesulfonamides and antineoplastic agents |
| US20050250854A1 (en) * | 2000-11-03 | 2005-11-10 | Amgen Inc. | Combination therapy using pentafluorobenzenesulfonamides and antineoplastic agents |
| US7547716B2 (en) * | 2001-06-08 | 2009-06-16 | Institute Of Medicinal Molecular Design, Inc. | Sulfonamide derivatives |
| JP2003081937A (ja) * | 2001-09-07 | 2003-03-19 | Bayer Ag | ベンゼンスルホンアミド誘導体 |
| US7550424B2 (en) * | 2002-11-26 | 2009-06-23 | Institute Of Virology Slovak Academy Of Sciences | CA IX-specific inhibitors |
| US7833734B2 (en) * | 2002-11-26 | 2010-11-16 | Institute Of Virology Of The Slovak Academy Of Sciences | CA IX-specific inhibitors |
| US7223761B2 (en) | 2003-10-03 | 2007-05-29 | Amgen Inc. | Salts and polymorphs of a potent antidiabetic compound |
| FI20055498A0 (fi) * | 2005-09-16 | 2005-09-16 | Biotie Therapies Corp | Sulfonamidijohdannaisia |
| GB0526252D0 (en) * | 2005-12-22 | 2006-02-01 | Novartis Ag | Organic compounds |
| EP2590957B1 (en) | 2010-07-09 | 2014-11-12 | Pfizer Limited | N-sulfonylbenzamides as inhibitors of voltage-gated sodium channels |
| US8692001B2 (en) | 2010-10-27 | 2014-04-08 | Dynamix Pharmaceuticals Ltd. | Sulfonamides for the modulation of PKM2 |
| EP2925717A4 (en) * | 2012-11-28 | 2016-08-03 | Stichting Dienst Landbouwkundi | BENZOLSULFONAMIDE COMPOUNDS FOR PLANTS WITH SOMATIC EMBRYOGENESIS I |
| CN105452745B (zh) * | 2013-08-28 | 2019-03-19 | 博格华纳公司 | 高温阀轴密封 |
| GB201514021D0 (en) | 2015-08-07 | 2015-09-23 | Arner Elias Set Jeno | Novel Pyridines and their use in the treatment of cancer |
| EP3580204A1 (en) | 2017-02-07 | 2019-12-18 | Oblique Therapeutics AB | Sulfinylpyridines and their use in the treatment of cancer |
| MA47452A (fr) | 2017-02-07 | 2019-12-18 | Oblique Therapeutics Ab | Pyridines à substitution hétérocyclylsulfonyle et leur utilisation dans le traitement du cancer |
| JP7229176B2 (ja) | 2017-02-07 | 2023-02-27 | オブリーク セラピューティクス アーベー | ヒドロカルビルスルホニル置換ピリジンおよび癌の治療におけるそれらの使用 |
| AU2018218519B2 (en) | 2017-02-07 | 2021-08-05 | Oblique Therapeutics Ab | Heteroarylsulfonyl-substituted pyridines and their use in the treatment of cancer |
| US11555012B2 (en) * | 2018-11-09 | 2023-01-17 | Nimbus Artemis, Inc. | ACLY inhibitors and uses thereof |
| AU2020315192A1 (en) * | 2019-07-17 | 2022-02-24 | 2692372 Ontario, Inc. | Benzenesulfonamide derivatives and uses thereof |
| JP2025510669A (ja) * | 2022-03-21 | 2025-04-15 | ケモセントリックス,インコーポレイティド | Cxcr6スルホンアミド化合物 |
| WO2024175999A2 (en) * | 2023-02-23 | 2024-08-29 | Dunad Therapeutics Ltd. | Benzenesulfonamide derivatives and uses thereof |
Family Cites Families (24)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US1955207A (en) | 1931-09-16 | 1934-04-17 | Ig Farbenindustrie Ag | Mothproofing agent |
| DE622494C (de) | 1932-01-03 | 1935-11-29 | I G Farbenindustrie Akt Ges | Verfahren zur Darstellung von Mono- bzw. Polynitropolysulfonen und deren Reduktionsprodukten |
| US2358365A (en) | 1940-08-03 | 1944-09-19 | Parke Davis & Co | Sulphonamide derivatives and process for obtaining the same |
| US2450863A (en) | 1946-03-07 | 1948-10-05 | Socony Vacuum Oil Co Inc | Amides from sulfonyl fluorides |
| CH362688A (de) | 1957-09-10 | 1962-06-30 | Geigy Ag J R | Verfahren zur Herstellung von neuen Arylsulfonarylamiden |
| US2937202A (en) | 1958-05-19 | 1960-05-17 | Dow Chemical Co | Substituted benzenesulfonanilides |
| GB938890A (en) | 1961-02-03 | 1963-10-09 | Boots Pure Drug Co Ltd | New fungicidal compositions and compounds |
| NL301745A (show.php) | 1962-12-17 | |||
| CH504416A (de) * | 1966-12-05 | 1971-03-15 | Ciba Geigy Ag | Verfahren zur Herstellung von aromatischen Sulfamoylverbindungen |
| US3505455A (en) | 1966-12-15 | 1970-04-07 | Ansul Co | Nematocidal method |
| NL174644C (nl) | 1970-04-13 | 1984-07-16 | Minnesota Mining & Mfg | Werkwijze ter bereiding van een herbicide verbinding; tevens werkwijze voor de bereiding van een preparaat met herbicide werking. |
| US3951910A (en) * | 1973-12-28 | 1976-04-20 | General Electric Company | Flame retardant polycarbonate composition |
| US4013621A (en) | 1975-04-29 | 1977-03-22 | Ciba-Geigy Corporation | Substituted sulfonamide derivatives of hindered phenols and stabilized compositions |
| DE2528697C2 (de) | 1975-06-27 | 1986-02-20 | Bayer Ag, 5090 Leverkusen | Verfahren zur Herstellung von Salicylaldehyden |
| US4034110A (en) | 1976-09-20 | 1977-07-05 | Hoffmann-La Roche Inc. | Anthelmintics effective against liver flukes |
| US4239699A (en) | 1978-05-24 | 1980-12-16 | Henkel Corporation | Sulfonamidophenols, metal complexes thereof, and solutions containing such compounds for use in extraction of metal values |
| US4373017A (en) | 1980-03-05 | 1983-02-08 | Konishiroku Photo Industry Co., Ltd. | Photosensitive compound and photosensitive material containing it |
| US4483986A (en) | 1982-05-03 | 1984-11-20 | Eli Lilly And Company | 4-Nitrobenzophenone compounds |
| NZ215272A (en) | 1985-02-27 | 1989-08-29 | Mitsui Toatsu Chemicals | Fungicidal n-(2-chloro-4-nitrophenyl)-benzenesulphonamide derivatives and compositions thereof |
| US4692466A (en) | 1985-02-28 | 1987-09-08 | Mitsui Toatsu Chemicals, Incorporated | N-(2-chloro-4-trifluoromethylphenyl)-3-trifluoromethylbenzenesulfonamide derivative and agricultural fungicide containing same |
| US5280043A (en) | 1988-10-10 | 1994-01-18 | Smith Kline & French Laboratories Ltd. | Sulphonamido containing phenylalkanoic acids as thromboxane A2 antagonists |
| DE3905075A1 (de) | 1989-02-18 | 1990-08-30 | Hoechst Ag | Benzolsulfonamide und verfahren zu ihrer herstellung |
| ATE167473T1 (de) | 1990-08-20 | 1998-07-15 | Eisai Co Ltd | Sulfonamid-derivate |
| WO1996040629A1 (en) * | 1995-06-07 | 1996-12-19 | Sugen, Inc. | Tyrphostin-like compounds for the treatment of cell proliferative disorders or cell differentiation disorders |
-
1997
- 1997-08-22 US US08/917,025 patent/US6284923B1/en not_active Expired - Fee Related
-
1998
- 1998-08-13 AU AU87824/98A patent/AU748826B2/en not_active Ceased
- 1998-08-13 ES ES98939384T patent/ES2245803T3/es not_active Expired - Lifetime
- 1998-08-13 EP EP98939384A patent/EP1005453B1/en not_active Expired - Lifetime
- 1998-08-13 JP JP2000507650A patent/JP4309041B2/ja not_active Expired - Fee Related
- 1998-08-13 PT PT98939384T patent/PT1005453E/pt unknown
- 1998-08-13 DE DE69827267T patent/DE69827267T2/de not_active Expired - Lifetime
- 1998-08-13 AT AT98939384T patent/ATE280756T1/de not_active IP Right Cessation
- 1998-08-13 WO PCT/US1998/016781 patent/WO1999010320A1/en not_active Ceased
- 1998-08-13 CA CA2301842A patent/CA2301842C/en not_active Expired - Fee Related
-
2001
- 2001-05-31 US US09/872,463 patent/US6388131B2/en not_active Expired - Fee Related
Also Published As
| Publication number | Publication date |
|---|---|
| PT1005453E (pt) | 2005-02-28 |
| WO1999010320A8 (en) | 1999-09-23 |
| JP4309041B2 (ja) | 2009-08-05 |
| ATE280756T1 (de) | 2004-11-15 |
| DE69827267D1 (de) | 2004-12-02 |
| AU748826B2 (en) | 2002-06-13 |
| CA2301842A1 (en) | 1999-03-04 |
| EP1005453A1 (en) | 2000-06-07 |
| US6388131B2 (en) | 2002-05-14 |
| WO1999010320A1 (en) | 1999-03-04 |
| JP2001514167A (ja) | 2001-09-11 |
| AU8782498A (en) | 1999-03-16 |
| EP1005453B1 (en) | 2004-10-27 |
| US20020013496A1 (en) | 2002-01-31 |
| CA2301842C (en) | 2010-04-27 |
| DE69827267T2 (de) | 2006-02-02 |
| US6284923B1 (en) | 2001-09-04 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| ES2245803T3 (es) | Compuestos bencenicos sustituidos como agentes antiproliferativos reductores. | |
| US6191170B1 (en) | Benzenesulfonamides and benzamides as therapeutic agents | |
| ES2201313T3 (es) | Pentafluorobencenosulfonamidas y analogos. | |
| TWI311551B (en) | Oxygenated esters of 4-iodo phenylamino benzhydroxamic acids | |
| US6583165B2 (en) | Arylsulfonanilide ureas | |
| ES2762193T3 (es) | Agonistas de proteína tirosina fosfatasa 1 que contiene dominio de homología Src-2 y métodos de tratamiento usando la misma | |
| CA2879798C (en) | Procaspase enzyme-activating substituted 2-(4-benzylpiperazin-1-yl)-n'-(2-hydroxybenzylidene)acetohydrazide derivatives and compostions thereof | |
| EP2091527A2 (en) | Sulfide, sulfoxide and sulfone chalcone analogues, derivatives thereof and therapeutic uses thereof | |
| EP1313701A1 (en) | Phenoxybenzylamine derivatives as selective serotonin re-uptake inhibitors | |
| Khodyuk et al. | Diaryl disulfides and thiosulfonates as combretastatin A-4 analogues: Synthesis, cytotoxicity and antitubulin activity | |
| US6417176B2 (en) | Arylsulfonanilide phosphates | |
| JP2022115836A (ja) | Lpa1受容体を拮抗するウレア化合物を有効成分として含有する医薬 | |
| Ajenjo | Synthesis and reactivity of hypervalent sulfur fluorides | |
| WO2016082052A1 (es) | Compuestos derivados de 2-fenil-2-fluorosulfonamidas y procedimiento de preparación; útiles como bloques de construcción en síntesis orgánica | |
| EP1285911A2 (en) | Arylsulfonanilide ureas | |
| MXPA01002717A (es) | Ureas de arilsulfonanilida | |
| HK1205112B (en) | Enzyme-activating compounds and compositions | |
| HK1038913B (en) | Arylsulfonanilide ureas |