CA2301842C - Substituted benzene compounds as antiproliferative and cholesterol lowering agents - Google Patents
Substituted benzene compounds as antiproliferative and cholesterol lowering agents Download PDFInfo
- Publication number
- CA2301842C CA2301842C CA2301842A CA2301842A CA2301842C CA 2301842 C CA2301842 C CA 2301842C CA 2301842 A CA2301842 A CA 2301842A CA 2301842 A CA2301842 A CA 2301842A CA 2301842 C CA2301842 C CA 2301842C
- Authority
- CA
- Canada
- Prior art keywords
- alkyl
- aminosulfonyl
- methoxyphenyl
- ocf3
- compound
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired - Fee Related
Links
- 125000001997 phenyl group Chemical class [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 title claims description 34
- 230000001028 anti-proliverative effect Effects 0.000 title description 5
- 239000003529 anticholesteremic agent Substances 0.000 title description 3
- 229940127226 anticholesterol agent Drugs 0.000 title description 2
- 150000001875 compounds Chemical class 0.000 claims abstract description 139
- 239000000203 mixture Substances 0.000 claims abstract description 66
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 claims abstract description 21
- 201000010099 disease Diseases 0.000 claims abstract description 20
- 206010028980 Neoplasm Diseases 0.000 claims abstract description 14
- 201000004681 Psoriasis Diseases 0.000 claims abstract description 10
- 201000011510 cancer Diseases 0.000 claims abstract description 10
- 208000015181 infectious disease Diseases 0.000 claims abstract description 5
- 208000037803 restenosis Diseases 0.000 claims abstract description 5
- 230000002792 vascular Effects 0.000 claims abstract description 4
- -1 N((C1-C6)alkyl)2 Chemical group 0.000 claims description 62
- 229910052739 hydrogen Inorganic materials 0.000 claims description 49
- 125000001424 substituent group Chemical group 0.000 claims description 42
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 claims description 40
- 229910052801 chlorine Inorganic materials 0.000 claims description 38
- 125000004169 (C1-C6) alkyl group Chemical group 0.000 claims description 37
- 125000000876 trifluoromethoxy group Chemical group FC(F)(F)O* 0.000 claims description 37
- 229910052736 halogen Inorganic materials 0.000 claims description 34
- 150000002367 halogens Chemical group 0.000 claims description 33
- 239000001257 hydrogen Substances 0.000 claims description 33
- 150000003839 salts Chemical class 0.000 claims description 33
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 29
- 229910052794 bromium Inorganic materials 0.000 claims description 28
- 229910052757 nitrogen Inorganic materials 0.000 claims description 28
- 229910052731 fluorine Inorganic materials 0.000 claims description 23
- 125000001072 heteroaryl group Chemical group 0.000 claims description 15
- JCXJVPUVTGWSNB-UHFFFAOYSA-N Nitrogen dioxide Chemical group O=[N]=O JCXJVPUVTGWSNB-UHFFFAOYSA-N 0.000 claims description 12
- 230000004663 cell proliferation Effects 0.000 claims description 12
- 239000003814 drug Substances 0.000 claims description 11
- 125000004191 (C1-C6) alkoxy group Chemical group 0.000 claims description 8
- 125000003107 substituted aryl group Chemical group 0.000 claims description 8
- 125000006716 (C1-C6) heteroalkyl group Chemical group 0.000 claims description 6
- 239000002246 antineoplastic agent Substances 0.000 claims description 5
- 229940127089 cytotoxic agent Drugs 0.000 claims description 5
- 239000008194 pharmaceutical composition Substances 0.000 claims description 5
- 239000000546 pharmaceutical excipient Substances 0.000 claims description 5
- 229940002612 prodrug Drugs 0.000 claims description 5
- 239000000651 prodrug Substances 0.000 claims description 5
- 238000004519 manufacturing process Methods 0.000 claims description 4
- 238000002360 preparation method Methods 0.000 claims description 3
- 230000000973 chemotherapeutic effect Effects 0.000 claims description 2
- 239000002254 cytotoxic agent Substances 0.000 claims description 2
- 231100000599 cytotoxic agent Toxicity 0.000 claims description 2
- 244000005700 microbiome Species 0.000 claims description 2
- 230000008685 targeting Effects 0.000 claims description 2
- 238000007918 intramuscular administration Methods 0.000 claims 1
- 238000001990 intravenous administration Methods 0.000 claims 1
- LMBFAGIMSUYTBN-MPZNNTNKSA-N teixobactin Chemical compound C([C@H](C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H](CCC(N)=O)C(=O)N[C@H]([C@@H](C)CC)C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H]1C(N[C@@H](C)C(=O)N[C@@H](C[C@@H]2NC(=N)NC2)C(=O)N[C@H](C(=O)O[C@H]1C)[C@@H](C)CC)=O)NC)C1=CC=CC=C1 LMBFAGIMSUYTBN-MPZNNTNKSA-N 0.000 claims 1
- 238000000034 method Methods 0.000 abstract description 32
- 125000003118 aryl group Chemical group 0.000 abstract description 13
- 238000011282 treatment Methods 0.000 abstract description 12
- 201000001320 Atherosclerosis Diseases 0.000 abstract description 10
- 239000003795 chemical substances by application Substances 0.000 abstract description 8
- 208000035150 Hypercholesterolemia Diseases 0.000 abstract description 7
- 238000011161 development Methods 0.000 abstract description 4
- 239000013543 active substance Substances 0.000 abstract description 3
- 150000002611 lead compounds Chemical class 0.000 abstract description 2
- 239000002831 pharmacologic agent Substances 0.000 abstract description 2
- HVYWMOMLDIMFJA-DPAQBDIFSA-N cholesterol Chemical compound C1C=C2C[C@@H](O)CC[C@]2(C)[C@@H]2[C@@H]1[C@@H]1CC[C@H]([C@H](C)CCCC(C)C)[C@@]1(C)CC2 HVYWMOMLDIMFJA-DPAQBDIFSA-N 0.000 description 66
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 42
- 239000000460 chlorine Substances 0.000 description 32
- 125000004404 heteroalkyl group Chemical group 0.000 description 27
- 210000004027 cell Anatomy 0.000 description 26
- 235000012000 cholesterol Nutrition 0.000 description 25
- 238000005160 1H NMR spectroscopy Methods 0.000 description 24
- 101150041968 CDC13 gene Proteins 0.000 description 24
- HEDRZPFGACZZDS-MICDWDOJSA-N Trichloro(2H)methane Chemical compound [2H]C(Cl)(Cl)Cl HEDRZPFGACZZDS-MICDWDOJSA-N 0.000 description 24
- 108010007622 LDL Lipoproteins Proteins 0.000 description 23
- 102000007330 LDL Lipoproteins Human genes 0.000 description 23
- 108010001831 LDL receptors Proteins 0.000 description 23
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 description 22
- 102000000853 LDL receptors Human genes 0.000 description 21
- 125000000217 alkyl group Chemical group 0.000 description 20
- 230000015572 biosynthetic process Effects 0.000 description 20
- 238000003786 synthesis reaction Methods 0.000 description 20
- RRONENSZKCGROA-UHFFFAOYSA-N 4-fluoro-3-nitrobenzenesulfonyl chloride Chemical compound [O-][N+](=O)C1=CC(S(Cl)(=O)=O)=CC=C1F RRONENSZKCGROA-UHFFFAOYSA-N 0.000 description 16
- 238000006243 chemical reaction Methods 0.000 description 14
- 125000004172 4-methoxyphenyl group Chemical group [H]C1=C([H])C(OC([H])([H])[H])=C([H])C([H])=C1* 0.000 description 12
- 102000004895 Lipoproteins Human genes 0.000 description 12
- 108090001030 Lipoproteins Proteins 0.000 description 12
- 125000001309 chloro group Chemical group Cl* 0.000 description 12
- 125000004178 (C1-C4) alkyl group Chemical group 0.000 description 11
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 11
- 125000004397 aminosulfonyl group Chemical group NS(=O)(=O)* 0.000 description 10
- 230000014509 gene expression Effects 0.000 description 10
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 10
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 9
- RAHZWNYVWXNFOC-UHFFFAOYSA-N Sulphur dioxide Chemical compound O=S=O RAHZWNYVWXNFOC-UHFFFAOYSA-N 0.000 description 9
- 125000004432 carbon atom Chemical group C* 0.000 description 9
- OQUWAOHSHWXMPX-UHFFFAOYSA-N 2-bromo-3,4,5-trifluoro-n-(4-methoxyphenyl)benzenesulfonamide Chemical compound C1=CC(OC)=CC=C1NS(=O)(=O)C1=CC(F)=C(F)C(F)=C1Br OQUWAOHSHWXMPX-UHFFFAOYSA-N 0.000 description 8
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 8
- 239000002253 acid Substances 0.000 description 8
- 125000003342 alkenyl group Chemical group 0.000 description 8
- 238000002330 electrospray ionisation mass spectrometry Methods 0.000 description 8
- 125000005842 heteroatom Chemical group 0.000 description 8
- 208000020346 hyperlipoproteinemia Diseases 0.000 description 8
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 description 8
- 150000003626 triacylglycerols Chemical class 0.000 description 8
- 206010033645 Pancreatitis Diseases 0.000 description 7
- 125000004429 atom Chemical group 0.000 description 7
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical class CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 7
- YBBRCQOCSYXUOC-UHFFFAOYSA-N sulfuryl dichloride Chemical compound ClS(Cl)(=O)=O YBBRCQOCSYXUOC-UHFFFAOYSA-N 0.000 description 7
- RCTCBSDWAUCMEI-UHFFFAOYSA-N 5-bromo-2,3,4-trifluoro-n-(4-methoxyphenyl)benzenesulfonamide Chemical compound C1=CC(OC)=CC=C1NS(=O)(=O)C1=CC(Br)=C(F)C(F)=C1F RCTCBSDWAUCMEI-UHFFFAOYSA-N 0.000 description 6
- 102000004190 Enzymes Human genes 0.000 description 6
- 108090000790 Enzymes Proteins 0.000 description 6
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 6
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 6
- 108010062497 VLDL Lipoproteins Proteins 0.000 description 6
- 229940088598 enzyme Drugs 0.000 description 6
- 150000002632 lipids Chemical class 0.000 description 6
- 150000003254 radicals Chemical class 0.000 description 6
- 239000007787 solid Substances 0.000 description 6
- 230000001225 therapeutic effect Effects 0.000 description 6
- HIPCPVSKULEHBJ-UHFFFAOYSA-N 2-bromo-3,4,5-trifluoro-n-(3-hydroxy-4-methoxyphenyl)benzenesulfonamide Chemical compound C1=C(O)C(OC)=CC=C1NS(=O)(=O)C1=CC(F)=C(F)C(F)=C1Br HIPCPVSKULEHBJ-UHFFFAOYSA-N 0.000 description 5
- BLQFHJKRTDIZLX-UHFFFAOYSA-N 5-amino-2-methoxyphenol Chemical compound COC1=CC=C(N)C=C1O BLQFHJKRTDIZLX-UHFFFAOYSA-N 0.000 description 5
- FTIFAPZODKUUQX-UHFFFAOYSA-N 5-bromo-2,3,4-trifluoro-n-(3-hydroxy-4-methoxyphenyl)benzenesulfonamide Chemical compound C1=C(O)C(OC)=CC=C1NS(=O)(=O)C1=CC(Br)=C(F)C(F)=C1F FTIFAPZODKUUQX-UHFFFAOYSA-N 0.000 description 5
- 208000031226 Hyperlipidaemia Diseases 0.000 description 5
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 5
- 125000004122 cyclic group Chemical group 0.000 description 5
- 229940079593 drug Drugs 0.000 description 5
- 125000004433 nitrogen atom Chemical group N* 0.000 description 5
- BHAAPTBBJKJZER-UHFFFAOYSA-N p-anisidine Chemical compound COC1=CC=C(N)C=C1 BHAAPTBBJKJZER-UHFFFAOYSA-N 0.000 description 5
- 108090000623 proteins and genes Proteins 0.000 description 5
- 102000005962 receptors Human genes 0.000 description 5
- 108020003175 receptors Proteins 0.000 description 5
- 229910052717 sulfur Inorganic materials 0.000 description 5
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical class ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 5
- 125000000008 (C1-C10) alkyl group Chemical group 0.000 description 4
- XFTDZYFHXRZLEF-UHFFFAOYSA-N 2,3,4-trifluorobenzenesulfonyl chloride Chemical compound FC1=CC=C(S(Cl)(=O)=O)C(F)=C1F XFTDZYFHXRZLEF-UHFFFAOYSA-N 0.000 description 4
- IAPZMOXNDIVGNQ-UHFFFAOYSA-N 3-bromo-2,4,5,6-tetrafluoro-n-(4-methoxyphenyl)benzenesulfonamide Chemical compound C1=CC(OC)=CC=C1NS(=O)(=O)C1=C(F)C(F)=C(F)C(Br)=C1F IAPZMOXNDIVGNQ-UHFFFAOYSA-N 0.000 description 4
- PAYRUJLWNCNPSJ-UHFFFAOYSA-N Aniline Chemical compound NC1=CC=CC=C1 PAYRUJLWNCNPSJ-UHFFFAOYSA-N 0.000 description 4
- AOJJSUZBOXZQNB-TZSSRYMLSA-N Doxorubicin Chemical compound O([C@H]1C[C@@](O)(CC=2C(O)=C3C(=O)C=4C=CC=C(C=4C(=O)C3=C(O)C=21)OC)C(=O)CO)[C@H]1C[C@H](N)[C@H](O)[C@H](C)O1 AOJJSUZBOXZQNB-TZSSRYMLSA-N 0.000 description 4
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 4
- 108010046315 IDL Lipoproteins Proteins 0.000 description 4
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 4
- NKANXQFJJICGDU-QPLCGJKRSA-N Tamoxifen Chemical compound C=1C=CC=CC=1C(/CC)=C(C=1C=CC(OCCN(C)C)=CC=1)/C1=CC=CC=C1 NKANXQFJJICGDU-QPLCGJKRSA-N 0.000 description 4
- 125000003545 alkoxy group Chemical group 0.000 description 4
- 125000000304 alkynyl group Chemical group 0.000 description 4
- 150000001491 aromatic compounds Chemical class 0.000 description 4
- 238000003556 assay Methods 0.000 description 4
- 210000004369 blood Anatomy 0.000 description 4
- 239000008280 blood Substances 0.000 description 4
- 125000001246 bromo group Chemical group Br* 0.000 description 4
- 229910052799 carbon Inorganic materials 0.000 description 4
- 230000001413 cellular effect Effects 0.000 description 4
- 235000019439 ethyl acetate Nutrition 0.000 description 4
- 238000009472 formulation Methods 0.000 description 4
- 125000000592 heterocycloalkyl group Chemical group 0.000 description 4
- 125000005647 linker group Chemical group 0.000 description 4
- 239000002245 particle Substances 0.000 description 4
- 230000008569 process Effects 0.000 description 4
- 230000002062 proliferating effect Effects 0.000 description 4
- 230000002285 radioactive effect Effects 0.000 description 4
- 239000011541 reaction mixture Substances 0.000 description 4
- 239000000243 solution Substances 0.000 description 4
- 125000006552 (C3-C8) cycloalkyl group Chemical group 0.000 description 3
- KEQGZUUPPQEDPF-UHFFFAOYSA-N 1,3-dichloro-5,5-dimethylimidazolidine-2,4-dione Chemical compound CC1(C)N(Cl)C(=O)N(Cl)C1=O KEQGZUUPPQEDPF-UHFFFAOYSA-N 0.000 description 3
- COVHFELBSZZSOI-UHFFFAOYSA-N 2,3,4,5-tetrafluoro-n-(3-hydroxy-4-methoxyphenyl)benzenesulfonamide Chemical compound C1=C(O)C(OC)=CC=C1NS(=O)(=O)C1=CC(F)=C(F)C(F)=C1F COVHFELBSZZSOI-UHFFFAOYSA-N 0.000 description 3
- QITZCKFTLJUUKY-UHFFFAOYSA-N 2,3,4,5-tetrafluoro-n-(4-methoxyphenyl)benzenesulfonamide Chemical compound C1=CC(OC)=CC=C1NS(=O)(=O)C1=CC(F)=C(F)C(F)=C1F QITZCKFTLJUUKY-UHFFFAOYSA-N 0.000 description 3
- IAYLRIOAUQKCBY-UHFFFAOYSA-N 2-bromo-3,4,5,6-tetrafluoro-n-(3-hydroxy-4-methoxyphenyl)benzenesulfonamide Chemical compound C1=C(O)C(OC)=CC=C1NS(=O)(=O)C1=C(F)C(F)=C(F)C(F)=C1Br IAYLRIOAUQKCBY-UHFFFAOYSA-N 0.000 description 3
- CUBSXTAOVAEONH-UHFFFAOYSA-N 2-bromo-3,4,5,6-tetrafluorobenzenesulfonyl chloride Chemical compound FC1=C(F)C(F)=C(S(Cl)(=O)=O)C(Br)=C1F CUBSXTAOVAEONH-UHFFFAOYSA-N 0.000 description 3
- JVGLQWNQRHPZMB-UHFFFAOYSA-N 2-bromo-3,4,5-trifluorobenzenesulfonyl chloride Chemical compound FC1=CC(S(Cl)(=O)=O)=C(Br)C(F)=C1F JVGLQWNQRHPZMB-UHFFFAOYSA-N 0.000 description 3
- SLXGUUYOJAEVJS-UHFFFAOYSA-N 3,4,5-trifluoro-n-(3-hydroxy-4-methoxyphenyl)benzenesulfonamide Chemical compound C1=C(O)C(OC)=CC=C1NS(=O)(=O)C1=CC(F)=C(F)C(F)=C1 SLXGUUYOJAEVJS-UHFFFAOYSA-N 0.000 description 3
- VNGDFXNFUBUXKA-UHFFFAOYSA-N 3,4,5-trifluoro-n-(4-methoxyphenyl)benzenesulfonamide Chemical compound C1=CC(OC)=CC=C1NS(=O)(=O)C1=CC(F)=C(F)C(F)=C1 VNGDFXNFUBUXKA-UHFFFAOYSA-N 0.000 description 3
- PTAPWFLHAVOUHJ-UHFFFAOYSA-N 3,5-dichloro-2,4,6-trifluoro-n-(3-hydroxy-4-methoxyphenyl)benzenesulfonamide Chemical compound C1=C(O)C(OC)=CC=C1NS(=O)(=O)C1=C(F)C(Cl)=C(F)C(Cl)=C1F PTAPWFLHAVOUHJ-UHFFFAOYSA-N 0.000 description 3
- XDYKWPNNTGMVKV-UHFFFAOYSA-N 3,5-dichloro-2,4,6-trifluorobenzenesulfonyl chloride Chemical compound FC1=C(Cl)C(F)=C(S(Cl)(=O)=O)C(F)=C1Cl XDYKWPNNTGMVKV-UHFFFAOYSA-N 0.000 description 3
- BBBAYGJTRRZKTC-UHFFFAOYSA-N 4-bromo-2,3,5,6-tetrafluoro-n-(4-methoxyphenyl)benzenesulfonamide Chemical compound C1=CC(OC)=CC=C1NS(=O)(=O)C1=C(F)C(F)=C(Br)C(F)=C1F BBBAYGJTRRZKTC-UHFFFAOYSA-N 0.000 description 3
- MEZPAKLVSGAERH-UHFFFAOYSA-N 4-chloro-2,3,5,6-tetrafluoro-n-(4-methoxyphenyl)benzenesulfonamide Chemical compound C1=CC(OC)=CC=C1NS(=O)(=O)C1=C(F)C(F)=C(Cl)C(F)=C1F MEZPAKLVSGAERH-UHFFFAOYSA-N 0.000 description 3
- XZDWZZHAPIJEDQ-UHFFFAOYSA-N 4-fluoro-n-(3-hydroxy-4-methoxyphenyl)-3-nitrobenzenesulfonamide Chemical compound C1=C(O)C(OC)=CC=C1NS(=O)(=O)C1=CC=C(F)C([N+]([O-])=O)=C1 XZDWZZHAPIJEDQ-UHFFFAOYSA-N 0.000 description 3
- XMRWHKXOGDGNHJ-UHFFFAOYSA-N 4-fluoro-n-(4-methoxyphenyl)-3-nitrobenzenesulfonamide Chemical compound C1=CC(OC)=CC=C1NS(=O)(=O)C1=CC=C(F)C([N+]([O-])=O)=C1 XMRWHKXOGDGNHJ-UHFFFAOYSA-N 0.000 description 3
- JPWPTHYAXFJZEX-UHFFFAOYSA-N 5-bromo-2,3,4-trifluorobenzenesulfonyl chloride Chemical compound FC1=C(F)C(Br)=CC(S(Cl)(=O)=O)=C1F JPWPTHYAXFJZEX-UHFFFAOYSA-N 0.000 description 3
- 208000035143 Bacterial infection Diseases 0.000 description 3
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 3
- MHAJPDPJQMAIIY-UHFFFAOYSA-N Hydrogen peroxide Chemical compound OO MHAJPDPJQMAIIY-UHFFFAOYSA-N 0.000 description 3
- FBOZXECLQNJBKD-ZDUSSCGKSA-N L-methotrexate Chemical compound C=1N=C2N=C(N)N=C(N)C2=NC=1CN(C)C1=CC=C(C(=O)N[C@@H](CCC(O)=O)C(O)=O)C=C1 FBOZXECLQNJBKD-ZDUSSCGKSA-N 0.000 description 3
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 3
- 229930182558 Sterol Natural products 0.000 description 3
- YZCKVEUIGOORGS-NJFSPNSNSA-N Tritium Chemical compound [3H] YZCKVEUIGOORGS-NJFSPNSNSA-N 0.000 description 3
- 230000002159 abnormal effect Effects 0.000 description 3
- 230000002378 acidificating effect Effects 0.000 description 3
- 150000007513 acids Chemical class 0.000 description 3
- 125000002947 alkylene group Chemical group 0.000 description 3
- 238000010171 animal model Methods 0.000 description 3
- 239000007864 aqueous solution Substances 0.000 description 3
- 125000004104 aryloxy group Chemical group 0.000 description 3
- 208000022362 bacterial infectious disease Diseases 0.000 description 3
- 239000003613 bile acid Substances 0.000 description 3
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Chemical compound BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 3
- 238000004364 calculation method Methods 0.000 description 3
- 210000000170 cell membrane Anatomy 0.000 description 3
- 239000007795 chemical reaction product Substances 0.000 description 3
- XTHPWXDJESJLNJ-UHFFFAOYSA-N chlorosulfonic acid Substances OS(Cl)(=O)=O XTHPWXDJESJLNJ-UHFFFAOYSA-N 0.000 description 3
- 238000004587 chromatography analysis Methods 0.000 description 3
- 125000001485 cycloalkadienyl group Chemical group 0.000 description 3
- 125000000753 cycloalkyl group Chemical group 0.000 description 3
- 235000014113 dietary fatty acids Nutrition 0.000 description 3
- 229930195729 fatty acid Natural products 0.000 description 3
- 239000000194 fatty acid Substances 0.000 description 3
- 150000004665 fatty acids Chemical class 0.000 description 3
- 230000012010 growth Effects 0.000 description 3
- 210000003494 hepatocyte Anatomy 0.000 description 3
- 125000004474 heteroalkylene group Chemical group 0.000 description 3
- 125000005553 heteroaryloxy group Chemical group 0.000 description 3
- 125000000623 heterocyclic group Chemical group 0.000 description 3
- 230000000871 hypocholesterolemic effect Effects 0.000 description 3
- 238000000338 in vitro Methods 0.000 description 3
- 230000006698 induction Effects 0.000 description 3
- 210000004185 liver Anatomy 0.000 description 3
- 230000007246 mechanism Effects 0.000 description 3
- 229960000485 methotrexate Drugs 0.000 description 3
- 230000007935 neutral effect Effects 0.000 description 3
- 231100000252 nontoxic Toxicity 0.000 description 3
- 230000003000 nontoxic effect Effects 0.000 description 3
- 239000012038 nucleophile Substances 0.000 description 3
- 230000007170 pathology Effects 0.000 description 3
- UHZYTMXLRWXGPK-UHFFFAOYSA-N phosphorus pentachloride Chemical compound ClP(Cl)(Cl)(Cl)Cl UHZYTMXLRWXGPK-UHFFFAOYSA-N 0.000 description 3
- 238000011321 prophylaxis Methods 0.000 description 3
- 238000000746 purification Methods 0.000 description 3
- 239000000741 silica gel Substances 0.000 description 3
- 229910002027 silica gel Inorganic materials 0.000 description 3
- 239000002904 solvent Substances 0.000 description 3
- 239000007858 starting material Substances 0.000 description 3
- 150000003432 sterols Chemical class 0.000 description 3
- 235000003702 sterols Nutrition 0.000 description 3
- 238000003756 stirring Methods 0.000 description 3
- 229940124530 sulfonamide Drugs 0.000 description 3
- 150000003456 sulfonamides Chemical class 0.000 description 3
- 125000004434 sulfur atom Chemical group 0.000 description 3
- 238000012360 testing method Methods 0.000 description 3
- 210000001519 tissue Anatomy 0.000 description 3
- CABVTRNMFUVUDM-VRHQGPGLSA-N (3S)-3-hydroxy-3-methylglutaryl-CoA Chemical compound O[C@@H]1[C@H](OP(O)(O)=O)[C@@H](COP(O)(=O)OP(O)(=O)OCC(C)(C)[C@@H](O)C(=O)NCCC(=O)NCCSC(=O)C[C@@](O)(CC(O)=O)C)O[C@H]1N1C2=NC=NC(N)=C2N=C1 CABVTRNMFUVUDM-VRHQGPGLSA-N 0.000 description 2
- 125000006709 (C5-C7) cycloalkenyl group Chemical group 0.000 description 2
- IAKHMKGGTNLKSZ-INIZCTEOSA-N (S)-colchicine Chemical compound C1([C@@H](NC(C)=O)CC2)=CC(=O)C(OC)=CC=C1C1=C2C=C(OC)C(OC)=C1OC IAKHMKGGTNLKSZ-INIZCTEOSA-N 0.000 description 2
- VSNHCAURESNICA-NJFSPNSNSA-N 1-oxidanylurea Chemical compound N[14C](=O)NO VSNHCAURESNICA-NJFSPNSNSA-N 0.000 description 2
- PCGXALSKZRHXOX-UHFFFAOYSA-N 2,3,4,5-tetrafluoro-n-(3-fluoro-4-methoxyphenyl)benzenesulfonamide Chemical compound C1=C(F)C(OC)=CC=C1NS(=O)(=O)C1=CC(F)=C(F)C(F)=C1F PCGXALSKZRHXOX-UHFFFAOYSA-N 0.000 description 2
- WCPZRJPXQPEWOJ-UHFFFAOYSA-N 2,3,4,6-tetrafluoro-5-[(3-fluoro-4-methoxyphenyl)sulfamoyl]benzoic acid Chemical compound C1=C(F)C(OC)=CC=C1NS(=O)(=O)C1=C(F)C(F)=C(F)C(C(O)=O)=C1F WCPZRJPXQPEWOJ-UHFFFAOYSA-N 0.000 description 2
- OMAJARUXDQCLTO-UHFFFAOYSA-N 2,3,4,6-tetrafluoro-5-[(3-hydroxy-4-methoxyphenyl)sulfamoyl]benzoic acid Chemical compound C1=C(O)C(OC)=CC=C1NS(=O)(=O)C1=C(F)C(F)=C(F)C(C(O)=O)=C1F OMAJARUXDQCLTO-UHFFFAOYSA-N 0.000 description 2
- FBAXNZWDMOJIFL-UHFFFAOYSA-N 2,3,4,6-tetrafluoro-5-[(4-methoxyphenyl)sulfamoyl]benzoic acid Chemical compound C1=CC(OC)=CC=C1NS(=O)(=O)C1=C(F)C(F)=C(F)C(C(O)=O)=C1F FBAXNZWDMOJIFL-UHFFFAOYSA-N 0.000 description 2
- ILLJRJUJVYZWEZ-UHFFFAOYSA-N 2,3,4,6-tetrafluoro-n-(4-methoxyphenyl)benzenesulfonamide Chemical compound C1=CC(OC)=CC=C1NS(=O)(=O)C1=C(F)C=C(F)C(F)=C1F ILLJRJUJVYZWEZ-UHFFFAOYSA-N 0.000 description 2
- KWGOMCGSAAGBBK-UHFFFAOYSA-N 2,3,4-trifluoro-5-[(3-fluoro-4-methoxyphenyl)sulfamoyl]benzoic acid Chemical compound C1=C(F)C(OC)=CC=C1NS(=O)(=O)C1=CC(C(O)=O)=C(F)C(F)=C1F KWGOMCGSAAGBBK-UHFFFAOYSA-N 0.000 description 2
- XIKMYDYIFMIMQB-UHFFFAOYSA-N 2,3,4-trifluoro-5-[(3-hydroxy-4-methoxyphenyl)sulfamoyl]benzoic acid Chemical compound C1=C(O)C(OC)=CC=C1NS(=O)(=O)C1=CC(C(O)=O)=C(F)C(F)=C1F XIKMYDYIFMIMQB-UHFFFAOYSA-N 0.000 description 2
- UHYIENZZAVUHSX-UHFFFAOYSA-N 2,3,4-trifluoro-5-[(4-methoxyphenyl)sulfamoyl]benzoic acid Chemical compound C1=CC(OC)=CC=C1NS(=O)(=O)C1=CC(C(O)=O)=C(F)C(F)=C1F UHYIENZZAVUHSX-UHFFFAOYSA-N 0.000 description 2
- ZEGWRALLTDGCBL-UHFFFAOYSA-N 2,3,4-trifluoro-n-(3-hydroxy-4-methoxyphenyl)benzenesulfonamide Chemical compound C1=C(O)C(OC)=CC=C1NS(=O)(=O)C1=CC=C(F)C(F)=C1F ZEGWRALLTDGCBL-UHFFFAOYSA-N 0.000 description 2
- LBSHLAUHXYJGJZ-UHFFFAOYSA-N 2,3,4-trifluoro-n-(4-methoxyphenyl)benzenesulfonamide Chemical compound C1=CC(OC)=CC=C1NS(=O)(=O)C1=CC=C(F)C(F)=C1F LBSHLAUHXYJGJZ-UHFFFAOYSA-N 0.000 description 2
- XINCBNCLCIQIJM-UHFFFAOYSA-N 2,4,6-trifluorobenzenesulfonyl chloride Chemical compound FC1=CC(F)=C(S(Cl)(=O)=O)C(F)=C1 XINCBNCLCIQIJM-UHFFFAOYSA-N 0.000 description 2
- KZMVSDGUYVLTTH-UHFFFAOYSA-N 2-bromo-3,4,5,6-tetrafluoro-n-(3-fluoro-4-methoxyphenyl)benzenesulfonamide Chemical compound C1=C(F)C(OC)=CC=C1NS(=O)(=O)C1=C(F)C(F)=C(F)C(F)=C1Br KZMVSDGUYVLTTH-UHFFFAOYSA-N 0.000 description 2
- GVUZWQXNPLQRKC-UHFFFAOYSA-N 2-bromo-3,4,5,6-tetrafluorobenzenesulfonic acid Chemical compound OS(=O)(=O)C1=C(F)C(F)=C(F)C(F)=C1Br GVUZWQXNPLQRKC-UHFFFAOYSA-N 0.000 description 2
- GRBJVYGMFKVYOF-UHFFFAOYSA-N 3,4,5-trifluoro-n-(3-fluoro-4-methoxyphenyl)benzenesulfonamide Chemical compound C1=C(F)C(OC)=CC=C1NS(=O)(=O)C1=CC(F)=C(F)C(F)=C1 GRBJVYGMFKVYOF-UHFFFAOYSA-N 0.000 description 2
- ADUDCACBCWTINI-UHFFFAOYSA-N 3,4-difluoro-n-(3-fluoro-4-methoxyphenyl)-5-nitrobenzenesulfonamide Chemical compound C1=C(F)C(OC)=CC=C1NS(=O)(=O)C1=CC(F)=C(F)C([N+]([O-])=O)=C1 ADUDCACBCWTINI-UHFFFAOYSA-N 0.000 description 2
- GLRMXHFJNKBGHG-UHFFFAOYSA-N 3,4-difluoro-n-(3-hydroxy-4-methoxyphenyl)-5-nitrobenzenesulfonamide Chemical compound C1=C(O)C(OC)=CC=C1NS(=O)(=O)C1=CC(F)=C(F)C([N+]([O-])=O)=C1 GLRMXHFJNKBGHG-UHFFFAOYSA-N 0.000 description 2
- FEBSNZXLIFIQMR-UHFFFAOYSA-N 3,4-difluoro-n-(4-methoxyphenyl)-5-nitrobenzenesulfonamide Chemical compound C1=CC(OC)=CC=C1NS(=O)(=O)C1=CC(F)=C(F)C([N+]([O-])=O)=C1 FEBSNZXLIFIQMR-UHFFFAOYSA-N 0.000 description 2
- SGYIKNJQNYKZNO-UHFFFAOYSA-N 3,5-dichloro-2,4,6-trifluoro-n-(3-fluoro-4-methoxyphenyl)benzenesulfonamide Chemical compound C1=C(F)C(OC)=CC=C1NS(=O)(=O)C1=C(F)C(Cl)=C(F)C(Cl)=C1F SGYIKNJQNYKZNO-UHFFFAOYSA-N 0.000 description 2
- AGQBGLPVAIJCBB-UHFFFAOYSA-N 3-bromo-2,4,5,6-tetrafluoro-n-(3-fluoro-4-methoxyphenyl)benzenesulfonamide Chemical compound C1=C(F)C(OC)=CC=C1NS(=O)(=O)C1=C(F)C(F)=C(F)C(Br)=C1F AGQBGLPVAIJCBB-UHFFFAOYSA-N 0.000 description 2
- WNLGUDNTEMSHRL-UHFFFAOYSA-N 3-bromo-2,4,5,6-tetrafluoro-n-(3-hydroxy-4-methoxyphenyl)benzenesulfonamide Chemical compound C1=C(O)C(OC)=CC=C1NS(=O)(=O)C1=C(F)C(F)=C(F)C(Br)=C1F WNLGUDNTEMSHRL-UHFFFAOYSA-N 0.000 description 2
- LJCQHRGXTOZMKU-UHFFFAOYSA-N 3-bromo-2,4,5,6-tetrafluorobenzenesulfonyl chloride Chemical compound FC1=C(F)C(Br)=C(F)C(S(Cl)(=O)=O)=C1F LJCQHRGXTOZMKU-UHFFFAOYSA-N 0.000 description 2
- PVNSHPIVBJKRBD-UHFFFAOYSA-N 3-cyano-4-fluoro-n-(3-fluoro-4-methoxyphenyl)benzenesulfonamide Chemical compound C1=C(F)C(OC)=CC=C1NS(=O)(=O)C1=CC=C(F)C(C#N)=C1 PVNSHPIVBJKRBD-UHFFFAOYSA-N 0.000 description 2
- KBQYBGLDOTXZHB-UHFFFAOYSA-N 3-cyano-4-fluoro-n-(3-hydroxy-4-methoxyphenyl)benzenesulfonamide Chemical compound C1=C(O)C(OC)=CC=C1NS(=O)(=O)C1=CC=C(F)C(C#N)=C1 KBQYBGLDOTXZHB-UHFFFAOYSA-N 0.000 description 2
- XEGJDKCSTPMARO-UHFFFAOYSA-N 3-cyano-4-fluoro-n-(4-methoxyphenyl)benzenesulfonamide Chemical compound C1=CC(OC)=CC=C1NS(=O)(=O)C1=CC=C(F)C(C#N)=C1 XEGJDKCSTPMARO-UHFFFAOYSA-N 0.000 description 2
- PYMSZTUXRNONSA-UHFFFAOYSA-N 4-bromo-2,3,5,6-tetrafluoro-n-(3-fluoro-4-methoxyphenyl)benzenesulfonamide Chemical compound C1=C(F)C(OC)=CC=C1NS(=O)(=O)C1=C(F)C(F)=C(Br)C(F)=C1F PYMSZTUXRNONSA-UHFFFAOYSA-N 0.000 description 2
- AYCKUVTUMLLKRS-UHFFFAOYSA-N 4-bromo-2,3,5,6-tetrafluoro-n-(3-hydroxy-4-methoxyphenyl)benzenesulfonamide Chemical compound C1=C(O)C(OC)=CC=C1NS(=O)(=O)C1=C(F)C(F)=C(Br)C(F)=C1F AYCKUVTUMLLKRS-UHFFFAOYSA-N 0.000 description 2
- NENYNUVEKYVIPB-UHFFFAOYSA-N 4-bromo-2,3,5,6-tetrafluorobenzenesulfonyl chloride Chemical compound FC1=C(F)C(S(Cl)(=O)=O)=C(F)C(F)=C1Br NENYNUVEKYVIPB-UHFFFAOYSA-N 0.000 description 2
- RLPCCVFJVXAXTH-UHFFFAOYSA-N 4-chloro-2,3,5,6-tetrafluoro-n-(3-fluoro-4-methoxyphenyl)benzenesulfonamide Chemical compound C1=C(F)C(OC)=CC=C1NS(=O)(=O)C1=C(F)C(F)=C(Cl)C(F)=C1F RLPCCVFJVXAXTH-UHFFFAOYSA-N 0.000 description 2
- FPAYYLJPZRQTAF-UHFFFAOYSA-N 4-chloro-2,3,5,6-tetrafluoro-n-(3-hydroxy-4-methoxyphenyl)benzenesulfonamide Chemical compound C1=C(O)C(OC)=CC=C1NS(=O)(=O)C1=C(F)C(F)=C(Cl)C(F)=C1F FPAYYLJPZRQTAF-UHFFFAOYSA-N 0.000 description 2
- WQDYDAHEDDHZMY-UHFFFAOYSA-N 4-chloro-3-cyano-n-(3-fluoro-4-methoxyphenyl)benzenesulfonamide Chemical compound C1=C(F)C(OC)=CC=C1NS(=O)(=O)C1=CC=C(Cl)C(C#N)=C1 WQDYDAHEDDHZMY-UHFFFAOYSA-N 0.000 description 2
- ACFAKOFFBCKARI-UHFFFAOYSA-N 4-chloro-3-cyano-n-(3-hydroxy-4-methoxyphenyl)benzenesulfonamide Chemical compound C1=C(O)C(OC)=CC=C1NS(=O)(=O)C1=CC=C(Cl)C(C#N)=C1 ACFAKOFFBCKARI-UHFFFAOYSA-N 0.000 description 2
- JHVYDXJPFRSREL-UHFFFAOYSA-N 4-chloro-3-cyano-n-(4-methoxyphenyl)benzenesulfonamide Chemical compound C1=CC(OC)=CC=C1NS(=O)(=O)C1=CC=C(Cl)C(C#N)=C1 JHVYDXJPFRSREL-UHFFFAOYSA-N 0.000 description 2
- VFAHHOBFWSSXLM-UHFFFAOYSA-N 4-chloro-n-(3-fluoro-4-methoxyphenyl)-3-nitrobenzenesulfonamide Chemical compound C1=C(F)C(OC)=CC=C1NS(=O)(=O)C1=CC=C(Cl)C([N+]([O-])=O)=C1 VFAHHOBFWSSXLM-UHFFFAOYSA-N 0.000 description 2
- MIGZZSMCMSIQLP-UHFFFAOYSA-N 4-chloro-n-(3-hydroxy-4-methoxyphenyl)-3-nitrobenzenesulfonamide Chemical compound C1=C(O)C(OC)=CC=C1NS(=O)(=O)C1=CC=C(Cl)C([N+]([O-])=O)=C1 MIGZZSMCMSIQLP-UHFFFAOYSA-N 0.000 description 2
- JMVWMQHIHCXUPR-UHFFFAOYSA-N 4-fluoro-n-(3-fluoro-4-methoxyphenyl)-3-nitrobenzenesulfonamide Chemical compound C1=C(F)C(OC)=CC=C1NS(=O)(=O)C1=CC=C(F)C([N+]([O-])=O)=C1 JMVWMQHIHCXUPR-UHFFFAOYSA-N 0.000 description 2
- 125000002373 5 membered heterocyclic group Chemical group 0.000 description 2
- SCUYULHGUMPWCG-UHFFFAOYSA-N 5-bromo-2,3,4-trifluoro-n-(3-fluoro-4-methoxyphenyl)benzenesulfonamide Chemical compound C1=C(F)C(OC)=CC=C1NS(=O)(=O)C1=CC(Br)=C(F)C(F)=C1F SCUYULHGUMPWCG-UHFFFAOYSA-N 0.000 description 2
- 125000004070 6 membered heterocyclic group Chemical group 0.000 description 2
- KHQZEUYAHWDICF-UHFFFAOYSA-N 6-bromo-2,3,4-trifluoro-n-(3-fluoro-4-methoxyphenyl)benzenesulfonamide Chemical compound C1=C(F)C(OC)=CC=C1NS(=O)(=O)C1=C(Br)C=C(F)C(F)=C1F KHQZEUYAHWDICF-UHFFFAOYSA-N 0.000 description 2
- SZFPXQCSQIPGPG-UHFFFAOYSA-N 6-bromo-2,3,4-trifluoro-n-(3-hydroxy-4-methoxyphenyl)benzenesulfonamide Chemical compound C1=C(O)C(OC)=CC=C1NS(=O)(=O)C1=C(F)C(F)=C(F)C=C1Br SZFPXQCSQIPGPG-UHFFFAOYSA-N 0.000 description 2
- VFMLEDLVUDSUAX-UHFFFAOYSA-N 6-bromo-2,3,4-trifluoro-n-(4-methoxyphenyl)benzenesulfonamide Chemical compound C1=CC(OC)=CC=C1NS(=O)(=O)C1=C(Br)C=C(F)C(F)=C1F VFMLEDLVUDSUAX-UHFFFAOYSA-N 0.000 description 2
- STQGQHZAVUOBTE-UHFFFAOYSA-N 7-Cyan-hept-2t-en-4,6-diinsaeure Natural products C1=2C(O)=C3C(=O)C=4C(OC)=CC=CC=4C(=O)C3=C(O)C=2CC(O)(C(C)=O)CC1OC1CC(N)C(O)C(C)O1 STQGQHZAVUOBTE-UHFFFAOYSA-N 0.000 description 2
- 108010071619 Apolipoproteins Proteins 0.000 description 2
- 102000007592 Apolipoproteins Human genes 0.000 description 2
- 239000004215 Carbon black (E152) Substances 0.000 description 2
- OKTJSMMVPCPJKN-NJFSPNSNSA-N Carbon-14 Chemical compound [14C] OKTJSMMVPCPJKN-NJFSPNSNSA-N 0.000 description 2
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 2
- CMSMOCZEIVJLDB-UHFFFAOYSA-N Cyclophosphamide Chemical compound ClCCN(CCCl)P1(=O)NCCCO1 CMSMOCZEIVJLDB-UHFFFAOYSA-N 0.000 description 2
- WEAHRLBPCANXCN-UHFFFAOYSA-N Daunomycin Natural products CCC1(O)CC(OC2CC(N)C(O)C(C)O2)c3cc4C(=O)c5c(OC)cccc5C(=O)c4c(O)c3C1 WEAHRLBPCANXCN-UHFFFAOYSA-N 0.000 description 2
- HEMJJKBWTPKOJG-UHFFFAOYSA-N Gemfibrozil Chemical compound CC1=CC=C(C)C(OCCCC(C)(C)C(O)=O)=C1 HEMJJKBWTPKOJG-UHFFFAOYSA-N 0.000 description 2
- 102000004286 Hydroxymethylglutaryl CoA Reductases Human genes 0.000 description 2
- 108090000895 Hydroxymethylglutaryl CoA Reductases Proteins 0.000 description 2
- 102000029749 Microtubule Human genes 0.000 description 2
- 108091022875 Microtubule Proteins 0.000 description 2
- MZRVEZGGRBJDDB-UHFFFAOYSA-N N-Butyllithium Chemical compound [Li]CCCC MZRVEZGGRBJDDB-UHFFFAOYSA-N 0.000 description 2
- PVNIIMVLHYAWGP-UHFFFAOYSA-N Niacin Chemical compound OC(=O)C1=CC=CN=C1 PVNIIMVLHYAWGP-UHFFFAOYSA-N 0.000 description 2
- 229930012538 Paclitaxel Natural products 0.000 description 2
- 206010033647 Pancreatitis acute Diseases 0.000 description 2
- JXLYSJRDGCGARV-WWYNWVTFSA-N Vinblastine Natural products O=C(O[C@H]1[C@](O)(C(=O)OC)[C@@H]2N(C)c3c(cc(c(OC)c3)[C@]3(C(=O)OC)c4[nH]c5c(c4CCN4C[C@](O)(CC)C[C@H](C3)C4)cccc5)[C@@]32[C@H]2[C@@]1(CC)C=CCN2CC3)C JXLYSJRDGCGARV-WWYNWVTFSA-N 0.000 description 2
- 238000009825 accumulation Methods 0.000 description 2
- 229960000583 acetic acid Drugs 0.000 description 2
- 201000003229 acute pancreatitis Diseases 0.000 description 2
- 150000001412 amines Chemical class 0.000 description 2
- 150000001448 anilines Chemical class 0.000 description 2
- 230000000340 anti-metabolite Effects 0.000 description 2
- 229940100197 antimetabolite Drugs 0.000 description 2
- 239000002256 antimetabolite Substances 0.000 description 2
- 230000003143 atherosclerotic effect Effects 0.000 description 2
- 230000037396 body weight Effects 0.000 description 2
- 239000002775 capsule Substances 0.000 description 2
- 150000001721 carbon Chemical group 0.000 description 2
- 239000000969 carrier Substances 0.000 description 2
- 230000010261 cell growth Effects 0.000 description 2
- 150000001840 cholesterol esters Chemical class 0.000 description 2
- DQLATGHUWYMOKM-UHFFFAOYSA-L cisplatin Chemical compound N[Pt](N)(Cl)Cl DQLATGHUWYMOKM-UHFFFAOYSA-L 0.000 description 2
- 229960004316 cisplatin Drugs 0.000 description 2
- 238000004440 column chromatography Methods 0.000 description 2
- 239000000470 constituent Substances 0.000 description 2
- 125000000392 cycloalkenyl group Chemical group 0.000 description 2
- 229960004397 cyclophosphamide Drugs 0.000 description 2
- 230000001472 cytotoxic effect Effects 0.000 description 2
- 230000003013 cytotoxicity Effects 0.000 description 2
- 231100000135 cytotoxicity Toxicity 0.000 description 2
- STQGQHZAVUOBTE-VGBVRHCVSA-N daunorubicin Chemical compound O([C@H]1C[C@@](O)(CC=2C(O)=C3C(=O)C=4C=CC=C(C=4C(=O)C3=C(O)C=21)OC)C(C)=O)[C@H]1C[C@H](N)[C@H](O)[C@H](C)O1 STQGQHZAVUOBTE-VGBVRHCVSA-N 0.000 description 2
- 239000012954 diazonium Substances 0.000 description 2
- 150000001989 diazonium salts Chemical class 0.000 description 2
- 235000005911 diet Nutrition 0.000 description 2
- 230000037213 diet Effects 0.000 description 2
- 230000004069 differentiation Effects 0.000 description 2
- ZUOUZKKEUPVFJK-UHFFFAOYSA-N diphenyl Chemical group C1=CC=CC=C1C1=CC=CC=C1 ZUOUZKKEUPVFJK-UHFFFAOYSA-N 0.000 description 2
- 230000000694 effects Effects 0.000 description 2
- 210000002889 endothelial cell Anatomy 0.000 description 2
- MKXKFYHWDHIYRV-UHFFFAOYSA-N flutamide Chemical compound CC(C)C(=O)NC1=CC=C([N+]([O-])=O)C(C(F)(F)F)=C1 MKXKFYHWDHIYRV-UHFFFAOYSA-N 0.000 description 2
- 229960002074 flutamide Drugs 0.000 description 2
- 229960003627 gemfibrozil Drugs 0.000 description 2
- 229940093915 gynecological organic acid Drugs 0.000 description 2
- 125000001475 halogen functional group Chemical group 0.000 description 2
- 230000002440 hepatic effect Effects 0.000 description 2
- 229930195733 hydrocarbon Natural products 0.000 description 2
- 150000002430 hydrocarbons Chemical group 0.000 description 2
- 238000000099 in vitro assay Methods 0.000 description 2
- 238000005462 in vivo assay Methods 0.000 description 2
- 239000012442 inert solvent Substances 0.000 description 2
- 208000027866 inflammatory disease Diseases 0.000 description 2
- 230000002401 inhibitory effect Effects 0.000 description 2
- 239000000543 intermediate Substances 0.000 description 2
- 229910052740 iodine Inorganic materials 0.000 description 2
- 210000005229 liver cell Anatomy 0.000 description 2
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 2
- 235000019341 magnesium sulphate Nutrition 0.000 description 2
- 230000036210 malignancy Effects 0.000 description 2
- 230000003211 malignant effect Effects 0.000 description 2
- 230000001404 mediated effect Effects 0.000 description 2
- 210000004688 microtubule Anatomy 0.000 description 2
- 208000010125 myocardial infarction Diseases 0.000 description 2
- ORPIWKMLDXEMKB-UHFFFAOYSA-N n-(3,4-dimethoxyphenyl)-3,4-difluoro-5-nitrobenzenesulfonamide Chemical compound C1=C(OC)C(OC)=CC=C1NS(=O)(=O)C1=CC(F)=C(F)C([N+]([O-])=O)=C1 ORPIWKMLDXEMKB-UHFFFAOYSA-N 0.000 description 2
- RBBZTWAVGFETGR-UHFFFAOYSA-N n-(3,4-dimethoxyphenyl)-4-fluoro-3-nitrobenzenesulfonamide Chemical compound C1=C(OC)C(OC)=CC=C1NS(=O)(=O)C1=CC=C(F)C([N+]([O-])=O)=C1 RBBZTWAVGFETGR-UHFFFAOYSA-N 0.000 description 2
- JOFIGGTZBGSBKO-UHFFFAOYSA-N n-(3-chloro-4-methoxyphenyl)-2,3,4-trifluorobenzenesulfonamide Chemical compound C1=C(Cl)C(OC)=CC=C1NS(=O)(=O)C1=CC=C(F)C(F)=C1F JOFIGGTZBGSBKO-UHFFFAOYSA-N 0.000 description 2
- QJGQUHMNIGDVPM-UHFFFAOYSA-N nitrogen group Chemical group [N] QJGQUHMNIGDVPM-UHFFFAOYSA-N 0.000 description 2
- 150000007524 organic acids Chemical class 0.000 description 2
- 235000005985 organic acids Nutrition 0.000 description 2
- 229960001592 paclitaxel Drugs 0.000 description 2
- 230000037361 pathway Effects 0.000 description 2
- 230000000144 pharmacologic effect Effects 0.000 description 2
- 150000003904 phospholipids Chemical class 0.000 description 2
- 239000002243 precursor Substances 0.000 description 2
- 102000004169 proteins and genes Human genes 0.000 description 2
- 230000002829 reductive effect Effects 0.000 description 2
- 230000001105 regulatory effect Effects 0.000 description 2
- 210000002966 serum Anatomy 0.000 description 2
- 208000017520 skin disease Diseases 0.000 description 2
- LPXPTNMVRIOKMN-UHFFFAOYSA-M sodium nitrite Chemical compound [Na+].[O-]N=O LPXPTNMVRIOKMN-UHFFFAOYSA-M 0.000 description 2
- 229910052979 sodium sulfide Inorganic materials 0.000 description 2
- GRVFOGOEDUUMBP-UHFFFAOYSA-N sodium sulfide (anhydrous) Chemical compound [Na+].[Na+].[S-2] GRVFOGOEDUUMBP-UHFFFAOYSA-N 0.000 description 2
- 238000003860 storage Methods 0.000 description 2
- 150000003457 sulfones Chemical class 0.000 description 2
- 150000003462 sulfoxides Chemical class 0.000 description 2
- HIFJUMGIHIZEPX-UHFFFAOYSA-N sulfuric acid;sulfur trioxide Chemical compound O=S(=O)=O.OS(O)(=O)=O HIFJUMGIHIZEPX-UHFFFAOYSA-N 0.000 description 2
- 229960001603 tamoxifen Drugs 0.000 description 2
- RCINICONZNJXQF-MZXODVADSA-N taxol Chemical compound O([C@@H]1[C@@]2(C[C@@H](C(C)=C(C2(C)C)[C@H](C([C@]2(C)[C@@H](O)C[C@H]3OC[C@]3([C@H]21)OC(C)=O)=O)OC(=O)C)OC(=O)[C@H](O)[C@@H](NC(=O)C=1C=CC=CC=1)C=1C=CC=CC=1)O)C(=O)C1=CC=CC=C1 RCINICONZNJXQF-MZXODVADSA-N 0.000 description 2
- 229940124597 therapeutic agent Drugs 0.000 description 2
- 231100001274 therapeutic index Toxicity 0.000 description 2
- 230000000699 topical effect Effects 0.000 description 2
- 231100000331 toxic Toxicity 0.000 description 2
- 230000002588 toxic effect Effects 0.000 description 2
- 231100000419 toxicity Toxicity 0.000 description 2
- 230000001988 toxicity Effects 0.000 description 2
- UFTFJSFQGQCHQW-UHFFFAOYSA-N triformin Chemical compound O=COCC(OC=O)COC=O UFTFJSFQGQCHQW-UHFFFAOYSA-N 0.000 description 2
- 229910052722 tritium Inorganic materials 0.000 description 2
- 230000003827 upregulation Effects 0.000 description 2
- HOFQVRTUGATRFI-XQKSVPLYSA-N vinblastine Chemical compound C([C@@H](C[C@]1(C(=O)OC)C=2C(=CC3=C([C@]45[C@H]([C@@]([C@H](OC(C)=O)[C@]6(CC)C=CCN([C@H]56)CC4)(O)C(=O)OC)N3C)C=2)OC)C[C@@](C2)(O)CC)N2CCC2=C1N=C1[C]2C=CC=C1 HOFQVRTUGATRFI-XQKSVPLYSA-N 0.000 description 2
- 229960003048 vinblastine Drugs 0.000 description 2
- OGWKCGZFUXNPDA-XQKSVPLYSA-N vincristine Chemical compound C([N@]1C[C@@H](C[C@]2(C(=O)OC)C=3C(=CC4=C([C@]56[C@H]([C@@]([C@H](OC(C)=O)[C@]7(CC)C=CCN([C@H]67)CC5)(O)C(=O)OC)N4C=O)C=3)OC)C[C@@](C1)(O)CC)CC1=C2NC2=CC=CC=C12 OGWKCGZFUXNPDA-XQKSVPLYSA-N 0.000 description 2
- 229960004528 vincristine Drugs 0.000 description 2
- OGWKCGZFUXNPDA-UHFFFAOYSA-N vincristine Natural products C1C(CC)(O)CC(CC2(C(=O)OC)C=3C(=CC4=C(C56C(C(C(OC(C)=O)C7(CC)C=CCN(C67)CC5)(O)C(=O)OC)N4C=O)C=3)OC)CN1CCC1=C2NC2=CC=CC=C12 OGWKCGZFUXNPDA-UHFFFAOYSA-N 0.000 description 2
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 2
- 238000001262 western blot Methods 0.000 description 2
- KEEKMOIRJUWKNK-CABZTGNLSA-N (2S)-2-[[2-[(4R)-4-(difluoromethyl)-2-oxo-1,3-thiazolidin-3-yl]-5,6-dihydroimidazo[1,2-d][1,4]benzoxazepin-9-yl]amino]propanamide Chemical compound FC([C@H]1N(C(SC1)=O)C=1N=C2N(CCOC3=C2C=CC(=C3)N[C@H](C(=O)N)C)C=1)F KEEKMOIRJUWKNK-CABZTGNLSA-N 0.000 description 1
- HSINOMROUCMIEA-FGVHQWLLSA-N (2s,4r)-4-[(3r,5s,6r,7r,8s,9s,10s,13r,14s,17r)-6-ethyl-3,7-dihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1h-cyclopenta[a]phenanthren-17-yl]-2-methylpentanoic acid Chemical compound C([C@@]12C)C[C@@H](O)C[C@H]1[C@@H](CC)[C@@H](O)[C@@H]1[C@@H]2CC[C@]2(C)[C@@H]([C@H](C)C[C@H](C)C(O)=O)CC[C@H]21 HSINOMROUCMIEA-FGVHQWLLSA-N 0.000 description 1
- 125000000229 (C1-C4)alkoxy group Chemical group 0.000 description 1
- 125000004209 (C1-C8) alkyl group Chemical group 0.000 description 1
- MCNILEHCARBUHB-UHFFFAOYSA-N 1,2,3,4-tetrafluoro-5-(4-methoxyphenyl)sulfonylbenzene Chemical compound C1=CC(OC)=CC=C1S(=O)(=O)C1=CC(F)=C(F)C(F)=C1F MCNILEHCARBUHB-UHFFFAOYSA-N 0.000 description 1
- 125000004520 1,3,4-thiadiazolyl group Chemical group 0.000 description 1
- JXUKFFRPLNTYIV-UHFFFAOYSA-N 1,3,5-trifluorobenzene Chemical compound FC1=CC(F)=CC(F)=C1 JXUKFFRPLNTYIV-UHFFFAOYSA-N 0.000 description 1
- TVTPENSWTCMKPK-UHFFFAOYSA-N 1,3-dichloro-2,4,6-trifluoro-5-[(3-fluoro-4-methoxyphenyl)methylsulfonyl]benzene Chemical compound C1=C(F)C(OC)=CC=C1CS(=O)(=O)C1=C(F)C(Cl)=C(F)C(Cl)=C1F TVTPENSWTCMKPK-UHFFFAOYSA-N 0.000 description 1
- 125000000196 1,4-pentadienyl group Chemical group [H]C([*])=C([H])C([H])([H])C([H])=C([H])[H] 0.000 description 1
- BUYSIDPAOVWMQX-UHFFFAOYSA-N 1-bromo-2,3,4,5-tetrafluorobenzene Chemical compound FC1=CC(Br)=C(F)C(F)=C1F BUYSIDPAOVWMQX-UHFFFAOYSA-N 0.000 description 1
- DFHZOYOPPGXKRZ-UHFFFAOYSA-N 1-bromo-2,3,4,6-tetrafluoro-5-(4-methoxyphenyl)sulfanylbenzene Chemical compound C1=CC(OC)=CC=C1SC1=C(F)C(F)=C(F)C(Br)=C1F DFHZOYOPPGXKRZ-UHFFFAOYSA-N 0.000 description 1
- MUUAQFJJUGVBGB-UHFFFAOYSA-N 1-bromo-2,3,4-trifluorobenzene Chemical compound FC1=CC=C(Br)C(F)=C1F MUUAQFJJUGVBGB-UHFFFAOYSA-N 0.000 description 1
- TUVDIBSCIAGVOH-UHFFFAOYSA-N 1-bromo-2,3,5,6-tetrafluoro-4-(3-fluoro-4-methoxyphenyl)sulfonylbenzene Chemical compound C1=C(F)C(OC)=CC=C1S(=O)(=O)C1=C(F)C(F)=C(Br)C(F)=C1F TUVDIBSCIAGVOH-UHFFFAOYSA-N 0.000 description 1
- FPGVRVWMXQGQAE-UHFFFAOYSA-N 1-chloro-4-[(4-methoxyphenyl)methylsulfonyl]-2-nitrobenzene Chemical compound C1=CC(OC)=CC=C1CS(=O)(=O)C1=CC=C(Cl)C([N+]([O-])=O)=C1 FPGVRVWMXQGQAE-UHFFFAOYSA-N 0.000 description 1
- PWKNBLFSJAVFAB-UHFFFAOYSA-N 1-fluoro-2-nitrobenzene Chemical compound [O-][N+](=O)C1=CC=CC=C1F PWKNBLFSJAVFAB-UHFFFAOYSA-N 0.000 description 1
- PXCOUSOFICGHIJ-UHFFFAOYSA-N 1-fluoro-4-(4-methoxyphenyl)sulfonyl-2-nitrobenzene Chemical compound C1=CC(OC)=CC=C1S(=O)(=O)C1=CC=C(F)C([N+]([O-])=O)=C1 PXCOUSOFICGHIJ-UHFFFAOYSA-N 0.000 description 1
- ZMJKZCMNCPVRJH-UHFFFAOYSA-N 1-fluoro-4-[(4-methoxyphenyl)methylsulfonyl]-2-nitrobenzene Chemical compound C1=CC(OC)=CC=C1CS(=O)(=O)C1=CC=C(F)C([N+]([O-])=O)=C1 ZMJKZCMNCPVRJH-UHFFFAOYSA-N 0.000 description 1
- 125000001637 1-naphthyl group Chemical group [H]C1=C([H])C([H])=C2C(*)=C([H])C([H])=C([H])C2=C1[H] 0.000 description 1
- 125000001462 1-pyrrolyl group Chemical group [*]N1C([H])=C([H])C([H])=C1[H] 0.000 description 1
- AYUOWVFSPKPEMA-UHFFFAOYSA-N 2,3,4-trifluoro-n-(3-fluoro-4-methoxyphenyl)benzenesulfonamide Chemical compound C1=C(F)C(OC)=CC=C1NS(=O)(=O)C1=CC=C(F)C(F)=C1F AYUOWVFSPKPEMA-UHFFFAOYSA-N 0.000 description 1
- MOSXORPPDAEREV-UHFFFAOYSA-N 2,3,5,6-tetrafluoro-n-(3-fluoro-4-methoxyphenyl)-4-(trifluoromethoxy)benzenesulfonamide Chemical compound C1=C(F)C(OC)=CC=C1NS(=O)(=O)C1=C(F)C(F)=C(OC(F)(F)F)C(F)=C1F MOSXORPPDAEREV-UHFFFAOYSA-N 0.000 description 1
- RXQPRAMLZGQWDI-UHFFFAOYSA-N 2,3,5,6-tetrafluoro-n-(3-hydroxy-4-methoxyphenyl)-4-(trifluoromethoxy)benzenesulfonamide Chemical compound C1=C(O)C(OC)=CC=C1NS(=O)(=O)C1=C(F)C(F)=C(OC(F)(F)F)C(F)=C1F RXQPRAMLZGQWDI-UHFFFAOYSA-N 0.000 description 1
- ZEOCIPNVCGNOIC-UHFFFAOYSA-N 2,3,5,6-tetrafluoro-n-(4-methoxyphenyl)-4-(trifluoromethoxy)benzenesulfonamide Chemical compound C1=CC(OC)=CC=C1NS(=O)(=O)C1=C(F)C(F)=C(OC(F)(F)F)C(F)=C1F ZEOCIPNVCGNOIC-UHFFFAOYSA-N 0.000 description 1
- AUEWWGZMFFWSPB-UHFFFAOYSA-N 2,3,5-trifluoro-n-(3-fluoro-4-methoxyphenyl)-4-(trifluoromethoxy)benzenesulfonamide Chemical compound C1=C(F)C(OC)=CC=C1NS(=O)(=O)C1=CC(F)=C(OC(F)(F)F)C(F)=C1F AUEWWGZMFFWSPB-UHFFFAOYSA-N 0.000 description 1
- UIYXGXNGHNQVBN-UHFFFAOYSA-N 2,3,5-trifluoro-n-(3-hydroxy-4-methoxyphenyl)-4-(trifluoromethoxy)benzenesulfonamide Chemical compound C1=C(O)C(OC)=CC=C1NS(=O)(=O)C1=CC(F)=C(OC(F)(F)F)C(F)=C1F UIYXGXNGHNQVBN-UHFFFAOYSA-N 0.000 description 1
- XQYHEYIPBWAONI-UHFFFAOYSA-N 2,4,5-trifluoro-n-(4-methoxyphenyl)benzenesulfonamide Chemical compound C1=CC(OC)=CC=C1NS(=O)(=O)C1=CC(F)=C(F)C=C1F XQYHEYIPBWAONI-UHFFFAOYSA-N 0.000 description 1
- FXQXDPGFERAWKC-UHFFFAOYSA-N 2,4,6-trifluoro-n-(4-methoxyphenyl)benzenesulfonamide Chemical compound C1=CC(OC)=CC=C1NS(=O)(=O)C1=C(F)C=C(F)C=C1F FXQXDPGFERAWKC-UHFFFAOYSA-N 0.000 description 1
- UOGVNYNJSZHQCN-UHFFFAOYSA-N 2,4-dichloro-1,3,5-trifluorobenzene Chemical compound FC1=CC(F)=C(Cl)C(F)=C1Cl UOGVNYNJSZHQCN-UHFFFAOYSA-N 0.000 description 1
- 125000004174 2-benzimidazolyl group Chemical group [H]N1C(*)=NC2=C([H])C([H])=C([H])C([H])=C12 0.000 description 1
- AHJRONLVHNFUNH-UHFFFAOYSA-N 2-bromo-1,3,4,5-tetrafluorobenzene Chemical compound FC1=CC(F)=C(Br)C(F)=C1F AHJRONLVHNFUNH-UHFFFAOYSA-N 0.000 description 1
- GGPCFSHQXLVTSO-UHFFFAOYSA-N 2-bromo-3,4,5,6-tetrafluoro-n-(4-methoxyphenyl)benzenesulfonamide Chemical compound C1=CC(OC)=CC=C1NS(=O)(=O)C1=C(F)C(F)=C(F)C(F)=C1Br GGPCFSHQXLVTSO-UHFFFAOYSA-N 0.000 description 1
- CJEJAONFCOJFCH-UHFFFAOYSA-N 2-bromo-3,4,5-trifluoro-n-(3-fluoro-4-methoxyphenyl)benzenesulfonamide Chemical compound C1=C(F)C(OC)=CC=C1NS(=O)(=O)C1=CC(F)=C(F)C(F)=C1Br CJEJAONFCOJFCH-UHFFFAOYSA-N 0.000 description 1
- GIEJFJDMESTIGD-UHFFFAOYSA-N 2-bromo-5-[(3,4-dimethoxyphenyl)sulfamoyl]benzoic acid Chemical compound C1=C(OC)C(OC)=CC=C1NS(=O)(=O)C1=CC=C(Br)C(C(O)=O)=C1 GIEJFJDMESTIGD-UHFFFAOYSA-N 0.000 description 1
- DYEWYJDJEBWPMY-UHFFFAOYSA-N 2-bromo-5-[(3-fluoro-4-methoxyphenyl)sulfamoyl]benzoic acid Chemical compound C1=C(F)C(OC)=CC=C1NS(=O)(=O)C1=CC=C(Br)C(C(O)=O)=C1 DYEWYJDJEBWPMY-UHFFFAOYSA-N 0.000 description 1
- SROIRJBMXUVDNJ-UHFFFAOYSA-N 2-bromo-5-[(3-hydroxy-4-methoxyphenyl)sulfamoyl]benzoic acid Chemical compound C1=C(O)C(OC)=CC=C1NS(=O)(=O)C1=CC=C(Br)C(C(O)=O)=C1 SROIRJBMXUVDNJ-UHFFFAOYSA-N 0.000 description 1
- GSXCMCSXYUOQMI-UHFFFAOYSA-N 2-bromo-5-[(4-methoxyphenyl)sulfamoyl]benzoic acid Chemical compound C1=CC(OC)=CC=C1NS(=O)(=O)C1=CC=C(Br)C(C(O)=O)=C1 GSXCMCSXYUOQMI-UHFFFAOYSA-N 0.000 description 1
- IFPBFUBXWYUVJR-UHFFFAOYSA-N 2-bromo-5-[[4-(dimethylamino)phenyl]sulfamoyl]benzoic acid Chemical compound C1=CC(N(C)C)=CC=C1NS(=O)(=O)C1=CC=C(Br)C(C(O)=O)=C1 IFPBFUBXWYUVJR-UHFFFAOYSA-N 0.000 description 1
- OJKIYKLQBVEZSF-UHFFFAOYSA-N 2-bromo-n-(3,4-dimethoxyphenyl)-3,4,5-trifluorobenzenesulfonamide Chemical compound C1=C(OC)C(OC)=CC=C1NS(=O)(=O)C1=CC(F)=C(F)C(F)=C1Br OJKIYKLQBVEZSF-UHFFFAOYSA-N 0.000 description 1
- WYNWVUXHQBFGRB-UHFFFAOYSA-N 2-chloro-5-[(3,4-dimethoxyphenyl)sulfamoyl]benzoic acid Chemical compound C1=C(OC)C(OC)=CC=C1NS(=O)(=O)C1=CC=C(Cl)C(C(O)=O)=C1 WYNWVUXHQBFGRB-UHFFFAOYSA-N 0.000 description 1
- HVKVXGPCEXFKLR-UHFFFAOYSA-N 2-chloro-5-[(3-fluoro-4-methoxyphenyl)sulfamoyl]benzoic acid Chemical compound C1=C(F)C(OC)=CC=C1NS(=O)(=O)C1=CC=C(Cl)C(C(O)=O)=C1 HVKVXGPCEXFKLR-UHFFFAOYSA-N 0.000 description 1
- SXYFQTUCEYSCFV-UHFFFAOYSA-N 2-chloro-5-[(3-hydroxy-4-methoxyphenyl)sulfamoyl]benzoic acid Chemical compound C1=C(O)C(OC)=CC=C1NS(=O)(=O)C1=CC=C(Cl)C(C(O)=O)=C1 SXYFQTUCEYSCFV-UHFFFAOYSA-N 0.000 description 1
- WQVGFKAYHAUMLS-UHFFFAOYSA-N 2-chloro-5-[(4-methoxyphenyl)sulfamoyl]benzoic acid Chemical compound C1=CC(OC)=CC=C1NS(=O)(=O)C1=CC=C(Cl)C(C(O)=O)=C1 WQVGFKAYHAUMLS-UHFFFAOYSA-N 0.000 description 1
- NWOCQOVDAKYIEK-UHFFFAOYSA-N 2-chloro-5-[[4-(dimethylamino)phenyl]sulfamoyl]benzoic acid Chemical compound C1=CC(N(C)C)=CC=C1NS(=O)(=O)C1=CC=C(Cl)C(C(O)=O)=C1 NWOCQOVDAKYIEK-UHFFFAOYSA-N 0.000 description 1
- BQGSRSVOLPHOPK-UHFFFAOYSA-N 2-fluoro-5-(4-methoxyphenyl)sulfonylbenzonitrile Chemical compound C1=CC(OC)=CC=C1S(=O)(=O)C1=CC=C(F)C(C#N)=C1 BQGSRSVOLPHOPK-UHFFFAOYSA-N 0.000 description 1
- 125000002941 2-furyl group Chemical group O1C([*])=C([H])C([H])=C1[H] 0.000 description 1
- LXWIBASBIXQBGP-UHFFFAOYSA-N 2-methoxy-5-[(2,3,4,6-tetrafluorophenyl)sulfonylmethyl]phenol Chemical compound C1=C(O)C(OC)=CC=C1CS(=O)(=O)C1=C(F)C=C(F)C(F)=C1F LXWIBASBIXQBGP-UHFFFAOYSA-N 0.000 description 1
- 125000005916 2-methylpentyl group Chemical class 0.000 description 1
- 125000001622 2-naphthyl group Chemical group [H]C1=C([H])C([H])=C2C([H])=C(*)C([H])=C([H])C2=C1[H] 0.000 description 1
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 description 1
- 125000001494 2-propynyl group Chemical group [H]C#CC([H])([H])* 0.000 description 1
- 125000004105 2-pyridyl group Chemical group N1=C([*])C([H])=C([H])C([H])=C1[H] 0.000 description 1
- 125000000389 2-pyrrolyl group Chemical group [H]N1C([*])=C([H])C([H])=C1[H] 0.000 description 1
- 125000000175 2-thienyl group Chemical group S1C([*])=C([H])C([H])=C1[H] 0.000 description 1
- BHPGBZPAKCWOBS-UHFFFAOYSA-N 3-[(3,4-dimethoxyphenyl)sulfamoyl]-2,4,5,6-tetrafluorobenzoic acid Chemical compound C1=C(OC)C(OC)=CC=C1NS(=O)(=O)C1=C(F)C(F)=C(F)C(C(O)=O)=C1F BHPGBZPAKCWOBS-UHFFFAOYSA-N 0.000 description 1
- KLFUPXTUDCKRQJ-UHFFFAOYSA-N 3-[4-(dimethylamino)phenyl]sulfanyl-2,4,5,6-tetrafluorobenzoic acid Chemical compound C1=CC(N(C)C)=CC=C1SC1=C(F)C(F)=C(F)C(C(O)=O)=C1F KLFUPXTUDCKRQJ-UHFFFAOYSA-N 0.000 description 1
- JYHDUPPDVZPMCG-UHFFFAOYSA-N 3-[[4-(dimethylamino)phenyl]sulfamoyl]-2,4,5,6-tetrafluorobenzoic acid Chemical compound C1=CC(N(C)C)=CC=C1NS(=O)(=O)C1=C(F)C(F)=C(F)C(C(O)=O)=C1F JYHDUPPDVZPMCG-UHFFFAOYSA-N 0.000 description 1
- YHAFCGSUIAFUCX-UHFFFAOYSA-N 3-bromo-1,2,4,5-tetrafluorobenzene Chemical compound FC1=CC(F)=C(F)C(Br)=C1F YHAFCGSUIAFUCX-UHFFFAOYSA-N 0.000 description 1
- QQSGXHYZMIVKJU-UHFFFAOYSA-N 3-bromo-n-(3,4-dimethoxyphenyl)-2,4,5,6-tetrafluorobenzenesulfonamide Chemical compound C1=C(OC)C(OC)=CC=C1NS(=O)(=O)C1=C(F)C(F)=C(F)C(Br)=C1F QQSGXHYZMIVKJU-UHFFFAOYSA-N 0.000 description 1
- LRKHKSCBJCFBGX-UHFFFAOYSA-N 3-bromo-n-[4-(dimethylamino)phenyl]-2,4,5,6-tetrafluorobenzenesulfonamide Chemical compound C1=CC(N(C)C)=CC=C1NS(=O)(=O)C1=C(F)C(F)=C(F)C(Br)=C1F LRKHKSCBJCFBGX-UHFFFAOYSA-N 0.000 description 1
- XQVCBOLNTSUFGD-UHFFFAOYSA-N 3-chloro-4-methoxyaniline Chemical compound COC1=CC=C(N)C=C1Cl XQVCBOLNTSUFGD-UHFFFAOYSA-N 0.000 description 1
- NHQDETIJWKXCTC-UHFFFAOYSA-N 3-chloroperbenzoic acid Chemical compound OOC(=O)C1=CC=CC(Cl)=C1 NHQDETIJWKXCTC-UHFFFAOYSA-N 0.000 description 1
- ROXFFMOUAOVREQ-UHFFFAOYSA-N 3-cyano-n-(3,4-dimethoxyphenyl)-4-(trifluoromethoxy)benzenesulfonamide Chemical compound C1=C(OC)C(OC)=CC=C1NS(=O)(=O)C1=CC=C(OC(F)(F)F)C(C#N)=C1 ROXFFMOUAOVREQ-UHFFFAOYSA-N 0.000 description 1
- DRNAVIIHHMGPTJ-UHFFFAOYSA-N 3-cyano-n-(3,4-dimethoxyphenyl)-4-fluorobenzenesulfonamide Chemical compound C1=C(OC)C(OC)=CC=C1NS(=O)(=O)C1=CC=C(F)C(C#N)=C1 DRNAVIIHHMGPTJ-UHFFFAOYSA-N 0.000 description 1
- QBVLJBATAAGWLC-UHFFFAOYSA-N 3-cyano-n-(3-fluoro-4-methoxyphenyl)-4-(trifluoromethoxy)benzenesulfonamide Chemical compound C1=C(F)C(OC)=CC=C1NS(=O)(=O)C1=CC=C(OC(F)(F)F)C(C#N)=C1 QBVLJBATAAGWLC-UHFFFAOYSA-N 0.000 description 1
- WCNUHUOTUVKUMP-UHFFFAOYSA-N 3-cyano-n-(3-hydroxy-4-methoxyphenyl)-4-(trifluoromethoxy)benzenesulfonamide Chemical compound C1=C(O)C(OC)=CC=C1NS(=O)(=O)C1=CC=C(OC(F)(F)F)C(C#N)=C1 WCNUHUOTUVKUMP-UHFFFAOYSA-N 0.000 description 1
- FLFLCMDIPGQWHT-UHFFFAOYSA-N 3-cyano-n-(4-methoxyphenyl)-4-(trifluoromethoxy)benzenesulfonamide Chemical compound C1=CC(OC)=CC=C1NS(=O)(=O)C1=CC=C(OC(F)(F)F)C(C#N)=C1 FLFLCMDIPGQWHT-UHFFFAOYSA-N 0.000 description 1
- CXLIEEZLDLYSND-UHFFFAOYSA-N 3-cyano-n-[4-(dimethylamino)phenyl]-4-(trifluoromethoxy)benzenesulfonamide Chemical compound C1=CC(N(C)C)=CC=C1NS(=O)(=O)C1=CC=C(OC(F)(F)F)C(C#N)=C1 CXLIEEZLDLYSND-UHFFFAOYSA-N 0.000 description 1
- OKZSLYMOEOOCQI-UHFFFAOYSA-N 3-cyano-n-[4-(dimethylamino)phenyl]-4-fluorobenzenesulfonamide Chemical compound C1=CC(N(C)C)=CC=C1NS(=O)(=O)C1=CC=C(F)C(C#N)=C1 OKZSLYMOEOOCQI-UHFFFAOYSA-N 0.000 description 1
- LJWAPDSCYTZUJU-UHFFFAOYSA-N 3-fluoro-4-methoxyaniline Chemical compound COC1=CC=C(N)C=C1F LJWAPDSCYTZUJU-UHFFFAOYSA-N 0.000 description 1
- 125000003682 3-furyl group Chemical group O1C([H])=C([*])C([H])=C1[H] 0.000 description 1
- 125000003349 3-pyridyl group Chemical group N1=C([H])C([*])=C([H])C([H])=C1[H] 0.000 description 1
- 125000001397 3-pyrrolyl group Chemical group [H]N1C([H])=C([*])C([H])=C1[H] 0.000 description 1
- 125000001541 3-thienyl group Chemical group S1C([H])=C([*])C([H])=C1[H] 0.000 description 1
- WJCUEHQSJJOMLA-UHFFFAOYSA-N 4-(4-chloro-3-nitrophenyl)sulfonyl-n,n-dimethylaniline Chemical compound C1=CC(N(C)C)=CC=C1S(=O)(=O)C1=CC=C(Cl)C([N+]([O-])=O)=C1 WJCUEHQSJJOMLA-UHFFFAOYSA-N 0.000 description 1
- NJPGHLCNGFGWCV-UHFFFAOYSA-N 4-bromo-2,3,5-trifluoro-n-(3-fluoro-4-methoxyphenyl)benzenesulfonamide Chemical compound C1=C(F)C(OC)=CC=C1NS(=O)(=O)C1=CC(F)=C(Br)C(F)=C1F NJPGHLCNGFGWCV-UHFFFAOYSA-N 0.000 description 1
- LWTYSTOCHJQJFX-UHFFFAOYSA-N 4-bromo-2,3,5-trifluoro-n-(3-hydroxy-4-methoxyphenyl)benzenesulfonamide Chemical compound C1=C(O)C(OC)=CC=C1NS(=O)(=O)C1=CC(F)=C(Br)C(F)=C1F LWTYSTOCHJQJFX-UHFFFAOYSA-N 0.000 description 1
- HBORMIVSTQLLES-UHFFFAOYSA-N 4-bromo-2,3,5-trifluoro-n-(4-methoxyphenyl)benzenesulfonamide Chemical compound C1=CC(OC)=CC=C1NS(=O)(=O)C1=CC(F)=C(Br)C(F)=C1F HBORMIVSTQLLES-UHFFFAOYSA-N 0.000 description 1
- YGTAWVDYBKYEBR-UHFFFAOYSA-N 4-bromo-3-cyano-n-(3,4-dimethoxyphenyl)benzenesulfonamide Chemical compound C1=C(OC)C(OC)=CC=C1NS(=O)(=O)C1=CC=C(Br)C(C#N)=C1 YGTAWVDYBKYEBR-UHFFFAOYSA-N 0.000 description 1
- YQEADRLEDOALJS-UHFFFAOYSA-N 4-bromo-3-cyano-n-(3-fluoro-4-methoxyphenyl)benzenesulfonamide Chemical compound C1=C(F)C(OC)=CC=C1NS(=O)(=O)C1=CC=C(Br)C(C#N)=C1 YQEADRLEDOALJS-UHFFFAOYSA-N 0.000 description 1
- CFRVSPCGPDWRBD-UHFFFAOYSA-N 4-bromo-3-cyano-n-(3-hydroxy-4-methoxyphenyl)benzenesulfonamide Chemical compound C1=C(O)C(OC)=CC=C1NS(=O)(=O)C1=CC=C(Br)C(C#N)=C1 CFRVSPCGPDWRBD-UHFFFAOYSA-N 0.000 description 1
- IRMKCYYXGDABSY-UHFFFAOYSA-N 4-bromo-3-cyano-n-(4-methoxyphenyl)benzenesulfonamide Chemical compound C1=CC(OC)=CC=C1NS(=O)(=O)C1=CC=C(Br)C(C#N)=C1 IRMKCYYXGDABSY-UHFFFAOYSA-N 0.000 description 1
- OLHKGYBQAZAXEK-UHFFFAOYSA-N 4-bromo-3-cyano-n-[4-(dimethylamino)phenyl]benzenesulfonamide Chemical compound C1=CC(N(C)C)=CC=C1NS(=O)(=O)C1=CC=C(Br)C(C#N)=C1 OLHKGYBQAZAXEK-UHFFFAOYSA-N 0.000 description 1
- VDGOAZFGSWBXBT-UHFFFAOYSA-N 4-bromo-n-(3,4-dimethoxyphenyl)-2,3,5,6-tetrafluorobenzenesulfonamide Chemical compound C1=C(OC)C(OC)=CC=C1NS(=O)(=O)C1=C(F)C(F)=C(Br)C(F)=C1F VDGOAZFGSWBXBT-UHFFFAOYSA-N 0.000 description 1
- BCSHHEPSTQQXHU-UHFFFAOYSA-N 4-bromo-n-(3,4-dimethoxyphenyl)-2,3,5-trifluorobenzenesulfonamide Chemical compound C1=C(OC)C(OC)=CC=C1NS(=O)(=O)C1=CC(F)=C(Br)C(F)=C1F BCSHHEPSTQQXHU-UHFFFAOYSA-N 0.000 description 1
- QLXJAMLIMRFEJJ-UHFFFAOYSA-N 4-bromo-n-(3,4-dimethoxyphenyl)-3-nitrobenzenesulfonamide Chemical compound C1=C(OC)C(OC)=CC=C1NS(=O)(=O)C1=CC=C(Br)C([N+]([O-])=O)=C1 QLXJAMLIMRFEJJ-UHFFFAOYSA-N 0.000 description 1
- BVRSYLSTJVXSAQ-UHFFFAOYSA-N 4-bromo-n-(3-fluoro-4-methoxyphenyl)-3-nitrobenzenesulfonamide Chemical compound C1=C(F)C(OC)=CC=C1NS(=O)(=O)C1=CC=C(Br)C([N+]([O-])=O)=C1 BVRSYLSTJVXSAQ-UHFFFAOYSA-N 0.000 description 1
- HMLJOMYNFYOAFY-UHFFFAOYSA-N 4-bromo-n-(3-hydroxy-4-methoxyphenyl)-3-nitrobenzenesulfonamide Chemical compound C1=C(O)C(OC)=CC=C1NS(=O)(=O)C1=CC=C(Br)C([N+]([O-])=O)=C1 HMLJOMYNFYOAFY-UHFFFAOYSA-N 0.000 description 1
- MZMBDAIFEPVKLN-UHFFFAOYSA-N 4-bromo-n-(4-methoxyphenyl)-3-nitrobenzenesulfonamide Chemical compound C1=CC(OC)=CC=C1NS(=O)(=O)C1=CC=C(Br)C([N+]([O-])=O)=C1 MZMBDAIFEPVKLN-UHFFFAOYSA-N 0.000 description 1
- IXYABTADRMSBNC-UHFFFAOYSA-N 4-bromo-n-[4-(dimethylamino)phenyl]-2,3,5,6-tetrafluorobenzenesulfonamide Chemical compound C1=CC(N(C)C)=CC=C1NS(=O)(=O)C1=C(F)C(F)=C(Br)C(F)=C1F IXYABTADRMSBNC-UHFFFAOYSA-N 0.000 description 1
- DQMVXLIMBAOSHJ-UHFFFAOYSA-N 4-bromo-n-[4-(dimethylamino)phenyl]-2,3,5-trifluorobenzenesulfonamide Chemical compound C1=CC(N(C)C)=CC=C1NS(=O)(=O)C1=CC(F)=C(Br)C(F)=C1F DQMVXLIMBAOSHJ-UHFFFAOYSA-N 0.000 description 1
- JJFQLVHULQCQRF-UHFFFAOYSA-N 4-bromo-n-[4-(dimethylamino)phenyl]-3-nitrobenzenesulfonamide Chemical compound C1=CC(N(C)C)=CC=C1NS(=O)(=O)C1=CC=C(Br)C([N+]([O-])=O)=C1 JJFQLVHULQCQRF-UHFFFAOYSA-N 0.000 description 1
- SDSAPRHTHABGDY-UHFFFAOYSA-N 4-chloro-2,3,5,6-tetrafluorobenzenesulfonyl chloride Chemical compound FC1=C(F)C(S(Cl)(=O)=O)=C(F)C(F)=C1Cl SDSAPRHTHABGDY-UHFFFAOYSA-N 0.000 description 1
- ITKPYFAMBCMGQH-UHFFFAOYSA-N 4-chloro-2,3,5-trifluoro-n-(3-fluoro-4-methoxyphenyl)benzenesulfonamide Chemical compound C1=C(F)C(OC)=CC=C1NS(=O)(=O)C1=CC(F)=C(Cl)C(F)=C1F ITKPYFAMBCMGQH-UHFFFAOYSA-N 0.000 description 1
- JVCGJYIBSYYQQV-UHFFFAOYSA-N 4-chloro-2,3,5-trifluoro-n-(3-hydroxy-4-methoxyphenyl)benzenesulfonamide Chemical compound C1=C(O)C(OC)=CC=C1NS(=O)(=O)C1=CC(F)=C(Cl)C(F)=C1F JVCGJYIBSYYQQV-UHFFFAOYSA-N 0.000 description 1
- JLRDZZSDWCODTE-UHFFFAOYSA-N 4-chloro-2,3,5-trifluoro-n-(4-methoxyphenyl)benzenesulfonamide Chemical compound C1=CC(OC)=CC=C1NS(=O)(=O)C1=CC(F)=C(Cl)C(F)=C1F JLRDZZSDWCODTE-UHFFFAOYSA-N 0.000 description 1
- OILVNLRSJZVLGC-UHFFFAOYSA-N 4-chloro-3-cyano-n-(3,4-dimethoxyphenyl)benzenesulfonamide Chemical compound C1=C(OC)C(OC)=CC=C1NS(=O)(=O)C1=CC=C(Cl)C(C#N)=C1 OILVNLRSJZVLGC-UHFFFAOYSA-N 0.000 description 1
- SDQQFUHZJVEGJZ-UHFFFAOYSA-N 4-chloro-3-cyano-n-[4-(dimethylamino)phenyl]benzenesulfonamide Chemical compound C1=CC(N(C)C)=CC=C1NS(=O)(=O)C1=CC=C(Cl)C(C#N)=C1 SDQQFUHZJVEGJZ-UHFFFAOYSA-N 0.000 description 1
- RXHQROYVYZQDRL-UHFFFAOYSA-N 4-chloro-n-(3,4-dimethoxyphenyl)-2,3,5,6-tetrafluorobenzenesulfonamide Chemical compound C1=C(OC)C(OC)=CC=C1NS(=O)(=O)C1=C(F)C(F)=C(Cl)C(F)=C1F RXHQROYVYZQDRL-UHFFFAOYSA-N 0.000 description 1
- ZDQZOQPJNDXFBT-UHFFFAOYSA-N 4-chloro-n-(3,4-dimethoxyphenyl)-2,3,5-trifluorobenzenesulfonamide Chemical compound C1=C(OC)C(OC)=CC=C1NS(=O)(=O)C1=CC(F)=C(Cl)C(F)=C1F ZDQZOQPJNDXFBT-UHFFFAOYSA-N 0.000 description 1
- VECXZRAVCCVMMM-UHFFFAOYSA-N 4-chloro-n-(3,4-dimethoxyphenyl)-3-nitrobenzenesulfonamide Chemical compound C1=C(OC)C(OC)=CC=C1NS(=O)(=O)C1=CC=C(Cl)C([N+]([O-])=O)=C1 VECXZRAVCCVMMM-UHFFFAOYSA-N 0.000 description 1
- ZARAKCIKPBGLMM-UHFFFAOYSA-N 4-chloro-n-(4-methoxyphenyl)-3-nitrobenzenesulfonamide Chemical compound C1=CC(OC)=CC=C1NS(=O)(=O)C1=CC=C(Cl)C([N+]([O-])=O)=C1 ZARAKCIKPBGLMM-UHFFFAOYSA-N 0.000 description 1
- HQMPUGJFXMKKQG-UHFFFAOYSA-N 4-chloro-n-[4-(dimethylamino)phenyl]-2,3,5,6-tetrafluorobenzenesulfonamide Chemical compound C1=CC(N(C)C)=CC=C1NS(=O)(=O)C1=C(F)C(F)=C(Cl)C(F)=C1F HQMPUGJFXMKKQG-UHFFFAOYSA-N 0.000 description 1
- CYEDPCHLRVYTPO-UHFFFAOYSA-N 4-chloro-n-[4-(dimethylamino)phenyl]-2,3,5-trifluorobenzenesulfonamide Chemical compound C1=CC(N(C)C)=CC=C1NS(=O)(=O)C1=CC(F)=C(Cl)C(F)=C1F CYEDPCHLRVYTPO-UHFFFAOYSA-N 0.000 description 1
- ZHIBDXKXHQKCIS-UHFFFAOYSA-N 4-chloro-n-[4-(dimethylamino)phenyl]-3-nitrobenzenesulfonamide Chemical compound C1=CC(N(C)C)=CC=C1NS(=O)(=O)C1=CC=C(Cl)C([N+]([O-])=O)=C1 ZHIBDXKXHQKCIS-UHFFFAOYSA-N 0.000 description 1
- HFGHRUCCKVYFKL-UHFFFAOYSA-N 4-ethoxy-2-piperazin-1-yl-7-pyridin-4-yl-5h-pyrimido[5,4-b]indole Chemical compound C1=C2NC=3C(OCC)=NC(N4CCNCC4)=NC=3C2=CC=C1C1=CC=NC=C1 HFGHRUCCKVYFKL-UHFFFAOYSA-N 0.000 description 1
- 125000000339 4-pyridyl group Chemical group N1=C([H])C([H])=C([*])C([H])=C1[H] 0.000 description 1
- KDDQRKBRJSGMQE-UHFFFAOYSA-N 4-thiazolyl Chemical group [C]1=CSC=N1 KDDQRKBRJSGMQE-UHFFFAOYSA-N 0.000 description 1
- IGLJDKFQWCNICI-UHFFFAOYSA-N 5-(4-fluoro-3-nitrophenyl)sulfonyl-2-methoxyphenol Chemical compound C1=C(O)C(OC)=CC=C1S(=O)(=O)C1=CC=C(F)C([N+]([O-])=O)=C1 IGLJDKFQWCNICI-UHFFFAOYSA-N 0.000 description 1
- POUANJRYNOEXMC-UHFFFAOYSA-N 5-[(2-bromo-3,4,5,6-tetrafluorophenyl)sulfonylmethyl]-2-methoxyphenol Chemical compound C1=C(O)C(OC)=CC=C1CS(=O)(=O)C1=C(F)C(F)=C(F)C(F)=C1Br POUANJRYNOEXMC-UHFFFAOYSA-N 0.000 description 1
- FTBFLXWCCDGUPN-UHFFFAOYSA-N 5-[(3,4-dimethoxyphenyl)methylsulfonyl]-2-fluorobenzonitrile Chemical compound C1=C(OC)C(OC)=CC=C1CS(=O)(=O)C1=CC=C(F)C(C#N)=C1 FTBFLXWCCDGUPN-UHFFFAOYSA-N 0.000 description 1
- QNDSWUGMAGXGHB-UHFFFAOYSA-N 5-[(3,4-dimethoxyphenyl)sulfamoyl]-2,3,4-trifluorobenzoic acid Chemical compound C1=C(OC)C(OC)=CC=C1NS(=O)(=O)C1=CC(C(O)=O)=C(F)C(F)=C1F QNDSWUGMAGXGHB-UHFFFAOYSA-N 0.000 description 1
- OOXGQWGJTYHDMH-UHFFFAOYSA-N 5-[(3,4-dimethoxyphenyl)sulfamoyl]-2-(trifluoromethoxy)benzoic acid Chemical compound C1=C(OC)C(OC)=CC=C1NS(=O)(=O)C1=CC=C(OC(F)(F)F)C(C(O)=O)=C1 OOXGQWGJTYHDMH-UHFFFAOYSA-N 0.000 description 1
- XMSQWWPWFOQZCF-UHFFFAOYSA-N 5-[(3-fluoro-4-methoxyphenyl)sulfamoyl]-2-(trifluoromethoxy)benzoic acid Chemical compound C1=C(F)C(OC)=CC=C1NS(=O)(=O)C1=CC=C(OC(F)(F)F)C(C(O)=O)=C1 XMSQWWPWFOQZCF-UHFFFAOYSA-N 0.000 description 1
- UMOVQYGNMVQXSK-UHFFFAOYSA-N 5-[(3-hydroxy-4-methoxyphenyl)sulfamoyl]-2-(trifluoromethoxy)benzoic acid Chemical compound C1=C(O)C(OC)=CC=C1NS(=O)(=O)C1=CC=C(OC(F)(F)F)C(C(O)=O)=C1 UMOVQYGNMVQXSK-UHFFFAOYSA-N 0.000 description 1
- LTLHSJWWDFUVPR-UHFFFAOYSA-N 5-[(4-fluoro-3-nitrophenyl)sulfonylmethyl]-2-methoxyphenol Chemical compound C1=C(O)C(OC)=CC=C1CS(=O)(=O)C1=CC=C(F)C([N+]([O-])=O)=C1 LTLHSJWWDFUVPR-UHFFFAOYSA-N 0.000 description 1
- XJZQPZWIVYNEBN-UHFFFAOYSA-N 5-[(4-methoxyphenyl)sulfamoyl]-2-(trifluoromethoxy)benzoic acid Chemical compound C1=CC(OC)=CC=C1NS(=O)(=O)C1=CC=C(OC(F)(F)F)C(C(O)=O)=C1 XJZQPZWIVYNEBN-UHFFFAOYSA-N 0.000 description 1
- PZBIGVICNQQFOR-UHFFFAOYSA-N 5-[4-(dimethylamino)phenyl]sulfonyl-2,3,4-trifluorobenzoic acid Chemical compound C1=CC(N(C)C)=CC=C1S(=O)(=O)C1=CC(C(O)=O)=C(F)C(F)=C1F PZBIGVICNQQFOR-UHFFFAOYSA-N 0.000 description 1
- RJQNZBKNPDZAAQ-UHFFFAOYSA-N 5-[[4-(dimethylamino)phenyl]sulfamoyl]-2,3,4-trifluorobenzoic acid Chemical compound C1=CC(N(C)C)=CC=C1NS(=O)(=O)C1=CC(C(O)=O)=C(F)C(F)=C1F RJQNZBKNPDZAAQ-UHFFFAOYSA-N 0.000 description 1
- XVEPWYUGOXMVJU-UHFFFAOYSA-N 5-bromo-n-(3,4-dimethoxyphenyl)-2,3,4-trifluorobenzenesulfonamide Chemical compound C1=C(OC)C(OC)=CC=C1NS(=O)(=O)C1=CC(Br)=C(F)C(F)=C1F XVEPWYUGOXMVJU-UHFFFAOYSA-N 0.000 description 1
- CWDWFSXUQODZGW-UHFFFAOYSA-N 5-thiazolyl Chemical group [C]1=CN=CS1 CWDWFSXUQODZGW-UHFFFAOYSA-N 0.000 description 1
- IZVFFXVYBHFIHY-SKCNUYALSA-N 5alpha-cholest-7-en-3beta-ol Chemical compound C1[C@@H](O)CC[C@]2(C)[C@@H](CC[C@@]3([C@@H]([C@H](C)CCCC(C)C)CC[C@H]33)C)C3=CC[C@H]21 IZVFFXVYBHFIHY-SKCNUYALSA-N 0.000 description 1
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical group [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 1
- QGZKDVFQNNGYKY-UHFFFAOYSA-O Ammonium Chemical compound [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 description 1
- 102000006991 Apolipoprotein B-100 Human genes 0.000 description 1
- 108010008150 Apolipoprotein B-100 Proteins 0.000 description 1
- 102100029470 Apolipoprotein E Human genes 0.000 description 1
- 101710095339 Apolipoprotein E Proteins 0.000 description 1
- 208000023275 Autoimmune disease Diseases 0.000 description 1
- 241000894006 Bacteria Species 0.000 description 1
- LSNNMFCWUKXFEE-UHFFFAOYSA-M Bisulfite Chemical compound OS([O-])=O LSNNMFCWUKXFEE-UHFFFAOYSA-M 0.000 description 1
- 102000015081 Blood Coagulation Factors Human genes 0.000 description 1
- 108010039209 Blood Coagulation Factors Proteins 0.000 description 1
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 1
- COVZYZSDYWQREU-UHFFFAOYSA-N Busulfan Chemical compound CS(=O)(=O)OCCCCOS(C)(=O)=O COVZYZSDYWQREU-UHFFFAOYSA-N 0.000 description 1
- 125000000882 C2-C6 alkenyl group Chemical group 0.000 description 1
- 125000003601 C2-C6 alkynyl group Chemical group 0.000 description 1
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 1
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 1
- 102000000844 Cell Surface Receptors Human genes 0.000 description 1
- 108010001857 Cell Surface Receptors Proteins 0.000 description 1
- KZBUYRJDOAKODT-UHFFFAOYSA-N Chlorine Chemical compound ClCl KZBUYRJDOAKODT-UHFFFAOYSA-N 0.000 description 1
- 229920001268 Cholestyramine Polymers 0.000 description 1
- 229920002911 Colestipol Polymers 0.000 description 1
- 208000035473 Communicable disease Diseases 0.000 description 1
- 229910021591 Copper(I) chloride Inorganic materials 0.000 description 1
- 241000699800 Cricetinae Species 0.000 description 1
- 239000012624 DNA alkylating agent Substances 0.000 description 1
- 239000012625 DNA intercalator Substances 0.000 description 1
- 229940122029 DNA synthesis inhibitor Drugs 0.000 description 1
- 201000004624 Dermatitis Diseases 0.000 description 1
- VYZAHLCBVHPDDF-UHFFFAOYSA-N Dinitrochlorobenzene Chemical compound [O-][N+](=O)C1=CC=C(Cl)C([N+]([O-])=O)=C1 VYZAHLCBVHPDDF-UHFFFAOYSA-N 0.000 description 1
- 208000032928 Dyslipidaemia Diseases 0.000 description 1
- 206010014476 Elevated cholesterol Diseases 0.000 description 1
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 description 1
- GHASVSINZRGABV-UHFFFAOYSA-N Fluorouracil Chemical compound FC1=CNC(=O)NC1=O GHASVSINZRGABV-UHFFFAOYSA-N 0.000 description 1
- 229940123414 Folate antagonist Drugs 0.000 description 1
- 241000233866 Fungi Species 0.000 description 1
- 108010010803 Gelatin Proteins 0.000 description 1
- 108700039691 Genetic Promoter Regions Proteins 0.000 description 1
- 241000026944 Giovanella Species 0.000 description 1
- 206010018364 Glomerulonephritis Diseases 0.000 description 1
- WQZGKKKJIJFFOK-GASJEMHNSA-N Glucose Natural products OC[C@H]1OC(O)[C@H](O)[C@@H](O)[C@@H]1O WQZGKKKJIJFFOK-GASJEMHNSA-N 0.000 description 1
- 102000003886 Glycoproteins Human genes 0.000 description 1
- 108090000288 Glycoproteins Proteins 0.000 description 1
- 208000031886 HIV Infections Diseases 0.000 description 1
- 208000037357 HIV infectious disease Diseases 0.000 description 1
- 229940121710 HMGCoA reductase inhibitor Drugs 0.000 description 1
- 241001446459 Heia Species 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- 206010061218 Inflammation Diseases 0.000 description 1
- 206010022562 Intermittent claudication Diseases 0.000 description 1
- 238000008214 LDL Cholesterol Methods 0.000 description 1
- 102000004882 Lipase Human genes 0.000 description 1
- 108090001060 Lipase Proteins 0.000 description 1
- 108010013563 Lipoprotein Lipase Proteins 0.000 description 1
- 102100022119 Lipoprotein lipase Human genes 0.000 description 1
- WHXSMMKQMYFTQS-UHFFFAOYSA-N Lithium Chemical compound [Li] WHXSMMKQMYFTQS-UHFFFAOYSA-N 0.000 description 1
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 1
- 241001465754 Metazoa Species 0.000 description 1
- 241000699670 Mus sp. Species 0.000 description 1
- ZDZOTLJHXYCWBA-VCVYQWHSSA-N N-debenzoyl-N-(tert-butoxycarbonyl)-10-deacetyltaxol Chemical compound O([C@H]1[C@H]2[C@@](C([C@H](O)C3=C(C)[C@@H](OC(=O)[C@H](O)[C@@H](NC(=O)OC(C)(C)C)C=4C=CC=CC=4)C[C@]1(O)C3(C)C)=O)(C)[C@@H](O)C[C@H]1OC[C@]12OC(=O)C)C(=O)C1=CC=CC=C1 ZDZOTLJHXYCWBA-VCVYQWHSSA-N 0.000 description 1
- 238000005481 NMR spectroscopy Methods 0.000 description 1
- 241000208125 Nicotiana Species 0.000 description 1
- 235000002637 Nicotiana tabacum Nutrition 0.000 description 1
- 108091028043 Nucleic acid sequence Proteins 0.000 description 1
- 102000004316 Oxidoreductases Human genes 0.000 description 1
- 108090000854 Oxidoreductases Proteins 0.000 description 1
- 102000019280 Pancreatic lipases Human genes 0.000 description 1
- 108050006759 Pancreatic lipases Proteins 0.000 description 1
- 206010034133 Pathogen resistance Diseases 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- TUZYXOIXSAXUGO-UHFFFAOYSA-N Pravastatin Natural products C1=CC(C)C(CCC(O)CC(O)CC(O)=O)C2C(OC(=O)C(C)CC)CC(O)C=C21 TUZYXOIXSAXUGO-UHFFFAOYSA-N 0.000 description 1
- 201000001263 Psoriatic Arthritis Diseases 0.000 description 1
- 208000036824 Psoriatic arthropathy Diseases 0.000 description 1
- 206010037575 Pustular psoriasis Diseases 0.000 description 1
- 108091027981 Response element Proteins 0.000 description 1
- RYMZZMVNJRMUDD-UHFFFAOYSA-N SJ000286063 Natural products C12C(OC(=O)C(C)(C)CC)CC(C)C=C2C=CC(C)C1CCC1CC(O)CC(=O)O1 RYMZZMVNJRMUDD-UHFFFAOYSA-N 0.000 description 1
- AJLFOPYRIVGYMJ-UHFFFAOYSA-N SJ000287055 Natural products C12C(OC(=O)C(C)CC)CCC=C2C=CC(C)C1CCC1CC(O)CC(=O)O1 AJLFOPYRIVGYMJ-UHFFFAOYSA-N 0.000 description 1
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical class [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 1
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 1
- 102000001494 Sterol O-Acyltransferase Human genes 0.000 description 1
- 108010054082 Sterol O-acyltransferase Proteins 0.000 description 1
- 208000006011 Stroke Diseases 0.000 description 1
- 206010052779 Transplant rejections Diseases 0.000 description 1
- DTQVDTLACAAQTR-UHFFFAOYSA-M Trifluoroacetate Chemical compound [O-]C(=O)C(F)(F)F DTQVDTLACAAQTR-UHFFFAOYSA-M 0.000 description 1
- 102000004243 Tubulin Human genes 0.000 description 1
- 108090000704 Tubulin Proteins 0.000 description 1
- 208000036142 Viral infection Diseases 0.000 description 1
- 238000005263 ab initio calculation Methods 0.000 description 1
- 238000010521 absorption reaction Methods 0.000 description 1
- 230000004913 activation Effects 0.000 description 1
- 125000002252 acyl group Chemical group 0.000 description 1
- 210000000577 adipose tissue Anatomy 0.000 description 1
- 229940009456 adriamycin Drugs 0.000 description 1
- 150000001335 aliphatic alkanes Chemical class 0.000 description 1
- 150000001336 alkenes Chemical class 0.000 description 1
- HSFWRNGVRCDJHI-UHFFFAOYSA-N alpha-acetylene Natural products C#C HSFWRNGVRCDJHI-UHFFFAOYSA-N 0.000 description 1
- 150000001413 amino acids Chemical class 0.000 description 1
- 238000004458 analytical method Methods 0.000 description 1
- 239000003524 antilipemic agent Substances 0.000 description 1
- 229940041181 antineoplastic drug Drugs 0.000 description 1
- 239000003963 antioxidant agent Substances 0.000 description 1
- 230000003078 antioxidant effect Effects 0.000 description 1
- 238000013459 approach Methods 0.000 description 1
- 238000007080 aromatic substitution reaction Methods 0.000 description 1
- 210000001367 artery Anatomy 0.000 description 1
- 125000001769 aryl amino group Chemical group 0.000 description 1
- 150000001499 aryl bromides Chemical class 0.000 description 1
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 1
- 238000011888 autopsy Methods 0.000 description 1
- 125000000852 azido group Chemical group *N=[N+]=[N-] 0.000 description 1
- 230000001580 bacterial effect Effects 0.000 description 1
- 230000004888 barrier function Effects 0.000 description 1
- 230000008901 benefit Effects 0.000 description 1
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid group Chemical group C(C1=CC=CC=C1)(=O)O WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 1
- 125000002618 bicyclic heterocycle group Chemical group 0.000 description 1
- 229920000080 bile acid sequestrant Polymers 0.000 description 1
- 229940096699 bile acid sequestrants Drugs 0.000 description 1
- 210000000013 bile duct Anatomy 0.000 description 1
- 230000004071 biological effect Effects 0.000 description 1
- 230000017531 blood circulation Effects 0.000 description 1
- 239000003114 blood coagulation factor Substances 0.000 description 1
- 230000036772 blood pressure Effects 0.000 description 1
- 210000001217 buttock Anatomy 0.000 description 1
- 239000011575 calcium Substances 0.000 description 1
- 229910052791 calcium Inorganic materials 0.000 description 1
- 239000011203 carbon fibre reinforced carbon Substances 0.000 description 1
- 210000004413 cardiac myocyte Anatomy 0.000 description 1
- 239000003054 catalyst Substances 0.000 description 1
- 230000003197 catalytic effect Effects 0.000 description 1
- 238000004113 cell culture Methods 0.000 description 1
- 230000019522 cellular metabolic process Effects 0.000 description 1
- 208000019065 cervical carcinoma Diseases 0.000 description 1
- 239000003610 charcoal Substances 0.000 description 1
- 239000007806 chemical reaction intermediate Substances 0.000 description 1
- 239000003153 chemical reaction reagent Substances 0.000 description 1
- 238000002512 chemotherapy Methods 0.000 description 1
- 239000012320 chlorinating reagent Substances 0.000 description 1
- 150000001805 chlorine compounds Chemical class 0.000 description 1
- 230000031154 cholesterol homeostasis Effects 0.000 description 1
- 150000001841 cholesterols Chemical class 0.000 description 1
- 230000001684 chronic effect Effects 0.000 description 1
- 230000004087 circulation Effects 0.000 description 1
- 208000024980 claudication Diseases 0.000 description 1
- 229960001214 clofibrate Drugs 0.000 description 1
- KNHUKKLJHYUCFP-UHFFFAOYSA-N clofibrate Chemical compound CCOC(=O)C(C)(C)OC1=CC=C(Cl)C=C1 KNHUKKLJHYUCFP-UHFFFAOYSA-N 0.000 description 1
- 230000035602 clotting Effects 0.000 description 1
- 210000002314 coated vesicle Anatomy 0.000 description 1
- 229960001338 colchicine Drugs 0.000 description 1
- 229960002604 colestipol Drugs 0.000 description 1
- GMRWGQCZJGVHKL-UHFFFAOYSA-N colestipol Chemical compound ClCC1CO1.NCCNCCNCCNCCN GMRWGQCZJGVHKL-UHFFFAOYSA-N 0.000 description 1
- 235000009508 confectionery Nutrition 0.000 description 1
- OXBLHERUFWYNTN-UHFFFAOYSA-M copper(I) chloride Chemical compound [Cu]Cl OXBLHERUFWYNTN-UHFFFAOYSA-M 0.000 description 1
- 239000003246 corticosteroid Substances 0.000 description 1
- 229960001334 corticosteroids Drugs 0.000 description 1
- 230000008878 coupling Effects 0.000 description 1
- 238000010168 coupling process Methods 0.000 description 1
- 238000005859 coupling reaction Methods 0.000 description 1
- 239000006071 cream Substances 0.000 description 1
- 229940045803 cuprous chloride Drugs 0.000 description 1
- 125000004093 cyano group Chemical group *C#N 0.000 description 1
- WZHCOOQXZCIUNC-UHFFFAOYSA-N cyclandelate Chemical compound C1C(C)(C)CC(C)CC1OC(=O)C(O)C1=CC=CC=C1 WZHCOOQXZCIUNC-UHFFFAOYSA-N 0.000 description 1
- 125000000582 cycloheptyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- 125000001511 cyclopentyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- 231100000433 cytotoxic Toxicity 0.000 description 1
- 238000001212 derivatisation Methods 0.000 description 1
- 238000006193 diazotization reaction Methods 0.000 description 1
- 102000038379 digestive enzymes Human genes 0.000 description 1
- 108091007734 digestive enzymes Proteins 0.000 description 1
- 239000003085 diluting agent Substances 0.000 description 1
- 230000003467 diminishing effect Effects 0.000 description 1
- 208000035475 disorder Diseases 0.000 description 1
- 238000006073 displacement reaction Methods 0.000 description 1
- 238000009826 distribution Methods 0.000 description 1
- 229960003668 docetaxel Drugs 0.000 description 1
- 229960004679 doxorubicin Drugs 0.000 description 1
- 210000001513 elbow Anatomy 0.000 description 1
- 238000003379 elimination reaction Methods 0.000 description 1
- 210000003989 endothelium vascular Anatomy 0.000 description 1
- 230000002708 enhancing effect Effects 0.000 description 1
- 230000010235 enterohepatic circulation Effects 0.000 description 1
- 210000002615 epidermis Anatomy 0.000 description 1
- 210000002919 epithelial cell Anatomy 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 125000002534 ethynyl group Chemical group [H]C#C* 0.000 description 1
- 238000011156 evaluation Methods 0.000 description 1
- 239000000284 extract Substances 0.000 description 1
- 210000004709 eyebrow Anatomy 0.000 description 1
- 230000008713 feedback mechanism Effects 0.000 description 1
- 229960002297 fenofibrate Drugs 0.000 description 1
- YMTINGFKWWXKFG-UHFFFAOYSA-N fenofibrate Chemical compound C1=CC(OC(C)(C)C(=O)OC(C)C)=CC=C1C(=O)C1=CC=C(Cl)C=C1 YMTINGFKWWXKFG-UHFFFAOYSA-N 0.000 description 1
- 239000000706 filtrate Substances 0.000 description 1
- 239000011737 fluorine Substances 0.000 description 1
- 125000001153 fluoro group Chemical group F* 0.000 description 1
- 229960002949 fluorouracil Drugs 0.000 description 1
- 239000004052 folic acid antagonist Substances 0.000 description 1
- 239000012634 fragment Substances 0.000 description 1
- 239000007789 gas Substances 0.000 description 1
- 239000008273 gelatin Substances 0.000 description 1
- 229920000159 gelatin Polymers 0.000 description 1
- 235000019322 gelatine Nutrition 0.000 description 1
- 235000011852 gelatine desserts Nutrition 0.000 description 1
- 210000004392 genitalia Anatomy 0.000 description 1
- 239000012362 glacial acetic acid Substances 0.000 description 1
- 210000003904 glomerular cell Anatomy 0.000 description 1
- 239000008103 glucose Substances 0.000 description 1
- PEDCQBHIVMGVHV-UHFFFAOYSA-N glycerol group Chemical group OCC(O)CO PEDCQBHIVMGVHV-UHFFFAOYSA-N 0.000 description 1
- 125000005843 halogen group Chemical group 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 125000005241 heteroarylamino group Chemical group 0.000 description 1
- 230000009097 homeostatic mechanism Effects 0.000 description 1
- 238000001794 hormone therapy Methods 0.000 description 1
- 208000033519 human immunodeficiency virus infectious disease Diseases 0.000 description 1
- XMBWDFGMSWQBCA-UHFFFAOYSA-N hydrogen iodide Chemical group I XMBWDFGMSWQBCA-UHFFFAOYSA-N 0.000 description 1
- 230000002209 hydrophobic effect Effects 0.000 description 1
- 239000002471 hydroxymethylglutaryl coenzyme A reductase inhibitor Substances 0.000 description 1
- 208000006575 hypertriglyceridemia Diseases 0.000 description 1
- 229960001101 ifosfamide Drugs 0.000 description 1
- HOMGKSMUEGBAAB-UHFFFAOYSA-N ifosfamide Chemical compound ClCCNP1(=O)OCCCN1CCCl HOMGKSMUEGBAAB-UHFFFAOYSA-N 0.000 description 1
- 210000002865 immune cell Anatomy 0.000 description 1
- 238000001727 in vivo Methods 0.000 description 1
- 230000002458 infectious effect Effects 0.000 description 1
- 210000004969 inflammatory cell Anatomy 0.000 description 1
- 230000002757 inflammatory effect Effects 0.000 description 1
- 230000004054 inflammatory process Effects 0.000 description 1
- 230000005764 inhibitory process Effects 0.000 description 1
- 230000003993 interaction Effects 0.000 description 1
- 210000000936 intestine Anatomy 0.000 description 1
- 230000003834 intracellular effect Effects 0.000 description 1
- 150000004694 iodide salts Chemical class 0.000 description 1
- 150000002500 ions Chemical class 0.000 description 1
- 230000002427 irreversible effect Effects 0.000 description 1
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 230000000155 isotopic effect Effects 0.000 description 1
- 210000002510 keratinocyte Anatomy 0.000 description 1
- 210000003292 kidney cell Anatomy 0.000 description 1
- 230000002147 killing effect Effects 0.000 description 1
- 210000003127 knee Anatomy 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 229910052744 lithium Inorganic materials 0.000 description 1
- DLEDOFVPSDKWEF-UHFFFAOYSA-N lithium butane Chemical compound [Li+].CCC[CH2-] DLEDOFVPSDKWEF-UHFFFAOYSA-N 0.000 description 1
- 239000007937 lozenge Substances 0.000 description 1
- 210000003712 lysosome Anatomy 0.000 description 1
- 230000001868 lysosomic effect Effects 0.000 description 1
- 159000000003 magnesium salts Chemical class 0.000 description 1
- 201000004792 malaria Diseases 0.000 description 1
- 239000003550 marker Substances 0.000 description 1
- 238000004949 mass spectrometry Methods 0.000 description 1
- 238000001819 mass spectrum Methods 0.000 description 1
- 239000002609 medium Substances 0.000 description 1
- 230000002503 metabolic effect Effects 0.000 description 1
- 229950009116 mevastatin Drugs 0.000 description 1
- AJLFOPYRIVGYMJ-INTXDZFKSA-N mevastatin Chemical compound C([C@H]1[C@@H](C)C=CC2=CCC[C@@H]([C@H]12)OC(=O)[C@@H](C)CC)C[C@@H]1C[C@@H](O)CC(=O)O1 AJLFOPYRIVGYMJ-INTXDZFKSA-N 0.000 description 1
- BOZILQFLQYBIIY-UHFFFAOYSA-N mevastatin hydroxy acid Natural products C1=CC(C)C(CCC(O)CC(O)CC(O)=O)C2C(OC(=O)C(C)CC)CCC=C21 BOZILQFLQYBIIY-UHFFFAOYSA-N 0.000 description 1
- 150000007522 mineralic acids Chemical class 0.000 description 1
- 238000012986 modification Methods 0.000 description 1
- 230000004048 modification Effects 0.000 description 1
- 125000002950 monocyclic group Chemical group 0.000 description 1
- 125000004572 morpholin-3-yl group Chemical group N1C(COCC1)* 0.000 description 1
- 125000004573 morpholin-4-yl group Chemical group N1(CCOCC1)* 0.000 description 1
- 210000003205 muscle Anatomy 0.000 description 1
- ZTFANDLOWOQSPC-UHFFFAOYSA-N n-(3,4-dimethoxyphenyl)-2,3,4,5-tetrafluorobenzenesulfonamide Chemical compound C1=C(OC)C(OC)=CC=C1NS(=O)(=O)C1=CC(F)=C(F)C(F)=C1F ZTFANDLOWOQSPC-UHFFFAOYSA-N 0.000 description 1
- FEKVRRGYZMDXPK-UHFFFAOYSA-N n-(3,4-dimethoxyphenyl)-2,3,5,6-tetrafluoro-4-(trifluoromethoxy)benzenesulfonamide Chemical compound C1=C(OC)C(OC)=CC=C1NS(=O)(=O)C1=C(F)C(F)=C(OC(F)(F)F)C(F)=C1F FEKVRRGYZMDXPK-UHFFFAOYSA-N 0.000 description 1
- DTTCEAMBTOMSQU-UHFFFAOYSA-N n-(3,4-dimethoxyphenyl)-3,4,5-trifluorobenzenesulfonamide Chemical compound C1=C(OC)C(OC)=CC=C1NS(=O)(=O)C1=CC(F)=C(F)C(F)=C1 DTTCEAMBTOMSQU-UHFFFAOYSA-N 0.000 description 1
- HRGJLHLAYOURMR-UHFFFAOYSA-N n-(3,4-dimethoxyphenyl)-3-nitro-4-(trifluoromethoxy)benzenesulfonamide Chemical compound C1=C(OC)C(OC)=CC=C1NS(=O)(=O)C1=CC=C(OC(F)(F)F)C([N+]([O-])=O)=C1 HRGJLHLAYOURMR-UHFFFAOYSA-N 0.000 description 1
- OIIBQIPDIYGJTQ-UHFFFAOYSA-N n-(3-fluoro-4-methoxyphenyl)-3-nitro-4-(trifluoromethoxy)benzenesulfonamide Chemical compound C1=C(F)C(OC)=CC=C1NS(=O)(=O)C1=CC=C(OC(F)(F)F)C([N+]([O-])=O)=C1 OIIBQIPDIYGJTQ-UHFFFAOYSA-N 0.000 description 1
- AQAMYBLSOUAWLZ-UHFFFAOYSA-N n-(3-fluoro-4-methoxyphenyl)-3-nitro-4-(trifluoromethylsulfonylamino)benzenesulfonamide Chemical compound C1=C(F)C(OC)=CC=C1NS(=O)(=O)C1=CC=C(NS(=O)(=O)C(F)(F)F)C([N+]([O-])=O)=C1 AQAMYBLSOUAWLZ-UHFFFAOYSA-N 0.000 description 1
- AGTXCOQWPYNWDF-UHFFFAOYSA-N n-(3-hydroxy-4-methoxyphenyl)-3-nitro-4-(trifluoromethoxy)benzenesulfonamide Chemical compound C1=C(O)C(OC)=CC=C1NS(=O)(=O)C1=CC=C(OC(F)(F)F)C([N+]([O-])=O)=C1 AGTXCOQWPYNWDF-UHFFFAOYSA-N 0.000 description 1
- VUWRCWXWQBTFRU-UHFFFAOYSA-N n-(3-hydroxy-4-methoxyphenyl)-3-nitro-4-(trifluoromethylsulfonylamino)benzenesulfonamide Chemical compound C1=C(O)C(OC)=CC=C1NS(=O)(=O)C1=CC=C(NS(=O)(=O)C(F)(F)F)C([N+]([O-])=O)=C1 VUWRCWXWQBTFRU-UHFFFAOYSA-N 0.000 description 1
- FLNUTAKRNHKNCQ-UHFFFAOYSA-N n-(4-aminophenyl)-3,4-difluoro-5-nitrobenzenesulfonamide Chemical compound C1=CC(N)=CC=C1NS(=O)(=O)C1=CC(F)=C(F)C([N+]([O-])=O)=C1 FLNUTAKRNHKNCQ-UHFFFAOYSA-N 0.000 description 1
- IYIKRKRESAIXHQ-UHFFFAOYSA-N n-(4-aminophenyl)-4-fluoro-3-nitrobenzenesulfonamide Chemical compound C1=CC(N)=CC=C1NS(=O)(=O)C1=CC=C(F)C([N+]([O-])=O)=C1 IYIKRKRESAIXHQ-UHFFFAOYSA-N 0.000 description 1
- BJJPVOZBTJYQQY-UHFFFAOYSA-N n-(4-methoxyphenyl)-3-nitro-4-(trifluoromethoxy)benzenesulfonamide Chemical compound C1=CC(OC)=CC=C1NS(=O)(=O)C1=CC=C(OC(F)(F)F)C([N+]([O-])=O)=C1 BJJPVOZBTJYQQY-UHFFFAOYSA-N 0.000 description 1
- NVEQEBWRWGITKR-UHFFFAOYSA-N n-(4-methoxyphenyl)-3-nitro-4-(trifluoromethylsulfonylamino)benzenesulfonamide Chemical compound C1=CC(OC)=CC=C1NS(=O)(=O)C1=CC=C(NS(=O)(=O)C(F)(F)F)C([N+]([O-])=O)=C1 NVEQEBWRWGITKR-UHFFFAOYSA-N 0.000 description 1
- IUERVNVXNGPCBB-UHFFFAOYSA-N n-[4-(dimethylamino)phenyl]-2,3,4,5-tetrafluorobenzenesulfonamide Chemical compound C1=CC(N(C)C)=CC=C1NS(=O)(=O)C1=CC(F)=C(F)C(F)=C1F IUERVNVXNGPCBB-UHFFFAOYSA-N 0.000 description 1
- QJTRAYDOBLCRMH-UHFFFAOYSA-N n-[4-(dimethylamino)phenyl]-2,3,5,6-tetrafluoro-4-(trifluoromethoxy)benzenesulfonamide Chemical compound C1=CC(N(C)C)=CC=C1NS(=O)(=O)C1=C(F)C(F)=C(OC(F)(F)F)C(F)=C1F QJTRAYDOBLCRMH-UHFFFAOYSA-N 0.000 description 1
- PDSDYZIRVDPYQV-UHFFFAOYSA-N n-[4-(dimethylamino)phenyl]-2,3,5-trifluoro-4-(trifluoromethoxy)benzenesulfonamide Chemical compound C1=CC(N(C)C)=CC=C1NS(=O)(=O)C1=CC(F)=C(OC(F)(F)F)C(F)=C1F PDSDYZIRVDPYQV-UHFFFAOYSA-N 0.000 description 1
- WXQSLAAJCUXBKF-UHFFFAOYSA-N n-[4-(dimethylamino)phenyl]-3,4,5-trifluorobenzenesulfonamide Chemical compound C1=CC(N(C)C)=CC=C1NS(=O)(=O)C1=CC(F)=C(F)C(F)=C1 WXQSLAAJCUXBKF-UHFFFAOYSA-N 0.000 description 1
- JKBURHGBOJYKRW-UHFFFAOYSA-N n-[4-(dimethylamino)phenyl]-3,4-difluoro-5-nitrobenzenesulfonamide Chemical compound C1=CC(N(C)C)=CC=C1NS(=O)(=O)C1=CC(F)=C(F)C([N+]([O-])=O)=C1 JKBURHGBOJYKRW-UHFFFAOYSA-N 0.000 description 1
- YRROBJUWLVFNEZ-UHFFFAOYSA-N n-[4-(dimethylamino)phenyl]-3-nitro-4-(trifluoromethoxy)benzenesulfonamide Chemical compound C1=CC(N(C)C)=CC=C1NS(=O)(=O)C1=CC=C(OC(F)(F)F)C([N+]([O-])=O)=C1 YRROBJUWLVFNEZ-UHFFFAOYSA-N 0.000 description 1
- HWMJPPODPDDSGB-UHFFFAOYSA-N n-[4-(dimethylamino)phenyl]-4-fluoro-3-nitrobenzenesulfonamide Chemical compound C1=CC(N(C)C)=CC=C1NS(=O)(=O)C1=CC=C(F)C([N+]([O-])=O)=C1 HWMJPPODPDDSGB-UHFFFAOYSA-N 0.000 description 1
- VOVZXURTCKPRDQ-CQSZACIVSA-N n-[4-[chloro(difluoro)methoxy]phenyl]-6-[(3r)-3-hydroxypyrrolidin-1-yl]-5-(1h-pyrazol-5-yl)pyridine-3-carboxamide Chemical compound C1[C@H](O)CCN1C1=NC=C(C(=O)NC=2C=CC(OC(F)(F)Cl)=CC=2)C=C1C1=CC=NN1 VOVZXURTCKPRDQ-CQSZACIVSA-N 0.000 description 1
- MBGDIAAXPUDULI-UHFFFAOYSA-N n-acetyl-n-[2,3-difluoro-4-[(3-fluoro-4-methoxyphenyl)sulfamoyl]-6-nitrophenyl]acetamide Chemical compound C1=C(F)C(OC)=CC=C1NS(=O)(=O)C1=CC([N+]([O-])=O)=C(N(C(C)=O)C(C)=O)C(F)=C1F MBGDIAAXPUDULI-UHFFFAOYSA-N 0.000 description 1
- 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000001280 n-hexyl group Chemical class C(CCCCC)* 0.000 description 1
- 125000000740 n-pentyl group Chemical class [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 210000000282 nail Anatomy 0.000 description 1
- 230000001613 neoplastic effect Effects 0.000 description 1
- 229960003512 nicotinic acid Drugs 0.000 description 1
- 235000001968 nicotinic acid Nutrition 0.000 description 1
- 239000011664 nicotinic acid Substances 0.000 description 1
- LQNUZADURLCDLV-UHFFFAOYSA-N nitrobenzene Substances [O-][N+](=O)C1=CC=CC=C1 LQNUZADURLCDLV-UHFFFAOYSA-N 0.000 description 1
- 239000012299 nitrogen atmosphere Substances 0.000 description 1
- 230000003287 optical effect Effects 0.000 description 1
- 238000005457 optimization Methods 0.000 description 1
- 210000000056 organ Anatomy 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- 229960003552 other antineoplastic agent in atc Drugs 0.000 description 1
- 230000003647 oxidation Effects 0.000 description 1
- 238000007254 oxidation reaction Methods 0.000 description 1
- 229910052760 oxygen Inorganic materials 0.000 description 1
- 239000001301 oxygen Substances 0.000 description 1
- 125000004430 oxygen atom Chemical group O* 0.000 description 1
- 229910052763 palladium Inorganic materials 0.000 description 1
- 229940116369 pancreatic lipase Drugs 0.000 description 1
- 230000003071 parasitic effect Effects 0.000 description 1
- DDBREPKUVSBGFI-UHFFFAOYSA-N phenobarbital Chemical compound C=1C=CC=CC=1C1(CC)C(=O)NC(=O)NC1=O DDBREPKUVSBGFI-UHFFFAOYSA-N 0.000 description 1
- OJMIONKXNSYLSR-UHFFFAOYSA-N phosphorous acid Chemical class OP(O)O OJMIONKXNSYLSR-UHFFFAOYSA-N 0.000 description 1
- 230000000704 physical effect Effects 0.000 description 1
- 230000035479 physiological effects, processes and functions Effects 0.000 description 1
- 239000006187 pill Substances 0.000 description 1
- 125000000587 piperidin-1-yl group Chemical group [H]C1([H])N(*)C([H])([H])C([H])([H])C([H])([H])C1([H])[H] 0.000 description 1
- 125000004483 piperidin-3-yl group Chemical group N1CC(CCC1)* 0.000 description 1
- 229940096701 plain lipid modifying drug hmg coa reductase inhibitors Drugs 0.000 description 1
- 230000007505 plaque formation Effects 0.000 description 1
- 230000036470 plasma concentration Effects 0.000 description 1
- 239000002798 polar solvent Substances 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- JCBJVAJGLKENNC-UHFFFAOYSA-M potassium ethyl xanthate Chemical compound [K+].CCOC([S-])=S JCBJVAJGLKENNC-UHFFFAOYSA-M 0.000 description 1
- 229940124606 potential therapeutic agent Drugs 0.000 description 1
- 230000003389 potentiating effect Effects 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- 229960002965 pravastatin Drugs 0.000 description 1
- TUZYXOIXSAXUGO-PZAWKZKUSA-N pravastatin Chemical compound C1=C[C@H](C)[C@H](CC[C@@H](O)C[C@@H](O)CC(O)=O)[C@H]2[C@@H](OC(=O)[C@@H](C)CC)C[C@H](O)C=C21 TUZYXOIXSAXUGO-PZAWKZKUSA-N 0.000 description 1
- 230000002265 prevention Effects 0.000 description 1
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 1
- FYPMFJGVHOHGLL-UHFFFAOYSA-N probucol Chemical compound C=1C(C(C)(C)C)=C(O)C(C(C)(C)C)=CC=1SC(C)(C)SC1=CC(C(C)(C)C)=C(O)C(C(C)(C)C)=C1 FYPMFJGVHOHGLL-UHFFFAOYSA-N 0.000 description 1
- 229960003912 probucol Drugs 0.000 description 1
- 239000000047 product Substances 0.000 description 1
- 230000002035 prolonged effect Effects 0.000 description 1
- 125000004368 propenyl group Chemical group C(=CC)* 0.000 description 1
- 230000000069 prophylactic effect Effects 0.000 description 1
- 230000001185 psoriatic effect Effects 0.000 description 1
- 125000000561 purinyl group Chemical group N1=C(N=C2N=CNC2=C1)* 0.000 description 1
- 125000003373 pyrazinyl group Chemical group 0.000 description 1
- 239000003790 pyrimidine antagonist Substances 0.000 description 1
- 125000002943 quinolinyl group Chemical group N1=C(C=CC2=CC=CC=C12)* 0.000 description 1
- 239000002516 radical scavenger Substances 0.000 description 1
- 239000002287 radioligand Substances 0.000 description 1
- GZUITABIAKMVPG-UHFFFAOYSA-N raloxifene Chemical compound C1=CC(O)=CC=C1C1=C(C(=O)C=2C=CC(OCCN3CCCCC3)=CC=2)C2=CC=C(O)C=C2S1 GZUITABIAKMVPG-UHFFFAOYSA-N 0.000 description 1
- 229960004622 raloxifene Drugs 0.000 description 1
- 238000001953 recrystallisation Methods 0.000 description 1
- 230000008439 repair process Effects 0.000 description 1
- 238000007127 saponification reaction Methods 0.000 description 1
- 239000012047 saturated solution Substances 0.000 description 1
- 210000004761 scalp Anatomy 0.000 description 1
- 125000002914 sec-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 230000028327 secretion Effects 0.000 description 1
- 239000000377 silicon dioxide Substances 0.000 description 1
- 229960002855 simvastatin Drugs 0.000 description 1
- RYMZZMVNJRMUDD-HGQWONQESA-N simvastatin Chemical compound C([C@H]1[C@@H](C)C=CC2=C[C@H](C)C[C@@H]([C@H]12)OC(=O)C(C)(C)CC)C[C@@H]1C[C@@H](O)CC(=O)O1 RYMZZMVNJRMUDD-HGQWONQESA-N 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 239000011780 sodium chloride Substances 0.000 description 1
- 235000010288 sodium nitrite Nutrition 0.000 description 1
- 238000007614 solvation Methods 0.000 description 1
- 238000001228 spectrum Methods 0.000 description 1
- 239000007921 spray Substances 0.000 description 1
- 239000003381 stabilizer Substances 0.000 description 1
- 238000010561 standard procedure Methods 0.000 description 1
- 239000003270 steroid hormone Substances 0.000 description 1
- 230000004936 stimulating effect Effects 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 238000006277 sulfonation reaction Methods 0.000 description 1
- 239000000829 suppository Substances 0.000 description 1
- 238000003239 susceptibility assay Methods 0.000 description 1
- 239000003826 tablet Substances 0.000 description 1
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 125000004192 tetrahydrofuran-2-yl group Chemical group [H]C1([H])OC([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- 150000003568 thioethers Chemical class 0.000 description 1
- 125000003396 thiol group Chemical group [H]S* 0.000 description 1
- 150000007944 thiolates Chemical class 0.000 description 1
- 238000013518 transcription Methods 0.000 description 1
- 230000035897 transcription Effects 0.000 description 1
- 230000007704 transition Effects 0.000 description 1
- 230000032258 transport Effects 0.000 description 1
- GETQZCLCWQTVFV-UHFFFAOYSA-N trimethylamine Chemical compound CN(C)C GETQZCLCWQTVFV-UHFFFAOYSA-N 0.000 description 1
- 230000004614 tumor growth Effects 0.000 description 1
- 210000004509 vascular smooth muscle cell Anatomy 0.000 description 1
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 description 1
- 229920002554 vinyl polymer Polymers 0.000 description 1
- 230000003612 virological effect Effects 0.000 description 1
- 239000012991 xanthate Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C311/00—Amides of sulfonic acids, i.e. compounds having singly-bound oxygen atoms of sulfo groups replaced by nitrogen atoms, not being part of nitro or nitroso groups
- C07C311/15—Sulfonamides having sulfur atoms of sulfonamide groups bound to carbon atoms of six-membered aromatic rings
- C07C311/21—Sulfonamides having sulfur atoms of sulfonamide groups bound to carbon atoms of six-membered aromatic rings having the nitrogen atom of at least one of the sulfonamide groups bound to a carbon atom of a six-membered aromatic ring
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P3/00—Drugs for disorders of the metabolism
- A61P3/06—Antihyperlipidemics
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P35/00—Antineoplastic agents
Landscapes
- Organic Chemistry (AREA)
- Chemical & Material Sciences (AREA)
- Health & Medical Sciences (AREA)
- General Health & Medical Sciences (AREA)
- Veterinary Medicine (AREA)
- Nuclear Medicine, Radiotherapy & Molecular Imaging (AREA)
- General Chemical & Material Sciences (AREA)
- Pharmacology & Pharmacy (AREA)
- Life Sciences & Earth Sciences (AREA)
- Animal Behavior & Ethology (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Public Health (AREA)
- Medicinal Chemistry (AREA)
- Engineering & Computer Science (AREA)
- Bioinformatics & Cheminformatics (AREA)
- Diabetes (AREA)
- Hematology (AREA)
- Obesity (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Acyclic And Carbocyclic Compounds In Medicinal Compositions (AREA)
Applications Claiming Priority (3)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US08/917,025 | 1997-08-22 | ||
| US08/917,025 US6284923B1 (en) | 1997-08-22 | 1997-08-22 | Substituted benzene compounds as antiproliferative and cholesterol lowering action |
| PCT/US1998/016781 WO1999010320A1 (en) | 1997-08-22 | 1998-08-13 | Substituted benzene compounds as antiproliferative and cholesterol lowering agents |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| CA2301842A1 CA2301842A1 (en) | 1999-03-04 |
| CA2301842C true CA2301842C (en) | 2010-04-27 |
Family
ID=25438246
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA2301842A Expired - Fee Related CA2301842C (en) | 1997-08-22 | 1998-08-13 | Substituted benzene compounds as antiproliferative and cholesterol lowering agents |
Country Status (10)
| Country | Link |
|---|---|
| US (2) | US6284923B1 (show.php) |
| EP (1) | EP1005453B1 (show.php) |
| JP (1) | JP4309041B2 (show.php) |
| AT (1) | ATE280756T1 (show.php) |
| AU (1) | AU748826B2 (show.php) |
| CA (1) | CA2301842C (show.php) |
| DE (1) | DE69827267T2 (show.php) |
| ES (1) | ES2245803T3 (show.php) |
| PT (1) | PT1005453E (show.php) |
| WO (1) | WO1999010320A1 (show.php) |
Families Citing this family (33)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| EA001367B1 (ru) * | 1996-02-22 | 2001-02-26 | Туларик, Инк. | Пентафторбензолсульфонамиды и их аналоги |
| US6482860B1 (en) * | 1996-07-19 | 2002-11-19 | Tularik Inc. | Pentafluorobenzenesulfonamides and analogs |
| US6583157B2 (en) | 1998-01-29 | 2003-06-24 | Tularik Inc. | Quinolinyl and benzothiazolyl modulators |
| JP4253126B2 (ja) | 1998-01-29 | 2009-04-08 | アムジェン インコーポレイテッド | Ppar−ガンマ調節剤 |
| CA2335559A1 (en) * | 1998-06-25 | 1999-12-29 | Tularik Inc. | Arylsulfonanilide phosphates |
| KR20010086073A (ko) * | 1998-12-02 | 2001-09-07 | 데이비드 존 우드 | p53계 단백질의 배좌 안정성을 회복하기 위한 방법 및조성물 |
| SG148834A1 (en) * | 1999-06-30 | 2009-01-29 | Japan Tobacco Inc | Compounds for the modulation of ppary activity |
| US7041691B1 (en) | 1999-06-30 | 2006-05-09 | Amgen Inc. | Compounds for the modulation of PPARγ activity |
| US6306615B1 (en) | 1999-08-19 | 2001-10-23 | Tularik Inc. | Detection method for monitoring β tubulin isotype specific modification |
| WO2001082916A2 (en) | 2000-05-03 | 2001-11-08 | Tularik Inc. | Combination therapeutic compositions and methods of use |
| US20030171399A1 (en) | 2000-06-28 | 2003-09-11 | Tularik Inc. | Quinolinyl and benzothiazolyl modulators |
| US20050250854A1 (en) * | 2000-11-03 | 2005-11-10 | Amgen Inc. | Combination therapy using pentafluorobenzenesulfonamides and antineoplastic agents |
| AU2002234165A1 (en) | 2000-11-03 | 2002-05-27 | Tularik, Inc. | Combination therapy using pentafluorobenzenesulfonamides and antineoplastic agents |
| WO2003007931A1 (en) * | 2001-06-08 | 2003-01-30 | Institute Of Medicinal Molecular Design. Inc. | Sulfonamide derivatives |
| JP2003081937A (ja) * | 2001-09-07 | 2003-03-19 | Bayer Ag | ベンゼンスルホンアミド誘導体 |
| US7550424B2 (en) * | 2002-11-26 | 2009-06-23 | Institute Of Virology Slovak Academy Of Sciences | CA IX-specific inhibitors |
| US7833734B2 (en) * | 2002-11-26 | 2010-11-16 | Institute Of Virology Of The Slovak Academy Of Sciences | CA IX-specific inhibitors |
| US7223761B2 (en) | 2003-10-03 | 2007-05-29 | Amgen Inc. | Salts and polymorphs of a potent antidiabetic compound |
| FI20055498A0 (fi) * | 2005-09-16 | 2005-09-16 | Biotie Therapies Corp | Sulfonamidijohdannaisia |
| GB0526252D0 (en) * | 2005-12-22 | 2006-02-01 | Novartis Ag | Organic compounds |
| CA2803118C (en) | 2010-07-09 | 2015-11-03 | Pfizer Limited | Sulfonamide derivatives as nav 1.7 inhibitors |
| US8692001B2 (en) | 2010-10-27 | 2014-04-08 | Dynamix Pharmaceuticals Ltd. | Sulfonamides for the modulation of PKM2 |
| EP2925717A4 (en) * | 2012-11-28 | 2016-08-03 | Stichting Dienst Landbouwkundi | BENZOLSULFONAMIDE COMPOUNDS FOR PLANTS WITH SOMATIC EMBRYOGENESIS I |
| CN105452745B (zh) * | 2013-08-28 | 2019-03-19 | 博格华纳公司 | 高温阀轴密封 |
| GB201514021D0 (en) | 2015-08-07 | 2015-09-23 | Arner Elias Set Jeno | Novel Pyridines and their use in the treatment of cancer |
| EP3580209A1 (en) | 2017-02-07 | 2019-12-18 | Oblique Therapeutics AB | Heterocyclylsulfonyl-substituted pyridines and their use in the treatment of cancer |
| KR20190115014A (ko) | 2017-02-07 | 2019-10-10 | 오블리크 세러퓨틱스 에이비 | 하이드로카르빌설포닐-치환된 피리딘 및 암의 치료에서 이의 용도 |
| BR112019016223A2 (pt) | 2017-02-07 | 2020-04-07 | Oblique Therapeutics Ab | piridinas substituídas por heteroarilsulfonila e uso das mesmas no tratamento de câncer |
| MX2019009356A (es) | 2017-02-07 | 2019-09-19 | Oblique Therapeutics Ab | Sulfinilpiridinas y su uso en el tratamiento del cancer. |
| US11555012B2 (en) * | 2018-11-09 | 2023-01-17 | Nimbus Artemis, Inc. | ACLY inhibitors and uses thereof |
| US20220281812A1 (en) * | 2019-07-17 | 2022-09-08 | 2692372 Ontario, Inc. | Benzenesulfonamide derivatives and uses thereof |
| MX2024011428A (es) * | 2022-03-21 | 2024-09-24 | Chemocentryx Inc | Compuestos de sulfonamida para cxcr6. |
| WO2024175999A2 (en) * | 2023-02-23 | 2024-08-29 | Dunad Therapeutics Ltd. | Benzenesulfonamide derivatives and uses thereof |
Family Cites Families (24)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US1955207A (en) | 1931-09-16 | 1934-04-17 | Ig Farbenindustrie Ag | Mothproofing agent |
| DE622494C (de) | 1932-01-03 | 1935-11-29 | I G Farbenindustrie Akt Ges | Verfahren zur Darstellung von Mono- bzw. Polynitropolysulfonen und deren Reduktionsprodukten |
| US2358365A (en) | 1940-08-03 | 1944-09-19 | Parke Davis & Co | Sulphonamide derivatives and process for obtaining the same |
| US2450863A (en) | 1946-03-07 | 1948-10-05 | Socony Vacuum Oil Co Inc | Amides from sulfonyl fluorides |
| CH362688A (de) | 1957-09-10 | 1962-06-30 | Geigy Ag J R | Verfahren zur Herstellung von neuen Arylsulfonarylamiden |
| US2937202A (en) | 1958-05-19 | 1960-05-17 | Dow Chemical Co | Substituted benzenesulfonanilides |
| GB938890A (en) | 1961-02-03 | 1963-10-09 | Boots Pure Drug Co Ltd | New fungicidal compositions and compounds |
| NL301745A (show.php) | 1962-12-17 | |||
| CH504416A (de) * | 1966-12-05 | 1971-03-15 | Ciba Geigy Ag | Verfahren zur Herstellung von aromatischen Sulfamoylverbindungen |
| US3505455A (en) | 1966-12-15 | 1970-04-07 | Ansul Co | Nematocidal method |
| NL174644C (nl) | 1970-04-13 | 1984-07-16 | Minnesota Mining & Mfg | Werkwijze ter bereiding van een herbicide verbinding; tevens werkwijze voor de bereiding van een preparaat met herbicide werking. |
| US3951910A (en) * | 1973-12-28 | 1976-04-20 | General Electric Company | Flame retardant polycarbonate composition |
| US4013621A (en) | 1975-04-29 | 1977-03-22 | Ciba-Geigy Corporation | Substituted sulfonamide derivatives of hindered phenols and stabilized compositions |
| DE2528697C2 (de) | 1975-06-27 | 1986-02-20 | Bayer Ag, 5090 Leverkusen | Verfahren zur Herstellung von Salicylaldehyden |
| US4034110A (en) | 1976-09-20 | 1977-07-05 | Hoffmann-La Roche Inc. | Anthelmintics effective against liver flukes |
| US4239699A (en) | 1978-05-24 | 1980-12-16 | Henkel Corporation | Sulfonamidophenols, metal complexes thereof, and solutions containing such compounds for use in extraction of metal values |
| US4373017A (en) | 1980-03-05 | 1983-02-08 | Konishiroku Photo Industry Co., Ltd. | Photosensitive compound and photosensitive material containing it |
| US4483986A (en) | 1982-05-03 | 1984-11-20 | Eli Lilly And Company | 4-Nitrobenzophenone compounds |
| NZ215272A (en) | 1985-02-27 | 1989-08-29 | Mitsui Toatsu Chemicals | Fungicidal n-(2-chloro-4-nitrophenyl)-benzenesulphonamide derivatives and compositions thereof |
| US4692466A (en) | 1985-02-28 | 1987-09-08 | Mitsui Toatsu Chemicals, Incorporated | N-(2-chloro-4-trifluoromethylphenyl)-3-trifluoromethylbenzenesulfonamide derivative and agricultural fungicide containing same |
| US5280043A (en) | 1988-10-10 | 1994-01-18 | Smith Kline & French Laboratories Ltd. | Sulphonamido containing phenylalkanoic acids as thromboxane A2 antagonists |
| DE3905075A1 (de) | 1989-02-18 | 1990-08-30 | Hoechst Ag | Benzolsulfonamide und verfahren zu ihrer herstellung |
| ATE167473T1 (de) | 1990-08-20 | 1998-07-15 | Eisai Co Ltd | Sulfonamid-derivate |
| AU6112896A (en) * | 1995-06-07 | 1996-12-30 | Sugen, Inc. | Tyrphostin-like compounds for the treatment of cell prolifer ative disorders or cell differentiation disorders |
-
1997
- 1997-08-22 US US08/917,025 patent/US6284923B1/en not_active Expired - Fee Related
-
1998
- 1998-08-13 ES ES98939384T patent/ES2245803T3/es not_active Expired - Lifetime
- 1998-08-13 DE DE69827267T patent/DE69827267T2/de not_active Expired - Lifetime
- 1998-08-13 PT PT98939384T patent/PT1005453E/pt unknown
- 1998-08-13 EP EP98939384A patent/EP1005453B1/en not_active Expired - Lifetime
- 1998-08-13 WO PCT/US1998/016781 patent/WO1999010320A1/en not_active Ceased
- 1998-08-13 JP JP2000507650A patent/JP4309041B2/ja not_active Expired - Fee Related
- 1998-08-13 AT AT98939384T patent/ATE280756T1/de not_active IP Right Cessation
- 1998-08-13 CA CA2301842A patent/CA2301842C/en not_active Expired - Fee Related
- 1998-08-13 AU AU87824/98A patent/AU748826B2/en not_active Ceased
-
2001
- 2001-05-31 US US09/872,463 patent/US6388131B2/en not_active Expired - Fee Related
Also Published As
| Publication number | Publication date |
|---|---|
| DE69827267D1 (de) | 2004-12-02 |
| DE69827267T2 (de) | 2006-02-02 |
| ES2245803T3 (es) | 2006-01-16 |
| US6388131B2 (en) | 2002-05-14 |
| AU748826B2 (en) | 2002-06-13 |
| US6284923B1 (en) | 2001-09-04 |
| JP4309041B2 (ja) | 2009-08-05 |
| AU8782498A (en) | 1999-03-16 |
| CA2301842A1 (en) | 1999-03-04 |
| EP1005453B1 (en) | 2004-10-27 |
| US20020013496A1 (en) | 2002-01-31 |
| PT1005453E (pt) | 2005-02-28 |
| JP2001514167A (ja) | 2001-09-11 |
| WO1999010320A8 (en) | 1999-09-23 |
| WO1999010320A1 (en) | 1999-03-04 |
| ATE280756T1 (de) | 2004-11-15 |
| EP1005453A1 (en) | 2000-06-07 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CA2301842C (en) | Substituted benzene compounds as antiproliferative and cholesterol lowering agents | |
| US6191170B1 (en) | Benzenesulfonamides and benzamides as therapeutic agents | |
| US7138418B2 (en) | Pentafluorobenzenesulfonamides and analogs | |
| AU775625B2 (en) | Phosphate mimics and methods of treatment using phosphatase inhibitors | |
| JP4606027B2 (ja) | Hdac阻害剤としてのピペラジン結合を有するカルバミン酸化合物 | |
| US6605615B2 (en) | Hydrazones and analogs as cholesterol lowering agents | |
| EP1115701B1 (en) | Arylsulfonanilide ureas | |
| JP4975941B2 (ja) | (e)−n−ヒドロキシ−3−(3−スルファモイル−フェニル)アクリルアミド化合物及びその治療用途 | |
| US6316503B1 (en) | LXR modulators | |
| CA2260777C (en) | Pentafluorobenzenesulfonamides and analogs | |
| EP2258681A2 (en) | Aromatic Derivatives as HIV Aspartyl Protease Inhibitors | |
| NO332782B1 (no) | Sulfonsyrer og derivater derav, samt fremstilling og anvendelse derav og farmasoytiske preparater omfattende nevnte sulfonsyrer | |
| EP1090014B1 (en) | Arylsulfonanilide phosphates | |
| EP1285911A2 (en) | Arylsulfonanilide ureas | |
| HK1038913B (en) | Arylsulfonanilide ureas |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| EEER | Examination request | ||
| MKLA | Lapsed |