DK149308C - Analogifremgangs-maade til fremstilling af trans-4-phenyl-1,2,3,4-tetrahydro-1-naphthalenamin-derivater eller farmaceutisk acceptablesyreadditionssalte deraf - Google Patents
Analogifremgangs-maade til fremstilling af trans-4-phenyl-1,2,3,4-tetrahydro-1-naphthalenamin-derivater eller farmaceutisk acceptablesyreadditionssalte derafInfo
- Publication number
- DK149308C DK149308C DK462480A DK462480A DK149308C DK 149308 C DK149308 C DK 149308C DK 462480 A DK462480 A DK 462480A DK 462480 A DK462480 A DK 462480A DK 149308 C DK149308 C DK 149308C
- Authority
- DK
- Denmark
- Prior art keywords
- tetrahydro
- analogue
- trans
- phenyl
- preparation
- Prior art date
Links
- IWNWWVPLTTUPBQ-XJKSGUPXSA-N (1r,4s)-4-phenyl-1,2,3,4-tetrahydronaphthalen-1-amine Chemical class C1([C@@H]2CC[C@H](C3=CC=CC=C32)N)=CC=CC=C1 IWNWWVPLTTUPBQ-XJKSGUPXSA-N 0.000 title 1
- 239000002253 acid Substances 0.000 title 1
- 150000003839 salts Chemical class 0.000 title 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C209/00—Preparation of compounds containing amino groups bound to a carbon skeleton
- C07C209/04—Preparation of compounds containing amino groups bound to a carbon skeleton by substitution of functional groups by amino groups
- C07C209/14—Preparation of compounds containing amino groups bound to a carbon skeleton by substitution of functional groups by amino groups by substitution of hydroxy groups or of etherified or esterified hydroxy groups
- C07C209/16—Preparation of compounds containing amino groups bound to a carbon skeleton by substitution of functional groups by amino groups by substitution of hydroxy groups or of etherified or esterified hydroxy groups with formation of amino groups bound to acyclic carbon atoms or to carbon atoms of rings other than six-membered aromatic rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C43/00—Ethers; Compounds having groups, groups or groups
- C07C43/02—Ethers
- C07C43/20—Ethers having an ether-oxygen atom bound to a carbon atom of a six-membered aromatic ring
- C07C43/21—Ethers having an ether-oxygen atom bound to a carbon atom of a six-membered aromatic ring containing rings other than six-membered aromatic rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C211/00—Compounds containing amino groups bound to a carbon skeleton
- C07C211/01—Compounds containing amino groups bound to a carbon skeleton having amino groups bound to acyclic carbon atoms
- C07C211/26—Compounds containing amino groups bound to a carbon skeleton having amino groups bound to acyclic carbon atoms of an unsaturated carbon skeleton containing at least one six-membered aromatic ring
- C07C211/30—Compounds containing amino groups bound to a carbon skeleton having amino groups bound to acyclic carbon atoms of an unsaturated carbon skeleton containing at least one six-membered aromatic ring the six-membered aromatic ring being part of a condensed ring system formed by two rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C211/00—Compounds containing amino groups bound to a carbon skeleton
- C07C211/43—Compounds containing amino groups bound to a carbon skeleton having amino groups bound to carbon atoms of six-membered aromatic rings of the carbon skeleton
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C45/00—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds
- C07C45/004—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by reaction with organometalhalides
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C45/00—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds
- C07C45/45—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by condensation
- C07C45/46—Friedel-Crafts reactions
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C49/00—Ketones; Ketenes; Dimeric ketenes; Ketonic chelates
- C07C49/587—Unsaturated compounds containing a keto groups being part of a ring
- C07C49/687—Unsaturated compounds containing a keto groups being part of a ring containing halogen
- C07C49/697—Unsaturated compounds containing a keto groups being part of a ring containing halogen containing six-membered aromatic rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C49/00—Ketones; Ketenes; Dimeric ketenes; Ketonic chelates
- C07C49/587—Unsaturated compounds containing a keto groups being part of a ring
- C07C49/753—Unsaturated compounds containing a keto groups being part of a ring containing ether groups, groups, groups, or groups
- C07C49/755—Unsaturated compounds containing a keto groups being part of a ring containing ether groups, groups, groups, or groups a keto group being part of a condensed ring system with two or three rings, at least one ring being a six-membered aromatic ring
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C57/00—Unsaturated compounds having carboxyl groups bound to acyclic carbon atoms
- C07C57/52—Unsaturated compounds having carboxyl groups bound to acyclic carbon atoms containing halogen
- C07C57/58—Unsaturated compounds having carboxyl groups bound to acyclic carbon atoms containing halogen containing six-membered aromatic rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C57/00—Unsaturated compounds having carboxyl groups bound to acyclic carbon atoms
- C07C57/52—Unsaturated compounds having carboxyl groups bound to acyclic carbon atoms containing halogen
- C07C57/58—Unsaturated compounds having carboxyl groups bound to acyclic carbon atoms containing halogen containing six-membered aromatic rings
- C07C57/60—Unsaturated compounds having carboxyl groups bound to acyclic carbon atoms containing halogen containing six-membered aromatic rings having unsaturation outside the rings
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Acyclic And Carbocyclic Compounds In Medicinal Compositions (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
Applications Claiming Priority (4)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US9023779A | 1979-11-01 | 1979-11-01 | |
| US9023779 | 1979-11-01 | ||
| US18444780 | 1980-09-05 | ||
| US06/184,447 US4556676A (en) | 1979-11-01 | 1980-09-05 | Antidepressant derivatives of trans-4-phenyl-1,2,3,4-tetrahydro-1-naphthalenamine |
Publications (3)
| Publication Number | Publication Date |
|---|---|
| DK462480A DK462480A (da) | 1981-05-02 |
| DK149308B DK149308B (da) | 1986-04-28 |
| DK149308C true DK149308C (da) | 1986-12-08 |
Family
ID=26782055
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DK462480A DK149308C (da) | 1979-11-01 | 1980-10-31 | Analogifremgangs-maade til fremstilling af trans-4-phenyl-1,2,3,4-tetrahydro-1-naphthalenamin-derivater eller farmaceutisk acceptablesyreadditionssalte deraf |
Country Status (18)
| Country | Link |
|---|---|
| US (1) | US4556676A (index.php) |
| EP (1) | EP0028901B1 (index.php) |
| KR (1) | KR840002021B1 (index.php) |
| AR (2) | AR225196A1 (index.php) |
| AT (1) | ATE2667T1 (index.php) |
| AU (1) | AU517842B2 (index.php) |
| CA (1) | CA1130816A (index.php) |
| DE (1) | DE3062226D1 (index.php) |
| DK (1) | DK149308C (index.php) |
| ES (2) | ES496441A0 (index.php) |
| FI (1) | FI68807C (index.php) |
| GR (1) | GR70782B (index.php) |
| IE (1) | IE50396B1 (index.php) |
| IL (1) | IL61376A (index.php) |
| NO (1) | NO149102C (index.php) |
| PH (1) | PH15468A (index.php) |
| PT (1) | PT72005B (index.php) |
| YU (2) | YU41744B (index.php) |
Families Citing this family (39)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| SE8004002L (sv) * | 1980-05-29 | 1981-11-30 | Arvidsson Folke Lars Erik | Terapeutiskt anvendbara tetralinderivat |
| US4866208A (en) * | 1981-12-21 | 1989-09-12 | The Dow Chemical Company | Meta-phenylene diamine derivatives |
| US4777288A (en) * | 1987-06-11 | 1988-10-11 | Pfizer Inc. | Process for preparing a 4,4-diphenylbutanoic acid derivative |
| US4839104A (en) * | 1987-06-11 | 1989-06-13 | Pfizer, Inc. | Process for preparing sertraline intermediates |
| FR2623802B1 (fr) * | 1987-11-26 | 1990-05-04 | Lucien Laboratoires | Derives d'amino-4 trifluoromethyl-1 tetralines. leur preparation et leur application en therapeutique |
| FR2642065B1 (fr) * | 1989-01-24 | 1991-05-24 | Lipha | Derives d'acides benzocycloalcenyl dihydroxy alcanoiques, procede de preparation et medicaments les contenant |
| FR2665443B1 (fr) * | 1990-08-03 | 1992-11-06 | Lucien Laboratoires | Derives d'amino-4-methyl-1-tetralines, leur preparation et leur application en therapeutique. |
| US5082970A (en) * | 1991-03-06 | 1992-01-21 | Pfizer Inc. | Process for recycling amine isomer |
| GB9114948D0 (en) * | 1991-07-11 | 1991-08-28 | Pfizer Ltd | Process for preparing sertraline intermediates |
| US5196607A (en) * | 1992-02-14 | 1993-03-23 | Pfizer Inc. | Process for preparing ketone enantiomer |
| US5248699A (en) * | 1992-08-13 | 1993-09-28 | Pfizer Inc. | Sertraline polymorph |
| US5466880A (en) * | 1992-09-15 | 1995-11-14 | Pfizer Inc. | Process for preparing ketone enantiomer |
| WO1994022495A1 (en) * | 1993-03-31 | 1994-10-13 | The Trustees Of The University Of Pennsylvania | Dopamine d-3 and serotonin (5-ht1a) receptor ligands and imaging agents |
| US5750794A (en) * | 1993-11-30 | 1998-05-12 | Pfizer Inc. | Process for preparing chiral tetralone |
| US6410794B1 (en) | 1994-12-16 | 2002-06-25 | Uop Llc | Process for preparation of pharmaceutically desired chiral tetralone from tetralones |
| US6455736B1 (en) | 1994-12-16 | 2002-09-24 | Uop Llc | Process for preparation of pharmaceutically desired sertraline and sertraline analogs |
| HU222341B1 (hu) * | 1996-12-18 | 2003-06-28 | Richter Gedeon Vegyészeti Gyár Rt. | Eljárás sertralin előállítására és az eljárásban alkalmazott intermedier |
| IN182588B (index.php) | 1998-05-12 | 1999-05-08 | Sun Pharmaceutical Ind Ltd | |
| IN187170B (index.php) | 2000-01-04 | 2002-02-23 | Sun Pharmaceutical Ind Ltd | |
| DE10006411C2 (de) * | 2000-02-14 | 2002-03-07 | Huf Huelsbeck & Fuerst Gmbh | Elektronischer Zündanlaßschalter für Kraftfahrzeuge und Reserveschlüssel zur Betätigung desselben |
| DE10041478A1 (de) | 2000-08-24 | 2002-03-14 | Sanol Arznei Schwarz Gmbh | Neue pharmazeutische Zusammensetzung |
| US6482440B2 (en) | 2000-09-21 | 2002-11-19 | Phase 2 Discovery, Inc. | Long acting antidepressant microparticles |
| US6723878B2 (en) | 2001-06-15 | 2004-04-20 | Orion Corporation Fermion | Method for preparing sertraline |
| CN100584818C (zh) * | 2002-09-16 | 2010-01-27 | 塞普拉科公司 | 用反式4-(3,4-二氯苯基)-1,2,3,4-四氢-1-萘胺及其甲酰胺治疗cns病症 |
| US8134029B2 (en) | 2002-09-16 | 2012-03-13 | Sunovion Pharmaceuticals Inc. | Treatment of CNS disorders with trans 4-(3,4-dichlorophenyl)-1,2,3,4-tetrahydro-1-napthalenamine |
| KR101067045B1 (ko) * | 2002-09-16 | 2011-09-22 | 선오비온 파마슈티컬스 인코포레이티드 | 트랜스 4-(3,4-디클로로페닐)-1,2,3,4-테트라하이드로-1-나프탈렌아민을 사용한 cns 장애의 치료 |
| CA2498175A1 (en) * | 2002-09-16 | 2004-03-25 | Sepracor Inc. | Treatment of cns disorders with trans 4-(3,4-dichlorophenyl)-1,2,3,4-tetrahydro-n-methyl-1-napthalenamine |
| DE10334188B4 (de) * | 2003-07-26 | 2007-07-05 | Schwarz Pharma Ag | Verwendung von Rotigotin zur Behandlung von Depressionen |
| DE10334187A1 (de) * | 2003-07-26 | 2005-03-03 | Schwarz Pharma Ag | Substituierte 2-Aminotetraline zur Behandlung von Depressionen |
| US20060014838A1 (en) * | 2004-07-14 | 2006-01-19 | Sudhakar Valluri | Process for converting trans-sertraline to cis-sertraline |
| CN101553217A (zh) | 2005-07-06 | 2009-10-07 | 塞普拉科公司 | 艾司佐匹克隆与反式4-(3,4-二氯苯基)-1,2,3,4-四氢-n-甲基-1-萘胺或反式4-(3,4-二氯苯基)-1,2,3,4-四氢-1-萘胺的组合以及治疗绝经期和心境障碍、焦虑症和认知障碍的方法 |
| DK2816024T3 (en) * | 2006-03-31 | 2017-10-30 | Sunovion Pharmaceuticals Inc | CHIRALE AMINER |
| KR20090015089A (ko) * | 2006-05-31 | 2009-02-11 | 세프라코 아이엔시. | 트랜스 4-(3,4-디클로로페닐)-1,2,3,4-테트라하이드로-1-나프탈렌아민 및 그의 포름아미드에 의한 통증장애 치료방법 |
| WO2007146796A2 (en) * | 2006-06-13 | 2007-12-21 | Ramot At Tel-Aviv University Ltd. | Antiproliferative compounds, compositions and methods of use |
| EP1987815A1 (en) * | 2007-05-04 | 2008-11-05 | Schwarz Pharma Ag | Oronasopharyngeally deliverable pharmaceutical compositions of dopamine agonists for the prevention and/or treatment of restless limb disorders |
| US20100081713A1 (en) * | 2008-03-19 | 2010-04-01 | CombinatoRx, (Singapore) Pte. Ltd. | Compositions and methods for treating viral infections |
| WO2015175514A1 (en) * | 2014-05-13 | 2015-11-19 | Sunovion Pharmaceuticals Inc. | Methods and compositions of dasotraline for treatment of adhd |
| KR20170005088A (ko) * | 2014-05-13 | 2017-01-11 | 선오비온 파마슈티컬스 인코포레이티드 | Adhd의 치료를 위한 방법 및 다소트랄린의 투약량 |
| WO2016046669A2 (en) * | 2014-09-27 | 2016-03-31 | Mohan M Alapati | Compositions and methods for the treatment of depression and neurological diseases |
Family Cites Families (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB793853A (en) * | 1954-09-15 | 1958-04-23 | Schering Ag | Manufacture of new 3-amino-indanes |
| DE1098511B (de) * | 1959-11-21 | 1961-02-02 | Schering Ag | Verfahren zur Abtrennung von analgetisch wirksamen d-1-Phenyl-3-dimethylaminoindan |
| US3704323A (en) * | 1969-12-23 | 1972-11-28 | Squibb & Sons Inc | Indane derivatives |
| GB1420472A (en) * | 1972-09-27 | 1976-01-07 | Pfizer | Aminophenyltetralin compounds |
| US4045488A (en) * | 1974-11-06 | 1977-08-30 | Pfizer Inc. | Aminophenyltetralin compounds |
| US4029731A (en) * | 1974-11-06 | 1977-06-14 | Pfizer Inc. | Aminophenyltetralin compounds |
-
1980
- 1980-09-05 US US06/184,447 patent/US4556676A/en not_active Expired - Lifetime
- 1980-10-28 DE DE8080303810T patent/DE3062226D1/de not_active Expired
- 1980-10-28 AT AT80303810T patent/ATE2667T1/de not_active IP Right Cessation
- 1980-10-28 EP EP80303810A patent/EP0028901B1/en not_active Expired
- 1980-10-29 PH PH24786A patent/PH15468A/en unknown
- 1980-10-30 CA CA363,571A patent/CA1130816A/en not_active Expired
- 1980-10-30 YU YU2774/80A patent/YU41744B/xx unknown
- 1980-10-30 FI FI803399A patent/FI68807C/fi not_active IP Right Cessation
- 1980-10-30 AR AR283061A patent/AR225196A1/es active
- 1980-10-30 GR GR63248A patent/GR70782B/el unknown
- 1980-10-30 IL IL61376A patent/IL61376A/xx unknown
- 1980-10-31 DK DK462480A patent/DK149308C/da not_active IP Right Cessation
- 1980-10-31 ES ES496441A patent/ES496441A0/es active Granted
- 1980-10-31 PT PT72005A patent/PT72005B/pt unknown
- 1980-10-31 NO NO803259A patent/NO149102C/no unknown
- 1980-10-31 IE IE2260/80A patent/IE50396B1/en not_active IP Right Cessation
- 1980-10-31 KR KR1019800004175A patent/KR840002021B1/ko not_active Expired
- 1980-10-31 AU AU63898/80A patent/AU517842B2/en not_active Expired
-
1981
- 1981-10-06 AR AR286998A patent/AR229106A1/es active
- 1981-11-05 ES ES506893A patent/ES8207120A1/es not_active Expired
-
1983
- 1983-01-07 YU YU33/83A patent/YU42066B/xx unknown
Also Published As
| Publication number | Publication date |
|---|---|
| FI68807B (fi) | 1985-07-31 |
| DK462480A (da) | 1981-05-02 |
| PH15468A (en) | 1983-01-24 |
| FI803399L (fi) | 1981-05-02 |
| PT72005B (en) | 1981-08-31 |
| ES506893A0 (es) | 1982-09-01 |
| NO803259L (no) | 1981-05-04 |
| KR840002021B1 (ko) | 1984-11-05 |
| ES8207120A1 (es) | 1982-09-01 |
| KR830004201A (ko) | 1983-07-06 |
| AR229106A1 (es) | 1983-06-15 |
| IL61376A (en) | 1983-10-31 |
| AU6389880A (en) | 1981-05-07 |
| FI68807C (fi) | 1985-11-11 |
| YU42066B (en) | 1988-04-30 |
| ES8201948A1 (es) | 1982-01-16 |
| NO149102C (no) | 1984-02-15 |
| YU3383A (en) | 1983-09-30 |
| NO149102B (no) | 1983-11-07 |
| EP0028901A1 (en) | 1981-05-20 |
| IL61376A0 (en) | 1980-12-31 |
| EP0028901B1 (en) | 1983-03-02 |
| CA1130816A (en) | 1982-08-31 |
| PT72005A (en) | 1980-11-01 |
| US4556676A (en) | 1985-12-03 |
| GR70782B (index.php) | 1983-03-23 |
| IE802260L (en) | 1981-05-01 |
| ATE2667T1 (de) | 1983-03-15 |
| YU277480A (en) | 1983-09-30 |
| DK149308B (da) | 1986-04-28 |
| YU41744B (en) | 1987-12-31 |
| ES496441A0 (es) | 1982-01-16 |
| AU517842B2 (en) | 1981-08-27 |
| AR225196A1 (es) | 1982-02-26 |
| IE50396B1 (en) | 1986-04-16 |
| DE3062226D1 (en) | 1983-04-07 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DK149308C (da) | Analogifremgangs-maade til fremstilling af trans-4-phenyl-1,2,3,4-tetrahydro-1-naphthalenamin-derivater eller farmaceutisk acceptablesyreadditionssalte deraf | |
| DK462380A (da) | Analogifremgangsmaade til fremstilling af 2,4-diaminoquinazolin-forbindelser eller syreadditionssalte deraf | |
| DK151623C (da) | Analogifremgangsmaade til fremstilling af n-substituerede moranolinderivater eller farmaceutisk acceptable syreadditionssalte deraf | |
| DK149895C (da) | Fremgangsmaade til fremstilling af alfa-aminoacylprolyl-ng-carboxy-argininaldehydderivater eller farmaceutisk acceptable syreadditionssalte deraf | |
| DK151884C (da) | Analogifremgangsmaade til fremstilling af 3-(1-imidazolylalkyl)indolderivater eller farmaceutisk acceptable syreadditionssalte deraf | |
| DK160045C (da) | Analogifremgangsmaade til fremstilling af 4-oxo-4h-pyridooe1,2-aaapyrimidiner eller farmaceutisk acceptable syreadditionssalte eller kvaternaere ammoniumsalte deraf | |
| DK157451C (da) | Analogifremgangsmaade til fremstilling af 2,4-diamino-6-alkoxybenzyl-5-methylpyridooe2,3-daapyrimidiner eller farmaceutisk acceptable syreadditionssalte deraf | |
| DK151805C (da) | Analogifremgangsmaade til fremstilling af 20,21-di-nor-eburnameninderivater eller farmaceutisk acceptable additionssalte deraf | |
| DK149841C (da) | Analogifremgangsmaade til fremstilling af alfa-fluor-methyl-alfa-aminoalkansyrer eller farmaceutisk acceptable syreadditionssalte deraf | |
| DK149077C (da) | Analogifremgangsmaade til fremstilling af encephalin-analoge pentapeptidamidderivater eller farmaceutisk acceptable syreadditionssalte deraf | |
| DK148281C (da) | Analogifremgangsmaade til fremstilling af 8a-substituerede 8,8a-desoxy-8,8a-dihydrooleandomycin-forbindelser eller farmaceutiskacceptable syreadditionssalte deraf | |
| DK150597C (da) | Analogifremgangsmaade til fremstilling af 3,4-bis-substituerede 1,2,5-oxadiazol-2-oxider eller farmakologisk acceptable syreadditionssalte deraf | |
| DK165005C (da) | Analogifremgangsmaade til fremstilling af 4,5-dihydro-4-oxofuran-2-carboxylsyrederivater eller terapeutisk acceptable salte deraf | |
| DK160875C (da) | Analogifremgangsmaade til fremstilling af 3,7-diazabicyklooe3.3.1aa-nonanforbindelser eller farmaceutisk acceptable syreadditionssalte deraf | |
| DK157135C (da) | Analogifremgangsmaade til fremstilling af 1,2,4-triazol-forbindelser eller farmaceutisk acceptable syreadditionssalte deraf | |
| DK152427C (da) | Analogifremgangsmaade til fremstilling af 4-thiomethylpyridinforbindelser eller farmaceutisk acceptable syreadditionssalte deraf | |
| DK144793C (da) | Analogifremgangsmaade til fremstilling af dihydro- eller tetrahydroiminothiaziner eller farmaceutisk acceptable syreadditionssalte deraf | |
| DK152754C (da) | Analogifremgangsmaade til fremstilling af 1-acyl-8-(3-amino-2-hydroxypropoxy)-1,2,3,4-tetrahydroquinoliner eller farmaceutisk acceptable syreadditionssalte deraf | |
| DK152211C (da) | Analogifremgangsmaade til fremstilling af n-phenyl-n-(4-piperidinyl)-amider eller farmaceutisk acceptable syreadditionssalte deraf. | |
| DK160874C (da) | Analogifremgangsmaade til fremstilling af ergol-8-en- eller ergolinforbindelser eller farmaceutisk acceptable syreadditionssalte deraf | |
| DK157021C (da) | Analogifremgangsmaade til fremstilling af 2,3-polymethylen-4-oxo-4h-pyrido- eller -azepinooe1,2-aaapyrimidiner eller farmaceutisk acceptable syreadditionssalte eller kvaternaere salte deraf | |
| DK146886C (da) | Analogifremgangsmaade til fremstilling af basisk substituerede o-propylerede oximer eller fysiologisk acceptable syreadditionssalte deraf | |
| DK150481C (da) | Analogifremgangsmaade til fremstilling af 3',4'-dihydro-spiro-(imidazolidin-4,1'-(2'h)-naphthalen)-5-on eller farmaceutisk acceptable syreadditionssalte deraf | |
| DK143197C (da) | Analogifremgangsmaade til fremstilling af 5,7-dihydroxy-tetrahydroisoquinoliner eller farmaceutisk acceptable syreadditionssalte deraf | |
| DK149750C (da) | Analogifremgangsmaade til fremstilling af n-alkenylmoranolin-derivater eller farmaceutiske acceptable syreadditionssalte deraf |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| PUP | Patent expired |