YU42066B - Processfor obtaining trans-4-phenyl-1,2,3,4-tetrahydro-1-naphthylamine - Google Patents
Processfor obtaining trans-4-phenyl-1,2,3,4-tetrahydro-1-naphthylamineInfo
- Publication number
- YU42066B YU42066B YU33/83A YU3383A YU42066B YU 42066 B YU42066 B YU 42066B YU 33/83 A YU33/83 A YU 33/83A YU 3383 A YU3383 A YU 3383A YU 42066 B YU42066 B YU 42066B
- Authority
- YU
- Yugoslavia
- Prior art keywords
- processfor
- naphthylamine
- tetrahydro
- phenyl
- obtaining trans
- Prior art date
Links
- IWNWWVPLTTUPBQ-XJKSGUPXSA-N (1r,4s)-4-phenyl-1,2,3,4-tetrahydronaphthalen-1-amine Chemical compound C1([C@@H]2CC[C@H](C3=CC=CC=C32)N)=CC=CC=C1 IWNWWVPLTTUPBQ-XJKSGUPXSA-N 0.000 title 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C209/00—Preparation of compounds containing amino groups bound to a carbon skeleton
- C07C209/04—Preparation of compounds containing amino groups bound to a carbon skeleton by substitution of functional groups by amino groups
- C07C209/14—Preparation of compounds containing amino groups bound to a carbon skeleton by substitution of functional groups by amino groups by substitution of hydroxy groups or of etherified or esterified hydroxy groups
- C07C209/16—Preparation of compounds containing amino groups bound to a carbon skeleton by substitution of functional groups by amino groups by substitution of hydroxy groups or of etherified or esterified hydroxy groups with formation of amino groups bound to acyclic carbon atoms or to carbon atoms of rings other than six-membered aromatic rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C43/00—Ethers; Compounds having groups, groups or groups
- C07C43/02—Ethers
- C07C43/20—Ethers having an ether-oxygen atom bound to a carbon atom of a six-membered aromatic ring
- C07C43/21—Ethers having an ether-oxygen atom bound to a carbon atom of a six-membered aromatic ring containing rings other than six-membered aromatic rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C211/00—Compounds containing amino groups bound to a carbon skeleton
- C07C211/01—Compounds containing amino groups bound to a carbon skeleton having amino groups bound to acyclic carbon atoms
- C07C211/26—Compounds containing amino groups bound to a carbon skeleton having amino groups bound to acyclic carbon atoms of an unsaturated carbon skeleton containing at least one six-membered aromatic ring
- C07C211/30—Compounds containing amino groups bound to a carbon skeleton having amino groups bound to acyclic carbon atoms of an unsaturated carbon skeleton containing at least one six-membered aromatic ring the six-membered aromatic ring being part of a condensed ring system formed by two rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C211/00—Compounds containing amino groups bound to a carbon skeleton
- C07C211/43—Compounds containing amino groups bound to a carbon skeleton having amino groups bound to carbon atoms of six-membered aromatic rings of the carbon skeleton
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C45/00—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds
- C07C45/004—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by reaction with organometalhalides
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C45/00—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds
- C07C45/45—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by condensation
- C07C45/46—Friedel-Crafts reactions
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C49/00—Ketones; Ketenes; Dimeric ketenes; Ketonic chelates
- C07C49/587—Unsaturated compounds containing a keto groups being part of a ring
- C07C49/687—Unsaturated compounds containing a keto groups being part of a ring containing halogen
- C07C49/697—Unsaturated compounds containing a keto groups being part of a ring containing halogen containing six-membered aromatic rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C49/00—Ketones; Ketenes; Dimeric ketenes; Ketonic chelates
- C07C49/587—Unsaturated compounds containing a keto groups being part of a ring
- C07C49/753—Unsaturated compounds containing a keto groups being part of a ring containing ether groups, groups, groups, or groups
- C07C49/755—Unsaturated compounds containing a keto groups being part of a ring containing ether groups, groups, groups, or groups a keto group being part of a condensed ring system with two or three rings, at least one ring being a six-membered aromatic ring
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C57/00—Unsaturated compounds having carboxyl groups bound to acyclic carbon atoms
- C07C57/52—Unsaturated compounds having carboxyl groups bound to acyclic carbon atoms containing halogen
- C07C57/58—Unsaturated compounds having carboxyl groups bound to acyclic carbon atoms containing halogen containing six-membered aromatic rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C57/00—Unsaturated compounds having carboxyl groups bound to acyclic carbon atoms
- C07C57/52—Unsaturated compounds having carboxyl groups bound to acyclic carbon atoms containing halogen
- C07C57/58—Unsaturated compounds having carboxyl groups bound to acyclic carbon atoms containing halogen containing six-membered aromatic rings
- C07C57/60—Unsaturated compounds having carboxyl groups bound to acyclic carbon atoms containing halogen containing six-membered aromatic rings having unsaturation outside the rings
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Acyclic And Carbocyclic Compounds In Medicinal Compositions (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
Priority Applications (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| BA970194A BA97194B1 (bs) | 1979-11-01 | 1997-08-13 | Postupak za dobivanje trans-4-fenil-1,2,3,4-tetrahidro-1-naftalin amina |
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US9023779A | 1979-11-01 | 1979-11-01 | |
| US06/184,447 US4556676A (en) | 1979-11-01 | 1980-09-05 | Antidepressant derivatives of trans-4-phenyl-1,2,3,4-tetrahydro-1-naphthalenamine |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| YU3383A YU3383A (en) | 1983-09-30 |
| YU42066B true YU42066B (en) | 1988-04-30 |
Family
ID=26782055
Family Applications (2)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| YU2774/80A YU41744B (en) | 1979-11-01 | 1980-10-30 | Process for obtaining trans-4-phenyl-1,2,3,4-tetrahydro-1-naphthalene amine |
| YU33/83A YU42066B (en) | 1979-11-01 | 1983-01-07 | Processfor obtaining trans-4-phenyl-1,2,3,4-tetrahydro-1-naphthylamine |
Family Applications Before (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| YU2774/80A YU41744B (en) | 1979-11-01 | 1980-10-30 | Process for obtaining trans-4-phenyl-1,2,3,4-tetrahydro-1-naphthalene amine |
Country Status (18)
| Country | Link |
|---|---|
| US (1) | US4556676A (xx) |
| EP (1) | EP0028901B1 (xx) |
| KR (1) | KR840002021B1 (xx) |
| AR (2) | AR225196A1 (xx) |
| AT (1) | ATE2667T1 (xx) |
| AU (1) | AU517842B2 (xx) |
| CA (1) | CA1130816A (xx) |
| DE (1) | DE3062226D1 (xx) |
| DK (1) | DK149308C (xx) |
| ES (2) | ES8201948A1 (xx) |
| FI (1) | FI68807C (xx) |
| GR (1) | GR70782B (xx) |
| IE (1) | IE50396B1 (xx) |
| IL (1) | IL61376A (xx) |
| NO (1) | NO149102C (xx) |
| PH (1) | PH15468A (xx) |
| PT (1) | PT72005B (xx) |
| YU (2) | YU41744B (xx) |
Families Citing this family (38)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| SE8004002L (sv) * | 1980-05-29 | 1981-11-30 | Arvidsson Folke Lars Erik | Terapeutiskt anvendbara tetralinderivat |
| US4866208A (en) * | 1981-12-21 | 1989-09-12 | The Dow Chemical Company | Meta-phenylene diamine derivatives |
| US4777288A (en) * | 1987-06-11 | 1988-10-11 | Pfizer Inc. | Process for preparing a 4,4-diphenylbutanoic acid derivative |
| US4839104A (en) * | 1987-06-11 | 1989-06-13 | Pfizer, Inc. | Process for preparing sertraline intermediates |
| FR2623802B1 (fr) * | 1987-11-26 | 1990-05-04 | Lucien Laboratoires | Derives d'amino-4 trifluoromethyl-1 tetralines. leur preparation et leur application en therapeutique |
| FR2642065B1 (fr) * | 1989-01-24 | 1991-05-24 | Lipha | Derives d'acides benzocycloalcenyl dihydroxy alcanoiques, procede de preparation et medicaments les contenant |
| FR2665443B1 (fr) * | 1990-08-03 | 1992-11-06 | Lucien Laboratoires | Derives d'amino-4-methyl-1-tetralines, leur preparation et leur application en therapeutique. |
| US5082970A (en) * | 1991-03-06 | 1992-01-21 | Pfizer Inc. | Process for recycling amine isomer |
| GB9114948D0 (en) * | 1991-07-11 | 1991-08-28 | Pfizer Ltd | Process for preparing sertraline intermediates |
| US5196607A (en) * | 1992-02-14 | 1993-03-23 | Pfizer Inc. | Process for preparing ketone enantiomer |
| US5248699A (en) * | 1992-08-13 | 1993-09-28 | Pfizer Inc. | Sertraline polymorph |
| US5466880A (en) * | 1992-09-15 | 1995-11-14 | Pfizer Inc. | Process for preparing ketone enantiomer |
| WO1994022495A1 (en) * | 1993-03-31 | 1994-10-13 | The Trustees Of The University Of Pennsylvania | Dopamine d-3 and serotonin (5-ht1a) receptor ligands and imaging agents |
| DE69406553T2 (de) * | 1993-11-30 | 1998-02-26 | Pfizer | Verfahren zur herstellung von chiralen tetralonen |
| US6455736B1 (en) | 1994-12-16 | 2002-09-24 | Uop Llc | Process for preparation of pharmaceutically desired sertraline and sertraline analogs |
| US6410794B1 (en) | 1994-12-16 | 2002-06-25 | Uop Llc | Process for preparation of pharmaceutically desired chiral tetralone from tetralones |
| HU222341B1 (hu) * | 1996-12-18 | 2003-06-28 | Richter Gedeon Vegyészeti Gyár Rt. | Eljárás sertralin előállítására és az eljárásban alkalmazott intermedier |
| IN182588B (xx) | 1998-05-12 | 1999-05-08 | Sun Pharmaceutical Ind Ltd | |
| IN187170B (xx) | 2000-01-04 | 2002-02-23 | Sun Pharmaceutical Ind Ltd | |
| DE10006411C2 (de) * | 2000-02-14 | 2002-03-07 | Huf Huelsbeck & Fuerst Gmbh | Elektronischer Zündanlaßschalter für Kraftfahrzeuge und Reserveschlüssel zur Betätigung desselben |
| DE10041478A1 (de) | 2000-08-24 | 2002-03-14 | Sanol Arznei Schwarz Gmbh | Neue pharmazeutische Zusammensetzung |
| US6482440B2 (en) | 2000-09-21 | 2002-11-19 | Phase 2 Discovery, Inc. | Long acting antidepressant microparticles |
| US6723878B2 (en) | 2001-06-15 | 2004-04-20 | Orion Corporation Fermion | Method for preparing sertraline |
| US20040087661A1 (en) * | 2002-09-16 | 2004-05-06 | Sepracor, Inc. | Treatment of CNS disorders with trans 4-3(3,4-dichlorophenyl)-1,2,3,4-tetrahydro-N-methyl-1-napthalenamine |
| US8134029B2 (en) | 2002-09-16 | 2012-03-13 | Sunovion Pharmaceuticals Inc. | Treatment of CNS disorders with trans 4-(3,4-dichlorophenyl)-1,2,3,4-tetrahydro-1-napthalenamine |
| AU2003272460B2 (en) * | 2002-09-16 | 2009-12-17 | Sepracor Inc. | Treatment of CNS disorders with trans 4-(3,4-dichlorophenyl)-1,2,3,4-tetrahydro-1-napthalenamine and its formamide |
| DE10334188B4 (de) * | 2003-07-26 | 2007-07-05 | Schwarz Pharma Ag | Verwendung von Rotigotin zur Behandlung von Depressionen |
| DE10334187A1 (de) * | 2003-07-26 | 2005-03-03 | Schwarz Pharma Ag | Substituierte 2-Aminotetraline zur Behandlung von Depressionen |
| US20060014838A1 (en) * | 2004-07-14 | 2006-01-19 | Sudhakar Valluri | Process for converting trans-sertraline to cis-sertraline |
| CA2957667A1 (en) | 2005-07-06 | 2007-01-11 | Sepracor Inc. | Combinations of eszopiclone and trans 4-(3,4-dichlorophenyl)-1,2,3,4-tetrahydro-n-methyl-1-napthalenamine or trans 4-(3,4-dichlorophenyl)-1,2,3,4-tetrahydro-1-napthalenamine, and methods of treatment of menopause and mood, anxiety, and cognitive disorders |
| AU2007233041B2 (en) | 2006-03-31 | 2013-05-02 | Sepracor Inc. | Preparation of chiral amides and amines |
| WO2007143267A2 (en) * | 2006-05-31 | 2007-12-13 | Sepracor Inc. | Treatment of pain disorders with trans 4-(3,4-dichlorophenyl)-1,2,3,4-tetrahydro-1-naphthalenamine and its formamide |
| WO2007146796A2 (en) * | 2006-06-13 | 2007-12-21 | Ramot At Tel-Aviv University Ltd. | Antiproliferative compounds, compositions and methods of use |
| EP1987815A1 (en) * | 2007-05-04 | 2008-11-05 | Schwarz Pharma Ag | Oronasopharyngeally deliverable pharmaceutical compositions of dopamine agonists for the prevention and/or treatment of restless limb disorders |
| US20100081713A1 (en) * | 2008-03-19 | 2010-04-01 | CombinatoRx, (Singapore) Pte. Ltd. | Compositions and methods for treating viral infections |
| MX2016014780A (es) * | 2014-05-13 | 2017-07-25 | Sunovion Pharmaceuticals Inc | Metodos y composiciones de dasotralina para el tratamiento del adhd. |
| WO2015175523A1 (en) * | 2014-05-13 | 2015-11-19 | Sunovion Pharmaceuticals Inc. | Dosage of dasotraline and method for treatment of adhd |
| WO2016046669A2 (en) * | 2014-09-27 | 2016-03-31 | Mohan M Alapati | Compositions and methods for the treatment of depression and neurological diseases |
Family Cites Families (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB793853A (en) * | 1954-09-15 | 1958-04-23 | Schering Ag | Manufacture of new 3-amino-indanes |
| DE1098511B (de) * | 1959-11-21 | 1961-02-02 | Schering Ag | Verfahren zur Abtrennung von analgetisch wirksamen d-1-Phenyl-3-dimethylaminoindan |
| US3704323A (en) * | 1969-12-23 | 1972-11-28 | Squibb & Sons Inc | Indane derivatives |
| GB1420472A (en) * | 1972-09-27 | 1976-01-07 | Pfizer | Aminophenyltetralin compounds |
| US4029731A (en) * | 1974-11-06 | 1977-06-14 | Pfizer Inc. | Aminophenyltetralin compounds |
| US4045488A (en) * | 1974-11-06 | 1977-08-30 | Pfizer Inc. | Aminophenyltetralin compounds |
-
1980
- 1980-09-05 US US06/184,447 patent/US4556676A/en not_active Expired - Lifetime
- 1980-10-28 EP EP80303810A patent/EP0028901B1/en not_active Expired
- 1980-10-28 DE DE8080303810T patent/DE3062226D1/de not_active Expired
- 1980-10-28 AT AT80303810T patent/ATE2667T1/de not_active IP Right Cessation
- 1980-10-29 PH PH24786A patent/PH15468A/en unknown
- 1980-10-30 AR AR283061A patent/AR225196A1/es active
- 1980-10-30 IL IL61376A patent/IL61376A/xx unknown
- 1980-10-30 FI FI803399A patent/FI68807C/fi not_active IP Right Cessation
- 1980-10-30 GR GR63248A patent/GR70782B/el unknown
- 1980-10-30 CA CA363,571A patent/CA1130816A/en not_active Expired
- 1980-10-30 YU YU2774/80A patent/YU41744B/xx unknown
- 1980-10-31 NO NO803259A patent/NO149102C/no unknown
- 1980-10-31 IE IE2260/80A patent/IE50396B1/en not_active IP Right Cessation
- 1980-10-31 PT PT72005A patent/PT72005B/pt unknown
- 1980-10-31 DK DK462480A patent/DK149308C/da not_active IP Right Cessation
- 1980-10-31 AU AU63898/80A patent/AU517842B2/en not_active Expired
- 1980-10-31 KR KR1019800004175A patent/KR840002021B1/ko active
- 1980-10-31 ES ES496441A patent/ES8201948A1/es not_active Expired
-
1981
- 1981-10-06 AR AR286998A patent/AR229106A1/es active
- 1981-11-05 ES ES506893A patent/ES8207120A1/es not_active Expired
-
1983
- 1983-01-07 YU YU33/83A patent/YU42066B/xx unknown
Also Published As
| Publication number | Publication date |
|---|---|
| PT72005B (en) | 1981-08-31 |
| ES506893A0 (es) | 1982-09-01 |
| ES496441A0 (es) | 1982-01-16 |
| PT72005A (en) | 1980-11-01 |
| NO149102C (no) | 1984-02-15 |
| YU277480A (en) | 1983-09-30 |
| DK149308C (da) | 1986-12-08 |
| YU41744B (en) | 1987-12-31 |
| DK462480A (da) | 1981-05-02 |
| NO149102B (no) | 1983-11-07 |
| KR840002021B1 (ko) | 1984-11-05 |
| AU6389880A (en) | 1981-05-07 |
| AU517842B2 (en) | 1981-08-27 |
| CA1130816A (en) | 1982-08-31 |
| YU3383A (en) | 1983-09-30 |
| GR70782B (xx) | 1983-03-23 |
| IE50396B1 (en) | 1986-04-16 |
| ATE2667T1 (de) | 1983-03-15 |
| AR225196A1 (es) | 1982-02-26 |
| DK149308B (da) | 1986-04-28 |
| PH15468A (en) | 1983-01-24 |
| FI803399L (fi) | 1981-05-02 |
| IL61376A0 (en) | 1980-12-31 |
| NO803259L (no) | 1981-05-04 |
| DE3062226D1 (en) | 1983-04-07 |
| KR830004201A (ko) | 1983-07-06 |
| IE802260L (en) | 1981-05-01 |
| AR229106A1 (es) | 1983-06-15 |
| ES8201948A1 (es) | 1982-01-16 |
| EP0028901A1 (en) | 1981-05-20 |
| IL61376A (en) | 1983-10-31 |
| ES8207120A1 (es) | 1982-09-01 |
| US4556676A (en) | 1985-12-03 |
| FI68807C (fi) | 1985-11-11 |
| EP0028901B1 (en) | 1983-03-02 |
| FI68807B (fi) | 1985-07-31 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| YU42066B (en) | Processfor obtaining trans-4-phenyl-1,2,3,4-tetrahydro-1-naphthylamine | |
| GB2064520B (en) | A-aryl-1h-1,2,4-triazole-1-ethanols | |
| PH13932A (en) | 1,2,3,4-tetrahydro-napthalenes | |
| ZA802092B (en) | Substituted 9,10-anthracene-bishydrazones | |
| GB2058766B (en) | 5'-aminoalkyl-4,4'-dialkylpsoralens | |
| GB2058767B (en) | 4'-substituted-4,5',8-trialklpsoralens | |
| ZA773308B (en) | Process for the preparation of 10,19-dihydro-vitamin d compounds | |
| ZA804178B (en) | Process for the preparation of 2,6-dialkylcyclohexylamines | |
| GB2044770B (en) | 24,24 - difluoro- 25 - hydroxycholecalciferol | |
| NZ193666A (en) | 3-aryl-2-(2,3-dihydrothiazol-2-ylidene)-3-oxopropionitriles | |
| PT66891B (en) | Process for the preparation of 1,5 disubstituted-2-pyrrolidones | |
| GB1542569A (en) | 2-substituted-15-heteroaryl-16,17,18,19,20-pentanor-prostaglandins | |
| GB8315918D0 (en) | 16-oxa-3-methyl-bicyclo-(10.3.1)pentadec-1-ene | |
| IL52424A0 (en) | 2,6-methano-2h-1-benzoxocins | |
| CS765780A2 (en) | Zpusob pripravy 1,2 bis (nikotinamido) propanu | |
| AU2468877A (en) | 1,4 -dicyanobytene | |
| PH14105A (en) | 1,2,3-thiadiazol-5-yl-ureas | |
| CS340780A2 (en) | Zpusob vyroby pyrazolo (1,5 c) chinazolinovych derivatu | |
| GB1537635A (en) | 15,16-dihydroxyprostaglandins | |
| IL75705A (en) | 1,2,5-thiadiazole-1-oxides | |
| ZA804183B (en) | 1,2,4-thiadiazolyloxyphenylureas | |
| YU40813B (en) | Process for obtaining 1-tert-butylamino-3-(2,5 dichlorophenoxio-2-propanoe | |
| JPS6485961A (en) | 3,5-cyclovitamine derivative | |
| NZ194583A (en) | 5,6-dihydro-11h-pyrimido (4,5-6)(1,5) benzodiazepin-5-ones | |
| CS515881A2 (en) | Zpusob pripravy oktahydropyrazolo(3,4 g) chinolinu |