DK142284B - Analogifremgangsmåde til fremstilling af thiazolderivater. - Google Patents
Analogifremgangsmåde til fremstilling af thiazolderivater. Download PDFInfo
- Publication number
- DK142284B DK142284B DK58476AA DK58476A DK142284B DK 142284 B DK142284 B DK 142284B DK 58476A A DK58476A A DK 58476AA DK 58476 A DK58476 A DK 58476A DK 142284 B DK142284 B DK 142284B
- Authority
- DK
- Denmark
- Prior art keywords
- formula
- compound
- preparation
- acid
- methyl
- Prior art date
Links
- 238000002360 preparation method Methods 0.000 title claims description 11
- 238000000034 method Methods 0.000 title claims description 8
- 150000007979 thiazole derivatives Chemical class 0.000 title claims description 4
- 150000001875 compounds Chemical class 0.000 claims description 21
- 150000003839 salts Chemical class 0.000 claims description 9
- 125000000217 alkyl group Chemical group 0.000 claims description 7
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical group [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims description 5
- 125000004432 carbon atom Chemical group C* 0.000 claims description 4
- 229910052801 chlorine Inorganic materials 0.000 claims description 3
- 239000000460 chlorine Substances 0.000 claims description 2
- LMBFAGIMSUYTBN-MPZNNTNKSA-N teixobactin Chemical compound C([C@H](C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H](CCC(N)=O)C(=O)N[C@H]([C@@H](C)CC)C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H]1C(N[C@@H](C)C(=O)N[C@@H](C[C@@H]2NC(=N)NC2)C(=O)N[C@H](C(=O)O[C@H]1C)[C@@H](C)CC)=O)NC)C1=CC=CC=C1 LMBFAGIMSUYTBN-MPZNNTNKSA-N 0.000 claims description 2
- FCSKOFQQCWLGMV-UHFFFAOYSA-N 5-{5-[2-chloro-4-(4,5-dihydro-1,3-oxazol-2-yl)phenoxy]pentyl}-3-methylisoxazole Chemical compound O1N=C(C)C=C1CCCCCOC1=CC=C(C=2OCCN=2)C=C1Cl FCSKOFQQCWLGMV-UHFFFAOYSA-N 0.000 claims 1
- KZBUYRJDOAKODT-UHFFFAOYSA-N Chlorine Chemical compound ClCl KZBUYRJDOAKODT-UHFFFAOYSA-N 0.000 claims 1
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 9
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 7
- 239000002253 acid Substances 0.000 description 6
- -1 alkali metal salts Chemical class 0.000 description 6
- 239000000047 product Substances 0.000 description 6
- 235000021588 free fatty acids Nutrition 0.000 description 5
- SCYULBFZEHDVBN-UHFFFAOYSA-N 1,1-Dichloroethane Chemical compound CC(Cl)Cl SCYULBFZEHDVBN-UHFFFAOYSA-N 0.000 description 4
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 4
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 4
- 150000007513 acids Chemical class 0.000 description 4
- 239000000284 extract Substances 0.000 description 4
- 229910052500 inorganic mineral Inorganic materials 0.000 description 4
- 235000010755 mineral Nutrition 0.000 description 4
- 239000011707 mineral Substances 0.000 description 4
- 150000007524 organic acids Chemical class 0.000 description 4
- 235000005985 organic acids Nutrition 0.000 description 4
- 239000003960 organic solvent Substances 0.000 description 4
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 3
- 241001465754 Metazoa Species 0.000 description 3
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 3
- 239000003513 alkali Substances 0.000 description 3
- AZDRQVAHHNSJOQ-UHFFFAOYSA-N alumane Chemical class [AlH3] AZDRQVAHHNSJOQ-UHFFFAOYSA-N 0.000 description 3
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 3
- 229910052794 bromium Inorganic materials 0.000 description 3
- FGQNJWQEVPVFIN-UHFFFAOYSA-N diethyl 2-(3-oxopropyl)propanedioate Chemical compound CCOC(=O)C(CCC=O)C(=O)OCC FGQNJWQEVPVFIN-UHFFFAOYSA-N 0.000 description 3
- 210000002381 plasma Anatomy 0.000 description 3
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 3
- DXWAMOUMQYPGDC-UHFFFAOYSA-N 3-(2-methyl-1,3-thiazol-5-yl)propanoic acid Chemical compound CC1=NC=C(CCC(O)=O)S1 DXWAMOUMQYPGDC-UHFFFAOYSA-N 0.000 description 2
- HGINCPLSRVDWNT-UHFFFAOYSA-N Acrolein Chemical compound C=CC=O HGINCPLSRVDWNT-UHFFFAOYSA-N 0.000 description 2
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 2
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 2
- AFVFQIVMOAPDHO-UHFFFAOYSA-N Methanesulfonic acid Chemical compound CS(O)(=O)=O AFVFQIVMOAPDHO-UHFFFAOYSA-N 0.000 description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 2
- ATUOYWHBWRKTHZ-UHFFFAOYSA-N Propane Chemical compound CCC ATUOYWHBWRKTHZ-UHFFFAOYSA-N 0.000 description 2
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 2
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- RAHZWNYVWXNFOC-UHFFFAOYSA-N Sulphur dioxide Chemical compound O=S=O RAHZWNYVWXNFOC-UHFFFAOYSA-N 0.000 description 2
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 2
- 230000007059 acute toxicity Effects 0.000 description 2
- 231100000403 acute toxicity Toxicity 0.000 description 2
- 235000011114 ammonium hydroxide Nutrition 0.000 description 2
- 230000003243 anti-lipolytic effect Effects 0.000 description 2
- 239000008346 aqueous phase Substances 0.000 description 2
- 238000006243 chemical reaction Methods 0.000 description 2
- 230000001684 chronic effect Effects 0.000 description 2
- 239000003814 drug Substances 0.000 description 2
- 229940079593 drug Drugs 0.000 description 2
- 150000002632 lipids Chemical class 0.000 description 2
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 2
- 235000019341 magnesium sulphate Nutrition 0.000 description 2
- 150000007522 mineralic acids Chemical class 0.000 description 2
- 230000000144 pharmacologic effect Effects 0.000 description 2
- 238000010992 reflux Methods 0.000 description 2
- 239000011734 sodium Substances 0.000 description 2
- 238000002560 therapeutic procedure Methods 0.000 description 2
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 1
- 241000282472 Canis lupus familiaris Species 0.000 description 1
- 229920002134 Carboxymethyl cellulose Polymers 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- 206010052895 Coronary artery insufficiency Diseases 0.000 description 1
- 206010019280 Heart failures Diseases 0.000 description 1
- 231100000111 LD50 Toxicity 0.000 description 1
- OFOBLEOULBTSOW-UHFFFAOYSA-N Malonic acid Chemical class OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 description 1
- 240000000233 Melia azedarach Species 0.000 description 1
- HGINADPHJQTSKN-UHFFFAOYSA-N Monoethyl malonic acid Chemical compound CCOC(=O)CC(O)=O HGINADPHJQTSKN-UHFFFAOYSA-N 0.000 description 1
- 241000699670 Mus sp. Species 0.000 description 1
- GRYLNZFGIOXLOG-UHFFFAOYSA-N Nitric acid Chemical compound O[N+]([O-])=O GRYLNZFGIOXLOG-UHFFFAOYSA-N 0.000 description 1
- OAICVXFJPJFONN-UHFFFAOYSA-N Phosphorus Chemical compound [P] OAICVXFJPJFONN-UHFFFAOYSA-N 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- 241000700159 Rattus Species 0.000 description 1
- 241000277331 Salmonidae Species 0.000 description 1
- 230000001154 acute effect Effects 0.000 description 1
- 229910052783 alkali metal Inorganic materials 0.000 description 1
- 150000008044 alkali metal hydroxides Chemical class 0.000 description 1
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 1
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 1
- 239000000908 ammonium hydroxide Substances 0.000 description 1
- 125000004429 atom Chemical group 0.000 description 1
- 239000002585 base Substances 0.000 description 1
- 210000004369 blood Anatomy 0.000 description 1
- 239000008280 blood Substances 0.000 description 1
- 210000000988 bone and bone Anatomy 0.000 description 1
- SXDBWCPKPHAZSM-UHFFFAOYSA-N bromic acid Chemical compound OBr(=O)=O SXDBWCPKPHAZSM-UHFFFAOYSA-N 0.000 description 1
- 159000000007 calcium salts Chemical class 0.000 description 1
- 239000001768 carboxy methyl cellulose Substances 0.000 description 1
- 235000010948 carboxy methyl cellulose Nutrition 0.000 description 1
- 239000008112 carboxymethyl-cellulose Substances 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- 125000001309 chloro group Chemical group Cl* 0.000 description 1
- 238000006114 decarboxylation reaction Methods 0.000 description 1
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 238000000605 extraction Methods 0.000 description 1
- 201000005577 familial hyperlipidemia Diseases 0.000 description 1
- 239000000706 filtrate Substances 0.000 description 1
- XMBWDFGMSWQBCA-UHFFFAOYSA-N hydrogen iodide Chemical compound I XMBWDFGMSWQBCA-UHFFFAOYSA-N 0.000 description 1
- 229910000043 hydrogen iodide Inorganic materials 0.000 description 1
- 230000007062 hydrolysis Effects 0.000 description 1
- 238000006460 hydrolysis reaction Methods 0.000 description 1
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 1
- OPUAWDUYWRUIIL-UHFFFAOYSA-N methanedisulfonic acid Chemical compound OS(=O)(=O)CS(O)(=O)=O OPUAWDUYWRUIIL-UHFFFAOYSA-N 0.000 description 1
- 229940098779 methanesulfonic acid Drugs 0.000 description 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 1
- 239000000203 mixture Substances 0.000 description 1
- 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 229910017604 nitric acid Inorganic materials 0.000 description 1
- 239000012074 organic phase Substances 0.000 description 1
- 125000001147 pentyl group Chemical group C(CCCC)* 0.000 description 1
- 239000012071 phase Substances 0.000 description 1
- 239000011574 phosphorus Substances 0.000 description 1
- 229910052698 phosphorus Inorganic materials 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- NTTOTNSKUYCDAV-UHFFFAOYSA-N potassium hydride Chemical compound [KH] NTTOTNSKUYCDAV-UHFFFAOYSA-N 0.000 description 1
- 229910000105 potassium hydride Inorganic materials 0.000 description 1
- 239000001294 propane Substances 0.000 description 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 239000011541 reaction mixture Substances 0.000 description 1
- 229920006395 saturated elastomer Polymers 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 229910000029 sodium carbonate Inorganic materials 0.000 description 1
- 239000011780 sodium chloride Substances 0.000 description 1
- 229910000104 sodium hydride Inorganic materials 0.000 description 1
- 239000002689 soil Substances 0.000 description 1
- 238000012453 sprague-dawley rat model Methods 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
- 230000008961 swelling Effects 0.000 description 1
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 1
- YUKQRDCYNOVPGJ-UHFFFAOYSA-N thioacetamide Chemical compound CC(N)=S YUKQRDCYNOVPGJ-UHFFFAOYSA-N 0.000 description 1
- DLFVBJFMPXGRIB-UHFFFAOYSA-N thioacetamide Natural products CC(N)=O DLFVBJFMPXGRIB-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D277/00—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings
- C07D277/02—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings not condensed with other rings
- C07D277/20—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members
- C07D277/22—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to ring carbon atoms
- C07D277/24—Radicals substituted by oxygen atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D277/00—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings
- C07D277/02—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings not condensed with other rings
- C07D277/20—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members
- C07D277/22—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to ring carbon atoms
- C07D277/30—Radicals substituted by carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Thiazole And Isothizaole Compounds (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
Applications Claiming Priority (4)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| FR7504627 | 1975-02-14 | ||
| FR7504627A FR2300562A1 (fr) | 1975-02-14 | 1975-02-14 | Nouveau |
| FR7538061 | 1975-12-12 | ||
| FR7538061A FR2334353A1 (fr) | 1975-12-12 | 1975-12-12 | Nouveaux derives thiazoliques, un procede pour leur preparation et leur application comme medicaments |
Publications (3)
| Publication Number | Publication Date |
|---|---|
| DK58476A DK58476A (Direct) | 1976-08-15 |
| DK142284B true DK142284B (da) | 1980-10-06 |
| DK142284C DK142284C (Direct) | 1981-03-02 |
Family
ID=26218733
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DK58476AA DK142284B (da) | 1975-02-14 | 1976-02-13 | Analogifremgangsmåde til fremstilling af thiazolderivater. |
Country Status (16)
| Country | Link |
|---|---|
| JP (1) | JPS51105056A (Direct) |
| AR (1) | AR219277A1 (Direct) |
| AU (1) | AU498142B2 (Direct) |
| BE (1) | BE838488A (Direct) |
| CA (1) | CA1082715A (Direct) |
| CH (1) | CH609974A5 (Direct) |
| DD (1) | DD124981A5 (Direct) |
| DE (1) | DE2605838A1 (Direct) |
| DK (1) | DK142284B (Direct) |
| ES (1) | ES445148A1 (Direct) |
| HU (1) | HU171950B (Direct) |
| IL (1) | IL48968A (Direct) |
| LU (1) | LU74338A1 (Direct) |
| NL (1) | NL7601561A (Direct) |
| PT (1) | PT64801B (Direct) |
| SE (1) | SE417510B (Direct) |
Families Citing this family (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1042362B (de) * | 1953-06-20 | 1958-10-30 | Mindener Molkerei E G M B H | Milchpasteurisieranlage |
-
1976
- 1976-02-04 IL IL48968A patent/IL48968A/xx unknown
- 1976-02-05 HU HU76RO00000874A patent/HU171950B/hu unknown
- 1976-02-11 AR AR262221A patent/AR219277A1/es active
- 1976-02-12 LU LU74338A patent/LU74338A1/xx unknown
- 1976-02-12 BE BE164262A patent/BE838488A/xx unknown
- 1976-02-12 SE SE7601589A patent/SE417510B/xx unknown
- 1976-02-12 CA CA245,873A patent/CA1082715A/fr not_active Expired
- 1976-02-12 DD DD191209A patent/DD124981A5/xx unknown
- 1976-02-13 ES ES445148A patent/ES445148A1/es not_active Expired
- 1976-02-13 PT PT64801A patent/PT64801B/pt unknown
- 1976-02-13 DK DK58476AA patent/DK142284B/da unknown
- 1976-02-13 DE DE19762605838 patent/DE2605838A1/de not_active Withdrawn
- 1976-02-13 AU AU11105/76A patent/AU498142B2/en not_active Expired
- 1976-02-13 JP JP51014118A patent/JPS51105056A/ja active Pending
- 1976-02-13 CH CH181176A patent/CH609974A5/xx not_active IP Right Cessation
- 1976-02-16 NL NL7601561A patent/NL7601561A/xx not_active Application Discontinuation
Also Published As
| Publication number | Publication date |
|---|---|
| IL48968A (en) | 1978-08-31 |
| PT64801B (fr) | 1978-02-06 |
| LU74338A1 (Direct) | 1976-12-31 |
| AU498142B2 (en) | 1979-02-15 |
| AR219277A1 (es) | 1980-08-15 |
| DD124981A5 (Direct) | 1977-03-23 |
| PT64801A (fr) | 1976-03-01 |
| SE417510B (sv) | 1981-03-23 |
| NL7601561A (nl) | 1976-08-17 |
| CA1082715A (fr) | 1980-07-29 |
| DE2605838A1 (de) | 1976-08-26 |
| BE838488A (fr) | 1976-08-12 |
| DK58476A (Direct) | 1976-08-15 |
| SE7601589L (sv) | 1976-08-15 |
| HU171950B (hu) | 1978-04-28 |
| JPS51105056A (Direct) | 1976-09-17 |
| CH609974A5 (en) | 1979-03-30 |
| DK142284C (Direct) | 1981-03-02 |
| ES445148A1 (es) | 1977-09-16 |
| IL48968A0 (en) | 1976-04-30 |
| AU1110576A (en) | 1977-08-18 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| JP3182213B2 (ja) | ピリミジンの新誘導体、それらの製造法、得られる中間体、それらの薬剤としての使用及びそれらを含有する製薬組成物 | |
| DK150512B (da) | Analogifremgangsmaade til fremstilling af 3-quino-lincarboxylsyrederivater eller syreadditionssalte deraf | |
| DK144702B (da) | Analogifremgangsmaade til fremstilling af 2,3-dihydro-imidazo (2,1-b)thiazolderivater | |
| NO147104B (no) | Analogifremgangsmaate ved fremstilling av terapeutisk aktive acetylenderivater av aminosyrer | |
| Parmar et al. | Substituted quinazolinone hydrazides as possible antituberculous agents | |
| DK141069B (da) | Analogifremgangsmåde til fremstilling af 1,5,10,10a-tetrahydrothiazolo (3,4-b)isoquinolinderivater eller syreadditionssalte deraf. | |
| FI66840B (fi) | Foerfarande foer framstaellning av nya terapeutiskt anvaendbara alfa-fluormetyl-alfa-aminoalkansyror | |
| DK142284B (da) | Analogifremgangsmåde til fremstilling af thiazolderivater. | |
| DK143105B (da) | Analogifremgangsmaade til fremstilling af aminobenzocycloheptf enderivater eller farmaceutisk acceptable additionssalte dera | |
| FI61310C (fi) | Nytt foerfarande foer framstaellning av saosom ett laekemedel anvaendbar 5-metyl-1-fenyl-1,3,4,6-tetrahydro-5h-bens(f)-2,5-oxazocin | |
| Watson | Purine N-oxides. 66. Synthesis of 9-hydroxyadenine | |
| CN112062763B (zh) | 羟基吡啶酮并[1,2-b][1,2,5]三氮卓平衍生物及制备和应用 | |
| RU2461545C1 (ru) | Способ получения 2-метилпиримидин-4,6-(3н,5н)-диона | |
| SU1250170A3 (ru) | Способ получени дихлоргидрата пирбутерола | |
| Elliott | 126. The stereochemistry of an oxazoline derivative of threonine. Improvement of a recent threonine synthesis | |
| FI70574C (fi) | Foerfarande foer framstaellning av nya farmaceutiskt anvaendbara derivat av 2-7(4-kinolinyl)-amino/-5-fluorbensoesyra | |
| Martirosyan et al. | New method for the synthesis of 2-phenylproline and its derivatives | |
| Tian et al. | Synthesis of 18F‐labeled cyclooxygenase‐2 (COX‐2) inhibitor as a potential PET imaging agent | |
| JP6580976B2 (ja) | 1−ベンゾイル−5−オキソ−2,3,4,5−テトラヒドロ−1H−ベンゾ[b]アゼピン−4−カルボン酸エステルの製造方法 | |
| DK142767B (da) | Analogifremgangsmåde til fremstilling af 1- og dl-(racem-)formerne af derivater af 6-(m-aminophenyl)-2,3,5,6-tetrahydroimidazo(2,1-b)thiazol. | |
| SU557760A3 (ru) | Способ получени изоксазолилпенициллинов | |
| RU2697804C1 (ru) | Способ получения 1-(ω-гидроксиалкил)урацилов | |
| DK142359B (da) | Analogifremgangsmåde til fremstilling af 7-amino-6,7-dihydro-5H-benzocyclohepten eller farmaceutisk acceptable additionssalte deraf. | |
| RU2059626C1 (ru) | СПОСОБ ПОЛУЧЕНИЯ ТРИБРОМИДА ТРИС( β -ДИЭТИЛБЕНЗИЛАММОНИО)ЭТИЛОВОГО ЭФИРА ИЗОЦИАНУРОВОЙ КИСЛОТЫ | |
| FI78687C (fi) | Foerfarande foer framstaellning av farmakologiskt aktiva /2-/(3-amino-2-pyridinyl)amino/fenyl/arylmetanoner. |