DK141846B - Analogifremgangsmåde til fremstilling af 1-oxo- eller 1-thioxo-s-triazolo(4,3-a)(1,4)benzodiazepinderivater. - Google Patents
Analogifremgangsmåde til fremstilling af 1-oxo- eller 1-thioxo-s-triazolo(4,3-a)(1,4)benzodiazepinderivater. Download PDFInfo
- Publication number
 - DK141846B DK141846B DK582970AA DK582970A DK141846B DK 141846 B DK141846 B DK 141846B DK 582970A A DK582970A A DK 582970AA DK 582970 A DK582970 A DK 582970A DK 141846 B DK141846 B DK 141846B
 - Authority
 - DK
 - Denmark
 - Prior art keywords
 - benzodiazepine
 - phenyl
 - chloro
 - parts
 - compound
 - Prior art date
 
Links
- ISZFECZEQLODQT-UHFFFAOYSA-N [1,2,4]triazolo[4,3-a][1,4]benzodiazepine-1-thione Chemical class S=C1N=NC=2N1C1=C(C=NC2)C=CC=C1 ISZFECZEQLODQT-UHFFFAOYSA-N 0.000 title claims description 3
 - 238000004519 manufacturing process Methods 0.000 title description 2
 - -1 4-substituted semicarbazido Chemical group 0.000 claims description 15
 - 125000004432 carbon atom Chemical group C* 0.000 claims description 9
 - 125000000217 alkyl group Chemical group 0.000 claims description 8
 - QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical group [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims description 8
 - 229910052760 oxygen Inorganic materials 0.000 claims description 8
 - 239000001301 oxygen Substances 0.000 claims description 8
 - 229910052757 nitrogen Inorganic materials 0.000 claims description 5
 - 125000004433 nitrogen atom Chemical group N* 0.000 claims description 5
 - 238000002360 preparation method Methods 0.000 claims description 5
 - 125000003545 alkoxy group Chemical group 0.000 claims description 3
 - 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims description 3
 - 150000003839 salts Chemical class 0.000 claims description 3
 - 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 claims description 3
 - NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical group [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 claims description 2
 - 125000005843 halogen group Chemical group 0.000 claims description 2
 - 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 2
 - 229910052717 sulfur Chemical group 0.000 claims description 2
 - 239000011593 sulfur Chemical group 0.000 claims description 2
 - OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 45
 - JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 32
 - 150000001875 compounds Chemical class 0.000 description 26
 - 239000013078 crystal Substances 0.000 description 25
 - ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 24
 - YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 21
 - 239000000203 mixture Substances 0.000 description 20
 - 238000001953 recrystallisation Methods 0.000 description 20
 - XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 18
 - UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 16
 - 239000002904 solvent Substances 0.000 description 16
 - 239000000243 solution Substances 0.000 description 15
 - LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 14
 - 238000002844 melting Methods 0.000 description 13
 - 230000008018 melting Effects 0.000 description 13
 - CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 12
 - UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 12
 - XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 12
 - 238000003756 stirring Methods 0.000 description 11
 - HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 10
 - 238000001914 filtration Methods 0.000 description 10
 - 239000000047 product Substances 0.000 description 10
 - 238000010992 reflux Methods 0.000 description 9
 - GWSXDWFXNVOIIC-UHFFFAOYSA-N (7-chloro-5-phenyl-3h-1,4-benzodiazepin-2-yl)hydrazine Chemical compound N=1CC(NN)=NC2=CC=C(Cl)C=C2C=1C1=CC=CC=C1 GWSXDWFXNVOIIC-UHFFFAOYSA-N 0.000 description 8
 - 238000001816 cooling Methods 0.000 description 8
 - 238000000354 decomposition reaction Methods 0.000 description 8
 - 238000000034 method Methods 0.000 description 7
 - 239000007858 starting material Substances 0.000 description 7
 - 229940126062 Compound A Drugs 0.000 description 6
 - RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 6
 - NLDMNSXOCDLTTB-UHFFFAOYSA-N Heterophylliin A Natural products O1C2COC(=O)C3=CC(O)=C(O)C(O)=C3C3=C(O)C(O)=C(O)C=C3C(=O)OC2C(OC(=O)C=2C=C(O)C(O)=C(O)C=2)C(O)C1OC(=O)C1=CC(O)=C(O)C(O)=C1 NLDMNSXOCDLTTB-UHFFFAOYSA-N 0.000 description 6
 - WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 6
 - 238000006243 chemical reaction Methods 0.000 description 6
 - QKFJKGMPGYROCL-UHFFFAOYSA-N phenyl isothiocyanate Chemical compound S=C=NC1=CC=CC=C1 QKFJKGMPGYROCL-UHFFFAOYSA-N 0.000 description 6
 - 238000010438 heat treatment Methods 0.000 description 5
 - HAMGRBXTJNITHG-UHFFFAOYSA-N methyl isocyanate Chemical compound CN=C=O HAMGRBXTJNITHG-UHFFFAOYSA-N 0.000 description 5
 - NWZSZGALRFJKBT-KNIFDHDWSA-N (2s)-2,6-diaminohexanoic acid;(2s)-2-hydroxybutanedioic acid Chemical compound OC(=O)[C@@H](O)CC(O)=O.NCCCC[C@H](N)C(O)=O NWZSZGALRFJKBT-KNIFDHDWSA-N 0.000 description 4
 - PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 4
 - 238000002425 crystallisation Methods 0.000 description 4
 - 230000008025 crystallization Effects 0.000 description 4
 - IKDUDTNKRLTJSI-UHFFFAOYSA-N hydrazine monohydrate Substances O.NN IKDUDTNKRLTJSI-UHFFFAOYSA-N 0.000 description 4
 - ILMRDZINEBHGMC-UHFFFAOYSA-N 1-[(7-chloro-5-phenyl-3H-1,4-benzodiazepin-2-yl)amino]-3-phenylthiourea Chemical compound ClC=1C=CC2=C(C(=NCC(=N2)NNC(=S)NC2=CC=CC=C2)C2=CC=CC=C2)C1 ILMRDZINEBHGMC-UHFFFAOYSA-N 0.000 description 3
 - FKLJPTJMIBLJAV-UHFFFAOYSA-N Compound IV Chemical compound O1N=C(C)C=C1CCCCCCCOC1=CC=C(C=2OCCN=2)C=C1 FKLJPTJMIBLJAV-UHFFFAOYSA-N 0.000 description 3
 - 125000003710 aryl alkyl group Chemical group 0.000 description 3
 - 125000003118 aryl group Chemical group 0.000 description 3
 - 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 3
 - 239000000460 chlorine Substances 0.000 description 3
 - 230000000694 effects Effects 0.000 description 3
 - 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 3
 - 125000004051 hexyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 3
 - 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 3
 - 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 3
 - 229940117953 phenylisothiocyanate Drugs 0.000 description 3
 - FAIAAWCVCHQXDN-UHFFFAOYSA-N phosphorus trichloride Chemical compound ClP(Cl)Cl FAIAAWCVCHQXDN-UHFFFAOYSA-N 0.000 description 3
 - 239000002244 precipitate Substances 0.000 description 3
 - 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 3
 - YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 3
 - CXWXQJXEFPUFDZ-UHFFFAOYSA-N tetralin Chemical compound C1=CC=C2CCCCC2=C1 CXWXQJXEFPUFDZ-UHFFFAOYSA-N 0.000 description 3
 - LSNRYGYYRQVPAA-UHFFFAOYSA-N 1-[(7-chloro-5-phenyl-3H-1,4-benzodiazepin-2-yl)amino]-3-methylurea Chemical compound ClC=1C=CC2=C(C(=NCC(=N2)NNC(=O)NC)C2=CC=CC=C2)C1 LSNRYGYYRQVPAA-UHFFFAOYSA-N 0.000 description 2
 - TZZMFMFEBJSMSP-UHFFFAOYSA-N 1-[[7-chloro-5-(4-methoxyphenyl)-3H-1,4-benzodiazepin-2-yl]amino]-3-methylurea Chemical compound ClC=1C=CC2=C(C(=NCC(=N2)NNC(=O)NC)C2=CC=C(C=C2)OC)C=1 TZZMFMFEBJSMSP-UHFFFAOYSA-N 0.000 description 2
 - VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 2
 - IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
 - ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 2
 - IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 2
 - BAVYZALUXZFZLV-UHFFFAOYSA-N Methylamine Chemical compound NC BAVYZALUXZFZLV-UHFFFAOYSA-N 0.000 description 2
 - 241000699670 Mus sp. Species 0.000 description 2
 - QGZKDVFQNNGYKY-UHFFFAOYSA-N ammonia Natural products N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 2
 - HOPRXXXSABQWAV-UHFFFAOYSA-N anhydrous collidine Natural products CC1=CC=NC(C)=C1C HOPRXXXSABQWAV-UHFFFAOYSA-N 0.000 description 2
 - 230000001773 anti-convulsant effect Effects 0.000 description 2
 - 239000001961 anticonvulsive agent Substances 0.000 description 2
 - 229960003965 antiepileptics Drugs 0.000 description 2
 - 229940049706 benzodiazepine Drugs 0.000 description 2
 - 229940053197 benzodiazepine derivative antiepileptics Drugs 0.000 description 2
 - 239000003795 chemical substances by application Substances 0.000 description 2
 - 229910052801 chlorine Inorganic materials 0.000 description 2
 - UTBIMNXEDGNJFE-UHFFFAOYSA-N collidine Natural products CC1=CC=C(C)C(C)=N1 UTBIMNXEDGNJFE-UHFFFAOYSA-N 0.000 description 2
 - 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 2
 - USIUVYZYUHIAEV-UHFFFAOYSA-N diphenyl ether Chemical compound C=1C=CC=CC=1OC1=CC=CC=C1 USIUVYZYUHIAEV-UHFFFAOYSA-N 0.000 description 2
 - 238000004821 distillation Methods 0.000 description 2
 - NLFBCYMMUAKCPC-KQQUZDAGSA-N ethyl (e)-3-[3-amino-2-cyano-1-[(e)-3-ethoxy-3-oxoprop-1-enyl]sulfanyl-3-oxoprop-1-enyl]sulfanylprop-2-enoate Chemical compound CCOC(=O)\C=C\SC(=C(C#N)C(N)=O)S\C=C\C(=O)OCC NLFBCYMMUAKCPC-KQQUZDAGSA-N 0.000 description 2
 - 238000005187 foaming Methods 0.000 description 2
 - 150000002430 hydrocarbons Chemical group 0.000 description 2
 - 238000011065 in-situ storage Methods 0.000 description 2
 - 231100001231 less toxic Toxicity 0.000 description 2
 - NBTOZLQBSIZIKS-UHFFFAOYSA-N methoxide Chemical compound [O-]C NBTOZLQBSIZIKS-UHFFFAOYSA-N 0.000 description 2
 - 239000003158 myorelaxant agent Substances 0.000 description 2
 - LVTJOONKWUXEFR-FZRMHRINSA-N protoneodioscin Natural products O(C[C@@H](CC[C@]1(O)[C@H](C)[C@@H]2[C@]3(C)[C@H]([C@H]4[C@@H]([C@]5(C)C(=CC4)C[C@@H](O[C@@H]4[C@H](O[C@H]6[C@@H](O)[C@@H](O)[C@@H](O)[C@H](C)O6)[C@@H](O)[C@H](O[C@H]6[C@@H](O)[C@@H](O)[C@@H](O)[C@H](C)O6)[C@H](CO)O4)CC5)CC3)C[C@@H]2O1)C)[C@H]1[C@H](O)[C@H](O)[C@H](O)[C@@H](CO)O1 LVTJOONKWUXEFR-FZRMHRINSA-N 0.000 description 2
 - 125000002914 sec-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 2
 - 239000000932 sedative agent Substances 0.000 description 2
 - 230000001624 sedative effect Effects 0.000 description 2
 - 239000000126 substance Substances 0.000 description 2
 - 125000001424 substituent group Chemical group 0.000 description 2
 - GFYHSKONPJXCDE-UHFFFAOYSA-N sym-collidine Natural products CC1=CN=C(C)C(C)=C1 GFYHSKONPJXCDE-UHFFFAOYSA-N 0.000 description 2
 - 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 2
 - 230000002936 tranquilizing effect Effects 0.000 description 2
 - ZGBRDDCNIPCLMZ-UHFFFAOYSA-N (7-nitro-5-phenyl-3h-1,4-benzodiazepin-2-yl)hydrazine Chemical compound N=1CC(NN)=NC2=CC=C([N+]([O-])=O)C=C2C=1C1=CC=CC=C1 ZGBRDDCNIPCLMZ-UHFFFAOYSA-N 0.000 description 1
 - GUJAGMICFDYKNR-UHFFFAOYSA-N 1,4-benzodiazepine Chemical compound N1C=CN=CC2=CC=CC=C12 GUJAGMICFDYKNR-UHFFFAOYSA-N 0.000 description 1
 - OUGXLBQUBTVOFM-UHFFFAOYSA-N 1-[(7-chloro-5-phenyl-3H-1,4-benzodiazepin-2-yl)amino]-3-phenylurea Chemical compound ClC=1C=CC2=C(C(=NCC(=N2)NNC(=O)NC2=CC=CC=C2)C2=CC=CC=C2)C1 OUGXLBQUBTVOFM-UHFFFAOYSA-N 0.000 description 1
 - SVUOLADPCWQTTE-UHFFFAOYSA-N 1h-1,2-benzodiazepine Chemical compound N1N=CC=CC2=CC=CC=C12 SVUOLADPCWQTTE-UHFFFAOYSA-N 0.000 description 1
 - BOMGSODHUPVXJU-UHFFFAOYSA-N 1h-1,4-benzodiazepin-2-ylhydrazine Chemical class N1C(NN)=CN=CC2=CC=CC=C21 BOMGSODHUPVXJU-UHFFFAOYSA-N 0.000 description 1
 - 125000000094 2-phenylethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])C([H])([H])* 0.000 description 1
 - 125000004172 4-methoxyphenyl group Chemical group [H]C1=C([H])C(OC([H])([H])[H])=C([H])C([H])=C1* 0.000 description 1
 - ULILTJWAJZIROM-UHFFFAOYSA-N 7-chloro-5-phenyl-1,3-dihydro-1,4-benzodiazepine-2-thione Chemical compound C12=CC(Cl)=CC=C2NC(=S)CN=C1C1=CC=CC=C1 ULILTJWAJZIROM-UHFFFAOYSA-N 0.000 description 1
 - OKSINCZQDWSATA-UHFFFAOYSA-N 7-nitro-5-phenyl-3h-1,4-benzodiazepin-2-amine Chemical compound N=1CC(N)=NC2=CC=C([N+]([O-])=O)C=C2C=1C1=CC=CC=C1 OKSINCZQDWSATA-UHFFFAOYSA-N 0.000 description 1
 - ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 1
 - WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 1
 - DRSHXJFUUPIBHX-UHFFFAOYSA-N COc1ccc(cc1)N1N=CC2C=NC(Nc3cc(OC)c(OC)c(OCCCN4CCN(C)CC4)c3)=NC12 Chemical compound COc1ccc(cc1)N1N=CC2C=NC(Nc3cc(OC)c(OC)c(OCCCN4CCN(C)CC4)c3)=NC12 DRSHXJFUUPIBHX-UHFFFAOYSA-N 0.000 description 1
 - KRKNYBCHXYNGOX-UHFFFAOYSA-K Citrate Chemical compound [O-]C(=O)CC(O)(CC([O-])=O)C([O-])=O KRKNYBCHXYNGOX-UHFFFAOYSA-K 0.000 description 1
 - FEWJPZIEWOKRBE-JCYAYHJZSA-N Dextrotartaric acid Chemical compound OC(=O)[C@H](O)[C@@H](O)C(O)=O FEWJPZIEWOKRBE-JCYAYHJZSA-N 0.000 description 1
 - PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 description 1
 - VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 1
 - 206010021118 Hypotonia Diseases 0.000 description 1
 - OFOBLEOULBTSOW-UHFFFAOYSA-L Malonate Chemical compound [O-]C(=O)CC([O-])=O OFOBLEOULBTSOW-UHFFFAOYSA-L 0.000 description 1
 - 241000699666 Mus <mouse, genus> Species 0.000 description 1
 - CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 1
 - MUBZPKHOEPUJKR-UHFFFAOYSA-N Oxalic acid Chemical compound OC(=O)C(O)=O MUBZPKHOEPUJKR-UHFFFAOYSA-N 0.000 description 1
 - 229910019142 PO4 Inorganic materials 0.000 description 1
 - OAICVXFJPJFONN-UHFFFAOYSA-N Phosphorus Chemical compound [P] OAICVXFJPJFONN-UHFFFAOYSA-N 0.000 description 1
 - QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 1
 - GQZZWGZHSUQJNS-UHFFFAOYSA-N [7-chloro-5-(4-methoxyphenyl)-3h-1,4-benzodiazepin-2-yl]hydrazine Chemical compound C1=CC(OC)=CC=C1C1=NCC(NN)=NC2=CC=C(Cl)C=C12 GQZZWGZHSUQJNS-UHFFFAOYSA-N 0.000 description 1
 - 239000002253 acid Substances 0.000 description 1
 - 230000007059 acute toxicity Effects 0.000 description 1
 - 231100000403 acute toxicity Toxicity 0.000 description 1
 - 150000001298 alcohols Chemical class 0.000 description 1
 - XLJMAIOERFSOGZ-UHFFFAOYSA-N anhydrous cyanic acid Natural products OC#N XLJMAIOERFSOGZ-UHFFFAOYSA-N 0.000 description 1
 - 150000004982 aromatic amines Chemical class 0.000 description 1
 - 150000004945 aromatic hydrocarbons Chemical class 0.000 description 1
 - 150000001557 benzodiazepines Chemical class 0.000 description 1
 - 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 1
 - 238000004166 bioassay Methods 0.000 description 1
 - 230000004071 biological effect Effects 0.000 description 1
 - GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 1
 - 229910052794 bromium Inorganic materials 0.000 description 1
 - 125000004106 butoxy group Chemical group [*]OC([H])([H])C([H])([H])C(C([H])([H])[H])([H])[H] 0.000 description 1
 - 238000009903 catalytic hydrogenation reaction Methods 0.000 description 1
 - 210000003169 central nervous system Anatomy 0.000 description 1
 - 239000011248 coating agent Substances 0.000 description 1
 - 238000000576 coating method Methods 0.000 description 1
 - 239000012141 concentrate Substances 0.000 description 1
 - 230000003635 deoxygenating effect Effects 0.000 description 1
 - 201000010099 disease Diseases 0.000 description 1
 - 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 description 1
 - 229940079593 drug Drugs 0.000 description 1
 - 239000003814 drug Substances 0.000 description 1
 - 239000003937 drug carrier Substances 0.000 description 1
 - HHFAWKCIHAUFRX-UHFFFAOYSA-N ethoxide Chemical compound CC[O-] HHFAWKCIHAUFRX-UHFFFAOYSA-N 0.000 description 1
 - 239000000706 filtrate Substances 0.000 description 1
 - 239000011737 fluorine Substances 0.000 description 1
 - 229910052731 fluorine Inorganic materials 0.000 description 1
 - 239000006260 foam Substances 0.000 description 1
 - 229910052736 halogen Inorganic materials 0.000 description 1
 - 150000002367 halogens Chemical class 0.000 description 1
 - ZMZDMBWJUHKJPS-UHFFFAOYSA-N hydrogen thiocyanate Natural products SC#N ZMZDMBWJUHKJPS-UHFFFAOYSA-N 0.000 description 1
 - 239000005457 ice water Substances 0.000 description 1
 - 230000001939 inductive effect Effects 0.000 description 1
 - 238000002347 injection Methods 0.000 description 1
 - 239000007924 injection Substances 0.000 description 1
 - 239000002198 insoluble material Substances 0.000 description 1
 - 239000011630 iodine Substances 0.000 description 1
 - 229910052740 iodine Inorganic materials 0.000 description 1
 - 238000002955 isolation Methods 0.000 description 1
 - 239000000155 melt Substances 0.000 description 1
 - 150000004682 monohydrates Chemical class 0.000 description 1
 - 125000000740 n-pentyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
 - 125000001624 naphthyl group Chemical group 0.000 description 1
 - 230000000926 neurological effect Effects 0.000 description 1
 - 125000002347 octyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
 - 125000001147 pentyl group Chemical group C(CCCC)* 0.000 description 1
 - 230000000144 pharmacologic effect Effects 0.000 description 1
 - 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 1
 - DGTNSSLYPYDJGL-UHFFFAOYSA-N phenyl isocyanate Chemical compound O=C=NC1=CC=CC=C1 DGTNSSLYPYDJGL-UHFFFAOYSA-N 0.000 description 1
 - NBIIXXVUZAFLBC-UHFFFAOYSA-K phosphate Chemical compound [O-]P([O-])([O-])=O NBIIXXVUZAFLBC-UHFFFAOYSA-K 0.000 description 1
 - 239000010452 phosphate Substances 0.000 description 1
 - 229910052698 phosphorus Inorganic materials 0.000 description 1
 - 239000011574 phosphorus Substances 0.000 description 1
 - 239000006187 pill Substances 0.000 description 1
 - 239000000843 powder Substances 0.000 description 1
 - 229910052938 sodium sulfate Inorganic materials 0.000 description 1
 - 235000011152 sodium sulphate Nutrition 0.000 description 1
 - 239000007787 solid Substances 0.000 description 1
 - 238000010186 staining Methods 0.000 description 1
 - KDYFGRWQOYBRFD-UHFFFAOYSA-L succinate(2-) Chemical compound [O-]C(=O)CCC([O-])=O KDYFGRWQOYBRFD-UHFFFAOYSA-L 0.000 description 1
 - 239000000725 suspension Substances 0.000 description 1
 - 239000003826 tablet Substances 0.000 description 1
 - 229940095064 tartrate Drugs 0.000 description 1
 - LMBFAGIMSUYTBN-MPZNNTNKSA-N teixobactin Chemical compound C([C@H](C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H](CCC(N)=O)C(=O)N[C@H]([C@@H](C)CC)C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H]1C(N[C@@H](C)C(=O)N[C@@H](C[C@@H]2NC(=N)NC2)C(=O)N[C@H](C(=O)O[C@H]1C)[C@@H](C)CC)=O)NC)C1=CC=CC=C1 LMBFAGIMSUYTBN-MPZNNTNKSA-N 0.000 description 1
 - 230000007306 turnover Effects 0.000 description 1
 - 239000008096 xylene Substances 0.000 description 1
 
Classifications
- 
        
- C—CHEMISTRY; METALLURGY
 - C07—ORGANIC CHEMISTRY
 - C07D—HETEROCYCLIC COMPOUNDS
 - C07D487/00—Heterocyclic compounds containing nitrogen atoms as the only ring hetero atoms in the condensed system, not provided for by groups C07D451/00 - C07D477/00
 - C07D487/02—Heterocyclic compounds containing nitrogen atoms as the only ring hetero atoms in the condensed system, not provided for by groups C07D451/00 - C07D477/00 in which the condensed system contains two hetero rings
 - C07D487/04—Ortho-condensed systems
 
 - 
        
- C—CHEMISTRY; METALLURGY
 - C07—ORGANIC CHEMISTRY
 - C07D—HETEROCYCLIC COMPOUNDS
 - C07D243/00—Heterocyclic compounds containing seven-membered rings having two nitrogen atoms as the only ring hetero atoms
 - C07D243/06—Heterocyclic compounds containing seven-membered rings having two nitrogen atoms as the only ring hetero atoms having the nitrogen atoms in positions 1 and 4
 - C07D243/10—Heterocyclic compounds containing seven-membered rings having two nitrogen atoms as the only ring hetero atoms having the nitrogen atoms in positions 1 and 4 condensed with carbocyclic rings or ring systems
 - C07D243/14—1,4-Benzodiazepines; Hydrogenated 1,4-benzodiazepines
 - C07D243/16—1,4-Benzodiazepines; Hydrogenated 1,4-benzodiazepines substituted in position 5 by aryl radicals
 - C07D243/18—1,4-Benzodiazepines; Hydrogenated 1,4-benzodiazepines substituted in position 5 by aryl radicals substituted in position 2 by nitrogen, oxygen or sulfur atoms
 - C07D243/20—Nitrogen atoms
 
 
Landscapes
- Chemical & Material Sciences (AREA)
 - Organic Chemistry (AREA)
 - Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
 - Nitrogen Condensed Heterocyclic Rings (AREA)
 - Nitrogen And Oxygen Or Sulfur-Condensed Heterocyclic Ring Systems (AREA)
 - Plural Heterocyclic Compounds (AREA)
 
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title | 
|---|---|---|---|
| JP44092366A JPS4910958B1 (instruction) | 1969-11-18 | 1969-11-18 | |
| JP9236669 | 1969-11-18 | 
Publications (2)
| Publication Number | Publication Date | 
|---|---|
| DK141846B true DK141846B (da) | 1980-06-30 | 
| DK141846C DK141846C (instruction) | 1980-11-24 | 
Family
ID=14052400
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date | 
|---|---|---|---|
| DK582970AA DK141846B (da) | 1969-11-18 | 1970-11-17 | Analogifremgangsmåde til fremstilling af 1-oxo- eller 1-thioxo-s-triazolo(4,3-a)(1,4)benzodiazepinderivater. | 
Country Status (15)
| Country | Link | 
|---|---|
| JP (2) | JPS5010659B1 (instruction) | 
| AT (2) | AT311993B (instruction) | 
| BE (1) | BE759099A (instruction) | 
| CH (2) | CH549588A (instruction) | 
| DE (2) | DE2064926A1 (instruction) | 
| DK (1) | DK141846B (instruction) | 
| ES (1) | ES385641A1 (instruction) | 
| FI (1) | FI51701C (instruction) | 
| FR (1) | FR2073379B1 (instruction) | 
| GB (2) | GB1337737A (instruction) | 
| NL (1) | NL167697C (instruction) | 
| NO (1) | NO126085B (instruction) | 
| SE (1) | SE363111B (instruction) | 
| YU (1) | YU34898B (instruction) | 
| ZA (1) | ZA707644B (instruction) | 
Families Citing this family (11)
| Publication number | Priority date | Publication date | Assignee | Title | 
|---|---|---|---|---|
| ZA713364B (en) * | 1970-06-18 | 1972-01-26 | Upjohn Co | Prganic compounds and process | 
| JPS494470B1 (instruction) * | 1970-08-26 | 1974-02-01 | ||
| CH545302A (de) * | 1971-04-08 | 1974-01-13 | Ciba Geigy Ag | Verfahren zur Herstellung von neuen Triazolo-benzodiazepinderivaten | 
| US3751426A (en) * | 1971-04-28 | 1973-08-07 | Upjohn Co | 1-substituted-6-phenyl-4h-s-triazolo(4,3-a)(1,6)benzodiazepine compounds | 
| GB1377230A (en) * | 1971-09-13 | 1974-12-11 | Upjohn Co | 4h-s-triazolo -4,3-a- 1,4-benzodiazepines | 
| BE790356A (fr) * | 1971-10-21 | 1973-04-20 | Takeda Chemical Industries Ltd | Derives de benzodiazepine | 
| JPS5418280B2 (instruction) * | 1971-10-30 | 1979-07-06 | ||
| BE793629A (fr) * | 1972-01-03 | 1973-07-03 | Upjohn Co | Nouveaux derives de benzodiazepines et leur preparation | 
| DE3021107A1 (de) * | 1980-06-04 | 1981-12-17 | Hoechst Ag, 6000 Frankfurt | Carbamoyloxyamino-1,4-benzodiazepine, verfahren zu irer herstellung und diese enthaltende arzneimittel | 
| CA1211437A (en) * | 1981-08-12 | 1986-09-16 | Rene Borer | Benzazepines | 
| CN111533745A (zh) * | 2020-05-20 | 2020-08-14 | 成都药明康德新药开发有限公司 | 叔丁基-3-(氨基甲基)二氢-5h-三唑并二氮杂卓-8(9h)-甲酸基酯制法 | 
Family Cites Families (2)
| Publication number | Priority date | Publication date | Assignee | Title | 
|---|---|---|---|---|
| FI50981C (fi) * | 1968-11-05 | 1976-09-10 | Takeda Chemical Industries Ltd | Menetelmä unilääkkeinä ja rauhoittavina lääkkeinä vaikuttavien s-triat solo-(4,3-a)(1,4)-bentsodiatsepiinien valmistamiseksi. | 
| US3987052A (en) * | 1969-03-17 | 1976-10-19 | The Upjohn Company | 6-Phenyl-4H-s-triazolo[4,3-a][1,4]benzodiazepines | 
- 
        0
        
- BE BE759099D patent/BE759099A/xx not_active IP Right Cessation
 
 - 
        1969
        
- 1969-11-17 JP JP44092336A patent/JPS5010659B1/ja active Pending
 - 1969-11-18 JP JP44092366A patent/JPS4910958B1/ja active Pending
 
 - 
        1970
        
- 1970-11-11 ZA ZA707644A patent/ZA707644B/xx unknown
 - 1970-11-13 NO NO4341/70A patent/NO126085B/no unknown
 - 1970-11-14 DE DE19702064926 patent/DE2064926A1/de active Pending
 - 1970-11-14 DE DE19702056174 patent/DE2056174A1/de active Pending
 - 1970-11-17 FR FR7041215A patent/FR2073379B1/fr not_active Expired
 - 1970-11-17 ES ES385641A patent/ES385641A1/es not_active Expired
 - 1970-11-17 NL NL7016848A patent/NL167697C/xx not_active IP Right Cessation
 - 1970-11-17 DK DK582970AA patent/DK141846B/da unknown
 - 1970-11-18 SE SE15638/70A patent/SE363111B/xx unknown
 - 1970-11-18 YU YU2827/70A patent/YU34898B/xx unknown
 - 1970-11-18 AT AT995571A patent/AT311993B/de not_active IP Right Cessation
 - 1970-11-18 CH CH1060273A patent/CH549588A/xx not_active IP Right Cessation
 - 1970-11-18 AT AT1038070A patent/AT300816B/de not_active IP Right Cessation
 - 1970-11-18 FI FI703096A patent/FI51701C/fi active
 - 1970-11-18 GB GB2860172A patent/GB1337737A/en not_active Expired
 - 1970-11-18 GB GB5479770A patent/GB1337736A/en not_active Expired
 - 1970-11-18 CH CH1708170A patent/CH551432A/xx not_active IP Right Cessation
 
 
Also Published As
| Publication number | Publication date | 
|---|---|
| SE363111B (instruction) | 1974-01-07 | 
| ES385641A1 (es) | 1973-10-01 | 
| BE759099A (fr) | 1971-04-30 | 
| ZA707644B (en) | 1971-08-25 | 
| JPS4910958B1 (instruction) | 1974-03-13 | 
| NL167697C (nl) | 1982-01-18 | 
| GB1337736A (en) | 1973-11-21 | 
| NL7016848A (instruction) | 1971-05-21 | 
| JPS5010659B1 (instruction) | 1975-04-23 | 
| GB1337737A (en) | 1973-11-21 | 
| NO126085B (instruction) | 1972-12-18 | 
| CH551432A (de) | 1974-07-15 | 
| CH549588A (de) | 1974-05-31 | 
| YU34898B (en) | 1980-04-30 | 
| DE2064926A1 (de) | 1971-07-22 | 
| AT300816B (de) | 1972-08-10 | 
| FR2073379B1 (instruction) | 1974-08-23 | 
| AT311993B (de) | 1973-12-10 | 
| FR2073379A1 (instruction) | 1971-10-01 | 
| YU282770A (en) | 1979-10-31 | 
| FI51701C (fi) | 1977-03-10 | 
| DK141846C (instruction) | 1980-11-24 | 
| NL167697B (nl) | 1981-08-17 | 
| FI51701B (instruction) | 1976-11-30 | 
| DE2056174A1 (de) | 1971-06-24 | 
Similar Documents
| Publication | Publication Date | Title | 
|---|---|---|
| JPS61165386A (ja) | トリアゾロキナゾリン化合物、その製法、およびそれを含む医薬組成物 | |
| WO2005105805A1 (fr) | Carbamoylase-heterocycles anneles, bibliotheque focalisee, compositions pharmaceutiques et procedes de fabrication correspondants | |
| DK141846B (da) | Analogifremgangsmåde til fremstilling af 1-oxo- eller 1-thioxo-s-triazolo(4,3-a)(1,4)benzodiazepinderivater. | |
| IE914369A1 (en) | Benzodiazepinones | |
| US3580915A (en) | 1,2,3,4-tetrahydrobenzol(b)(1,6)naphthyridine derivatives | |
| DE2321705A1 (de) | Benzodiazepinderivate, ihre herstellung und verwendung | |
| US3674790A (en) | 2,10-disubstituted-1,2,3,4-tetrahydrobenzo(bhq (1,6)naphthyridines useful as cns depressants | |
| DK145577B (da) | Analogifremgangsmaade til fremstilling af s-triazolo(4,3-a)-(1,4)-benzodiazepiner eller 5n-oxyder eller syreadditionssalte deraf | |
| US3647800A (en) | 10-substituted - 1 2 3 4 - tetrahydrobenzo(b)(1 6)naphthyridines useful as cns depressants | |
| EP0602097B1 (de) | Tricyclische thiazol- und oxazol-derivate mit antiviraler wirkung | |
| NO126799B (instruction) | ||
| NO146470B (no) | Analogifremgangsmaate til fremstilling av terapeutisk aktive nye 6-fenyl-s-triazolo-(4,3-a)-pyrido-(2,3-f)-(1,4)-diazepiner | |
| US3046276A (en) | S-triazolo-[2, 3-c] pyrimidine derivatives | |
| US3846443A (en) | 1H-IMIDAZO{8 1,2a{9 {8 1,4{9 BENZO-DIAZEPINE-1,2(3H)-DIONES | |
| RU2057754C1 (ru) | Гетероциклические соединения или их кислотно-аддитивные соли | |
| EP0054839B1 (de) | 2-Acylaminomethyl-1,4-benzodiazepine und deren Salze sowie Verfahren zu ihrer Herstellung und diese Verbindungen enthaltende Arzneimittel | |
| US3523947A (en) | 1-cyclic amidine-5-aryl-1,4-benzodiazepine and process | |
| DE2838846A1 (de) | Imidazo- und pyrimido eckige klammer auf 2,1-b eckige klammer zu chinazoline, verfahren zu ihrer herstellung und diese verbindungen enthaltende arzneimittel | |
| US3865811A (en) | 1,4-Benzodiazepine derivatives | |
| KR20210146296A (ko) | 티민 핵산 염기를 베이스로 하는 트리아졸로피리미딘류 및 그 제조 방법 | |
| US3513158A (en) | Process for preparing 5-aryl benzodiazepines and intermediates | |
| US3864356A (en) | Method for preparing S-Triazolo (4,3-A) (1,4) Benzodiazepine Derivatives | |
| US3328406A (en) | Amide and piperazides of carbazole-9-glyoxylic acid | |
| US3850951A (en) | Triazolobenzodiazepine 5n-oxide derivatives | |
| Solankee et al. | Synthesis of some novel chalcones, pyrazolines, aminopyrimidines and their antimicrobial study |