DK133898B - Analogifremgangsmåde til fremstilling af 10-hydroxy-10,11-dihydro-5H-dibenz /b,f/azepin-5-carboxamid. - Google Patents
Analogifremgangsmåde til fremstilling af 10-hydroxy-10,11-dihydro-5H-dibenz /b,f/azepin-5-carboxamid.Info
- Publication number
- DK133898B DK133898B DK104670AA DK104670A DK133898B DK 133898 B DK133898 B DK 133898B DK 104670A A DK104670A A DK 104670AA DK 104670 A DK104670 A DK 104670A DK 133898 B DK133898 B DK 133898B
- Authority
- DK
- Denmark
- Prior art keywords
- azepine
- dibenzo
- carboxamide
- dihydro
- hydroxy
- Prior art date
Links
- BMPDWHIDQYTSHX-UHFFFAOYSA-N licarbazepine Chemical compound C1C(O)C2=CC=CC=C2N(C(=O)N)C2=CC=CC=C21 BMPDWHIDQYTSHX-UHFFFAOYSA-N 0.000 title 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D223/00—Heterocyclic compounds containing seven-membered rings having one nitrogen atom as the only ring hetero atom
- C07D223/14—Heterocyclic compounds containing seven-membered rings having one nitrogen atom as the only ring hetero atom condensed with carbocyclic rings or ring systems
- C07D223/18—Dibenzazepines; Hydrogenated dibenzazepines
- C07D223/22—Dibenz [b, f] azepines; Hydrogenated dibenz [b, f] azepines
- C07D223/24—Dibenz [b, f] azepines; Hydrogenated dibenz [b, f] azepines with hydrocarbon radicals, substituted by nitrogen atoms, attached to the ring nitrogen atom
- C07D223/28—Dibenz [b, f] azepines; Hydrogenated dibenz [b, f] azepines with hydrocarbon radicals, substituted by nitrogen atoms, attached to the ring nitrogen atom having a single bond between positions 10 and 11
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Other In-Based Heterocyclic Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| CH484469A CH505101A (de) | 1969-03-31 | 1969-03-31 | Verfahren zur Herstellung von neuen Azepinderivaten |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DK133898B true DK133898B (da) | 1976-08-09 |
| DK133898C DK133898C (enExample) | 1977-03-07 |
Family
ID=4283538
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DK104670AA DK133898B (da) | 1969-03-31 | 1970-03-03 | Analogifremgangsmåde til fremstilling af 10-hydroxy-10,11-dihydro-5H-dibenz /b,f/azepin-5-carboxamid. |
Country Status (20)
| Country | Link |
|---|---|
| AT (1) | AT294106B (enExample) |
| BE (1) | BE747086A (enExample) |
| BG (1) | BG17600A3 (enExample) |
| BR (1) | BR7017333D0 (enExample) |
| CA (1) | CA920587A (enExample) |
| CH (1) | CH505101A (enExample) |
| CS (1) | CS154295B2 (enExample) |
| DE (1) | DE2011045C3 (enExample) |
| DK (1) | DK133898B (enExample) |
| ES (1) | ES377280A1 (enExample) |
| FI (1) | FI50524C (enExample) |
| FR (1) | FR2035999B1 (enExample) |
| GB (1) | GB1310120A (enExample) |
| IE (1) | IE34050B1 (enExample) |
| IL (1) | IL34027A (enExample) |
| NL (1) | NL159972C (enExample) |
| NO (1) | NO131546C (enExample) |
| PL (1) | PL80544B1 (enExample) |
| SE (1) | SE354069B (enExample) |
| YU (1) | YU33863B (enExample) |
Families Citing this family (10)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| BE789320A (fr) * | 1971-09-30 | 1973-03-27 | Takeda Chemical Industries Ltd | Derives de dibenzoxirenazepine |
| EP0108715A1 (de) * | 1982-10-15 | 1984-05-16 | Ciba-Geigy Ag | Dibenzazepincarboxamide |
| PT101732B (pt) * | 1995-06-30 | 1997-12-31 | Portela & Ca Sa | Novas di-hidrodibenzo<b,f>azepinas substituidas processo para a sua preparacao composicoes farmaceuticas que as contem e utilizacao dos novos compostos na preparacao de composicoes farmaceuticas empregues em doencas do sistema nervoso |
| US20020022056A1 (en) | 1997-02-14 | 2002-02-21 | Burkhard Schlutermann | Oxacarbazepine film-coated tablets |
| AT408224B (de) * | 1999-03-15 | 2001-09-25 | Dsm Fine Chem Austria Gmbh | Verfahren zur herstellung von oxcarbazepin |
| CN100506797C (zh) * | 2001-11-12 | 2009-07-01 | 诺瓦提斯公司 | 用于制备治疗情感和注意障碍以及神经性疼痛的药物的单羟基卡马西平 |
| GB0303615D0 (en) * | 2003-02-17 | 2003-03-19 | Novartis Ag | Use of organic compounds |
| ITMI20042230A1 (it) | 2004-11-19 | 2005-02-19 | Farchemia Srl | Procedimento per la preparazione della 10,11-diidro-10 idrossi-5h-dibenz-b,f-azepin-5carbossiammide |
| US20060252745A1 (en) | 2005-05-06 | 2006-11-09 | Almeida Jose L D | Methods of preparing pharmaceutical compositions comprising eslicarbazepine acetate and methods of use |
| GB0700773D0 (en) | 2007-01-15 | 2007-02-21 | Portela & Ca Sa | Drug therapies |
-
1969
- 1969-03-31 CH CH484469A patent/CH505101A/de not_active IP Right Cessation
-
1970
- 1970-03-03 BR BR217333/70A patent/BR7017333D0/pt unknown
- 1970-03-03 DK DK104670AA patent/DK133898B/da not_active IP Right Cessation
- 1970-03-03 NL NL7003026.A patent/NL159972C/xx not_active IP Right Cessation
- 1970-03-03 FI FI700560A patent/FI50524C/fi active
- 1970-03-03 SE SE02771/70A patent/SE354069B/xx unknown
- 1970-03-05 YU YU537/70A patent/YU33863B/xx unknown
- 1970-03-09 CS CS155770A patent/CS154295B2/cs unknown
- 1970-03-09 IE IE303/70A patent/IE34050B1/xx unknown
- 1970-03-09 ES ES377280A patent/ES377280A1/es not_active Expired
- 1970-03-09 DE DE2011045A patent/DE2011045C3/de not_active Expired
- 1970-03-09 PL PL1970139289A patent/PL80544B1/pl unknown
- 1970-03-09 IL IL34027A patent/IL34027A/xx unknown
- 1970-03-09 NO NO70757A patent/NO131546C/no unknown
- 1970-03-09 AT AT218670A patent/AT294106B/de not_active IP Right Cessation
- 1970-03-09 CA CA076788A patent/CA920587A/en not_active Expired
- 1970-03-09 FR FR707008345A patent/FR2035999B1/fr not_active Expired
- 1970-03-09 BE BE747086D patent/BE747086A/xx not_active IP Right Cessation
- 1970-03-09 GB GB1111170A patent/GB1310120A/en not_active Expired
- 1970-03-09 BG BG014134A patent/BG17600A3/xx unknown
Also Published As
| Publication number | Publication date |
|---|---|
| CS154295B2 (enExample) | 1974-03-29 |
| FR2035999B1 (enExample) | 1973-04-06 |
| IL34027A (en) | 1972-12-29 |
| NO131546B (enExample) | 1975-03-10 |
| NL159972C (nl) | 1979-09-17 |
| YU33863B (en) | 1978-06-30 |
| DK133898C (enExample) | 1977-03-07 |
| DE2011045A1 (de) | 1970-10-08 |
| YU53770A (en) | 1977-12-31 |
| GB1310120A (en) | 1973-03-14 |
| PL80544B1 (enExample) | 1975-08-30 |
| IE34050L (en) | 1970-09-30 |
| FR2035999A1 (enExample) | 1970-12-24 |
| NO131546C (enExample) | 1975-06-25 |
| SE354069B (enExample) | 1973-02-26 |
| DE2011045C3 (de) | 1979-05-31 |
| ES377280A1 (es) | 1972-06-16 |
| CA920587A (en) | 1973-02-06 |
| CH505101A (de) | 1971-03-31 |
| BG17600A3 (bg) | 1973-11-10 |
| IE34050B1 (en) | 1975-01-22 |
| FI50524B (enExample) | 1975-12-31 |
| BR7017333D0 (pt) | 1973-05-31 |
| IL34027A0 (en) | 1970-05-21 |
| NL7003026A (enExample) | 1970-10-02 |
| BE747086A (fr) | 1970-09-09 |
| FI50524C (fi) | 1976-04-12 |
| DE2011045B2 (de) | 1978-10-05 |
| AT294106B (de) | 1971-11-10 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DK125649B (da) | Analogifremgangsmåde til fremstilling af 10-oxo-10, 11-dihydro-5H-dibenz[b,f]azepin-5-carboxamid. | |
| ATA401174A (de) | Verfahren zur herstellung von neuen wasserunloeslichen proteinpraeparaten, insbesondere von neuen wasserunloeslichen penicillinacylasepraeparaten | |
| DK138798B (da) | Fremgangsmåde til fremstilling af optisk aktive 1,4-benzodiazepin-2-on-derivater. | |
| DK133898B (da) | Analogifremgangsmåde til fremstilling af 10-hydroxy-10,11-dihydro-5H-dibenz /b,f/azepin-5-carboxamid. | |
| DK131904B (da) | Analogifremgangsmåde til fremstilling af 1,2,4,5-tetrahydro-2,4-dioxo-3H-1,5-benzodiazepinderivater. | |
| DK112527B (da) | Fremgangsmåde til fremstilling af 1,3,4,5-tetrahydro-1,4-benzodiazepinderivater. | |
| DK137754B (da) | Fremgangsmåde til fremstilling af 1,4-benzodiazepinderivater. | |
| DK136362B (da) | Fremgangsmåde til fremstilling af 5-alkyl-10-amino-10,11-dihydrodibenz(b,f)azepiner. | |
| DK127784B (da) | Fremgangsmåde til fremstilling af 1-aryl-2,3,4,5-tetrahydro-1H-1,5-benzodiazepin-2-oner. | |
| DK136776B (da) | Analogifremgangsmåde til fremstilling af 17aalfa-alkanoyloxy-D-homopregn-4-en-3,20-dioner. | |
| DK134700B (da) | Analogifremgangsmåde til fremstilling af 21-alkylerede 16alfa,17alfa-alkylidendioxy-pregn-4-en-3,20-dioner. | |
| FI49831C (fi) | Menetelmä 7-kloori-1,3-dihydro-1-metyyli-5-fenyyli-2H-1,4-dibentsodiat sepiini-2-onin valmistamiseksi. | |
| DK121760B (da) | Fremgangsmåde til fremstilling af 5H-dibenzo[b,f]azepinderivater. | |
| DK127115B (da) | Fremgangsmåde til fremstilling af 1,4-benzodiazepinderivater. | |
| DK122764B (da) | Analogifremgangsmåde til fremstilling af 10, 11-dihydro-5H-dibenz [b,f] azepinderivater eller syreadditionssalte deraf. | |
| DK137855B (da) | Analogifremgangsmåde til fremstilling af optisk aktive 1,3,4,5-tetrahydro-2H-1,4-benzodiazepin-2-on-derivater. | |
| DK115626B (da) | Fremgangsmåde til fremstilling af 5H-dibenz[b,f] azepinderivater eller syreadditionssalte deraf. | |
| DK118953B (da) | Fremgangsmåde til fremstilling af 1,3,4,5-tetrahydro-2H-1,4-benzodiazepin-2-on-derivater. | |
| DK134433B (da) | Fremgangsmåde til fremstilling af 7-chlor-1-methyl-5-phenyl-2,3-dihyro-1H-1,4-benzodiazepin-2-on. | |
| DK129583B (da) | Fremgangsmåde til fremstilling af 1-hydroxyalkyl-1,4-benzodiazepinderivater. | |
| DK129582B (da) | Fremgangsmåde til fremstilling af 1-hydroxyalkyl-1,4-benzodiazepinderivater. | |
| DK121235B (da) | Fremgangsmåde til fremstilling af 1,4-benzodiazepinderivater. | |
| DK140282B (da) | Analogifremgangsmåde til fremstilling af 1,4-benzodiazepinderivater. | |
| DK112946B (da) | Fremgangsmåde til fremstilling af 5H-dibenz [b,f]azepinderivater eller syreadditionssalte deraf. | |
| DK135719B (da) | Analogifremgangsmåde til fremstilling af 1,4-benzodiazepinderivater. |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| PBP | Patent lapsed |