DK133898B - Analogifremgangsmåde til fremstilling af 10-hydroxy-10,11-dihydro-5H-dibenz /b,f/azepin-5-carboxamid. - Google Patents
Analogifremgangsmåde til fremstilling af 10-hydroxy-10,11-dihydro-5H-dibenz /b,f/azepin-5-carboxamid.Info
- Publication number
- DK133898B DK133898B DK104670AA DK104670A DK133898B DK 133898 B DK133898 B DK 133898B DK 104670A A DK104670A A DK 104670AA DK 104670 A DK104670 A DK 104670A DK 133898 B DK133898 B DK 133898B
- Authority
- DK
- Denmark
- Prior art keywords
- azepine
- dibenzo
- carboxamide
- dihydro
- hydroxy
- Prior art date
Links
- BMPDWHIDQYTSHX-UHFFFAOYSA-N licarbazepine Chemical compound C1C(O)C2=CC=CC=C2N(C(=O)N)C2=CC=CC=C21 BMPDWHIDQYTSHX-UHFFFAOYSA-N 0.000 title 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D223/00—Heterocyclic compounds containing seven-membered rings having one nitrogen atom as the only ring hetero atom
- C07D223/14—Heterocyclic compounds containing seven-membered rings having one nitrogen atom as the only ring hetero atom condensed with carbocyclic rings or ring systems
- C07D223/18—Dibenzazepines; Hydrogenated dibenzazepines
- C07D223/22—Dibenz [b, f] azepines; Hydrogenated dibenz [b, f] azepines
- C07D223/24—Dibenz [b, f] azepines; Hydrogenated dibenz [b, f] azepines with hydrocarbon radicals, substituted by nitrogen atoms, attached to the ring nitrogen atom
- C07D223/28—Dibenz [b, f] azepines; Hydrogenated dibenz [b, f] azepines with hydrocarbon radicals, substituted by nitrogen atoms, attached to the ring nitrogen atom having a single bond between positions 10 and 11
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Other In-Based Heterocyclic Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| CH484469A CH505101A (de) | 1969-03-31 | 1969-03-31 | Verfahren zur Herstellung von neuen Azepinderivaten |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DK133898B true DK133898B (da) | 1976-08-09 |
| DK133898C DK133898C (enExample) | 1977-03-07 |
Family
ID=4283538
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DK104670AA DK133898B (da) | 1969-03-31 | 1970-03-03 | Analogifremgangsmåde til fremstilling af 10-hydroxy-10,11-dihydro-5H-dibenz /b,f/azepin-5-carboxamid. |
Country Status (20)
| Country | Link |
|---|---|
| AT (1) | AT294106B (enExample) |
| BE (1) | BE747086A (enExample) |
| BG (1) | BG17600A3 (enExample) |
| BR (1) | BR7017333D0 (enExample) |
| CA (1) | CA920587A (enExample) |
| CH (1) | CH505101A (enExample) |
| CS (1) | CS154295B2 (enExample) |
| DE (1) | DE2011045C3 (enExample) |
| DK (1) | DK133898B (enExample) |
| ES (1) | ES377280A1 (enExample) |
| FI (1) | FI50524C (enExample) |
| FR (1) | FR2035999B1 (enExample) |
| GB (1) | GB1310120A (enExample) |
| IE (1) | IE34050B1 (enExample) |
| IL (1) | IL34027A (enExample) |
| NL (1) | NL159972C (enExample) |
| NO (1) | NO131546C (enExample) |
| PL (1) | PL80544B1 (enExample) |
| SE (1) | SE354069B (enExample) |
| YU (1) | YU33863B (enExample) |
Families Citing this family (10)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| BE789320A (fr) * | 1971-09-30 | 1973-03-27 | Takeda Chemical Industries Ltd | Derives de dibenzoxirenazepine |
| EP0108715A1 (de) * | 1982-10-15 | 1984-05-16 | Ciba-Geigy Ag | Dibenzazepincarboxamide |
| PT101732B (pt) * | 1995-06-30 | 1997-12-31 | Portela & Ca Sa | Novas di-hidrodibenzo<b,f>azepinas substituidas processo para a sua preparacao composicoes farmaceuticas que as contem e utilizacao dos novos compostos na preparacao de composicoes farmaceuticas empregues em doencas do sistema nervoso |
| US20020022056A1 (en) | 1997-02-14 | 2002-02-21 | Burkhard Schlutermann | Oxacarbazepine film-coated tablets |
| AT408224B (de) * | 1999-03-15 | 2001-09-25 | Dsm Fine Chem Austria Gmbh | Verfahren zur herstellung von oxcarbazepin |
| EP1446383B1 (en) * | 2001-11-12 | 2008-09-17 | Novartis AG | Monohydroxycarbamazepine for use in the preparation of a medicament for the treatment of affective and attention disorder and neuropathic pain |
| GB0303615D0 (en) * | 2003-02-17 | 2003-03-19 | Novartis Ag | Use of organic compounds |
| ITMI20042230A1 (it) | 2004-11-19 | 2005-02-19 | Farchemia Srl | Procedimento per la preparazione della 10,11-diidro-10 idrossi-5h-dibenz-b,f-azepin-5carbossiammide |
| US20060252745A1 (en) | 2005-05-06 | 2006-11-09 | Almeida Jose L D | Methods of preparing pharmaceutical compositions comprising eslicarbazepine acetate and methods of use |
| GB0700773D0 (en) | 2007-01-15 | 2007-02-21 | Portela & Ca Sa | Drug therapies |
-
1969
- 1969-03-31 CH CH484469A patent/CH505101A/de not_active IP Right Cessation
-
1970
- 1970-03-03 NL NL7003026.A patent/NL159972C/xx not_active IP Right Cessation
- 1970-03-03 SE SE02771/70A patent/SE354069B/xx unknown
- 1970-03-03 DK DK104670AA patent/DK133898B/da not_active IP Right Cessation
- 1970-03-03 FI FI700560A patent/FI50524C/fi active
- 1970-03-03 BR BR217333/70A patent/BR7017333D0/pt unknown
- 1970-03-05 YU YU537/70A patent/YU33863B/xx unknown
- 1970-03-09 PL PL1970139289A patent/PL80544B1/pl unknown
- 1970-03-09 AT AT218670A patent/AT294106B/de not_active IP Right Cessation
- 1970-03-09 NO NO70757A patent/NO131546C/no unknown
- 1970-03-09 IL IL34027A patent/IL34027A/xx unknown
- 1970-03-09 DE DE2011045A patent/DE2011045C3/de not_active Expired
- 1970-03-09 IE IE303/70A patent/IE34050B1/xx unknown
- 1970-03-09 FR FR707008345A patent/FR2035999B1/fr not_active Expired
- 1970-03-09 BE BE747086D patent/BE747086A/xx not_active IP Right Cessation
- 1970-03-09 CS CS155770A patent/CS154295B2/cs unknown
- 1970-03-09 ES ES377280A patent/ES377280A1/es not_active Expired
- 1970-03-09 CA CA076788A patent/CA920587A/en not_active Expired
- 1970-03-09 GB GB1111170A patent/GB1310120A/en not_active Expired
- 1970-03-09 BG BG014134A patent/BG17600A3/xx unknown
Also Published As
| Publication number | Publication date |
|---|---|
| DE2011045C3 (de) | 1979-05-31 |
| ES377280A1 (es) | 1972-06-16 |
| IL34027A (en) | 1972-12-29 |
| YU53770A (en) | 1977-12-31 |
| IE34050L (en) | 1970-09-30 |
| CA920587A (en) | 1973-02-06 |
| GB1310120A (en) | 1973-03-14 |
| PL80544B1 (enExample) | 1975-08-30 |
| YU33863B (en) | 1978-06-30 |
| NO131546B (enExample) | 1975-03-10 |
| FR2035999B1 (enExample) | 1973-04-06 |
| NL159972C (nl) | 1979-09-17 |
| AT294106B (de) | 1971-11-10 |
| IE34050B1 (en) | 1975-01-22 |
| NO131546C (enExample) | 1975-06-25 |
| NL7003026A (enExample) | 1970-10-02 |
| IL34027A0 (en) | 1970-05-21 |
| BG17600A3 (bg) | 1973-11-10 |
| SE354069B (enExample) | 1973-02-26 |
| DE2011045B2 (de) | 1978-10-05 |
| CS154295B2 (enExample) | 1974-03-29 |
| BE747086A (fr) | 1970-09-09 |
| FR2035999A1 (enExample) | 1970-12-24 |
| BR7017333D0 (pt) | 1973-05-31 |
| DE2011045A1 (de) | 1970-10-08 |
| FI50524B (enExample) | 1975-12-31 |
| FI50524C (fi) | 1976-04-12 |
| CH505101A (de) | 1971-03-31 |
| DK133898C (enExample) | 1977-03-07 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DK125649B (da) | Analogifremgangsmåde til fremstilling af 10-oxo-10, 11-dihydro-5H-dibenz[b,f]azepin-5-carboxamid. | |
| ATA401174A (de) | Verfahren zur herstellung von neuen wasserunloeslichen proteinpraeparaten, insbesondere von neuen wasserunloeslichen penicillinacylasepraeparaten | |
| DK138798B (da) | Fremgangsmåde til fremstilling af optisk aktive 1,4-benzodiazepin-2-on-derivater. | |
| DK133898B (da) | Analogifremgangsmåde til fremstilling af 10-hydroxy-10,11-dihydro-5H-dibenz /b,f/azepin-5-carboxamid. | |
| DK131904B (da) | Analogifremgangsmåde til fremstilling af 1,2,4,5-tetrahydro-2,4-dioxo-3H-1,5-benzodiazepinderivater. | |
| DK112527B (da) | Fremgangsmåde til fremstilling af 1,3,4,5-tetrahydro-1,4-benzodiazepinderivater. | |
| DK137754B (da) | Fremgangsmåde til fremstilling af 1,4-benzodiazepinderivater. | |
| DK136362B (da) | Fremgangsmåde til fremstilling af 5-alkyl-10-amino-10,11-dihydrodibenz(b,f)azepiner. | |
| DK127784B (da) | Fremgangsmåde til fremstilling af 1-aryl-2,3,4,5-tetrahydro-1H-1,5-benzodiazepin-2-oner. | |
| DK136776B (da) | Analogifremgangsmåde til fremstilling af 17aalfa-alkanoyloxy-D-homopregn-4-en-3,20-dioner. | |
| DK134700B (da) | Analogifremgangsmåde til fremstilling af 21-alkylerede 16alfa,17alfa-alkylidendioxy-pregn-4-en-3,20-dioner. | |
| FI49831C (fi) | Menetelmä 7-kloori-1,3-dihydro-1-metyyli-5-fenyyli-2H-1,4-dibentsodiat sepiini-2-onin valmistamiseksi. | |
| DK121760B (da) | Fremgangsmåde til fremstilling af 5H-dibenzo[b,f]azepinderivater. | |
| DK127115B (da) | Fremgangsmåde til fremstilling af 1,4-benzodiazepinderivater. | |
| DK137494B (da) | Fremgangsmåde til fremstilling af 1,4-benzodiazepinderivater. | |
| DK122764B (da) | Analogifremgangsmåde til fremstilling af 10, 11-dihydro-5H-dibenz [b,f] azepinderivater eller syreadditionssalte deraf. | |
| DK137855B (da) | Analogifremgangsmåde til fremstilling af optisk aktive 1,3,4,5-tetrahydro-2H-1,4-benzodiazepin-2-on-derivater. | |
| DK115626B (da) | Fremgangsmåde til fremstilling af 5H-dibenz[b,f] azepinderivater eller syreadditionssalte deraf. | |
| DK118953B (da) | Fremgangsmåde til fremstilling af 1,3,4,5-tetrahydro-2H-1,4-benzodiazepin-2-on-derivater. | |
| DK134433B (da) | Fremgangsmåde til fremstilling af 7-chlor-1-methyl-5-phenyl-2,3-dihyro-1H-1,4-benzodiazepin-2-on. | |
| DK129582B (da) | Fremgangsmåde til fremstilling af 1-hydroxyalkyl-1,4-benzodiazepinderivater. | |
| DK121235B (da) | Fremgangsmåde til fremstilling af 1,4-benzodiazepinderivater. | |
| DK140282B (da) | Analogifremgangsmåde til fremstilling af 1,4-benzodiazepinderivater. | |
| DK112096B (da) | Fremgangsmåde til fremstilling af 5H-dibenz[b,f]azepinderivater eller syreadditionssalte deraf. | |
| DK135719B (da) | Analogifremgangsmåde til fremstilling af 1,4-benzodiazepinderivater. |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| PBP | Patent lapsed |