DEZ0003298MA - - Google Patents
Info
- Publication number
- DEZ0003298MA DEZ0003298MA DEZ0003298MA DE Z0003298M A DEZ0003298M A DE Z0003298MA DE Z0003298M A DEZ0003298M A DE Z0003298MA
- Authority
- DE
- Germany
- Prior art keywords
- cellulose
- hydrolysis
- oxidized
- solvent
- atmospheres
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Active
Links
- 230000007062 hydrolysis Effects 0.000 claims description 4
- 238000006460 hydrolysis reaction Methods 0.000 claims description 4
- 229920002201 Oxidized cellulose Polymers 0.000 claims description 3
- 229920002678 cellulose Polymers 0.000 claims description 3
- 239000001913 cellulose Substances 0.000 claims description 3
- 239000002904 solvent Substances 0.000 claims description 3
- MGWGWNFMUOTEHG-UHFFFAOYSA-N 4-(3,5-dimethylphenyl)-1,3-thiazol-2-amine Chemical compound CC1=CC(C)=CC(C=2N=C(N)SC=2)=C1 MGWGWNFMUOTEHG-UHFFFAOYSA-N 0.000 claims description 2
- 238000005903 acid hydrolysis reaction Methods 0.000 claims description 2
- 239000007795 chemical reaction product Substances 0.000 claims description 2
- JCXJVPUVTGWSNB-UHFFFAOYSA-N nitrogen dioxide Inorganic materials O=[N]=O JCXJVPUVTGWSNB-UHFFFAOYSA-N 0.000 claims description 2
- 239000003960 organic solvent Substances 0.000 claims description 2
- 229940107304 oxidized cellulose Drugs 0.000 claims description 2
- 239000000126 substance Substances 0.000 claims description 2
- 238000000034 method Methods 0.000 claims 2
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 claims 1
- 229910052799 carbon Inorganic materials 0.000 claims 1
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 description 4
- 239000000047 product Substances 0.000 description 3
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 2
- 229910002092 carbon dioxide Inorganic materials 0.000 description 2
- 239000001569 carbon dioxide Substances 0.000 description 2
- FEHVEVVZUMSQSR-UHFFFAOYSA-N oxane-3,4,5-trione Chemical compound O=C1COCC(C1=O)=O FEHVEVVZUMSQSR-UHFFFAOYSA-N 0.000 description 2
- 230000003647 oxidation Effects 0.000 description 2
- 238000007254 oxidation reaction Methods 0.000 description 2
- 239000002253 acid Substances 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 description 1
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 1
- 238000006243 chemical reaction Methods 0.000 description 1
- 150000001875 compounds Chemical class 0.000 description 1
- 238000000605 extraction Methods 0.000 description 1
- 238000000260 fractional sublimation Methods 0.000 description 1
- 239000013067 intermediate product Substances 0.000 description 1
- 230000008018 melting Effects 0.000 description 1
- 238000002844 melting Methods 0.000 description 1
- 229910052757 nitrogen Inorganic materials 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 1
Family
ID=
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DEZ0003298MA (enExample) | ||
| DE952814C (de) | Verfahren zur Herstellung von 3, 4, 5-Trioxyotetrahydropyran | |
| DE574838C (de) | Verfahren zur Darstellung von cyclischen Glykolen und ihren Derivaten bzw. von Ketonen | |
| EP0043922A1 (de) | Verfahren zur Herstellung von 1.2-Dimethyl-5-nitroimidazol | |
| DE1243194B (de) | Verfahren zur Durchfuehrung der Carboxylierung von Grignard-Verbindungen mit Kohlendioxyd | |
| DE851194C (de) | Verfahren zur Herstellung von monomerem ªŠ-Caprolactam | |
| DE1618245A1 (de) | Verfahren zur gefahrlosen Herstellung von Derivaten des epsilon-Caprolactons | |
| DE1088063B (de) | Verfahren zur Rueckgewinnung von Dicarbonsaeuren und Diaminen aus Polyamiden | |
| DE941429C (de) | Verfahren zur Herstellung von Dialkalisalzen der 2-Oxynaphthalin-(3)-carbonsaeure | |
| DE2051320C3 (de) | Verfahren zur Reinigung von aliphatischen Dicarbonsäuregemischen | |
| DE1189990B (de) | Verfahren zur Herstellung von 2, 2-Dihalogencyclopropancarbonsaeuren | |
| DE709983C (de) | Verfahren zur Herstellung von Glykolsaeure | |
| EP0359043A1 (de) | Verfahren zur Isolierung von 2-Keto-polyphydroxy-C6-carbonsäuren, insbesondere von 2-Keto-L-gulonsäure aus wässrigen Fermentationsausträgen | |
| DE899193C (de) | Verfahren zur Herstellung von Imidazolderivaten | |
| DE965402C (de) | Verfahren zur Herstellung von 2-Methylol-3-ketobuten-(1,2) | |
| DE436443C (de) | Verfahren zur Darstellung einer Oxypyridincarbonsaeure | |
| DE162822C (enExample) | ||
| DE170520C (enExample) | ||
| DE2600657B2 (de) | Verfahren zur Herstellung von GIykolaldehyd | |
| DE287798C (enExample) | ||
| DE2223327C3 (de) | Verfahren zur Herstellung von als Härter für Epoxidharze geeigneten Kondensationsprodukten | |
| DE590238C (de) | Verfahren zur Herstellung von Lactonen | |
| DEF0015415MA (enExample) | ||
| DER0015471MA (enExample) | ||
| DE1793712A1 (de) | Verfahren zur Reinigung von Ameisensaeure |