DER0015468MA - - Google Patents
Info
- Publication number
- DER0015468MA DER0015468MA DER0015468MA DE R0015468M A DER0015468M A DE R0015468MA DE R0015468M A DER0015468M A DE R0015468MA
- Authority
- DE
- Germany
- Prior art keywords
- resin
- color
- solution
- sugar
- contained
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Active
Links
- 239000011347 resin Substances 0.000 claims description 47
- 229920005989 resin Polymers 0.000 claims description 47
- 235000000346 sugar Nutrition 0.000 claims description 47
- 238000000034 method Methods 0.000 claims description 20
- 239000003957 anion exchange resin Substances 0.000 claims description 15
- 125000001453 quaternary ammonium group Chemical group 0.000 claims description 15
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 claims description 10
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 claims description 9
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical group Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 claims description 8
- 150000003839 salts Chemical class 0.000 claims description 7
- 230000008929 regeneration Effects 0.000 claims description 6
- 238000011069 regeneration method Methods 0.000 claims description 6
- 239000011780 sodium chloride Substances 0.000 claims description 5
- 239000007787 solid Substances 0.000 claims description 5
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 5
- 239000003456 ion exchange resin Substances 0.000 claims description 4
- 229920003303 ion-exchange polymer Polymers 0.000 claims description 4
- NWUYHJFMYQTDRP-UHFFFAOYSA-N 1,2-bis(ethenyl)benzene;1-ethenyl-2-ethylbenzene;styrene Chemical compound C=CC1=CC=CC=C1.CCC1=CC=CC=C1C=C.C=CC1=CC=CC=C1C=C NWUYHJFMYQTDRP-UHFFFAOYSA-N 0.000 claims description 3
- 239000003610 charcoal Substances 0.000 claims description 3
- 238000004043 dyeing Methods 0.000 claims description 3
- 238000002845 discoloration Methods 0.000 claims description 2
- 239000005708 Sodium hypochlorite Substances 0.000 claims 4
- 239000007800 oxidant agent Substances 0.000 claims 4
- SUKJFIGYRHOWBL-UHFFFAOYSA-N sodium hypochlorite Chemical compound [Na+].Cl[O-] SUKJFIGYRHOWBL-UHFFFAOYSA-N 0.000 claims 4
- 238000010186 staining Methods 0.000 claims 3
- MHAJPDPJQMAIIY-UHFFFAOYSA-N Hydrogen peroxide Chemical compound OO MHAJPDPJQMAIIY-UHFFFAOYSA-N 0.000 claims 2
- 238000004140 cleaning Methods 0.000 claims 1
- 239000003463 adsorbent Substances 0.000 description 5
- 235000020357 syrup Nutrition 0.000 description 5
- 239000006188 syrup Substances 0.000 description 5
- MYRTYDVEIRVNKP-UHFFFAOYSA-N 1,2-Divinylbenzene Chemical compound C=CC1=CC=CC=C1C=C MYRTYDVEIRVNKP-UHFFFAOYSA-N 0.000 description 4
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 4
- 238000001179 sorption measurement Methods 0.000 description 4
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 3
- 229920001577 copolymer Polymers 0.000 description 3
- 239000003431 cross linking reagent Substances 0.000 description 3
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 3
- 239000002245 particle Substances 0.000 description 3
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 description 2
- PPBRXRYQALVLMV-UHFFFAOYSA-N Styrene Chemical compound C=CC1=CC=CC=C1 PPBRXRYQALVLMV-UHFFFAOYSA-N 0.000 description 2
- 150000001450 anions Chemical class 0.000 description 2
- 229910052799 carbon Inorganic materials 0.000 description 2
- 150000001805 chlorine compounds Chemical class 0.000 description 2
- 238000004040 coloring Methods 0.000 description 2
- 238000004042 decolorization Methods 0.000 description 2
- 239000012535 impurity Substances 0.000 description 2
- 238000004519 manufacturing process Methods 0.000 description 2
- 235000013379 molasses Nutrition 0.000 description 2
- 229920000642 polymer Polymers 0.000 description 2
- 150000003242 quaternary ammonium salts Chemical group 0.000 description 2
- 229910021653 sulphate ion Inorganic materials 0.000 description 2
- GETQZCLCWQTVFV-UHFFFAOYSA-N trimethylamine Chemical compound CN(C)C GETQZCLCWQTVFV-UHFFFAOYSA-N 0.000 description 2
- 239000004215 Carbon black (E152) Substances 0.000 description 1
- 235000008733 Citrus aurantifolia Nutrition 0.000 description 1
- CPELXLSAUQHCOX-UHFFFAOYSA-N Hydrogen bromide Chemical group Br CPELXLSAUQHCOX-UHFFFAOYSA-N 0.000 description 1
- 229910019142 PO4 Inorganic materials 0.000 description 1
- OAICVXFJPJFONN-UHFFFAOYSA-N Phosphorus Chemical compound [P] OAICVXFJPJFONN-UHFFFAOYSA-N 0.000 description 1
- 235000011941 Tilia x europaea Nutrition 0.000 description 1
- 238000010521 absorption reaction Methods 0.000 description 1
- 239000002253 acid Substances 0.000 description 1
- 239000007900 aqueous suspension Substances 0.000 description 1
- 230000009286 beneficial effect Effects 0.000 description 1
- 150000001768 cations Chemical class 0.000 description 1
- 229920001429 chelating resin Polymers 0.000 description 1
- 238000006243 chemical reaction Methods 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- 238000007265 chloromethylation reaction Methods 0.000 description 1
- 238000005352 clarification Methods 0.000 description 1
- 239000013078 crystal Substances 0.000 description 1
- FYZZJDABXBPMOG-UHFFFAOYSA-N ethanol;n-methylmethanamine Chemical compound CCO.CNC FYZZJDABXBPMOG-UHFFFAOYSA-N 0.000 description 1
- 125000003983 fluorenyl group Chemical group C1(=CC=CC=2C3=CC=CC=C3CC12)* 0.000 description 1
- 125000000524 functional group Chemical group 0.000 description 1
- 235000021552 granulated sugar Nutrition 0.000 description 1
- 150000004820 halides Chemical group 0.000 description 1
- 229930195733 hydrocarbon Natural products 0.000 description 1
- 150000002430 hydrocarbons Chemical class 0.000 description 1
- 229910052500 inorganic mineral Inorganic materials 0.000 description 1
- 229910017053 inorganic salt Inorganic materials 0.000 description 1
- 229960004903 invert sugar Drugs 0.000 description 1
- 239000004571 lime Substances 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 239000011707 mineral Substances 0.000 description 1
- 239000000203 mixture Substances 0.000 description 1
- NIHNNTQXNPWCJQ-UHFFFAOYSA-N o-biphenylenemethane Natural products C1=CC=C2CC3=CC=CC=C3C2=C1 NIHNNTQXNPWCJQ-UHFFFAOYSA-N 0.000 description 1
- 235000021317 phosphate Nutrition 0.000 description 1
- 150000003013 phosphoric acid derivatives Chemical class 0.000 description 1
- 239000011574 phosphorus Substances 0.000 description 1
- 229910052698 phosphorus Inorganic materials 0.000 description 1
- 239000011148 porous material Substances 0.000 description 1
- 238000007670 refining Methods 0.000 description 1
- 230000000717 retained effect Effects 0.000 description 1
- 239000002594 sorbent Substances 0.000 description 1
- 150000008163 sugars Chemical class 0.000 description 1
- 150000003467 sulfuric acid derivatives Chemical class 0.000 description 1
- -1 sulphate ions Chemical class 0.000 description 1
- 230000008961 swelling Effects 0.000 description 1
- 150000003512 tertiary amines Chemical class 0.000 description 1
Family
ID=
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2156471C3 (de) | Verwendung eines Zeolithen zur Entfernung von Ammoniumionen | |
| EP2678272B1 (de) | Verfahren zur reinigung starker säuren bzw. stark saurer medien von zwei- und höherwertigen metallionen | |
| DE2518431C3 (de) | Verfarhen zur Entfernung der schädlichen organischen Verbindungen aus der bei der Tonerdegewinnung nach dem Bayer-Verfarhen anfallenden Aluminatlauge | |
| EP0389661A1 (de) | Verfahren zur Abtrennung von Arsen aus Abwässern | |
| EP0085344A2 (de) | Verfahren zur Entfernung von Schwermetallionen aus Nassverfahrensphosphorsäure | |
| DE2515861A1 (de) | Verfahren zur adsorptiven entfernung von arsen, antimon und/oder wismut | |
| DE1299617B (de) | Verfahren zur Herstellung von feinverteiltem gefaelltem Siliciumdioxid | |
| DE3212681A1 (de) | Wasserklaerung | |
| DE69523483T2 (de) | Verfahren zur regeneration von ionenaustauscherharzen, die zum entfaerben von zuckerloesungen benutzt werden | |
| DE2519382A1 (de) | Verfahren zur gewinnung einer gereinigten alpha-galactosidase aus einer alpha-galactosidase enthaltenden fluessigkeit | |
| DE69112770T2 (de) | Verfahren zur Abscheidung der organischen Säure oder Säuren aus einer organische Säuren enthaltenden Lösung. | |
| DE1467130A1 (de) | Pigmente und Verfahren zu deren Herstellung | |
| CH682639A5 (de) | Feinreinigung von Wasser und Behandlung von Kondensaten in einer Ionenaustauscheranlage. | |
| EP0286698B1 (de) | Verfahren zur Entfernung von Schwermetall- und/oder Alkalimetall-Kationen aus wässrigen Lösungen mit Ionenaustauschermaterial | |
| DER0015468MA (https=) | ||
| DE3411474C2 (https=) | ||
| DE3241293C2 (de) | Verfahren zur Wiedergewinnung von Uran aus einem mit Uran kontaminierten Abwasser | |
| EP0184690B1 (de) | Verfahren zur Entarsenierung von phosphorsauren Lösungen | |
| DE2029117C3 (de) | Verfahren zur Entfernung von metallischen und/oder halbmetallischen Verunreinigungen aus Schwefelsäure | |
| DE4214075A1 (de) | Verfahren zur reinigung von wasserstoffperoxid | |
| DE2854249C2 (de) | Verfahren zum Regenerieren eines Mischbettfilters | |
| DE617706C (de) | Verfahren zum Entfaerben und Klaeren von waessrigen Loesungen | |
| DE2449500C2 (de) | Verfahren zum Reinigen von Abwässern | |
| EP0308521B1 (de) | Verfahren zur Entfernung von störenden organischen Stoffen und anorganischen Anionen aus Zuckerlösungen | |
| DE1014532B (de) | Verfahren zur Entfernung der kationischen und/oder anionischen Verunreinigungen aus feinverteilter stabilisierter Kieselsaeure |