DEN0008383MA - - Google Patents
Info
- Publication number
- DEN0008383MA DEN0008383MA DEN0008383MA DE N0008383M A DEN0008383M A DE N0008383MA DE N0008383M A DEN0008383M A DE N0008383MA
- Authority
- DE
- Germany
- Prior art keywords
- phosphates
- salts
- monoalkyl
- phosphate
- separating
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Active
Links
- 229910019142 PO4 Inorganic materials 0.000 claims description 14
- 235000021317 phosphate Nutrition 0.000 claims description 14
- 150000003839 salts Chemical class 0.000 claims description 12
- -1 ester salts Chemical class 0.000 claims description 11
- 239000000203 mixture Substances 0.000 claims description 10
- 238000000034 method Methods 0.000 claims description 9
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 claims description 8
- 150000008280 chlorinated hydrocarbons Chemical class 0.000 claims description 7
- 238000000605 extraction Methods 0.000 claims description 7
- 239000003513 alkali Substances 0.000 claims description 6
- 125000004432 carbon atom Chemical group C* 0.000 claims description 6
- NBIIXXVUZAFLBC-UHFFFAOYSA-K phosphate Chemical compound [O-]P([O-])([O-])=O NBIIXXVUZAFLBC-UHFFFAOYSA-K 0.000 claims description 6
- 239000010452 phosphate Substances 0.000 claims description 6
- 150000003013 phosphoric acid derivatives Chemical class 0.000 claims description 6
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 claims description 4
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 claims description 4
- 125000000217 alkyl group Chemical group 0.000 claims description 4
- 239000000126 substance Substances 0.000 claims description 3
- DVZIQPGIAQDYQH-UHFFFAOYSA-N diheptyl hydrogen phosphate Chemical class CCCCCCCOP(O)(=O)OCCCCCCC DVZIQPGIAQDYQH-UHFFFAOYSA-N 0.000 claims description 2
- QAXKHFJPTMUUOV-UHFFFAOYSA-N dinonyl hydrogen phosphate Chemical class CCCCCCCCCOP(O)(=O)OCCCCCCCCC QAXKHFJPTMUUOV-UHFFFAOYSA-N 0.000 claims 1
- 150000002148 esters Chemical class 0.000 claims 1
- 238000000926 separation method Methods 0.000 description 8
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 6
- 150000001447 alkali salts Chemical class 0.000 description 6
- 239000007795 chemical reaction product Substances 0.000 description 6
- 150000008028 secondary esters Chemical class 0.000 description 6
- DLYUQMMRRRQYAE-UHFFFAOYSA-N tetraphosphorus decaoxide Chemical compound O1P(O2)(=O)OP3(=O)OP1(=O)OP2(=O)O3 DLYUQMMRRRQYAE-UHFFFAOYSA-N 0.000 description 6
- 239000002585 base Substances 0.000 description 5
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 5
- 125000005907 alkyl ester group Chemical group 0.000 description 3
- 159000000009 barium salts Chemical class 0.000 description 3
- 239000011734 sodium Substances 0.000 description 3
- TWRXJAOTZQYOKJ-UHFFFAOYSA-L Magnesium chloride Chemical compound [Mg+2].[Cl-].[Cl-] TWRXJAOTZQYOKJ-UHFFFAOYSA-L 0.000 description 2
- RMXZWBZGNQVISU-UHFFFAOYSA-L disodium;nonyl phosphate Chemical compound [Na+].[Na+].CCCCCCCCCOP([O-])([O-])=O RMXZWBZGNQVISU-UHFFFAOYSA-L 0.000 description 2
- 229930195733 hydrocarbon Natural products 0.000 description 2
- 150000002430 hydrocarbons Chemical class 0.000 description 2
- YIXJRHPUWRPCBB-UHFFFAOYSA-N magnesium nitrate Chemical compound [Mg+2].[O-][N+]([O-])=O.[O-][N+]([O-])=O YIXJRHPUWRPCBB-UHFFFAOYSA-N 0.000 description 2
- 150000005374 primary esters Chemical class 0.000 description 2
- 229910000162 sodium phosphate Inorganic materials 0.000 description 2
- 239000001488 sodium phosphate Substances 0.000 description 2
- KECOWKBVYCBTPB-UHFFFAOYSA-M sodium;dinonyl phosphate Chemical compound [Na+].CCCCCCCCCOP([O-])(=O)OCCCCCCCCC KECOWKBVYCBTPB-UHFFFAOYSA-M 0.000 description 2
- 239000000243 solution Substances 0.000 description 2
- RYFMWSXOAZQYPI-UHFFFAOYSA-K trisodium phosphate Chemical compound [Na+].[Na+].[Na+].[O-]P([O-])([O-])=O RYFMWSXOAZQYPI-UHFFFAOYSA-K 0.000 description 2
- PQSMEVPHTJECDZ-UHFFFAOYSA-N 2,3-dimethylheptan-2-ol Chemical compound CCCCC(C)C(C)(C)O PQSMEVPHTJECDZ-UHFFFAOYSA-N 0.000 description 1
- 125000001931 aliphatic group Chemical group 0.000 description 1
- 229910000318 alkali metal phosphate Inorganic materials 0.000 description 1
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 1
- 150000001342 alkaline earth metals Chemical class 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 125000003118 aryl group Chemical group 0.000 description 1
- XAEMLUCIRLRCRC-UHFFFAOYSA-L barium(2+) dihexadecyl phosphate Chemical compound [Ba++].CCCCCCCCCCCCCCCCOP([O-])(=O)OCCCCCCCCCCCCCCCC.CCCCCCCCCCCCCCCCOP([O-])(=O)OCCCCCCCCCCCCCCCC XAEMLUCIRLRCRC-UHFFFAOYSA-L 0.000 description 1
- VFJUCHICZXDEEY-UHFFFAOYSA-L barium(2+);hexadecyl phosphate Chemical compound [Ba+2].CCCCCCCCCCCCCCCCOP([O-])([O-])=O VFJUCHICZXDEEY-UHFFFAOYSA-L 0.000 description 1
- 150000001875 compounds Chemical class 0.000 description 1
- 150000005690 diesters Chemical class 0.000 description 1
- 238000004821 distillation Methods 0.000 description 1
- 238000001640 fractional crystallisation Methods 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- GGKJPMAIXBETTD-UHFFFAOYSA-N heptyl dihydrogen phosphate Chemical compound CCCCCCCOP(O)(O)=O GGKJPMAIXBETTD-UHFFFAOYSA-N 0.000 description 1
- 229910001629 magnesium chloride Inorganic materials 0.000 description 1
- 150000002903 organophosphorus compounds Chemical class 0.000 description 1
- 235000011007 phosphoric acid Nutrition 0.000 description 1
- 150000003016 phosphoric acids Chemical class 0.000 description 1
- 239000002244 precipitate Substances 0.000 description 1
- 238000001256 steam distillation Methods 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
Family
ID=
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2337289A1 (de) | Verfahren zur herstellung von n-phosphonomethylglycin | |
| EP0070415B1 (de) | Verfahren zur Extraktion von Schwermetallionen aus wässrigen Lösungen | |
| DE2312152C2 (de) | Verfahren zur Gewinnung von Molybdän und/oder Rhenium | |
| DE956848C (de) | Verfahren zum Trennen von Monoalkyl- und Dialkylphosphaten | |
| DE1161865B (de) | Verfahren zur Gewinnung von Phosphorsaeure | |
| DE2050632A1 (de) | Verfahren zum Reinigen, Trennen und Gewinnen von Metallen aus Losungen | |
| DE3872014T2 (de) | Verfahren zum fluessig-fluessig extrahieren von seltenen erden. | |
| DE2843574C2 (enExample) | ||
| DEN0008383MA (enExample) | ||
| DE1261850B (de) | Verfahren zur Herstellung von AEthan-1-hydroxy-1,1-diphosphonsaeure | |
| DE2952475C2 (de) | Verfahren zur Gewinnung von Uranverbindungen aus wäßriger Uran enthaltender Phosphorsäure | |
| DE2125587A1 (de) | Verfahren zur Herstellung von Hypophosphiten | |
| DE957479C (de) | Verfahren zum Trennen von Monoalkyl- und Dialkylphosphaten | |
| DE3235693C2 (de) | Verfahren zur Rückextraktion von Indiumionen aus einer organischen Lösungsmittelphase | |
| CH634332A5 (de) | Verfahren zur gewinnung von reinen 0,0-dialkyldithiophosphorsaeuren. | |
| DE2160783C3 (de) | Phosphorsäureester von polyfluorierten Alkoholen | |
| DE2952476C2 (de) | Verfahren zur Gewinnung von Uranverbindungen aus wäßriger Uran enthaltender Phosphorsäure | |
| DEN0008384MA (enExample) | ||
| DE2365882B2 (de) | Verfahren zur Reinigung einer rohen Naßphosphorsäure durch Extraktion mit Methylisoburylketon | |
| DE1768760C2 (de) | Verfahren zur Herstellung von Sulfathalbestern höhermolekularer allphatischer sekundärer Alkohole | |
| DE2833380A1 (de) | Verfahren zur herstellung von phosphoriger saeure | |
| DE1592085A1 (de) | Verfahren zum Reinigen von Magnesiumchloridsolen | |
| DE1176112B (de) | Verfahren zur Gewinnung von Verbindungen der Transplutonium-Elemente aus ihrem Gemisch mit Seltenen Erden | |
| DE1074558B (de) | Verfahren zur Herstellung von Phosphorsäure | |
| DE2519814A1 (de) | Verfahren zur extraktion von phosphorsaeure |