DEN0006494MA - - Google Patents
Info
- Publication number
- DEN0006494MA DEN0006494MA DEN0006494MA DE N0006494M A DEN0006494M A DE N0006494MA DE N0006494M A DEN0006494M A DE N0006494MA
- Authority
- DE
- Germany
- Prior art keywords
- oil
- percent
- weight
- oxygen
- oils
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Active
Links
- 239000003963 antioxidant agent Substances 0.000 claims description 11
- 239000002480 mineral oil Substances 0.000 claims description 10
- 150000003839 salts Chemical class 0.000 claims description 7
- 239000000314 lubricant Substances 0.000 claims description 6
- 239000010685 fatty oil Substances 0.000 claims description 5
- 239000001993 wax Substances 0.000 claims description 5
- 229910052791 calcium Inorganic materials 0.000 claims description 2
- 239000011575 calcium Substances 0.000 claims description 2
- 239000000203 mixture Substances 0.000 claims description 2
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 claims 1
- 159000000009 barium salts Chemical class 0.000 claims 1
- 150000001875 compounds Chemical class 0.000 claims 1
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 12
- 239000001301 oxygen Substances 0.000 description 12
- 229910052760 oxygen Inorganic materials 0.000 description 12
- 239000003921 oil Substances 0.000 description 10
- 239000000654 additive Substances 0.000 description 8
- 230000003647 oxidation Effects 0.000 description 8
- 238000007254 oxidation reaction Methods 0.000 description 8
- 238000010521 absorption reaction Methods 0.000 description 7
- 230000003078 antioxidant effect Effects 0.000 description 4
- 239000003054 catalyst Substances 0.000 description 4
- 239000012188 paraffin wax Substances 0.000 description 4
- WSFSSNUMVMOOMR-UHFFFAOYSA-N Formaldehyde Chemical compound O=C WSFSSNUMVMOOMR-UHFFFAOYSA-N 0.000 description 3
- 239000008186 active pharmaceutical agent Substances 0.000 description 3
- 230000000996 additive effect Effects 0.000 description 3
- 230000005484 gravity Effects 0.000 description 3
- 239000003112 inhibitor Substances 0.000 description 3
- 239000010688 mineral lubricating oil Substances 0.000 description 3
- 235000010446 mineral oil Nutrition 0.000 description 3
- 239000003208 petroleum Substances 0.000 description 3
- NLZUEZXRPGMBCV-UHFFFAOYSA-N Butylhydroxytoluene Chemical compound CC1=CC(C(C)(C)C)=C(O)C(C(C)(C)C)=C1 NLZUEZXRPGMBCV-UHFFFAOYSA-N 0.000 description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 2
- ATUOYWHBWRKTHZ-UHFFFAOYSA-N Propane Chemical compound CCC ATUOYWHBWRKTHZ-UHFFFAOYSA-N 0.000 description 2
- 229910052788 barium Inorganic materials 0.000 description 2
- 230000015572 biosynthetic process Effects 0.000 description 2
- 238000009835 boiling Methods 0.000 description 2
- 235000010354 butylated hydroxytoluene Nutrition 0.000 description 2
- 230000003197 catalytic effect Effects 0.000 description 2
- VNWKTOKETHGBQD-UHFFFAOYSA-N methane Chemical compound C VNWKTOKETHGBQD-UHFFFAOYSA-N 0.000 description 2
- 150000002978 peroxides Chemical class 0.000 description 2
- 239000001294 propane Substances 0.000 description 2
- 239000000126 substance Substances 0.000 description 2
- -1 B. Ca Chemical class 0.000 description 1
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical group [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 1
- 241000790917 Dioxys <bee> Species 0.000 description 1
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 1
- 241001026509 Kata Species 0.000 description 1
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 1
- 239000002253 acid Substances 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- 229910052782 aluminium Inorganic materials 0.000 description 1
- 235000015241 bacon Nutrition 0.000 description 1
- 235000013871 bee wax Nutrition 0.000 description 1
- 239000012166 beeswax Substances 0.000 description 1
- 229910052793 cadmium Inorganic materials 0.000 description 1
- 159000000007 calcium salts Chemical class 0.000 description 1
- 239000004203 carnauba wax Substances 0.000 description 1
- 235000013869 carnauba wax Nutrition 0.000 description 1
- 125000002091 cationic group Chemical group 0.000 description 1
- 239000003518 caustics Substances 0.000 description 1
- 238000004140 cleaning Methods 0.000 description 1
- 239000012459 cleaning agent Substances 0.000 description 1
- 239000007859 condensation product Substances 0.000 description 1
- 230000007797 corrosion Effects 0.000 description 1
- 238000005260 corrosion Methods 0.000 description 1
- 230000000994 depressogenic effect Effects 0.000 description 1
- 239000002283 diesel fuel Substances 0.000 description 1
- 238000002845 discoloration Methods 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 239000003925 fat Substances 0.000 description 1
- 230000002349 favourable effect Effects 0.000 description 1
- 125000002485 formyl group Chemical class [H]C(*)=O 0.000 description 1
- 239000003502 gasoline Substances 0.000 description 1
- 239000002198 insoluble material Substances 0.000 description 1
- JEIPFZHSYJVQDO-UHFFFAOYSA-N iron(III) oxide Inorganic materials O=[Fe]O[Fe]=O JEIPFZHSYJVQDO-UHFFFAOYSA-N 0.000 description 1
- 229910052749 magnesium Inorganic materials 0.000 description 1
- 230000008018 melting Effects 0.000 description 1
- 238000002844 melting Methods 0.000 description 1
- 229910052751 metal Inorganic materials 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- 150000002739 metals Chemical class 0.000 description 1
- 239000004200 microcrystalline wax Substances 0.000 description 1
- 235000019808 microcrystalline wax Nutrition 0.000 description 1
- 239000012184 mineral wax Substances 0.000 description 1
- 230000007935 neutral effect Effects 0.000 description 1
- 230000020477 pH reduction Effects 0.000 description 1
- 239000003209 petroleum derivative Substances 0.000 description 1
- 239000000047 product Substances 0.000 description 1
- 239000011541 reaction mixture Substances 0.000 description 1
- 238000007670 refining Methods 0.000 description 1
- 239000011347 resin Substances 0.000 description 1
- 229920005989 resin Polymers 0.000 description 1
- 229910052712 strontium Inorganic materials 0.000 description 1
- 150000003460 sulfonic acids Chemical class 0.000 description 1
- 229910052717 sulfur Inorganic materials 0.000 description 1
- 239000011593 sulfur Substances 0.000 description 1
- 229910052718 tin Inorganic materials 0.000 description 1
- 229910052725 zinc Inorganic materials 0.000 description 1
Family
ID=
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE938148C (de) | Schmieroel | |
| DE912251C (de) | Schmiermittel mit einem Gehalt an halogen- und phosphorhaltigen Verbindungen | |
| DE1274774B (de) | Mineralschmieroel | |
| DE1806899C3 (de) | Schmiermittel | |
| DE935271C (de) | Zusatzmittel zu Schmieroelen | |
| DE843458C (de) | Schmieroele | |
| DE1245009B (de) | Verfahren zur Herstellung einer Dispersion von Magnesiumcarbonat in Schmieroelen | |
| DE944625C (de) | Schmieroel | |
| DE942584C (de) | Antioxydationsmittel fuer Mineraloele, fette OEle, Wachse und synthetische Schmiermittel | |
| DE2044480C3 (de) | Derivate der 2-Hydroxybenzol-1,3-dicarbonsäure, Verfahren zu ihrer Herstellung und ihre Verwendung als Rostschutzmittel in Schmierstoffen, Kraft- und Brennstoffen | |
| DE1063311B (de) | Schmieroel | |
| DE3633763A1 (de) | Verfahren zur herstellung hochbasischer, sehr fluider additive, danach hergestelltes schmiermittel sowie brennstoffzusammensetzung | |
| DEN0006494MA (enrdf_load_stackoverflow) | ||
| DE1444851A1 (de) | Schmiermittelzusammensetzung | |
| DE956341C (de) | Schmiermittel | |
| DE2235608A1 (de) | Schmiermittel | |
| DE68928409T2 (de) | Borierte überbasische carboxylate als antikorrosionsmittel | |
| DE1105547B (de) | Schmieroel | |
| DE898065C (de) | Verfahren zum Stabilisieren von Erdoelprodukten, insbesondere viskosen Mineraloelen | |
| DE942524C (de) | Zusaetze zu Schmiermitteln | |
| DE2027812C3 (de) | Verfahren zur Herstellung eines Bor enthaltenden Additivs | |
| DE2539886C2 (de) | Schmierflüssigkeiten und Betriebsöle und ihre Verwendung | |
| DE968010C (de) | Schmieroel | |
| DE961915C (de) | Mineralschmieroel | |
| DE1050487B (de) | Zusatzstoffe fur Mo torenschmierol |