DEM0019879MA - - Google Patents
Info
- Publication number
- DEM0019879MA DEM0019879MA DEM0019879MA DE M0019879M A DEM0019879M A DE M0019879MA DE M0019879M A DEM0019879M A DE M0019879MA
- Authority
- DE
- Germany
- Prior art keywords
- oxidizing
- ignition
- strongly
- silver
- oxidizing agents
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Active
Links
- 239000007800 oxidant agent Substances 0.000 claims description 9
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 claims description 8
- 229910000108 silver(I,III) oxide Inorganic materials 0.000 claims description 6
- 229910052742 iron Inorganic materials 0.000 claims description 4
- KWVVTSALYXIJSS-UHFFFAOYSA-L silver(ii) fluoride Chemical compound [F-].[F-].[Ag+2] KWVVTSALYXIJSS-UHFFFAOYSA-L 0.000 claims description 4
- 239000007787 solid Substances 0.000 claims description 4
- 239000010425 asbestos Substances 0.000 claims description 3
- 239000003638 chemical reducing agent Substances 0.000 claims description 3
- 239000002657 fibrous material Substances 0.000 claims description 3
- 229910052895 riebeckite Inorganic materials 0.000 claims description 3
- 229920000742 Cotton Polymers 0.000 claims description 2
- 206010061218 Inflammation Diseases 0.000 claims description 2
- QFWPJPIVLCBXFJ-UHFFFAOYSA-N glymidine Chemical compound N1=CC(OCCOC)=CN=C1NS(=O)(=O)C1=CC=CC=C1 QFWPJPIVLCBXFJ-UHFFFAOYSA-N 0.000 claims description 2
- 230000004054 inflammatory process Effects 0.000 claims description 2
- 239000000203 mixture Substances 0.000 claims description 2
- 230000001590 oxidative effect Effects 0.000 claims description 2
- FHHJDRFHHWUPDG-UHFFFAOYSA-N peroxysulfuric acid Chemical compound OOS(O)(=O)=O FHHJDRFHHWUPDG-UHFFFAOYSA-N 0.000 claims description 2
- 239000000969 carrier Substances 0.000 claims 1
- -1 z. B. pulp Substances 0.000 claims 1
- 239000000126 substance Substances 0.000 description 9
- 238000006243 chemical reaction Methods 0.000 description 4
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 4
- 239000000835 fiber Substances 0.000 description 3
- 239000000725 suspension Substances 0.000 description 3
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 2
- OAKJQQAXSVQMHS-UHFFFAOYSA-N Hydrazine Chemical class NN OAKJQQAXSVQMHS-UHFFFAOYSA-N 0.000 description 2
- 238000002485 combustion reaction Methods 0.000 description 2
- 238000001035 drying Methods 0.000 description 2
- 238000001914 filtration Methods 0.000 description 2
- 150000002429 hydrazines Chemical class 0.000 description 2
- 238000004519 manufacturing process Methods 0.000 description 2
- 239000000463 material Substances 0.000 description 2
- 150000003839 salts Chemical class 0.000 description 2
- 239000000853 adhesive Substances 0.000 description 1
- 230000001070 adhesive effect Effects 0.000 description 1
- 230000001680 brushing effect Effects 0.000 description 1
- 229920002678 cellulose Polymers 0.000 description 1
- 239000001913 cellulose Substances 0.000 description 1
- 235000019504 cigarettes Nutrition 0.000 description 1
- 238000005516 engineering process Methods 0.000 description 1
- 239000002360 explosive Substances 0.000 description 1
- 150000002443 hydroxylamines Chemical class 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 238000000034 method Methods 0.000 description 1
- 239000003208 petroleum Substances 0.000 description 1
- 239000000376 reactant Substances 0.000 description 1
- 230000036632 reaction speed Effects 0.000 description 1
- 230000009257 reactivity Effects 0.000 description 1
- 238000005507 spraying Methods 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- 239000000375 suspending agent Substances 0.000 description 1
- 235000019505 tobacco product Nutrition 0.000 description 1
Family
ID=
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2224945A1 (de) | Gipszubereitungen | |
| DE3247364A1 (de) | Umhuellung fuer rauchartikel | |
| DE2026070A1 (de) | Kohlenstoffhaltiges nichtgewebtes Tuch | |
| DEM0019879MA (enExample) | ||
| DE1951020C3 (de) | Verfahren zur Herstellung von Kohlenstoffasern mit erhöhter Festigkeit | |
| DE965928C (de) | Kontaktzuender auf der Basis Oxydations- und Reduktionsmittel | |
| US2405978A (en) | Manufacture of artificial fibrous sheet material | |
| DE10161727A1 (de) | Verfahren zur Herstellung einer verbrennbaren Hülse für patronierte Munition | |
| DE2624130A1 (de) | Verfahren zur herstellung kuenstlicher faserprodukte | |
| DE1248456B (de) | Verfahren zur Herstellung von schwer entflammbarem Papier | |
| DE2144030A1 (de) | Verfahren zum Herstellen eines oxydierten Polysaccharide und dessen Verwendung als synthetisches Rauchmaterial | |
| DE662272C (de) | Verfahren zum Herstellen zusammenhaengender Zuendstreifen u. dgl. | |
| DE1238432B (de) | Verfahren zum Appretieren von Cellulosematerialien | |
| AT209857B (de) | Verfahren zur Herstellung flammfester Vliesstoffe | |
| DE853417C (de) | Masse fuer Wandverkleidungen und Verfahren zu ihrer Herstellung | |
| DE2402661A1 (de) | Verfahren zum verhindern chemischer angriffe auf mineralfasern bei fiberarmierung | |
| CH401642A (de) | Verfahren zur Herstellung einer umhüllten Schweisselektrode | |
| DE3627255A1 (de) | Verfahren zur herstellung von feuerfesten formkoerpern | |
| DE99151C (enExample) | ||
| DE865802C (de) | Verfahren zur Herstellung von Rohpapier fuer die Vulkanfiberfabrikation | |
| AT291834B (de) | Wunderkerze | |
| AT78946B (de) | Verfahren zur Herstellung eines zur Nitrierung bestimmten Materials aus Holzzellulose und Baumwolle. | |
| DE944347C (de) | Verfahren zur Herstellung von Papier fuer chromatographische Zwecke | |
| AT164806B (de) | Verfahren zur Darstellung eines im wesentlichen einbasischen Bleisalzes des 2,4-Dinitroresorzins | |
| DE1909488C3 (de) | Verfahren zur direkten Gewinnung eines hochporösen Papiers hoher Naßfestigkeit |