DEK0014458MA - - Google Patents
Info
- Publication number
- DEK0014458MA DEK0014458MA DEK0014458MA DE K0014458M A DEK0014458M A DE K0014458MA DE K0014458M A DEK0014458M A DE K0014458MA
- Authority
- DE
- Germany
- Prior art keywords
- acetylene
- trans
- aqueous
- dihaloethylene
- cupric
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Active
Links
- HSFWRNGVRCDJHI-UHFFFAOYSA-N alpha-acetylene Natural products C#C HSFWRNGVRCDJHI-UHFFFAOYSA-N 0.000 claims description 23
- 125000002534 ethynyl group Chemical group [H]C#C* 0.000 claims description 23
- 238000000034 method Methods 0.000 claims description 18
- 150000003839 salts Chemical class 0.000 claims description 13
- 229910000039 hydrogen halide Inorganic materials 0.000 claims description 7
- 239000012433 hydrogen halide Substances 0.000 claims description 7
- 239000000203 mixture Substances 0.000 claims description 7
- 239000012266 salt solution Substances 0.000 claims description 7
- 239000000243 solution Substances 0.000 claims description 6
- 239000002253 acid Substances 0.000 claims description 3
- 239000000839 emulsion Substances 0.000 claims description 2
- 239000000725 suspension Substances 0.000 claims description 2
- 238000006243 chemical reaction Methods 0.000 description 12
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 11
- 239000000460 chlorine Substances 0.000 description 7
- QPFMBZIOSGYJDE-UHFFFAOYSA-N 1,1,2,2-tetrachloroethane Chemical compound ClC(Cl)C(Cl)Cl QPFMBZIOSGYJDE-UHFFFAOYSA-N 0.000 description 6
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 6
- CPELXLSAUQHCOX-UHFFFAOYSA-N Hydrogen bromide Chemical compound Br CPELXLSAUQHCOX-UHFFFAOYSA-N 0.000 description 6
- 230000015572 biosynthetic process Effects 0.000 description 6
- 229910052801 chlorine Inorganic materials 0.000 description 6
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 5
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 5
- 229910052794 bromium Inorganic materials 0.000 description 5
- 239000007789 gas Substances 0.000 description 5
- ORTQZVOHEJQUHG-UHFFFAOYSA-L copper(II) chloride Chemical compound Cl[Cu]Cl ORTQZVOHEJQUHG-UHFFFAOYSA-L 0.000 description 4
- QSHDDOUJBYECFT-UHFFFAOYSA-N mercury Chemical compound [Hg] QSHDDOUJBYECFT-UHFFFAOYSA-N 0.000 description 4
- 229910052753 mercury Inorganic materials 0.000 description 4
- 230000003647 oxidation Effects 0.000 description 4
- 238000007254 oxidation reaction Methods 0.000 description 4
- 239000006227 byproduct Substances 0.000 description 3
- 229910052736 halogen Inorganic materials 0.000 description 3
- 150000002367 halogens Chemical class 0.000 description 3
- 229910000042 hydrogen bromide Inorganic materials 0.000 description 3
- -1 hydrogen halides Chemical class 0.000 description 3
- 239000007791 liquid phase Substances 0.000 description 3
- 239000012071 phase Substances 0.000 description 3
- KFUSEUYYWQURPO-OWOJBTEDSA-N trans-1,2-dichloroethene Chemical group Cl\C=C\Cl KFUSEUYYWQURPO-OWOJBTEDSA-N 0.000 description 3
- WSLDOOZREJYCGB-UHFFFAOYSA-N 1,2-Dichloroethane Chemical group ClCCCl WSLDOOZREJYCGB-UHFFFAOYSA-N 0.000 description 2
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 description 2
- 238000009835 boiling Methods 0.000 description 2
- 239000010949 copper Substances 0.000 description 2
- 150000001879 copper Chemical class 0.000 description 2
- 229960003280 cupric chloride Drugs 0.000 description 2
- UWTUEMKLYAGTNQ-OWOJBTEDSA-N (e)-1,2-dibromoethene Chemical group Br\C=C\Br UWTUEMKLYAGTNQ-OWOJBTEDSA-N 0.000 description 1
- UWTUEMKLYAGTNQ-UHFFFAOYSA-N 1,2-dibromoethene Chemical group BrC=CBr UWTUEMKLYAGTNQ-UHFFFAOYSA-N 0.000 description 1
- KFUSEUYYWQURPO-UHFFFAOYSA-N 1,2-dichloroethene Chemical group ClC=CCl KFUSEUYYWQURPO-UHFFFAOYSA-N 0.000 description 1
- BMYNFMYTOJXKLE-UHFFFAOYSA-N 3-azaniumyl-2-hydroxypropanoate Chemical compound NCC(O)C(O)=O BMYNFMYTOJXKLE-UHFFFAOYSA-N 0.000 description 1
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 1
- 229910021591 Copper(I) chloride Inorganic materials 0.000 description 1
- ZVQOOHYFBIDMTQ-UHFFFAOYSA-N [methyl(oxido){1-[6-(trifluoromethyl)pyridin-3-yl]ethyl}-lambda(6)-sulfanylidene]cyanamide Chemical compound N#CN=S(C)(=O)C(C)C1=CC=C(C(F)(F)F)N=C1 ZVQOOHYFBIDMTQ-UHFFFAOYSA-N 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 239000000969 carrier Substances 0.000 description 1
- 239000003054 catalyst Substances 0.000 description 1
- 239000003610 charcoal Substances 0.000 description 1
- HRYZWHHZPQKTII-UHFFFAOYSA-N chloroethane Chemical compound CCCl HRYZWHHZPQKTII-UHFFFAOYSA-N 0.000 description 1
- RCTYPNKXASFOBE-UHFFFAOYSA-M chloromercury Chemical compound [Hg]Cl RCTYPNKXASFOBE-UHFFFAOYSA-M 0.000 description 1
- 150000001875 compounds Chemical class 0.000 description 1
- OXBLHERUFWYNTN-UHFFFAOYSA-M copper(I) chloride Chemical compound [Cu]Cl OXBLHERUFWYNTN-UHFFFAOYSA-M 0.000 description 1
- 238000004880 explosion Methods 0.000 description 1
- 230000004720 fertilization Effects 0.000 description 1
- 239000011521 glass Substances 0.000 description 1
- 150000004820 halides Chemical class 0.000 description 1
- 230000026030 halogenation Effects 0.000 description 1
- 238000005658 halogenation reaction Methods 0.000 description 1
- 230000017525 heat dissipation Effects 0.000 description 1
- 229910052739 hydrogen Inorganic materials 0.000 description 1
- 239000001257 hydrogen Substances 0.000 description 1
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 1
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 1
- 229910052742 iron Inorganic materials 0.000 description 1
- 238000002360 preparation method Methods 0.000 description 1
- 239000000047 product Substances 0.000 description 1
- 239000002994 raw material Substances 0.000 description 1
- 239000004576 sand Substances 0.000 description 1
- 229920006395 saturated elastomer Polymers 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 229920002554 vinyl polymer Polymers 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Chemical compound O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 1
Family
ID=
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE4013947C2 (de) | Verfahren zur Elektrosynthese ß, gamma-ungesättigter Ester | |
| DE1917630A1 (de) | Verfahren zur Herstellung von fluorhaltigen Perhalogencarbonsaeurefluoriden oder -chloriden | |
| DEK0014458MA (enrdf_load_stackoverflow) | ||
| DE968921C (de) | Verfahren zur Herstellung von trans-1, 2-Dihalogenaethylenen | |
| DE969191C (de) | Verfahren zur Herstellung von trans-1, 2-Dihalogenaethylenen | |
| DE1817193C3 (de) | Verfahren zur gleichzeitigen Herstellung von symmetrischem und unsymmetrischem Tetrachloräthan | |
| DE3013888A1 (de) | Verfahren zur herstellung von trichlorbenzolen | |
| EP0111203B1 (de) | Verfahren zur Herstellung von 1,2-Dichlorethan | |
| DE2651901C3 (de) | Verfahren zur Herabsetzung des Monochloracetylengehaltes von Roh-1, 1-Dichloräthylen | |
| DE2637861A1 (de) | Verfahren zur herstellung von polyhalogen-metallphthalocyaninen | |
| EP0046555B1 (de) | Verfahren zur Herstellung von 2,5-Dichlortoluol | |
| DE2113858C3 (de) | Verfahren zur Herstellung von 2,3 Dichlorbutadien-(1,3) | |
| DE2059597A1 (de) | Verfahren zum Herstellen von Carbonsaeurechloriden | |
| DE3128442A1 (de) | Verfahren zur herstellung von 2-chlor-4-nitrotoluol | |
| DEK0016621MA (enrdf_load_stackoverflow) | ||
| DE2505055C2 (de) | Verfahren zur Herstellung von 1,1,2-Trichloräthan aus 1,2-Dichloräthan und Chlor | |
| DE2364093C3 (de) | Verfahren zur Umwandlung von Trichloräthylen, das in 1,2-Dichloräthan enthalten ist | |
| DE1543407C (de) | Verfahren zur Herstellung von ahpha tisch ungesättigten oder gesattigten Chlor kohlenwasserstoffen | |
| DE1175690B (de) | Verfahren zur Herstellung von 4-Chlor-2-methylphenol | |
| DE2460821A1 (de) | Verfahren zur herstellung von carbonsaeurefluoriden | |
| CH620412A5 (enrdf_load_stackoverflow) | ||
| DE254069C (enrdf_load_stackoverflow) | ||
| DE2050562A1 (de) | Verfahren zur Herstellung von Dichloracetylchlorid | |
| DE2500766C3 (de) | Verfahren zur Herstellung von Alkoxitetrabromoctanen | |
| DE843695C (de) | Verfahren zur Herstellung ungesaettigter organischer Halogenide durch Austausch von Halogenatomen |