DEG0013258MA - - Google Patents
Info
- Publication number
- DEG0013258MA DEG0013258MA DEG0013258MA DE G0013258M A DEG0013258M A DE G0013258MA DE G0013258M A DEG0013258M A DE G0013258MA
- Authority
- DE
- Germany
- Prior art keywords
- etching
- formamide
- tantalum
- water
- ammonium
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Active
Links
- ZHNUHDYFZUAESO-UHFFFAOYSA-N Formamide Chemical compound NC=O ZHNUHDYFZUAESO-UHFFFAOYSA-N 0.000 claims description 26
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 25
- 239000000243 solution Substances 0.000 claims description 16
- GUVRBAGPIYLISA-UHFFFAOYSA-N tantalum atom Chemical compound [Ta] GUVRBAGPIYLISA-UHFFFAOYSA-N 0.000 claims description 15
- 229910052715 tantalum Inorganic materials 0.000 claims description 12
- 239000002904 solvent Substances 0.000 claims description 6
- MIMUSZHMZBJBPO-UHFFFAOYSA-N 6-methoxy-8-nitroquinoline Chemical compound N1=CC=CC2=CC(OC)=CC([N+]([O-])=O)=C21 MIMUSZHMZBJBPO-UHFFFAOYSA-N 0.000 claims description 5
- DDFHBQSCUXNBSA-UHFFFAOYSA-N 5-(5-carboxythiophen-2-yl)thiophene-2-carboxylic acid Chemical compound S1C(C(=O)O)=CC=C1C1=CC=C(C(O)=O)S1 DDFHBQSCUXNBSA-UHFFFAOYSA-N 0.000 claims description 4
- 238000000034 method Methods 0.000 claims description 4
- SWLVFNYSXGMGBS-UHFFFAOYSA-N ammonium bromide Chemical group [NH4+].[Br-] SWLVFNYSXGMGBS-UHFFFAOYSA-N 0.000 claims description 3
- 239000008151 electrolyte solution Substances 0.000 claims description 3
- 229910017053 inorganic salt Inorganic materials 0.000 claims description 3
- 238000000866 electrolytic etching Methods 0.000 claims 1
- 238000005530 etching Methods 0.000 description 26
- 150000003839 salts Chemical class 0.000 description 10
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 6
- 239000003990 capacitor Substances 0.000 description 4
- 239000003792 electrolyte Substances 0.000 description 4
- KRHYYFGTRYWZRS-UHFFFAOYSA-M Fluoride anion Chemical compound [F-] KRHYYFGTRYWZRS-UHFFFAOYSA-M 0.000 description 3
- 150000003842 bromide salts Chemical class 0.000 description 3
- 150000004673 fluoride salts Chemical class 0.000 description 3
- 229910052751 metal Inorganic materials 0.000 description 3
- 239000002184 metal Substances 0.000 description 3
- FVAUCKIRQBBSSJ-UHFFFAOYSA-M sodium iodide Chemical compound [Na+].[I-] FVAUCKIRQBBSSJ-UHFFFAOYSA-M 0.000 description 3
- LWBPNIJBHRISSS-UHFFFAOYSA-L beryllium dichloride Chemical compound Cl[Be]Cl LWBPNIJBHRISSS-UHFFFAOYSA-L 0.000 description 2
- 230000000694 effects Effects 0.000 description 2
- 150000004820 halides Chemical class 0.000 description 2
- KWGKDLIKAYFUFQ-UHFFFAOYSA-M lithium chloride Chemical compound [Li+].[Cl-] KWGKDLIKAYFUFQ-UHFFFAOYSA-M 0.000 description 2
- 150000002739 metals Chemical class 0.000 description 2
- IOLCXVTUBQKXJR-UHFFFAOYSA-M potassium bromide Chemical compound [K+].[Br-] IOLCXVTUBQKXJR-UHFFFAOYSA-M 0.000 description 2
- 230000001681 protective effect Effects 0.000 description 2
- PUZPDOWCWNUUKD-UHFFFAOYSA-M sodium fluoride Chemical compound [F-].[Na+] PUZPDOWCWNUUKD-UHFFFAOYSA-M 0.000 description 2
- QGZKDVFQNNGYKY-UHFFFAOYSA-O Ammonium Chemical compound [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 description 1
- 229910021578 Iron(III) chloride Inorganic materials 0.000 description 1
- 229910002651 NO3 Inorganic materials 0.000 description 1
- 229910021586 Nickel(II) chloride Inorganic materials 0.000 description 1
- NHNBFGGVMKEFGY-UHFFFAOYSA-N Nitrate Chemical compound [O-][N+]([O-])=O NHNBFGGVMKEFGY-UHFFFAOYSA-N 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- ZMZDMBWJUHKJPS-UHFFFAOYSA-M Thiocyanate anion Chemical compound [S-]C#N ZMZDMBWJUHKJPS-UHFFFAOYSA-M 0.000 description 1
- 229910052782 aluminium Inorganic materials 0.000 description 1
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 230000009286 beneficial effect Effects 0.000 description 1
- 229910001627 beryllium chloride Inorganic materials 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 150000001805 chlorine compounds Chemical class 0.000 description 1
- 239000011248 coating agent Substances 0.000 description 1
- 238000000576 coating method Methods 0.000 description 1
- XTVVROIMIGLXTD-UHFFFAOYSA-N copper(II) nitrate Chemical compound [Cu+2].[O-][N+]([O-])=O.[O-][N+]([O-])=O XTVVROIMIGLXTD-UHFFFAOYSA-N 0.000 description 1
- 125000000118 dimethyl group Chemical group [H]C([H])([H])* 0.000 description 1
- 238000004090 dissolution Methods 0.000 description 1
- 229940021013 electrolyte solution Drugs 0.000 description 1
- 238000002474 experimental method Methods 0.000 description 1
- 230000002349 favourable effect Effects 0.000 description 1
- HTHVSMTZYMMWKO-UHFFFAOYSA-N formamide Chemical compound NC=O.NC=O HTHVSMTZYMMWKO-UHFFFAOYSA-N 0.000 description 1
- IYWCBYFJFZCCGV-UHFFFAOYSA-N formamide;hydrate Chemical compound O.NC=O IYWCBYFJFZCCGV-UHFFFAOYSA-N 0.000 description 1
- 238000009499 grossing Methods 0.000 description 1
- RBTARNINKXHZNM-UHFFFAOYSA-K iron trichloride Chemical compound Cl[Fe](Cl)Cl RBTARNINKXHZNM-UHFFFAOYSA-K 0.000 description 1
- YAFKGUAJYKXPDI-UHFFFAOYSA-J lead tetrafluoride Chemical compound F[Pb](F)(F)F YAFKGUAJYKXPDI-UHFFFAOYSA-J 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 239000000203 mixture Substances 0.000 description 1
- QMMRZOWCJAIUJA-UHFFFAOYSA-L nickel dichloride Chemical compound Cl[Ni]Cl QMMRZOWCJAIUJA-UHFFFAOYSA-L 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- 230000001105 regulatory effect Effects 0.000 description 1
- 239000012047 saturated solution Substances 0.000 description 1
- 235000013024 sodium fluoride Nutrition 0.000 description 1
- 239000011775 sodium fluoride Substances 0.000 description 1
- 235000009518 sodium iodide Nutrition 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
Family
ID=
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE1796220B2 (de) | Verfahren zur Herstellung einer Elektrode zur Verwendung bei elektrolytischen Verfahren | |
| DE69218075T2 (de) | Elektrode für Elektrolyse | |
| DE2708669A1 (de) | Verfahren zum elektrolytischen koernen von aluminiumplatten | |
| DE2810308A1 (de) | Verfahren zum elektrolytischen koernen von aluminium | |
| DE942004C (de) | Verfahren zum AEtzen von Tantal | |
| DE1671455A1 (de) | Elektrochemische Elektrode | |
| DE1937756A1 (de) | Sekundaerelement mit hoher Energiedichte | |
| DE2404560A1 (de) | Verfahren zur herstellung von sebacinsaeure | |
| DE2338549B2 (enFirst) | ||
| DE1909757C3 (de) | Verfahren zur Reinigung von Anoden für elektrolytische Prozesse, die aus einer Unterlage eines filmbildenden Metalls und einem Überzug aus Edelmetalloxiden oder Edelmetalloxide enthaltenden Mischoxiden bestehen | |
| DE3139757C2 (de) | Verfahren zur Regenerierung von Palladium und Zinn enthaltenden wäßrigen Aktivatorlösungen | |
| DE2008335A1 (de) | Verfahren zum Entfernen von leitenden Schichten auf formbeständigen Elektroden | |
| DEG0013258MA (enFirst) | ||
| DE2838406A1 (de) | Verfahren zur gewinnung von kupfer und nickel aus legierungen | |
| EP0911428B1 (de) | Verfahren zur Herstellung von Wismutverbindungen | |
| DE2131672A1 (de) | Verfahren zum galvanischen Plattieren mit Aluminium | |
| DE3311473A1 (de) | Verfahren zur anodischen oxidation eines aluminium-traegermaterials fuer die herstellung lithografischer druckplatten | |
| DE3443338C2 (de) | Kathode zur Herstellung von Elektrolyt-Mangandioxid | |
| DE2546677A1 (de) | Verfahren zur herstellung von cadmiumelektroden fuer nickel-cadmium-batterien | |
| DE2213528A1 (de) | Verfahren zur Beseitigung verbrauchter Überzüge von metallischen Elektroden | |
| DE1227560B (de) | Verfahren zum elektrolytischen AEtzen von Elektroden aus Schwermetall fuer Elektrolyt-kondensatoren | |
| DE2061745B2 (de) | Verfahren zum elektrolytischen Ätzen von Elektrodenfolien aus Aluminium für Elektrolytkondensatoren | |
| DE2044260A1 (de) | Elektrode | |
| DE3215346C2 (enFirst) | ||
| AT127160B (de) | Verfahren zur Herstellung von Persalzen durch Elektrolyse. |