DEG0011474MA - - Google Patents
Info
- Publication number
- DEG0011474MA DEG0011474MA DEG0011474MA DE G0011474M A DEG0011474M A DE G0011474MA DE G0011474M A DEG0011474M A DE G0011474MA
- Authority
- DE
- Germany
- Prior art keywords
- water
- acid
- hydrolysis
- circulating
- mixture
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Active
Links
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 73
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 claims description 49
- 230000007062 hydrolysis Effects 0.000 claims description 37
- 238000006460 hydrolysis reaction Methods 0.000 claims description 37
- 239000002253 acid Substances 0.000 claims description 31
- 239000000203 mixture Substances 0.000 claims description 22
- 229920001296 polysiloxane Polymers 0.000 claims description 21
- 150000001367 organochlorosilanes Chemical class 0.000 claims description 20
- 230000002378 acidificating effect Effects 0.000 claims description 19
- 238000000034 method Methods 0.000 claims description 19
- -1 polysiloxane Polymers 0.000 claims description 15
- LIKFHECYJZWXFJ-UHFFFAOYSA-N dimethyldichlorosilane Chemical compound C[Si](C)(Cl)Cl LIKFHECYJZWXFJ-UHFFFAOYSA-N 0.000 claims description 14
- 229910000041 hydrogen chloride Inorganic materials 0.000 claims description 14
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 claims description 14
- 239000000463 material Substances 0.000 claims description 10
- 229910000077 silane Inorganic materials 0.000 claims description 10
- BLRPTPMANUNPDV-UHFFFAOYSA-N Silane Chemical compound [SiH4] BLRPTPMANUNPDV-UHFFFAOYSA-N 0.000 claims description 9
- KPUWHANPEXNPJT-UHFFFAOYSA-N disiloxane Chemical class [SiH3]O[SiH3] KPUWHANPEXNPJT-UHFFFAOYSA-N 0.000 claims description 5
- 125000001309 chloro group Chemical group Cl* 0.000 claims description 3
- 125000000217 alkyl group Chemical group 0.000 claims description 2
- 239000000460 chlorine Substances 0.000 claims description 2
- 239000013505 freshwater Substances 0.000 claims description 2
- 150000005840 aryl radicals Chemical group 0.000 claims 1
- 238000009795 derivation Methods 0.000 claims 1
- 239000003921 oil Substances 0.000 description 13
- 239000005046 Chlorosilane Substances 0.000 description 7
- KOPOQZFJUQMUML-UHFFFAOYSA-N chlorosilane Chemical compound Cl[SiH3] KOPOQZFJUQMUML-UHFFFAOYSA-N 0.000 description 7
- YGZSVWMBUCGDCV-UHFFFAOYSA-N chloro(methyl)silane Chemical compound C[SiH2]Cl YGZSVWMBUCGDCV-UHFFFAOYSA-N 0.000 description 6
- 239000005055 methyl trichlorosilane Substances 0.000 description 6
- JLUFWMXJHAVVNN-UHFFFAOYSA-N methyltrichlorosilane Chemical compound C[Si](Cl)(Cl)Cl JLUFWMXJHAVVNN-UHFFFAOYSA-N 0.000 description 6
- 239000000047 product Substances 0.000 description 6
- 239000004205 dimethyl polysiloxane Substances 0.000 description 5
- 229920000435 poly(dimethylsiloxane) Polymers 0.000 description 5
- 239000007787 solid Substances 0.000 description 5
- 239000007795 chemical reaction product Substances 0.000 description 4
- 238000002474 experimental method Methods 0.000 description 4
- 239000007788 liquid Substances 0.000 description 4
- 239000002245 particle Substances 0.000 description 4
- 229910052710 silicon Inorganic materials 0.000 description 4
- XUIMIQQOPSSXEZ-UHFFFAOYSA-N Silicon Chemical group [Si] XUIMIQQOPSSXEZ-UHFFFAOYSA-N 0.000 description 3
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- 238000006243 chemical reaction Methods 0.000 description 3
- 239000007789 gas Substances 0.000 description 3
- 239000011521 glass Substances 0.000 description 3
- 239000010703 silicon Substances 0.000 description 3
- 239000000126 substance Substances 0.000 description 3
- NEHMKBQYUWJMIP-UHFFFAOYSA-N chloromethane Chemical compound ClC NEHMKBQYUWJMIP-UHFFFAOYSA-N 0.000 description 2
- 230000007812 deficiency Effects 0.000 description 2
- 238000004821 distillation Methods 0.000 description 2
- 239000012530 fluid Substances 0.000 description 2
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 2
- 238000012856 packing Methods 0.000 description 2
- 238000010992 reflux Methods 0.000 description 2
- 238000000926 separation method Methods 0.000 description 2
- VXEGSRKPIUDPQT-UHFFFAOYSA-N 4-[4-(4-methoxyphenyl)piperazin-1-yl]aniline Chemical compound C1=CC(OC)=CC=C1N1CCN(C=2C=CC(N)=CC=2)CC1 VXEGSRKPIUDPQT-UHFFFAOYSA-N 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- 229910003902 SiCl 4 Inorganic materials 0.000 description 1
- 125000002877 alkyl aryl group Chemical group 0.000 description 1
- 125000003710 aryl alkyl group Chemical group 0.000 description 1
- 125000003118 aryl group Chemical group 0.000 description 1
- 238000010923 batch production Methods 0.000 description 1
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 239000006227 byproduct Substances 0.000 description 1
- 239000003518 caustics Substances 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- 229910052801 chlorine Inorganic materials 0.000 description 1
- KQHIGRPLCKIXNJ-UHFFFAOYSA-N chloro-methyl-silylsilane Chemical class C[SiH]([SiH3])Cl KQHIGRPLCKIXNJ-UHFFFAOYSA-N 0.000 description 1
- 125000000068 chlorophenyl group Chemical group 0.000 description 1
- 238000004140 cleaning Methods 0.000 description 1
- 238000011109 contamination Methods 0.000 description 1
- 239000000110 cooling liquid Substances 0.000 description 1
- 239000000498 cooling water Substances 0.000 description 1
- 230000003247 decreasing effect Effects 0.000 description 1
- OSXYHAQZDCICNX-UHFFFAOYSA-N dichloro(diphenyl)silane Chemical compound C=1C=CC=CC=1[Si](Cl)(Cl)C1=CC=CC=C1 OSXYHAQZDCICNX-UHFFFAOYSA-N 0.000 description 1
- KTQYJQFGNYHXMB-UHFFFAOYSA-N dichloro(methyl)silicon Chemical compound C[Si](Cl)Cl KTQYJQFGNYHXMB-UHFFFAOYSA-N 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 125000001183 hydrocarbyl group Chemical group 0.000 description 1
- 239000012535 impurity Substances 0.000 description 1
- 238000009413 insulation Methods 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 239000010687 lubricating oil Substances 0.000 description 1
- 229940050176 methyl chloride Drugs 0.000 description 1
- 239000005048 methyldichlorosilane Substances 0.000 description 1
- 238000000465 moulding Methods 0.000 description 1
- 238000006386 neutralization reaction Methods 0.000 description 1
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 1
- 239000005054 phenyltrichlorosilane Substances 0.000 description 1
- 229920000548 poly(silane) polymer Polymers 0.000 description 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 239000000376 reactant Substances 0.000 description 1
- 238000011084 recovery Methods 0.000 description 1
- 230000001105 regulatory effect Effects 0.000 description 1
- 150000004756 silanes Chemical class 0.000 description 1
- 239000005049 silicon tetrachloride Substances 0.000 description 1
- 229920002545 silicone oil Polymers 0.000 description 1
- 229920002379 silicone rubber Polymers 0.000 description 1
- 239000004945 silicone rubber Substances 0.000 description 1
- 150000003384 small molecules Chemical class 0.000 description 1
- 239000012265 solid product Substances 0.000 description 1
- 229920003051 synthetic elastomer Polymers 0.000 description 1
- 239000000057 synthetic resin Substances 0.000 description 1
- 229920003002 synthetic resin Polymers 0.000 description 1
- 239000005061 synthetic rubber Substances 0.000 description 1
- ORVMIVQULIKXCP-UHFFFAOYSA-N trichloro(phenyl)silane Chemical compound Cl[Si](Cl)(Cl)C1=CC=CC=C1 ORVMIVQULIKXCP-UHFFFAOYSA-N 0.000 description 1
Family
ID=
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE954198C (de) | Verfahren zur Herstellung von Organopolysiloxanen durch kontinuierliche Hydrolyse von Organochlorsilanen mit Wasser | |
| EP1988115B1 (de) | Verfahren zur kontinuierlichen Herstellung von Aminoalkylgruppen aufweisenden Organopolysiloxanen | |
| EP0003285B1 (de) | Verfahren zur Herstellung von siliciumfunktionellen Polyorganosiloxanen | |
| DE2229514B2 (de) | Verfahren zur Förderung von Kondensations- und/oder Äquilibrierungsreaktionen von Organosiliciumverbindungen | |
| DE1283238B (de) | Verfahren zur Herstellung von Hydroxyalkyloxyalkylsiloxanen | |
| DE3425067C1 (de) | Verfahren und Vorrichtung zur kontinuierlichen Herstellung von Alkoxypolysiloxanen | |
| DE2148669C3 (de) | Verfahren zur Herstellung von Organosiloxanen | |
| EP2050777B1 (de) | Mehrstufiges Verfahren zur Herstellung von Aminoalkylgruppen aufweisenden Organopolysiloxanen | |
| DE3231196A1 (de) | Verfahren zum hydrolysieren von organochlorsilanen | |
| DE2908249A1 (de) | Verfahren zur herstellung von octamethylcyclotetrasiloxan | |
| DE69221667T2 (de) | Einstufiges Verfahren zur Herstellung von Siloxanen, wobei wasserfreie Chlorwasserstoff freigesetzt wird | |
| DE2521742B2 (de) | Verfahren zur Herstellung von Organosiloxanen | |
| DE69634557T2 (de) | Katalysatoren für Redistribution von Organosiloxan-Polymeren | |
| DE3146526C2 (enrdf_load_stackoverflow) | ||
| DE69922127T2 (de) | Verfahren zur Herstellung von Epoxygruppen enthaltenden Organosiloxanen oder Organosilanen | |
| EP0115772B1 (de) | Verfahren zur Spaltung von Organosiloxanen und deren Produkte und Anwendungen | |
| DE2559603A1 (de) | Verfahren zur erhoehung des molekulargewichts eines polyorganosiloxans | |
| EP0524526B1 (de) | Verfahren zur Herstellung von Organosiloxanen | |
| DE1294377B (de) | Verfahren zur Herstellung von hitzestabilen Pentahalogenphenylaethylsiliciumverbindungen | |
| EP0258640A1 (de) | Verfahren zur Ketten-stabilisierung von Organo-polysiloxanen | |
| DEG0011474MA (enrdf_load_stackoverflow) | ||
| DE2557624A1 (de) | Verfahren zur herstellung von organosiloxanen | |
| DE69727288T2 (de) | Verfahren zur Herstellung von hochreine, verzweigte, flüssige Phenylsiloxane | |
| DE1268143B (de) | Verfahren zur Herstellung von Chlormethylarylsilanen und Chlormethylaralkylsilanen sowie der entsprechenden Siloxane | |
| DE1420470A1 (de) | Verfahren zur Herstellung von carbalkoxyalkylhaltigen Organopolysiloxanen |