DEF0015568MA - - Google Patents
Info
- Publication number
- DEF0015568MA DEF0015568MA DEF0015568MA DE F0015568M A DEF0015568M A DE F0015568MA DE F0015568M A DEF0015568M A DE F0015568MA
- Authority
- DE
- Germany
- Prior art keywords
- chlorine
- carbon tetrachloride
- chloromethyl
- solution
- tetraalkylated
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Active
Links
- 239000000460 chlorine Substances 0.000 claims description 16
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 10
- 229910052801 chlorine Inorganic materials 0.000 claims description 10
- 229910052757 nitrogen Inorganic materials 0.000 claims description 8
- 150000001412 amines Chemical class 0.000 claims description 5
- 230000007717 exclusion Effects 0.000 claims description 3
- 238000000034 method Methods 0.000 claims description 3
- 125000004433 nitrogen atom Chemical group N* 0.000 claims description 3
- 239000002904 solvent Substances 0.000 claims description 3
- 125000000623 heterocyclic group Chemical group 0.000 claims description 2
- RTWNYYOXLSILQN-UHFFFAOYSA-N methanediamine Chemical class NCN RTWNYYOXLSILQN-UHFFFAOYSA-N 0.000 claims description 2
- 125000000217 alkyl group Chemical group 0.000 claims 1
- 125000004218 chloromethyl group Chemical group [H]C([H])(Cl)* 0.000 claims 1
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims 1
- VZGDMQKNWNREIO-UHFFFAOYSA-N tetrachloromethane Chemical compound ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 description 22
- 238000006243 chemical reaction Methods 0.000 description 4
- WSFSSNUMVMOOMR-UHFFFAOYSA-N Formaldehyde Chemical compound O=C WSFSSNUMVMOOMR-UHFFFAOYSA-N 0.000 description 3
- -1 chloromethyl diethyl amine Chemical compound 0.000 description 3
- 150000001875 compounds Chemical class 0.000 description 3
- 238000001816 cooling Methods 0.000 description 3
- 239000013078 crystal Substances 0.000 description 3
- 150000004985 diamines Chemical class 0.000 description 3
- 230000007062 hydrolysis Effects 0.000 description 3
- 238000006460 hydrolysis reaction Methods 0.000 description 3
- 239000000047 product Substances 0.000 description 3
- 239000000126 substance Substances 0.000 description 3
- IYMYHZHCOOWPGK-UHFFFAOYSA-N 1-chloro-n,n-dimethylmethanamine Chemical compound CN(C)CCl IYMYHZHCOOWPGK-UHFFFAOYSA-N 0.000 description 2
- ROSDSFDQCJNGOL-UHFFFAOYSA-N Dimethylamine Chemical compound CNC ROSDSFDQCJNGOL-UHFFFAOYSA-N 0.000 description 2
- RAJISUUPOAJLEQ-UHFFFAOYSA-N chloromethanamine Chemical class NCCl RAJISUUPOAJLEQ-UHFFFAOYSA-N 0.000 description 2
- VGIVLIHKENZQHQ-UHFFFAOYSA-N n,n,n',n'-tetramethylmethanediamine Chemical compound CN(C)CN(C)C VGIVLIHKENZQHQ-UHFFFAOYSA-N 0.000 description 2
- 239000002244 precipitate Substances 0.000 description 2
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 2
- CPEONABTMRSIKA-UHFFFAOYSA-N 1,4$l^{2}-oxazinane Chemical compound C1COCC[N]1 CPEONABTMRSIKA-UHFFFAOYSA-N 0.000 description 1
- RQYKSYJVWNUSHW-UHFFFAOYSA-N 1-(chloromethyl)piperidine Chemical compound ClCN1CCCCC1 RQYKSYJVWNUSHW-UHFFFAOYSA-N 0.000 description 1
- LRKYLKBLUJXTFL-UHFFFAOYSA-N 1-(piperidin-1-ylmethyl)piperidine Chemical compound C1CCCCN1CN1CCCCC1 LRKYLKBLUJXTFL-UHFFFAOYSA-N 0.000 description 1
- QWZONZYNHJSSDY-UHFFFAOYSA-N 1-bromo-n,n-dimethylmethanamine Chemical group CN(C)CBr QWZONZYNHJSSDY-UHFFFAOYSA-N 0.000 description 1
- CIQJWKNJDQKPPO-UHFFFAOYSA-N 1-chloropiperidine Chemical compound ClN1CCCCC1 CIQJWKNJDQKPPO-UHFFFAOYSA-N 0.000 description 1
- XWKNMWGIOZCUKH-UHFFFAOYSA-N C(C1=CC=CC=C1)N(CCl)CC1=CC=CC=C1 Chemical compound C(C1=CC=CC=C1)N(CCl)CC1=CC=CC=C1 XWKNMWGIOZCUKH-UHFFFAOYSA-N 0.000 description 1
- SNRUBQQJIBEYMU-UHFFFAOYSA-N Dodecane Natural products CCCCCCCCCCCC SNRUBQQJIBEYMU-UHFFFAOYSA-N 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 1
- 150000003863 ammonium salts Chemical group 0.000 description 1
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 239000006227 byproduct Substances 0.000 description 1
- YIYQCBWKAHIVOF-UHFFFAOYSA-N chloromethyl methyl sulfate Chemical compound COS(=O)(=O)OCCl YIYQCBWKAHIVOF-UHFFFAOYSA-N 0.000 description 1
- 238000003776 cleavage reaction Methods 0.000 description 1
- ATDGTVJJHBUTRL-UHFFFAOYSA-N cyanogen bromide Chemical compound BrC#N ATDGTVJJHBUTRL-UHFFFAOYSA-N 0.000 description 1
- 125000002704 decyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- HPNMFZURTQLUMO-UHFFFAOYSA-N diethylamine Chemical compound CCNCC HPNMFZURTQLUMO-UHFFFAOYSA-N 0.000 description 1
- 238000004508 fractional distillation Methods 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 239000013067 intermediate product Substances 0.000 description 1
- 238000002955 isolation Methods 0.000 description 1
- WSFSSNUMVMOOMR-NJFSPNSNSA-N methanone Chemical compound O=[14CH2] WSFSSNUMVMOOMR-NJFSPNSNSA-N 0.000 description 1
- MBELUIWNSOZTSD-UHFFFAOYSA-N n,n'-dibenzyl-n,n'-dimethylmethanediamine Chemical compound C=1C=CC=CC=1CN(C)CN(C)CC1=CC=CC=C1 MBELUIWNSOZTSD-UHFFFAOYSA-N 0.000 description 1
- KFSATLCGQPCVMU-UHFFFAOYSA-N n,n,n',n'-tetra(propan-2-yl)methanediamine Chemical compound CC(C)N(C(C)C)CN(C(C)C)C(C)C KFSATLCGQPCVMU-UHFFFAOYSA-N 0.000 description 1
- UNEXJVCWJSHFNN-UHFFFAOYSA-N n,n,n',n'-tetraethylmethanediamine Chemical compound CCN(CC)CN(CC)CC UNEXJVCWJSHFNN-UHFFFAOYSA-N 0.000 description 1
- ZBUQPAJRQXISTC-UHFFFAOYSA-N n-(chloromethyl)-n-ethylethanamine Chemical compound CCN(CC)CCl ZBUQPAJRQXISTC-UHFFFAOYSA-N 0.000 description 1
- LCOAWTFPNJRXLH-UHFFFAOYSA-N n-(chloromethyl)-n-propan-2-ylpropan-2-amine Chemical compound CC(C)N(CCl)C(C)C LCOAWTFPNJRXLH-UHFFFAOYSA-N 0.000 description 1
- HKGNFFDTYLFGTE-UHFFFAOYSA-N n-(chloromethyl)-n-propylpropan-1-amine Chemical compound CCCN(CCl)CCC HKGNFFDTYLFGTE-UHFFFAOYSA-N 0.000 description 1
- XKFSGOVGQYHLCK-UHFFFAOYSA-N n-butyl-n-(chloromethyl)butan-1-amine Chemical compound CCCCN(CCl)CCCC XKFSGOVGQYHLCK-UHFFFAOYSA-N 0.000 description 1
- 150000002923 oximes Chemical class 0.000 description 1
- 238000010992 reflux Methods 0.000 description 1
- 230000007017 scission Effects 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
Family
ID=
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2203837C3 (de) | Verfahren zur Herstellung von Benzylphosphonaten | |
| DE1643227A1 (de) | Aryl-substituierte aliphatische tertiaere Amine | |
| DEF0015568MA (OSRAM) | ||
| DE951269C (de) | Verfahren zur Herstellung von Chlormethylaminen | |
| DE1543984A1 (de) | Verfahren zur Herstellung von chemischen Verbindungen | |
| DE847900C (de) | Verfahren zur Herstellung von mindestens eine AEthergruppe enthaltenden tertiaeren und quaternaeren Diaminen | |
| DE1077214B (de) | Verfahren zur Herstellung stickstoffhaltiger monomerer organischer Phosphine | |
| DE1670907B2 (de) | N-disubstituierte 3-amino-1,2benzisothiazole und verfahren in ihrer herstellung | |
| DE963427C (de) | Verfahren zur Herstellung neuer anaesthetisch wirkender Aminocarbonsaeureamide | |
| DE1568622A1 (de) | Verfahren zur Herstellung neuartiger Phenolderivate | |
| DE688675C (de) | Verfahren zur Herstellung von den Morpholinkern enthaltenden Polyaminen | |
| DE1184758B (de) | Verfahren zur Herstellung von Azo-bis-alkylphosphonaten und den entsprechenden Saeuren | |
| DE1097995B (de) | Verfahren zur Herstellung von Phenthiazinderivaten | |
| DE2617967C3 (de) | Verfahren zur Herstellung von 2,4-Diamino-5-benzylpyrimidinen | |
| CH634819A5 (en) | Process for the preparation of 2-[N-(2-hydroxyethyl)-N-lower alkyl-amino methyl]-benzhydrols. | |
| DE938013C (de) | Verfahren zur Herstellung von 1-Oxyacyclobutanverbindungen | |
| DE1445659C (de) | Pyndylphosphorverbindungen und Verfahren zu ihrer Herstellung | |
| DE1272286C2 (de) | Verfahren zur Herstellung von N-substituierten aliphatischen Thiocarbonsaeureamiden | |
| DE1075609B (de) | Verfahren zur Herstellung neuer O - Aryl O - methylthiophosphorsaureamidester | |
| DE1254634B (de) | Verfahren zur Herstellung von 1-Aryl-hydropyrazolen | |
| DE1445074A1 (de) | Verfahren zur Herstellung von therapeutisch wertvollen tertiaeren Aminen | |
| DE1203790B (de) | Verfahren zur Herstellung von N-substituierten beta-Aminoaethyl-arylketonpikraten | |
| DE1124039B (de) | Verfahren zur Herstellung von tertiaeren Aminen | |
| DE1092019B (de) | Verfahren zur N-Monoalkylierung des Piperazins | |
| DE2044926A1 (de) | Neue Azathiaxanthendenvate und Verfahren zu ihrer Herstellung |