DEF0010747MA - - Google Patents
Info
- Publication number
- DEF0010747MA DEF0010747MA DEF0010747MA DE F0010747M A DEF0010747M A DE F0010747MA DE F0010747M A DEF0010747M A DE F0010747MA
- Authority
- DE
- Germany
- Prior art keywords
- ester
- esters
- derivatives
- radicals
- aromatic
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Active
Links
- 150000002148 esters Chemical class 0.000 claims description 9
- -1 ester amides Chemical class 0.000 claims description 8
- 238000000034 method Methods 0.000 claims description 7
- ACVYVLVWPXVTIT-UHFFFAOYSA-N phosphinic acid Chemical class O[PH2]=O ACVYVLVWPXVTIT-UHFFFAOYSA-N 0.000 claims description 3
- YNJBWRMUSHSURL-UHFFFAOYSA-N trichloroacetic acid Chemical compound OC(=O)C(Cl)(Cl)Cl YNJBWRMUSHSURL-UHFFFAOYSA-N 0.000 claims description 3
- 238000006053 organic reaction Methods 0.000 claims 1
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 6
- 238000006243 chemical reaction Methods 0.000 description 4
- 239000002253 acid Substances 0.000 description 3
- 150000007513 acids Chemical class 0.000 description 3
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 2
- LSDPWZHWYPCBBB-UHFFFAOYSA-N Methanethiol Chemical compound SC LSDPWZHWYPCBBB-UHFFFAOYSA-N 0.000 description 2
- 238000009835 boiling Methods 0.000 description 2
- 239000007795 chemical reaction product Substances 0.000 description 2
- HRYZWHHZPQKTII-UHFFFAOYSA-N chloroethane Chemical compound CCCl HRYZWHHZPQKTII-UHFFFAOYSA-N 0.000 description 2
- 150000001875 compounds Chemical class 0.000 description 2
- JXTHNDFMNIQAHM-UHFFFAOYSA-N dichloroacetic acid Chemical compound OC(=O)C(Cl)Cl JXTHNDFMNIQAHM-UHFFFAOYSA-N 0.000 description 2
- 229960005215 dichloroacetic acid Drugs 0.000 description 2
- 229960003750 ethyl chloride Drugs 0.000 description 2
- 238000003756 stirring Methods 0.000 description 2
- KNIUHBNRWZGIQQ-UHFFFAOYSA-N 7-diethoxyphosphinothioyloxy-4-methylchromen-2-one Chemical compound CC1=CC(=O)OC2=CC(OP(=S)(OCC)OCC)=CC=C21 KNIUHBNRWZGIQQ-UHFFFAOYSA-N 0.000 description 1
- OSDWBNJEKMUWAV-UHFFFAOYSA-N Allyl chloride Chemical compound ClCC=C OSDWBNJEKMUWAV-UHFFFAOYSA-N 0.000 description 1
- 241001124076 Aphididae Species 0.000 description 1
- OAICVXFJPJFONN-UHFFFAOYSA-N Phosphorus Chemical compound [P] OAICVXFJPJFONN-UHFFFAOYSA-N 0.000 description 1
- 241001454295 Tetranychidae Species 0.000 description 1
- 150000001242 acetic acid derivatives Chemical class 0.000 description 1
- 150000001348 alkyl chlorides Chemical class 0.000 description 1
- 125000000217 alkyl group Chemical group 0.000 description 1
- 150000001408 amides Chemical class 0.000 description 1
- 125000003118 aryl group Chemical group 0.000 description 1
- 150000005840 aryl radicals Chemical class 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 150000001723 carbon free-radicals Chemical class 0.000 description 1
- 125000003963 dichloro group Chemical group Cl* 0.000 description 1
- 239000012442 inert solvent Substances 0.000 description 1
- 230000000749 insecticidal effect Effects 0.000 description 1
- HVTICUPFWKNHNG-UHFFFAOYSA-N iodoethane Chemical compound CCI HVTICUPFWKNHNG-UHFFFAOYSA-N 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 125000003854 p-chlorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1Cl 0.000 description 1
- 239000000575 pesticide Substances 0.000 description 1
- CGNKSELPNJJTSM-UHFFFAOYSA-N phenylphosphonous acid Chemical compound OP(O)C1=CC=CC=C1 CGNKSELPNJJTSM-UHFFFAOYSA-N 0.000 description 1
- 150000003003 phosphines Chemical class 0.000 description 1
- 150000003008 phosphonic acid esters Chemical class 0.000 description 1
- 150000003013 phosphoric acid derivatives Chemical class 0.000 description 1
- 150000003014 phosphoric acid esters Chemical class 0.000 description 1
- 229910052698 phosphorus Inorganic materials 0.000 description 1
- 239000011574 phosphorus Substances 0.000 description 1
- 239000004476 plant protection product Substances 0.000 description 1
- 239000000047 product Substances 0.000 description 1
- 150000003254 radicals Chemical class 0.000 description 1
- 239000002904 solvent Substances 0.000 description 1
Family
ID=
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| EP0391329B1 (de) | Verfahren zur Herstellung von Alkylphosphonigsäurdiestern und/oder Dialkylphosphinigsäureestern | |
| EP0136543B1 (de) | Verfahren zur Herstellung von Nukleosidalkyl-, -aralkyl- und -arylphosphoniten und -phosphonaten | |
| DE2526689A1 (de) | Verfahren zur herstellung von 1,2-oxa-phospholanen | |
| DEF0010747MA (enExample) | ||
| DE1543531A1 (de) | Verfahren zur Herstellung von halogenierten Estern der Phosphorsaeuren | |
| DE1206425B (de) | Verfahren zur Herstellung von Phosphorsaeureestern | |
| DE942988C (de) | Verfahren zur Herstellung von Thiolphosphorsaeuretriestern | |
| DE954244C (de) | Verfahren zur Herstellung von Derivaten aromatischer Phosphonsaeuren | |
| DE1183494B (de) | Verfahren zur Herstellung von Phosphor-, Phosphon- bzw. Thionophosphor-, -phosphonsaeureestern | |
| EP0227918A1 (de) | Verfahren zur Herstellung von Phosphonsäuredichloriden | |
| EP0144743B1 (de) | Verfahren zur Herstellung organischer Chlorphosphane | |
| DE1445659C (de) | Pyndylphosphorverbindungen und Verfahren zu ihrer Herstellung | |
| DE1153746B (de) | Verfahren zur Herstellung von Thiophosphor-(-phosphon, -phosphin)- bzw. Dithiophosphor-(-phosphon, -phosphin)-saeureestern | |
| DE1171427B (de) | Verfahren zur Herstellung von Thiophosphor-, -phosphon- oder -phosphinsaeureestern bzw. -esteramiden | |
| DE2062120C3 (de) | 2-Chloräthylphosphonsäurediamide und diese enthaltende Mittel | |
| AT216015B (de) | Verfahren zur Herstellung neuer organischer Phosphorverbindungen | |
| DEF0010745MA (enExample) | ||
| DE1094745B (de) | Verfahren zur Herstellung von neuen Dithiopyrophosphonsaeurediamiden | |
| EP0329595A2 (de) | Verfahren zur Herstellung von Alkenylphosphinsäurealkylestern | |
| EP0210452A2 (de) | Verfahren zur Herstellung partiell veresterter Siliciumhalogenide | |
| DE1257153B (de) | Verfahren zur Herstellung von neuen basischen Estern der phosphorigen, phosphonigen oder phosphinigen Saeure | |
| DEF0013447MA (enExample) | ||
| DE1143512B (de) | Verfahren zur Herstellung von Phosphon- bzw. Thiophosphonsaeureestern | |
| DE1234207B (de) | Verfahren zur Herstellung von insektiziden Phosphorsaeuretriestern | |
| DE2357678A1 (de) | Verfahren zur herstellung von alkenphosphonsaeurechloriden und alkenphosphinsaeurechloriden |