DEF0010673MA - - Google Patents
Info
- Publication number
- DEF0010673MA DEF0010673MA DEF0010673MA DE F0010673M A DEF0010673M A DE F0010673MA DE F0010673M A DEF0010673M A DE F0010673MA
- Authority
- DE
- Germany
- Prior art keywords
- ester
- general formula
- heated
- esters
- acid
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Active
Links
- 150000002148 esters Chemical class 0.000 claims description 14
- 229940042400 direct acting antivirals phosphonic acid derivative Drugs 0.000 claims description 4
- 150000001875 compounds Chemical class 0.000 claims description 3
- 229960005215 dichloroacetic acid Drugs 0.000 claims description 3
- 238000000034 method Methods 0.000 claims description 3
- 150000003007 phosphonic acid derivatives Chemical class 0.000 claims description 3
- 150000007970 thio esters Chemical class 0.000 claims description 3
- YNJBWRMUSHSURL-UHFFFAOYSA-N trichloroacetic acid Chemical class OC(=O)C(Cl)(Cl)Cl YNJBWRMUSHSURL-UHFFFAOYSA-N 0.000 claims description 3
- 125000003963 dichloro group Chemical group Cl* 0.000 claims description 2
- 238000002360 preparation method Methods 0.000 claims description 2
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 7
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 6
- 239000012043 crude product Substances 0.000 description 6
- 238000009835 boiling Methods 0.000 description 4
- 239000000460 chlorine Substances 0.000 description 4
- 239000002253 acid Substances 0.000 description 3
- -1 aromatic mercaptans Chemical group 0.000 description 3
- 230000000694 effects Effects 0.000 description 3
- NGNBDVOYPDDBFK-UHFFFAOYSA-N 2-[2,4-di(pentan-2-yl)phenoxy]acetyl chloride Chemical compound CCCC(C)C1=CC=C(OCC(Cl)=O)C(C(C)CCC)=C1 NGNBDVOYPDDBFK-UHFFFAOYSA-N 0.000 description 2
- OAICVXFJPJFONN-UHFFFAOYSA-N Phosphorus Chemical compound [P] OAICVXFJPJFONN-UHFFFAOYSA-N 0.000 description 2
- 150000001348 alkyl chlorides Chemical class 0.000 description 2
- 150000001408 amides Chemical class 0.000 description 2
- 238000005660 chlorination reaction Methods 0.000 description 2
- JXTHNDFMNIQAHM-UHFFFAOYSA-N dichloroacetic acid Chemical compound OC(=O)C(Cl)Cl JXTHNDFMNIQAHM-UHFFFAOYSA-N 0.000 description 2
- 125000003827 glycol group Chemical group 0.000 description 2
- WGCNASOHLSPBMP-UHFFFAOYSA-N hydroxyacetaldehyde Natural products OCC=O WGCNASOHLSPBMP-UHFFFAOYSA-N 0.000 description 2
- 239000000575 pesticide Substances 0.000 description 2
- 239000011574 phosphorus Substances 0.000 description 2
- 229910052698 phosphorus Inorganic materials 0.000 description 2
- 241001124076 Aphididae Species 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- XTHFKEDIFFGKHM-UHFFFAOYSA-N Dimethoxyethane Chemical compound COCCOC XTHFKEDIFFGKHM-UHFFFAOYSA-N 0.000 description 1
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 1
- 229910019142 PO4 Inorganic materials 0.000 description 1
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 1
- 125000001931 aliphatic group Chemical group 0.000 description 1
- 229910052801 chlorine Inorganic materials 0.000 description 1
- QKIUAMUSENSFQQ-UHFFFAOYSA-N dimethylazanide Chemical compound C[N-]C QKIUAMUSENSFQQ-UHFFFAOYSA-N 0.000 description 1
- SJMLNDPIJZBEKY-UHFFFAOYSA-N ethyl 2,2,2-trichloroacetate Chemical compound CCOC(=O)C(Cl)(Cl)Cl SJMLNDPIJZBEKY-UHFFFAOYSA-N 0.000 description 1
- QDHCHVWSKUMZDZ-UHFFFAOYSA-N ethyl dihydrogen phosphite Chemical compound CCOP(O)O QDHCHVWSKUMZDZ-UHFFFAOYSA-N 0.000 description 1
- 239000012442 inert solvent Substances 0.000 description 1
- 230000000749 insecticidal effect Effects 0.000 description 1
- 239000003921 oil Substances 0.000 description 1
- 239000003973 paint Substances 0.000 description 1
- NBIIXXVUZAFLBC-UHFFFAOYSA-K phosphate Chemical compound [O-]P([O-])([O-])=O NBIIXXVUZAFLBC-UHFFFAOYSA-K 0.000 description 1
- 239000010452 phosphate Substances 0.000 description 1
- FAIAAWCVCHQXDN-UHFFFAOYSA-N phosphorus trichloride Chemical compound ClP(Cl)Cl FAIAAWCVCHQXDN-UHFFFAOYSA-N 0.000 description 1
- 239000000047 product Substances 0.000 description 1
- ISIJQEHRDSCQIU-UHFFFAOYSA-N tert-butyl 2,7-diazaspiro[4.5]decane-7-carboxylate Chemical compound C1N(C(=O)OC(C)(C)C)CCCC11CNCC1 ISIJQEHRDSCQIU-UHFFFAOYSA-N 0.000 description 1
Family
ID=
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DEF0010673MA (OSRAM) | ||
| DE1131671B (de) | Verfahren zur Herstellung von Vinylphosphinen | |
| DE876691C (de) | Verfahren zur Herstellung von Dithiophosphorsaeureestern | |
| DE1543531A1 (de) | Verfahren zur Herstellung von halogenierten Estern der Phosphorsaeuren | |
| DE2643442A1 (de) | Verfahren zur herstellung von phosphitchloriden | |
| DE2132962C3 (de) | Verfahren zur Herstellung von 2-Chloräthanphosphonsäuredichlorid | |
| DE3535149A1 (de) | Verfahren zur herstellung von chlorphosphanen und thiophosphinsaeurechloriden sowie neue 9-chlor-9-thioxo-9-phosphabicyclononane | |
| DE2129583B2 (de) | Verfahren zur Herstellung von Phosphinsäureanhydriden | |
| EP0074582B1 (de) | Verfahren zur Herstellung von Dialkylphosphinsäurehalogeniden | |
| EP0122587B1 (de) | Verfahren zur Herstellung organischer Chlorphosphane | |
| DEF0010679MA (OSRAM) | ||
| DE1668103C3 (de) | Verfahren zur Herstellung von Chloralkyl-S-alkyl-bzw. -aryl-(di)thiolphosphorsäurediesteramiden bzw. -ersterdiamiden | |
| DE1199264B (de) | Verfahren zur Herstellung von Phospholin-derivaten | |
| DE1668040C3 (de) | Verfahren zur Herstellung von Bromalkyl-S-alkyl-bzw.-aryHdi)thiolphosphorsäurediester-bzw.-esteramidchloriden | |
| DE2035073C3 (de) | Verfahren zur Herstellung von Salzen der O-Alkyl-N-monoalkylamidodithiophosphorsäure | |
| DE1593849C3 (OSRAM) | ||
| AT200157B (de) | Verfahren zur Herstellung von neuen Thiophosphorsäureestern | |
| DE1153746B (de) | Verfahren zur Herstellung von Thiophosphor-(-phosphon, -phosphin)- bzw. Dithiophosphor-(-phosphon, -phosphin)-saeureestern | |
| DE1214681B (de) | Verfahren zur Herstellung von Phosphonsaeureestern | |
| DE3425701A1 (de) | Verfahren zur herstellung von chlorierten phosphorylmethylcarbonyl-derivaten und neue zwischenprodukte zu ihrer herstellung | |
| DE2357678A1 (de) | Verfahren zur herstellung von alkenphosphonsaeurechloriden und alkenphosphinsaeurechloriden | |
| DE2210485C3 (de) | Phosphorderivate des Chlorformamidins und Verfahren zu deren Herstellung | |
| DEF0010747MA (OSRAM) | ||
| DEF0010745MA (OSRAM) | ||
| DE1053521B (de) | Verfahren zur Herstellung von cyclischen Thiophosphorsaeureesterhalogeniden |