DEC0005778MA - - Google Patents
Info
- Publication number
- DEC0005778MA DEC0005778MA DEC0005778MA DE C0005778M A DEC0005778M A DE C0005778MA DE C0005778M A DEC0005778M A DE C0005778MA
- Authority
- DE
- Germany
- Prior art keywords
- acid
- ester
- esterification
- vol
- yield
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Active
Links
- OFOBLEOULBTSOW-UHFFFAOYSA-N Malonic acid Chemical compound OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 claims description 18
- MLIREBYILWEBDM-UHFFFAOYSA-N cyanoacetic acid Chemical compound OC(=O)CC#N MLIREBYILWEBDM-UHFFFAOYSA-N 0.000 claims description 18
- 230000032050 esterification Effects 0.000 claims description 11
- 238000005886 esterification reaction Methods 0.000 claims description 11
- KEQGZUUPPQEDPF-UHFFFAOYSA-N 1,3-dichloro-5,5-dimethylimidazolidine-2,4-dione Chemical compound CC1(C)N(Cl)C(=O)N(Cl)C1=O KEQGZUUPPQEDPF-UHFFFAOYSA-N 0.000 claims description 8
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 claims description 8
- XTHPWXDJESJLNJ-UHFFFAOYSA-N chlorosulfonic acid Substances OS(Cl)(=O)=O XTHPWXDJESJLNJ-UHFFFAOYSA-N 0.000 claims description 8
- 238000007127 saponification reaction Methods 0.000 claims description 7
- 239000003054 catalyst Substances 0.000 claims description 6
- 238000000034 method Methods 0.000 claims description 6
- LTMRRSWNXVJMBA-UHFFFAOYSA-L 2,2-diethylpropanedioate Chemical compound CCC(CC)(C([O-])=O)C([O-])=O LTMRRSWNXVJMBA-UHFFFAOYSA-L 0.000 claims description 5
- 239000003795 chemical substances by application Substances 0.000 claims 1
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 9
- MUBZPKHOEPUJKR-UHFFFAOYSA-N Oxalic acid Chemical compound OC(=O)C(O)=O MUBZPKHOEPUJKR-UHFFFAOYSA-N 0.000 description 6
- 150000002148 esters Chemical class 0.000 description 6
- 238000006243 chemical reaction Methods 0.000 description 5
- FOCAUTSVDIKZOP-UHFFFAOYSA-N chloroacetic acid Chemical compound OC(=O)CCl FOCAUTSVDIKZOP-UHFFFAOYSA-N 0.000 description 5
- VZCYOOQTPOCHFL-OWOJBTEDSA-N Fumaric acid Chemical compound OC(=O)\C=C\C(O)=O VZCYOOQTPOCHFL-OWOJBTEDSA-N 0.000 description 4
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 4
- 235000019441 ethanol Nutrition 0.000 description 4
- -1 malonic acid ester Chemical class 0.000 description 4
- 235000002639 sodium chloride Nutrition 0.000 description 4
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 3
- 239000002253 acid Substances 0.000 description 3
- 238000004519 manufacturing process Methods 0.000 description 3
- 239000000203 mixture Substances 0.000 description 3
- 150000003839 salts Chemical class 0.000 description 3
- 239000000243 solution Substances 0.000 description 3
- 239000002904 solvent Substances 0.000 description 3
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonia chloride Chemical compound [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 2
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- IYXGSMUGOJNHAZ-UHFFFAOYSA-N Ethyl malonate Chemical compound CCOC(=O)CC(=O)OCC IYXGSMUGOJNHAZ-UHFFFAOYSA-N 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- GWFWWCYVZMFJIV-UHFFFAOYSA-N [Ca].C(CC(=O)O)(=O)O Chemical compound [Ca].C(CC(=O)O)(=O)O GWFWWCYVZMFJIV-UHFFFAOYSA-N 0.000 description 2
- NLBFDFIZQKPFKP-UHFFFAOYSA-N [Na].C(#N)CC(=O)O Chemical compound [Na].C(#N)CC(=O)O NLBFDFIZQKPFKP-UHFFFAOYSA-N 0.000 description 2
- 239000008346 aqueous phase Substances 0.000 description 2
- 238000009835 boiling Methods 0.000 description 2
- 238000001816 cooling Methods 0.000 description 2
- 238000001704 evaporation Methods 0.000 description 2
- 230000008020 evaporation Effects 0.000 description 2
- 239000001530 fumaric acid Substances 0.000 description 2
- 235000006408 oxalic acid Nutrition 0.000 description 2
- 239000011833 salt mixture Substances 0.000 description 2
- JAUCIKCNYHCSIR-UHFFFAOYSA-M sodium;2-cyanoacetate Chemical compound [Na+].[O-]C(=O)CC#N JAUCIKCNYHCSIR-UHFFFAOYSA-M 0.000 description 2
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 2
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 2
- UXVMQQNJUSDDNG-UHFFFAOYSA-L Calcium chloride Chemical compound [Cl-].[Cl-].[Ca+2] UXVMQQNJUSDDNG-UHFFFAOYSA-L 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 1
- QIIGWXFEWHTAQM-WXXKFALUSA-N OC(=O)CCC(O)=O.OC(=O)\C=C\C(O)=O.OC(=O)C(O)C(O)C(O)=O Chemical compound OC(=O)CCC(O)=O.OC(=O)\C=C\C(O)=O.OC(=O)C(O)C(O)C(O)=O QIIGWXFEWHTAQM-WXXKFALUSA-N 0.000 description 1
- 235000019270 ammonium chloride Nutrition 0.000 description 1
- BFNBIHQBYMNNAN-UHFFFAOYSA-N ammonium sulfate Chemical compound N.N.OS(O)(=O)=O BFNBIHQBYMNNAN-UHFFFAOYSA-N 0.000 description 1
- 229910052921 ammonium sulfate Inorganic materials 0.000 description 1
- 235000011130 ammonium sulphate Nutrition 0.000 description 1
- 238000013459 approach Methods 0.000 description 1
- 239000001110 calcium chloride Substances 0.000 description 1
- 229910001628 calcium chloride Inorganic materials 0.000 description 1
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 1
- KXZJHVJKXJLBKO-UHFFFAOYSA-N chembl1408157 Chemical compound N=1C2=CC=CC=C2C(C(=O)O)=CC=1C1=CC=C(O)C=C1 KXZJHVJKXJLBKO-UHFFFAOYSA-N 0.000 description 1
- 229940106681 chloroacetic acid Drugs 0.000 description 1
- 238000000354 decomposition reaction Methods 0.000 description 1
- 230000008021 deposition Effects 0.000 description 1
- 150000001991 dicarboxylic acids Chemical class 0.000 description 1
- 238000011031 large-scale manufacturing process Methods 0.000 description 1
- 150000007522 mineralic acids Chemical class 0.000 description 1
- 229910052757 nitrogen Inorganic materials 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- 235000005985 organic acids Nutrition 0.000 description 1
- 239000000825 pharmaceutical preparation Substances 0.000 description 1
- 239000012071 phase Substances 0.000 description 1
- 238000001556 precipitation Methods 0.000 description 1
- 230000035484 reaction time Effects 0.000 description 1
- 239000012266 salt solution Substances 0.000 description 1
- 238000000926 separation method Methods 0.000 description 1
- 239000011780 sodium chloride Substances 0.000 description 1
- FDRCDNZGSXJAFP-UHFFFAOYSA-M sodium chloroacetate Chemical compound [Na+].[O-]C(=O)CCl FDRCDNZGSXJAFP-UHFFFAOYSA-M 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
Family
ID=
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE60226229T2 (de) | Verfahren zur herstellung von carbonsäuren und deren derivaten | |
| DE2721264C2 (de) | Verfahren zur Herstellung von Di-n-propylessigsäure und deren nichttoxischen Alkali- und Erdalkalimetallsalzen | |
| EP0512211A2 (de) | Verfahren zur Herstellung von substituierten Malonesteraniliden und Malonsäure-monoaniliden | |
| DE1793559C3 (de) | Verfahren zur Herstellung von Furan 3 carbonsaureestern Ausscheidung aus 1543804 | |
| EP3655413B1 (de) | Herstellung von glufosinat durch umsetzung von 3-[n-butoxy(methyl)phosphoryl]-1-cyanopropylacetat zu einer mischung aus n-butyl(3-amino-3-cyanopropyl)-methylphosphinat und (3-amino-3-cyanopropyl)-methylphosphinsäure ammoniumsalz | |
| DE3308922A1 (de) | Verfahren zur herstellung von fettsaeureestern der ascorbinsaeure | |
| EP0087585A1 (de) | Verfahren zur Herstellung von 3-Alkoxi-acrylnitrilen | |
| DE2015840B2 (de) | Verfahren zur herstellung von fettsaeuredialkylamiden | |
| DEC0005778MA (enrdf_load_stackoverflow) | ||
| EP0174624B1 (de) | Verfahren zur Herstellung von Milchsäureestern | |
| DE953874C (de) | Verfahren zur Herstellung von Malonsaeurediaethylester | |
| DE2404159C2 (de) | Verfahren zur Herstellung von 2-(4-Alkylphenyl)-propionsäuren und ihren Natrium-oder Kaliumsalzen | |
| DE2721265C2 (de) | Verfahren zur Herstellung von Di- n-propylacetonitril | |
| EP0879813B1 (de) | Verfahren zur Herstellung von Cyclopropancarbonsäuren | |
| DE1643195C (enrdf_load_stackoverflow) | ||
| DE2936416C2 (enrdf_load_stackoverflow) | ||
| DE930686C (de) | Verfahren zur Herstellung von Dehydracetsaeure | |
| DE1958619C3 (de) | Verfahren zur Herstellung substituierter Pyrazine | |
| DE2060329C3 (de) | Verfahren zur Herstellung von substituierten Benzamiden | |
| DE68907146T2 (de) | Verfahren zur Reinigung von D-hydroxyphenoxypropionsäure. | |
| DE969341C (de) | Verfahren zur Herstellung von Terephthalsaeuredimethylester | |
| DE871751C (de) | Verfahren zur Gewinnung des Pentaerythrit-dichlorhydrinmonoschwefligsaeureesters | |
| EP0293752A2 (de) | Verfahren zur Herstellung von E-2-Propyl-2-pentensäure und physiologisch verträglichen Salzen derselben | |
| DE719571C (de) | Verfahren zur Herstellung von Aldehyden und Estern aus Aldehyddiacylaten | |
| DE2606855C2 (de) | Verfahren zur Herstellung von Propionsäure-3,4-dichloranilid |