DEB0030365MA - - Google Patents
Info
- Publication number
- DEB0030365MA DEB0030365MA DE1954B0030365 DEB0030365AZ DEB0030365MA DE B0030365M A DEB0030365M A DE B0030365MA DE 1954B0030365 DE1954B0030365 DE 1954B0030365 DE B0030365A Z DEB0030365A Z DE B0030365AZ DE B0030365M A DEB0030365M A DE B0030365MA
- Authority
- DE
- Germany
- Prior art keywords
- parts
- primer
- resins
- finely divided
- finely
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 238000000576 coating method Methods 0.000 claims description 8
- 229920000642 polymer Polymers 0.000 claims description 8
- 229920005989 resin Polymers 0.000 claims description 8
- 239000011347 resin Substances 0.000 claims description 8
- 239000006185 dispersion Substances 0.000 claims description 4
- 239000000945 filler Substances 0.000 claims description 3
- 239000000049 pigment Substances 0.000 claims description 2
- 239000007787 solid Substances 0.000 claims description 2
- 238000009833 condensation Methods 0.000 claims 1
- 230000005494 condensation Effects 0.000 claims 1
- 239000002966 varnish Substances 0.000 claims 1
- 229920000915 polyvinyl chloride Polymers 0.000 description 6
- 239000004800 polyvinyl chloride Substances 0.000 description 6
- 239000002184 metal Substances 0.000 description 5
- 229910052751 metal Inorganic materials 0.000 description 5
- 239000000243 solution Substances 0.000 description 5
- 239000000126 substance Substances 0.000 description 5
- CXWXQJXEFPUFDZ-UHFFFAOYSA-N tetralin Chemical compound C1=CC=C2CCCCC2=C1 CXWXQJXEFPUFDZ-UHFFFAOYSA-N 0.000 description 5
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 description 4
- LRHPLDYGYMQRHN-UHFFFAOYSA-N N-Butanol Chemical compound CCCCO LRHPLDYGYMQRHN-UHFFFAOYSA-N 0.000 description 4
- WNLRTRBMVRJNCN-UHFFFAOYSA-N adipic acid Chemical compound OC(=O)CCCCC(O)=O WNLRTRBMVRJNCN-UHFFFAOYSA-N 0.000 description 4
- 239000011230 binding agent Substances 0.000 description 4
- 239000011248 coating agent Substances 0.000 description 4
- 150000001875 compounds Chemical class 0.000 description 4
- 239000010410 layer Substances 0.000 description 4
- OEPOKWHJYJXUGD-UHFFFAOYSA-N 2-(3-phenylmethoxyphenyl)-1,3-thiazole-4-carbaldehyde Chemical compound O=CC1=CSC(C=2C=C(OCC=3C=CC=CC=3)C=CC=2)=N1 OEPOKWHJYJXUGD-UHFFFAOYSA-N 0.000 description 3
- WSFSSNUMVMOOMR-UHFFFAOYSA-N Formaldehyde Chemical compound O=C WSFSSNUMVMOOMR-UHFFFAOYSA-N 0.000 description 3
- 229920001807 Urea-formaldehyde Polymers 0.000 description 3
- BZHJMEDXRYGGRV-UHFFFAOYSA-N Vinyl chloride Chemical compound ClC=C BZHJMEDXRYGGRV-UHFFFAOYSA-N 0.000 description 3
- 229920001577 copolymer Polymers 0.000 description 3
- 239000000454 talc Substances 0.000 description 3
- 229910052623 talc Inorganic materials 0.000 description 3
- ZNQVEEAIQZEUHB-UHFFFAOYSA-N 2-ethoxyethanol Chemical compound CCOCCO ZNQVEEAIQZEUHB-UHFFFAOYSA-N 0.000 description 2
- ZJCCRDAZUWHFQH-UHFFFAOYSA-N Trimethylolpropane Chemical compound CCC(CO)(CO)CO ZJCCRDAZUWHFQH-UHFFFAOYSA-N 0.000 description 2
- 239000000853 adhesive Substances 0.000 description 2
- 230000001070 adhesive effect Effects 0.000 description 2
- 235000011037 adipic acid Nutrition 0.000 description 2
- 239000001361 adipic acid Substances 0.000 description 2
- 239000007859 condensation product Substances 0.000 description 2
- 239000002270 dispersing agent Substances 0.000 description 2
- 229910052742 iron Inorganic materials 0.000 description 2
- 239000004922 lacquer Substances 0.000 description 2
- 239000000203 mixture Substances 0.000 description 2
- 238000006116 polymerization reaction Methods 0.000 description 2
- 150000005846 sugar alcohols Polymers 0.000 description 2
- 229920003002 synthetic resin Polymers 0.000 description 2
- 239000000057 synthetic resin Substances 0.000 description 2
- 229920002554 vinyl polymer Polymers 0.000 description 2
- 239000004801 Chlorinated PVC Substances 0.000 description 1
- 229920000877 Melamine resin Polymers 0.000 description 1
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 1
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Chemical compound NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 description 1
- 239000012790 adhesive layer Substances 0.000 description 1
- GZCGUPFRVQAUEE-SLPGGIOYSA-N aldehydo-D-glucose Chemical compound OC[C@@H](O)[C@@H](O)[C@H](O)[C@@H](O)C=O GZCGUPFRVQAUEE-SLPGGIOYSA-N 0.000 description 1
- 229920000180 alkyd Polymers 0.000 description 1
- 238000004873 anchoring Methods 0.000 description 1
- 238000005452 bending Methods 0.000 description 1
- 239000004202 carbamide Substances 0.000 description 1
- 150000001735 carboxylic acids Chemical class 0.000 description 1
- 229920000457 chlorinated polyvinyl chloride Polymers 0.000 description 1
- 239000011247 coating layer Substances 0.000 description 1
- 238000010790 dilution Methods 0.000 description 1
- 239000012895 dilution Substances 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 229920006158 high molecular weight polymer Polymers 0.000 description 1
- 239000000976 ink Substances 0.000 description 1
- 239000001023 inorganic pigment Substances 0.000 description 1
- JEIPFZHSYJVQDO-UHFFFAOYSA-N iron(III) oxide Inorganic materials O=[Fe]O[Fe]=O JEIPFZHSYJVQDO-UHFFFAOYSA-N 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- JDSHMPZPIAZGSV-UHFFFAOYSA-N melamine Chemical compound NC1=NC(N)=NC(N)=N1 JDSHMPZPIAZGSV-UHFFFAOYSA-N 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- 239000003973 paint Substances 0.000 description 1
- 239000002904 solvent Substances 0.000 description 1
- 239000007921 spray Substances 0.000 description 1
- 239000000758 substrate Substances 0.000 description 1
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DEB0030365MA true DEB0030365MA (cg-RX-API-DMAC7.html) | 1956-06-14 |
Family
ID=
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2934485A1 (de) | Harzartige zusammensetzung und ihre verwendung zur elektrotauchlackierung | |
| DE1178161B (de) | Bindemittel in waessriger Verteilung enthaltendes UEberzugsmittel | |
| DE60006183T2 (de) | Härtungsbeschleuniger und Harzzusammensetzung | |
| DE1494525C3 (de) | Härtbare Kunststoffmischungen | |
| DE966281C (de) | Verfahren zum Haerten von Epoxyharzen | |
| DE2213051B2 (de) | Stabile wäßrige Emulsion eines Epoxyharzes | |
| DE1745795B2 (de) | Verfahren zur Herstellung von Epoxy gruppen enthaltenden Reaktions produkten | |
| DE1669243B2 (de) | Wasserdispergiertes Mittel zum Überziehen elektrisch leitender Oberflächen und Verwendung dieses Mittels | |
| DE2606831C3 (de) | Pigmentzubereitungen für Lackbindemittel | |
| DE1929593B2 (de) | Wäßrige Überzugsmittel | |
| DE2262463C2 (de) | Überzugsmittel | |
| DE2314983C2 (de) | Hitzehärtbare Überzugsmittel | |
| DE953897C (de) | Grundiermittel fuer Lackueberzuege auf Basis von Polymerisationsharzen | |
| DE60022673T2 (de) | Tanninfleckenhemmende überzugszusammensetzung | |
| DEB0030365MA (cg-RX-API-DMAC7.html) | ||
| AT392649B (de) | Verwendung von acrylatcopolymerisaten als additive fuer waessrige kationische lacksysteme | |
| WO1992009664A1 (de) | Zweikomponentiges epoxidharz-zinkstaub-grundbeschichtungsmittel für stahlflächen | |
| DE568767C (de) | Lacke, Filme, Kunststoffe u. dgl. | |
| EP1298174A1 (de) | Lackzusammensetzung auf Wasserbasis | |
| DE2123564A1 (de) | Verfahren zur Herstellung von Formkörpern und Überzügen | |
| EP0062226B2 (de) | Verfahren zur Herstellung von wasserverdünnbaren Bindemittellösungen unter Verwendung von Monoalkylglykolethern | |
| DE2142449C2 (de) | Wäßrige Dispersion aus einem nicht-gelierten, in Wasser dispergierbaren Epoxyharz | |
| DE741087C (de) | Gleitlack | |
| WO1983001624A1 (fr) | Composition de vernis et leur utilisation dans les domaines du cuir et des materiaux textiles | |
| DE1950222A1 (de) | UEberzugsmassen in Form von Organosolen oder Plastisolen |