DEA0016617MA - - Google Patents
Info
- Publication number
- DEA0016617MA DEA0016617MA DEA0016617MA DE A0016617M A DEA0016617M A DE A0016617MA DE A0016617M A DEA0016617M A DE A0016617MA
- Authority
- DE
- Germany
- Prior art keywords
- oil
- sulfur
- catalyst
- wax
- hydrocarbons
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Active
Links
- 239000003921 oil Substances 0.000 claims description 40
- 239000003054 catalyst Substances 0.000 claims description 24
- 239000007789 gas Substances 0.000 claims description 21
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 claims description 19
- 229910052717 sulfur Inorganic materials 0.000 claims description 19
- 239000011593 sulfur Substances 0.000 claims description 19
- 229930195733 hydrocarbon Natural products 0.000 claims description 18
- 150000002430 hydrocarbons Chemical class 0.000 claims description 18
- 238000000034 method Methods 0.000 claims description 15
- 238000009835 boiling Methods 0.000 claims description 12
- 239000003208 petroleum Substances 0.000 claims description 8
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 7
- 239000001257 hydrogen Substances 0.000 claims description 7
- 229910052739 hydrogen Inorganic materials 0.000 claims description 7
- 238000006243 chemical reaction Methods 0.000 claims description 6
- RWSOTUBLDIXVET-UHFFFAOYSA-N Dihydrogen sulfide Chemical compound S RWSOTUBLDIXVET-UHFFFAOYSA-N 0.000 claims description 5
- 229910000037 hydrogen sulfide Inorganic materials 0.000 claims description 5
- 229910017052 cobalt Inorganic materials 0.000 claims description 4
- 239000010941 cobalt Substances 0.000 claims description 4
- GUTLYIVDDKVIGB-UHFFFAOYSA-N cobalt atom Chemical compound [Co] GUTLYIVDDKVIGB-UHFFFAOYSA-N 0.000 claims description 4
- ZOKXTWBITQBERF-UHFFFAOYSA-N Molybdenum Chemical compound [Mo] ZOKXTWBITQBERF-UHFFFAOYSA-N 0.000 claims description 3
- PNEYBMLMFCGWSK-UHFFFAOYSA-N aluminium oxide Inorganic materials [O-2].[O-2].[O-2].[Al+3].[Al+3] PNEYBMLMFCGWSK-UHFFFAOYSA-N 0.000 claims description 3
- 239000010779 crude oil Substances 0.000 claims description 3
- 229910052750 molybdenum Inorganic materials 0.000 claims description 3
- 239000011733 molybdenum Substances 0.000 claims description 3
- CPLXHLVBOLITMK-UHFFFAOYSA-N Magnesium oxide Chemical compound [Mg]=O CPLXHLVBOLITMK-UHFFFAOYSA-N 0.000 claims 2
- 239000000395 magnesium oxide Substances 0.000 claims 1
- RMAQACBXLXPBSY-UHFFFAOYSA-N silicic acid Chemical compound O[Si](O)(O)O RMAQACBXLXPBSY-UHFFFAOYSA-N 0.000 claims 1
- 235000012239 silicon dioxide Nutrition 0.000 claims 1
- 239000000047 product Substances 0.000 description 17
- 238000005336 cracking Methods 0.000 description 9
- 239000000571 coke Substances 0.000 description 6
- 238000004523 catalytic cracking Methods 0.000 description 5
- 230000015572 biosynthetic process Effects 0.000 description 4
- 238000006477 desulfuration reaction Methods 0.000 description 4
- 230000023556 desulfurization Effects 0.000 description 4
- NNPPMTNAJDCUHE-UHFFFAOYSA-N isobutane Chemical compound CC(C)C NNPPMTNAJDCUHE-UHFFFAOYSA-N 0.000 description 4
- 239000007788 liquid Substances 0.000 description 4
- 239000004215 Carbon black (E152) Substances 0.000 description 3
- 239000007795 chemical reaction product Substances 0.000 description 3
- 238000005194 fractionation Methods 0.000 description 3
- TWNQGVIAIRXVLR-UHFFFAOYSA-N oxo(oxoalumanyloxy)alumane Chemical compound O=[Al]O[Al]=O TWNQGVIAIRXVLR-UHFFFAOYSA-N 0.000 description 3
- 150000003464 sulfur compounds Chemical class 0.000 description 3
- PAYRUJLWNCNPSJ-UHFFFAOYSA-N Aniline Chemical compound NC1=CC=CC=C1 PAYRUJLWNCNPSJ-UHFFFAOYSA-N 0.000 description 2
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- 238000000605 extraction Methods 0.000 description 2
- 238000005984 hydrogenation reaction Methods 0.000 description 2
- 230000002779 inactivation Effects 0.000 description 2
- 239000001282 iso-butane Substances 0.000 description 2
- 238000011084 recovery Methods 0.000 description 2
- 239000000126 substance Substances 0.000 description 2
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 1
- 230000029936 alkylation Effects 0.000 description 1
- 238000005804 alkylation reaction Methods 0.000 description 1
- 125000003118 aryl group Chemical group 0.000 description 1
- 239000002199 base oil Substances 0.000 description 1
- 229910001570 bauxite Inorganic materials 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- KYYSIVCCYWZZLR-UHFFFAOYSA-N cobalt(2+);dioxido(dioxo)molybdenum Chemical compound [Co+2].[O-][Mo]([O-])(=O)=O KYYSIVCCYWZZLR-UHFFFAOYSA-N 0.000 description 1
- 230000003750 conditioning effect Effects 0.000 description 1
- 230000003247 decreasing effect Effects 0.000 description 1
- 238000004821 distillation Methods 0.000 description 1
- 239000012535 impurity Substances 0.000 description 1
- 239000012263 liquid product Substances 0.000 description 1
- 230000002101 lytic effect Effects 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 229910000476 molybdenum oxide Inorganic materials 0.000 description 1
- 229910052757 nitrogen Inorganic materials 0.000 description 1
- PQQKPALAQIIWST-UHFFFAOYSA-N oxomolybdenum Chemical class [Mo]=O PQQKPALAQIIWST-UHFFFAOYSA-N 0.000 description 1
- 239000002574 poison Substances 0.000 description 1
- 231100000614 poison Toxicity 0.000 description 1
- 239000010802 sludge Substances 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 229910052720 vanadium Inorganic materials 0.000 description 1
- LEONUFNNVUYDNQ-UHFFFAOYSA-N vanadium atom Chemical compound [V] LEONUFNNVUYDNQ-UHFFFAOYSA-N 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
Family
ID=
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2215665C3 (de) | Verfahren zum Herstellen von Benzin und raffinierten flüssigen Kohlenwasserstoffen | |
| DE2215664A1 (de) | Verfahren zum herstellen von koks ausgehend von rohoel, das mit wasserstoff behandelt bzw. hydriert ist | |
| DE69202527T3 (de) | Verfahren zur Erzeugung von Diesel-Gasöl mit niedrigem Schwefelgehalt. | |
| DE2164951B2 (de) | Verfahren zur Herstellung gasförmiger Olefine | |
| DE2454197A1 (de) | Verfahren zur herstellung eines synthetischen schmieroels mit hohem viskositaetsindex | |
| DE976855C (de) | Verfahren zum Hydrofinieren von rohem Erdoel | |
| DE2149370C3 (de) | Verfahren zur Umwandlung rückstandshaltiger Erdölfraktionen | |
| DE2041219B2 (de) | Verfahren zum hydrokracken hoch- siedender kohlenwasserstoffe | |
| DE1470628A1 (de) | Verfahren zur Befreiung von Kohlenwasserstoffoelen von Verunreinigungen | |
| DE2914010A1 (de) | Verfahren zur umwandlung von hochsiedenden kohlenwasserstoffrueckstaenden | |
| DE1909840A1 (de) | Verfahren zur Aufarbeitung von Schwerbenzin | |
| US2647076A (en) | Catalytic cracking of petroleum hydrocarbons with a clay treated catalyst | |
| DE933826C (de) | Verfahren zur Herstellung von Benzin und gegebenenfalls von Dieseloel aus Rohoel | |
| DE2202526A1 (de) | Reinigungsverfahren fuer Kohlenwasserstoff-Einsatzmaterial u.dgl. sowie Verwendung der gereinigten Kohlenwasserstoffe zum katalytischen Cracken | |
| DE2613877A1 (de) | Verfahren zur herstellung von schmieroel mit niedrigem pourpoint | |
| DE3780305T2 (de) | Verfahren zur produktion von maximum-mitteldistillaten mit minimalem wasserstoffverbrauch. | |
| DE972357C (de) | Verfahren zur Gewinnung im wesentlichen schwefelfreier Produkte aus im Bereich der Wachsdestillate siedenden Erdoelkohlenwasserstoffen | |
| DE69011217T2 (de) | Schwerölumwandlungsverfahren. | |
| DEA0016617MA (cs) | ||
| DE1645728B2 (de) | Verfahren zur herstellung eines schweren aromatischen loesungsmittels | |
| DE3039263A1 (de) | Solvensextraktionsverfahren fuer die kohleumwandlung | |
| DE10297760T5 (de) | Verbessertes Hydrocrackverfahren | |
| DE69017122T2 (de) | Molecul-Umstrukturierungskatalysator. | |
| DE2312930C3 (de) | Verfahren zur Herstellung von Naphthalin oder RuB | |
| DE2042184A1 (de) | Verfahren zur Entfernung von Metall-,Schwefel- und Stickstoffverunreinigungen aus Kohlenwasserstoffbeschickungen |