DE963876C - Verfahren zur Herstellung von Mono-ª‡ú¼ ª‰-alkylenimido-phosphorverbindungen - Google Patents
Verfahren zur Herstellung von Mono-ª‡ú¼ ª‰-alkylenimido-phosphorverbindungenInfo
- Publication number
- DE963876C DE963876C DEF13220A DEF0013220A DE963876C DE 963876 C DE963876 C DE 963876C DE F13220 A DEF13220 A DE F13220A DE F0013220 A DEF0013220 A DE F0013220A DE 963876 C DE963876 C DE 963876C
- Authority
- DE
- Germany
- Prior art keywords
- acid
- phosphorus compounds
- benzene
- phosphorus
- halogen
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 238000000034 method Methods 0.000 title claims description 6
- 239000002253 acid Substances 0.000 claims description 16
- -1 N'-substituted diamidophosphoric acid Chemical class 0.000 claims description 7
- 229910052757 nitrogen Inorganic materials 0.000 claims description 7
- 125000000217 alkyl group Chemical group 0.000 claims description 5
- 229910052698 phosphorus Inorganic materials 0.000 claims description 5
- 150000003018 phosphorus compounds Chemical class 0.000 claims description 5
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 claims description 4
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 claims description 4
- 125000003118 aryl group Chemical group 0.000 claims description 4
- 229910052736 halogen Inorganic materials 0.000 claims description 4
- 150000002367 halogens Chemical class 0.000 claims description 4
- 229910052717 sulfur Inorganic materials 0.000 claims description 4
- 239000011593 sulfur Substances 0.000 claims description 4
- OAICVXFJPJFONN-UHFFFAOYSA-N Phosphorus Chemical compound [P] OAICVXFJPJFONN-UHFFFAOYSA-N 0.000 claims description 3
- 125000003710 aryl alkyl group Chemical group 0.000 claims description 3
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims description 3
- 125000000753 cycloalkyl group Chemical group 0.000 claims description 3
- 229910052760 oxygen Inorganic materials 0.000 claims description 3
- 239000001301 oxygen Substances 0.000 claims description 3
- 239000011574 phosphorus Substances 0.000 claims description 3
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims description 2
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 2
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 2
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 claims description 2
- 229910052794 bromium Inorganic materials 0.000 claims description 2
- 239000000460 chlorine Substances 0.000 claims description 2
- 229910052801 chlorine Inorganic materials 0.000 claims description 2
- 125000005843 halogen group Chemical group 0.000 claims description 2
- 229910052739 hydrogen Inorganic materials 0.000 claims description 2
- 239000001257 hydrogen Substances 0.000 claims description 2
- 125000004437 phosphorous atom Chemical group 0.000 claims description 2
- 125000000623 heterocyclic group Chemical group 0.000 claims 2
- 125000002947 alkylene group Chemical group 0.000 claims 1
- 125000005842 heteroatom Chemical group 0.000 claims 1
- 125000004433 nitrogen atom Chemical group N* 0.000 claims 1
- 239000011541 reaction mixture Substances 0.000 claims 1
- 239000007858 starting material Substances 0.000 claims 1
- 150000003581 thiophosphoric acid halides Chemical class 0.000 claims 1
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 66
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 45
- NOWKCMXCCJGMRR-UHFFFAOYSA-N Aziridine Chemical compound C1CN1 NOWKCMXCCJGMRR-UHFFFAOYSA-N 0.000 description 16
- 239000000203 mixture Substances 0.000 description 14
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 12
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 12
- 238000009835 boiling Methods 0.000 description 8
- 150000001875 compounds Chemical class 0.000 description 8
- 239000000243 solution Substances 0.000 description 7
- 238000003756 stirring Methods 0.000 description 7
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 6
- RWRDLPDLKQPQOW-UHFFFAOYSA-N Pyrrolidine Chemical compound C1CCNC1 RWRDLPDLKQPQOW-UHFFFAOYSA-N 0.000 description 6
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 6
- VZGDMQKNWNREIO-UHFFFAOYSA-N tetrachloromethane Chemical compound ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 description 6
- 239000000706 filtrate Substances 0.000 description 5
- 239000000047 product Substances 0.000 description 5
- NGNBDVOYPDDBFK-UHFFFAOYSA-N 2-[2,4-di(pentan-2-yl)phenoxy]acetyl chloride Chemical compound CCCC(C)C1=CC=C(OCC(Cl)=O)C(C(C)CCC)=C1 NGNBDVOYPDDBFK-UHFFFAOYSA-N 0.000 description 4
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 4
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 4
- YNAVUWVOSKDBBP-UHFFFAOYSA-N Morpholine Chemical compound C1COCCN1 YNAVUWVOSKDBBP-UHFFFAOYSA-N 0.000 description 4
- 150000001408 amides Chemical class 0.000 description 4
- 239000002585 base Substances 0.000 description 4
- 238000006243 chemical reaction Methods 0.000 description 4
- 150000002148 esters Chemical class 0.000 description 4
- 239000007788 liquid Substances 0.000 description 4
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 3
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 3
- DNIAPMSPPWPWGF-UHFFFAOYSA-N Propylene glycol Chemical compound CC(O)CO DNIAPMSPPWPWGF-UHFFFAOYSA-N 0.000 description 3
- 239000011230 binding agent Substances 0.000 description 3
- 238000004821 distillation Methods 0.000 description 3
- 238000002844 melting Methods 0.000 description 3
- 230000008018 melting Effects 0.000 description 3
- 239000002904 solvent Substances 0.000 description 3
- 239000000126 substance Substances 0.000 description 3
- ZJEHRMYJNACSLL-UHFFFAOYSA-N 1-[butoxy(chloro)phosphoryl]oxybutane Chemical compound CCCCOP(Cl)(=O)OCCCC ZJEHRMYJNACSLL-UHFFFAOYSA-N 0.000 description 2
- NQRYJNQNLNOLGT-UHFFFAOYSA-N Piperidine Chemical compound C1CCNCC1 NQRYJNQNLNOLGT-UHFFFAOYSA-N 0.000 description 2
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 2
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 2
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 2
- RYYWUUFWQRZTIU-UHFFFAOYSA-N Thiophosphoric acid Chemical compound OP(O)(S)=O RYYWUUFWQRZTIU-UHFFFAOYSA-N 0.000 description 2
- 150000007513 acids Chemical class 0.000 description 2
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 2
- ZSIQJIWKELUFRJ-UHFFFAOYSA-N azepane Chemical compound C1CCCNCC1 ZSIQJIWKELUFRJ-UHFFFAOYSA-N 0.000 description 2
- 125000004122 cyclic group Chemical group 0.000 description 2
- LGTLXDJOAJDFLR-UHFFFAOYSA-N diethyl chlorophosphate Chemical compound CCOP(Cl)(=O)OCC LGTLXDJOAJDFLR-UHFFFAOYSA-N 0.000 description 2
- 238000001704 evaporation Methods 0.000 description 2
- 230000008020 evaporation Effects 0.000 description 2
- 238000001914 filtration Methods 0.000 description 2
- 150000004820 halides Chemical class 0.000 description 2
- HKKBJRUSFKTHSU-UHFFFAOYSA-N n-[chloro(diethylamino)phosphoryl]-n-ethylethanamine Chemical compound CCN(CC)P(Cl)(=O)N(CC)CC HKKBJRUSFKTHSU-UHFFFAOYSA-N 0.000 description 2
- 239000003960 organic solvent Substances 0.000 description 2
- 229910052938 sodium sulfate Inorganic materials 0.000 description 2
- 235000011152 sodium sulphate Nutrition 0.000 description 2
- ILWRPSCZWQJDMK-UHFFFAOYSA-N triethylazanium;chloride Chemical compound Cl.CCN(CC)CC ILWRPSCZWQJDMK-UHFFFAOYSA-N 0.000 description 2
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 1
- IRRTUEIEPNRYCS-UHFFFAOYSA-N 2-methylprop-1-en-1-imine Chemical compound CC(C)=C=N IRRTUEIEPNRYCS-UHFFFAOYSA-N 0.000 description 1
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonium chloride Substances [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 1
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 1
- CLBNGRFUFHAIQI-UHFFFAOYSA-N CCOC(C=CC=C1)=C1P(Cl)(Cl)=O Chemical compound CCOC(C=CC=C1)=C1P(Cl)(Cl)=O CLBNGRFUFHAIQI-UHFFFAOYSA-N 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate Chemical compound [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 description 1
- OAKJQQAXSVQMHS-UHFFFAOYSA-N Hydrazine Chemical compound NN OAKJQQAXSVQMHS-UHFFFAOYSA-N 0.000 description 1
- JLTDJTHDQAWBAV-UHFFFAOYSA-N N,N-dimethylaniline Chemical compound CN(C)C1=CC=CC=C1 JLTDJTHDQAWBAV-UHFFFAOYSA-N 0.000 description 1
- YIINTZRQVLYONJ-UHFFFAOYSA-N O1CCN(CC1)[ClH]P(=O)(Cl)[ClH]N1CCOCC1 Chemical compound O1CCN(CC1)[ClH]P(=O)(Cl)[ClH]N1CCOCC1 YIINTZRQVLYONJ-UHFFFAOYSA-N 0.000 description 1
- QLZHNIAADXEJJP-UHFFFAOYSA-N Phenylphosphonic acid Chemical class OP(O)(=O)C1=CC=CC=C1 QLZHNIAADXEJJP-UHFFFAOYSA-N 0.000 description 1
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 1
- 230000001476 alcoholic effect Effects 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- 125000001931 aliphatic group Chemical group 0.000 description 1
- 229910001854 alkali hydroxide Inorganic materials 0.000 description 1
- 150000008044 alkali metal hydroxides Chemical class 0.000 description 1
- NBZANZVJRKXVBH-GYDPHNCVSA-N alpha-Cryptoxanthin Natural products O[C@H]1CC(C)(C)C(/C=C/C(=C\C=C\C(=C/C=C/C=C(\C=C\C=C(/C=C/[C@H]2C(C)=CCCC2(C)C)\C)/C)\C)/C)=C(C)C1 NBZANZVJRKXVBH-GYDPHNCVSA-N 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- 229910021529 ammonia Inorganic materials 0.000 description 1
- 235000011114 ammonium hydroxide Nutrition 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 150000001649 bromium compounds Chemical class 0.000 description 1
- 150000004649 carbonic acid derivatives Chemical class 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 150000001805 chlorine compounds Chemical class 0.000 description 1
- KMJJJTCKNZYTEY-UHFFFAOYSA-N chloro-diethoxy-sulfanylidene-$l^{5}-phosphane Chemical compound CCOP(Cl)(=S)OCC KMJJJTCKNZYTEY-UHFFFAOYSA-N 0.000 description 1
- 239000012230 colorless oil Substances 0.000 description 1
- 238000010411 cooking Methods 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 239000013078 crystal Substances 0.000 description 1
- IBDMRHDXAQZJAP-UHFFFAOYSA-N dichlorophosphorylbenzene Chemical compound ClP(Cl)(=O)C1=CC=CC=C1 IBDMRHDXAQZJAP-UHFFFAOYSA-N 0.000 description 1
- 150000005690 diesters Chemical class 0.000 description 1
- 229940042400 direct acting antivirals phosphonic acid derivative Drugs 0.000 description 1
- 150000002170 ethers Chemical class 0.000 description 1
- 125000004494 ethyl ester group Chemical group 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 238000002474 experimental method Methods 0.000 description 1
- 239000000284 extract Substances 0.000 description 1
- 238000000605 extraction Methods 0.000 description 1
- 230000002349 favourable effect Effects 0.000 description 1
- 150000002366 halogen compounds Chemical class 0.000 description 1
- 229930195733 hydrocarbon Natural products 0.000 description 1
- 150000002430 hydrocarbons Chemical class 0.000 description 1
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 1
- 150000003949 imides Chemical class 0.000 description 1
- 239000012442 inert solvent Substances 0.000 description 1
- ABOLDQVTRJWIRN-UHFFFAOYSA-N n-[chloro(diethylamino)phosphinothioyl]-n-ethylethanamine Chemical compound CCN(CC)P(Cl)(=S)N(CC)CC ABOLDQVTRJWIRN-UHFFFAOYSA-N 0.000 description 1
- AYCXIVOOSPZUOI-UHFFFAOYSA-N n-[chloro(ethoxy)phosphoryl]-n-ethylethanamine Chemical compound CCOP(Cl)(=O)N(CC)CC AYCXIVOOSPZUOI-UHFFFAOYSA-N 0.000 description 1
- 230000007935 neutral effect Effects 0.000 description 1
- 239000003208 petroleum Substances 0.000 description 1
- 150000002989 phenols Chemical class 0.000 description 1
- 150000003007 phosphonic acid derivatives Chemical class 0.000 description 1
- 150000003009 phosphonic acids Chemical class 0.000 description 1
- 150000003013 phosphoric acid derivatives Chemical class 0.000 description 1
- 150000003017 phosphorus Chemical class 0.000 description 1
- 150000003141 primary amines Chemical class 0.000 description 1
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 1
- 238000001953 recrystallisation Methods 0.000 description 1
- 238000010992 reflux Methods 0.000 description 1
- 150000003335 secondary amines Chemical class 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 239000011780 sodium chloride Substances 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 231100001274 therapeutic index Toxicity 0.000 description 1
- 210000004881 tumor cell Anatomy 0.000 description 1
- 230000004614 tumor growth Effects 0.000 description 1
- 238000010626 work up procedure Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07F—ACYCLIC, CARBOCYCLIC OR HETEROCYCLIC COMPOUNDS CONTAINING ELEMENTS OTHER THAN CARBON, HYDROGEN, HALOGEN, OXYGEN, NITROGEN, SULFUR, SELENIUM OR TELLURIUM
- C07F9/00—Compounds containing elements of Groups 5 or 15 of the Periodic Table
- C07F9/02—Phosphorus compounds
- C07F9/547—Heterocyclic compounds, e.g. containing phosphorus as a ring hetero atom
- C07F9/553—Heterocyclic compounds, e.g. containing phosphorus as a ring hetero atom having one nitrogen atom as the only ring hetero atom
- C07F9/564—Three-membered rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07F—ACYCLIC, CARBOCYCLIC OR HETEROCYCLIC COMPOUNDS CONTAINING ELEMENTS OTHER THAN CARBON, HYDROGEN, HALOGEN, OXYGEN, NITROGEN, SULFUR, SELENIUM OR TELLURIUM
- C07F9/00—Compounds containing elements of Groups 5 or 15 of the Periodic Table
- C07F9/02—Phosphorus compounds
- C07F9/547—Heterocyclic compounds, e.g. containing phosphorus as a ring hetero atom
- C07F9/6558—Heterocyclic compounds, e.g. containing phosphorus as a ring hetero atom containing at least two different or differently substituted hetero rings neither condensed among themselves nor condensed with a common carbocyclic ring or ring system
- C07F9/65583—Heterocyclic compounds, e.g. containing phosphorus as a ring hetero atom containing at least two different or differently substituted hetero rings neither condensed among themselves nor condensed with a common carbocyclic ring or ring system each of the hetero rings containing nitrogen as ring hetero atom
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Health & Medical Sciences (AREA)
- Life Sciences & Earth Sciences (AREA)
- Biochemistry (AREA)
- General Health & Medical Sciences (AREA)
- Molecular Biology (AREA)
Priority Applications (3)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| BE550319D BE550319A (pm) | 1953-11-13 | ||
| DEF13220A DE963876C (de) | 1953-11-13 | 1953-11-13 | Verfahren zur Herstellung von Mono-ª‡ú¼ ª‰-alkylenimido-phosphorverbindungen |
| FR1174704D FR1174704A (fr) | 1953-11-13 | 1956-08-16 | Procédé pour la préparation de composés mono-alpha, beta-alcoylène-imido-phosphoriques |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DEF13220A DE963876C (de) | 1953-11-13 | 1953-11-13 | Verfahren zur Herstellung von Mono-ª‡ú¼ ª‰-alkylenimido-phosphorverbindungen |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE963876C true DE963876C (de) | 1957-05-16 |
Family
ID=7087236
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DEF13220A Expired DE963876C (de) | 1953-11-13 | 1953-11-13 | Verfahren zur Herstellung von Mono-ª‡ú¼ ª‰-alkylenimido-phosphorverbindungen |
Country Status (3)
| Country | Link |
|---|---|
| BE (1) | BE550319A (pm) |
| DE (1) | DE963876C (pm) |
| FR (1) | FR1174704A (pm) |
Cited By (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1082266B (de) * | 1958-04-05 | 1960-05-25 | Benckiser Gmbh Joh A | Verfahren zur Herstellung von N-substituierten Amidophosphorsaeuredialkylestern |
| DE1087130B (de) * | 1958-04-23 | 1960-08-18 | Bayer Ag | Verfahren zur Herstellung von Thionophosphinsaeureaethylenimiden |
| US5186733A (en) * | 1991-11-12 | 1993-02-16 | Imperial Chemical Industries Plc | Arylphosphonodiamide compounds and herbicidal compositions thereof |
| US5189169A (en) * | 1991-11-12 | 1993-02-23 | Imperial Chemical Industries Plc | Phosphorodiamidothioate herbicides |
| US5205852A (en) * | 1991-11-12 | 1993-04-27 | Imperial Chemical Industries Plc | Alkylphosphonamidate herbicides |
| US5232895A (en) * | 1991-11-12 | 1993-08-03 | Imperial Chemical Industries Plc | Alkylphosphonodiamide herbicides |
Families Citing this family (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| NL248976A (pm) * | 1959-03-03 | 1900-01-01 | ||
| US3136754A (en) * | 1962-05-18 | 1964-06-09 | Olin Mathieson | Aziridinyl-halocyclotriphosphaza-1, 3, 5-trienes |
| US3207661A (en) * | 1963-01-11 | 1965-09-21 | American Agricultural Chem Co | Bis-(aziridinyl)-phosphinothioic esters as chemical sterilants for insects and mites |
| CH570113A5 (pm) * | 1972-07-13 | 1975-12-15 | Ciba Geigy Ag |
Citations (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE854651C (de) * | 1945-01-11 | 1952-11-06 | Hoechst Ag | Verfahren zur Herstellung von AEthyleniminverbindungen |
| DE888853C (de) * | 1948-10-02 | 1953-09-07 | Hoechst Ag | Verfahren zur Herstellung von AEthyleniminverbindungen |
| US2654738A (en) * | 1952-08-02 | 1953-10-06 | American Cyanamid Co | Organic derivatives of phosphonic acids and method of preparing the same |
-
0
- BE BE550319D patent/BE550319A/fr unknown
-
1953
- 1953-11-13 DE DEF13220A patent/DE963876C/de not_active Expired
-
1956
- 1956-08-16 FR FR1174704D patent/FR1174704A/fr not_active Expired
Patent Citations (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE854651C (de) * | 1945-01-11 | 1952-11-06 | Hoechst Ag | Verfahren zur Herstellung von AEthyleniminverbindungen |
| DE888853C (de) * | 1948-10-02 | 1953-09-07 | Hoechst Ag | Verfahren zur Herstellung von AEthyleniminverbindungen |
| US2654738A (en) * | 1952-08-02 | 1953-10-06 | American Cyanamid Co | Organic derivatives of phosphonic acids and method of preparing the same |
Cited By (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1082266B (de) * | 1958-04-05 | 1960-05-25 | Benckiser Gmbh Joh A | Verfahren zur Herstellung von N-substituierten Amidophosphorsaeuredialkylestern |
| DE1087130B (de) * | 1958-04-23 | 1960-08-18 | Bayer Ag | Verfahren zur Herstellung von Thionophosphinsaeureaethylenimiden |
| US5186733A (en) * | 1991-11-12 | 1993-02-16 | Imperial Chemical Industries Plc | Arylphosphonodiamide compounds and herbicidal compositions thereof |
| US5189169A (en) * | 1991-11-12 | 1993-02-23 | Imperial Chemical Industries Plc | Phosphorodiamidothioate herbicides |
| US5205852A (en) * | 1991-11-12 | 1993-04-27 | Imperial Chemical Industries Plc | Alkylphosphonamidate herbicides |
| US5232895A (en) * | 1991-11-12 | 1993-08-03 | Imperial Chemical Industries Plc | Alkylphosphonodiamide herbicides |
Also Published As
| Publication number | Publication date |
|---|---|
| BE550319A (pm) | |
| FR1174704A (fr) | 1959-03-16 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE917668C (de) | Verfahren zur Herstellung von neutralen Estern der Dithiophosphorsaeure | |
| DE1057119B (de) | Verfahren zur Herstellung von cyclischen Phosphorsaeure-esteramiden | |
| DE963876C (de) | Verfahren zur Herstellung von Mono-ª‡ú¼ ª‰-alkylenimido-phosphorverbindungen | |
| CH426776A (de) | Verfahren zur Herstellung von O,O-Dialkyl-S-alkylthiolphosphaten | |
| CH510699A (de) | Verfahren zur Herstellung von neuen Phosphorsäure- und Thiophosphorsäurederivaten | |
| EP0133493B1 (de) | Verfahren zur Herstellung von Kohlenhydraten | |
| DE1160440B (de) | Verfahren zur Herstellung von heterocyclischen Phosphor-, Phosphon-, Phosphin- bzw. Thionophosphor-, -phosphon-, -phosphinsaeureestern | |
| DE917972C (de) | Verfahren zur Herstellung von cyclischen Urethanen | |
| EP1024140B1 (de) | Verfahren zur N-Alkylierung von cyclischen Cyanamidinen | |
| DEF0013220MA (pm) | ||
| DE1058992B (de) | Verfahren zur Herstellung von Thiophosphonsaeureestern | |
| EP0543845A1 (de) | Verfahren zur herstellung von aminomethanphosphonsäure und aminomethyl-phosphinsäuren. | |
| DE1139492B (de) | Verfahren zur Herstellung von Dithiolphosphonsaeureestern | |
| EP0022546A2 (de) | Verfahren zur Herstellung von 1-Oxophospholan-chlorhydrinen sowie einige spezielle dieser Verbindungen | |
| DE2062120C3 (de) | 2-Chloräthylphosphonsäurediamide und diese enthaltende Mittel | |
| DE937949C (de) | Verfahren zur Herstellung von Phosphor und Schwefel enthaltenden organischen Verbindungen | |
| DE962608C (de) | Verfahren zur Herstellung von Phosphorsaeure- bzw. Thiophosphorsaeureestern | |
| DE1593563C3 (de) | Verfahren zur Herstellung von Alkyl-N-(beta-dialkyldithiophosprioryläthyl)carbamaten und -thiolcarbamaten | |
| DE1199264B (de) | Verfahren zur Herstellung von Phospholin-derivaten | |
| DE1243192B (de) | Verfahren zur Herstellung von Vinylphosphonaten | |
| DE1167587B (de) | Insektizides Mittel | |
| DE1076662B (de) | Verfahren zur Herstellung von Amiden der O, O-Dialkyl-dithiophosphoryl-fettsaeuren | |
| DE4116830A1 (de) | Verfahren zur herstellung von n,n-disubstituierten m-aminophenolen | |
| DE1445659C (de) | Pyndylphosphorverbindungen und Verfahren zu ihrer Herstellung | |
| DE1257153B (de) | Verfahren zur Herstellung von neuen basischen Estern der phosphorigen, phosphonigen oder phosphinigen Saeure |