DE837848C - Verfahren zur Herstellung von Benzoesaeureestern sekundaerer Alkyl-sek. Aminopropanole und -butanole - Google Patents
Verfahren zur Herstellung von Benzoesaeureestern sekundaerer Alkyl-sek. Aminopropanole und -butanoleInfo
- Publication number
- DE837848C DE837848C DES2606A DES0002606A DE837848C DE 837848 C DE837848 C DE 837848C DE S2606 A DES2606 A DE S2606A DE S0002606 A DES0002606 A DE S0002606A DE 837848 C DE837848 C DE 837848C
- Authority
- DE
- Germany
- Prior art keywords
- salt
- alkylaminoalkanol
- secondary alkyl
- propylbenzoate
- preparation
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 125000000217 alkyl group Chemical group 0.000 title claims description 17
- 238000000034 method Methods 0.000 title claims description 15
- LRHPLDYGYMQRHN-UHFFFAOYSA-N N-Butanol Chemical class CCCCO LRHPLDYGYMQRHN-UHFFFAOYSA-N 0.000 title claims description 7
- 150000001558 benzoic acid derivatives Chemical class 0.000 title claims description 7
- 238000002360 preparation method Methods 0.000 title claims description 7
- MXZROAOUCUVNHX-UHFFFAOYSA-N 2-Aminopropanol Chemical class CCC(N)O MXZROAOUCUVNHX-UHFFFAOYSA-N 0.000 title claims description 5
- -1 benzoyl halide Chemical class 0.000 claims description 41
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 claims description 21
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 claims description 15
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 claims description 12
- 150000003839 salts Chemical class 0.000 claims description 12
- 125000004432 carbon atom Chemical group C* 0.000 claims description 10
- KXDAEFPNCMNJSK-UHFFFAOYSA-N Benzamide Chemical compound NC(=O)C1=CC=CC=C1 KXDAEFPNCMNJSK-UHFFFAOYSA-N 0.000 claims description 8
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 claims description 8
- 125000003277 amino group Chemical group 0.000 claims description 7
- 239000002904 solvent Substances 0.000 claims description 7
- 239000002253 acid Substances 0.000 claims description 5
- 150000002148 esters Chemical class 0.000 claims description 5
- 125000001650 tertiary alcohol group Chemical group 0.000 claims description 5
- NOGFHTGYPKWWRX-UHFFFAOYSA-N 2,2,6,6-tetramethyloxan-4-one Chemical compound CC1(C)CC(=O)CC(C)(C)O1 NOGFHTGYPKWWRX-UHFFFAOYSA-N 0.000 claims description 4
- 239000012458 free base Substances 0.000 claims description 4
- KFZMGEQAYNKOFK-UHFFFAOYSA-N 2-propanol Substances CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 claims description 3
- 239000004215 Carbon black (E152) Substances 0.000 claims description 2
- OAKJQQAXSVQMHS-UHFFFAOYSA-N Hydrazine Chemical group NN OAKJQQAXSVQMHS-UHFFFAOYSA-N 0.000 claims description 2
- 239000003513 alkali Substances 0.000 claims description 2
- 229930195733 hydrocarbon Natural products 0.000 claims description 2
- 150000002430 hydrocarbons Chemical class 0.000 claims description 2
- WPWHSFAFEBZWBB-UHFFFAOYSA-N 1-butyl radical Chemical compound [CH2]CCC WPWHSFAFEBZWBB-UHFFFAOYSA-N 0.000 claims 1
- 125000002723 alicyclic group Chemical group 0.000 claims 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 claims 1
- 238000002844 melting Methods 0.000 description 9
- 230000008018 melting Effects 0.000 description 9
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 8
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 7
- 150000001875 compounds Chemical class 0.000 description 6
- PASDCCFISLVPSO-UHFFFAOYSA-N benzoyl chloride Chemical compound ClC(=O)C1=CC=CC=C1 PASDCCFISLVPSO-UHFFFAOYSA-N 0.000 description 5
- 239000002585 base Substances 0.000 description 4
- 239000000203 mixture Substances 0.000 description 4
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 3
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- JXHYCCGOZUGBFD-UHFFFAOYSA-N benzoic acid;hydrochloride Chemical compound Cl.OC(=O)C1=CC=CC=C1 JXHYCCGOZUGBFD-UHFFFAOYSA-N 0.000 description 3
- XSIFPSYPOVKYCO-UHFFFAOYSA-N butyl benzoate Chemical class CCCCOC(=O)C1=CC=CC=C1 XSIFPSYPOVKYCO-UHFFFAOYSA-N 0.000 description 3
- OFBQJSOFQDEBGM-UHFFFAOYSA-N n-pentane Natural products CCCCC OFBQJSOFQDEBGM-UHFFFAOYSA-N 0.000 description 3
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 3
- BDERNNFJNOPAEC-UHFFFAOYSA-N propan-1-ol Chemical class CCCO BDERNNFJNOPAEC-UHFFFAOYSA-N 0.000 description 3
- 239000011541 reaction mixture Substances 0.000 description 3
- 238000010992 reflux Methods 0.000 description 3
- HZAXFHJVJLSVMW-UHFFFAOYSA-N 2-Aminoethan-1-ol Chemical compound NCCO HZAXFHJVJLSVMW-UHFFFAOYSA-N 0.000 description 2
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 2
- ATUOYWHBWRKTHZ-UHFFFAOYSA-N Propane Chemical compound CCC ATUOYWHBWRKTHZ-UHFFFAOYSA-N 0.000 description 2
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 2
- 125000003282 alkyl amino group Chemical group 0.000 description 2
- 230000015572 biosynthetic process Effects 0.000 description 2
- 238000009835 boiling Methods 0.000 description 2
- 238000006243 chemical reaction Methods 0.000 description 2
- 239000007795 chemical reaction product Substances 0.000 description 2
- 238000001816 cooling Methods 0.000 description 2
- 125000004122 cyclic group Chemical group 0.000 description 2
- 238000004821 distillation Methods 0.000 description 2
- 238000001704 evaporation Methods 0.000 description 2
- 230000008020 evaporation Effects 0.000 description 2
- 239000007789 gas Substances 0.000 description 2
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 2
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 2
- 239000003589 local anesthetic agent Substances 0.000 description 2
- 229960005015 local anesthetics Drugs 0.000 description 2
- 125000001424 substituent group Chemical group 0.000 description 2
- OZHIYEINSCNALY-UHFFFAOYSA-N 1-aminobutan-1-ol Chemical class CCCC(N)O OZHIYEINSCNALY-UHFFFAOYSA-N 0.000 description 1
- DRHQUYUVJFKDBU-UHFFFAOYSA-N 2-(cyclohexylamino)butan-1-ol Chemical compound CCC(CO)NC1CCCCC1 DRHQUYUVJFKDBU-UHFFFAOYSA-N 0.000 description 1
- XPWWRSIBXKFKTA-UHFFFAOYSA-N 2-(cyclohexylamino)propan-1-ol Chemical compound OCC(C)NC1CCCCC1 XPWWRSIBXKFKTA-UHFFFAOYSA-N 0.000 description 1
- CHJDDDIKQFVCKB-UHFFFAOYSA-N 2-(cyclopentylamino)propan-1-ol Chemical compound OCC(C)NC1CCCC1 CHJDDDIKQFVCKB-UHFFFAOYSA-N 0.000 description 1
- HHZREYAIWSZPGE-UHFFFAOYSA-N 2-(propan-2-ylamino)butan-1-ol Chemical compound CCC(CO)NC(C)C HHZREYAIWSZPGE-UHFFFAOYSA-N 0.000 description 1
- WPYMKLBDIGXBTP-UHFFFAOYSA-N Benzoic acid Natural products OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 1
- 239000005711 Benzoic acid Substances 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- AEMRFAOFKBGASW-UHFFFAOYSA-N Glycolic acid Chemical class OCC(O)=O AEMRFAOFKBGASW-UHFFFAOYSA-N 0.000 description 1
- WYNCHZVNFNFDNH-UHFFFAOYSA-N Oxazolidine Chemical compound C1COCN1 WYNCHZVNFNFDNH-UHFFFAOYSA-N 0.000 description 1
- 125000002947 alkylene group Chemical group 0.000 description 1
- 230000003444 anaesthetic effect Effects 0.000 description 1
- 235000010233 benzoic acid Nutrition 0.000 description 1
- UDEWPOVQBGFNGE-UHFFFAOYSA-N benzoic acid n-propyl ester Natural products CCCOC(=O)C1=CC=CC=C1 UDEWPOVQBGFNGE-UHFFFAOYSA-N 0.000 description 1
- AQIHMSVIAGNIDM-UHFFFAOYSA-N benzoyl bromide Chemical compound BrC(=O)C1=CC=CC=C1 AQIHMSVIAGNIDM-UHFFFAOYSA-N 0.000 description 1
- 239000001273 butane Substances 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 238000009833 condensation Methods 0.000 description 1
- 230000005494 condensation Effects 0.000 description 1
- 238000002425 crystallisation Methods 0.000 description 1
- 230000008025 crystallization Effects 0.000 description 1
- 125000000753 cycloalkyl group Chemical group 0.000 description 1
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- 125000001511 cyclopentyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- MQRJBSHKWOFOGF-UHFFFAOYSA-L disodium;carbonate;hydrate Chemical compound O.[Na+].[Na+].[O-]C([O-])=O MQRJBSHKWOFOGF-UHFFFAOYSA-L 0.000 description 1
- 230000007717 exclusion Effects 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 125000003187 heptyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000004051 hexyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 150000003840 hydrochlorides Chemical class 0.000 description 1
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 1
- 239000012442 inert solvent Substances 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 150000002576 ketones Chemical class 0.000 description 1
- 231100000053 low toxicity Toxicity 0.000 description 1
- OLXYLDUSSBULGU-UHFFFAOYSA-N methyl pyridine-4-carboxylate Chemical compound COC(=O)C1=CC=NC=C1 OLXYLDUSSBULGU-UHFFFAOYSA-N 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- 125000001400 nonyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000002347 octyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000001147 pentyl group Chemical group C(CCCC)* 0.000 description 1
- 239000001294 propane Substances 0.000 description 1
- 230000009257 reactivity Effects 0.000 description 1
- 238000001953 recrystallisation Methods 0.000 description 1
- 229920006395 saturated elastomer Polymers 0.000 description 1
- 229940001593 sodium carbonate Drugs 0.000 description 1
- 229910000029 sodium carbonate Inorganic materials 0.000 description 1
- 229940076133 sodium carbonate monohydrate Drugs 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- IIACRCGMVDHOTQ-UHFFFAOYSA-N sulfamic acid Chemical class NS(O)(=O)=O IIACRCGMVDHOTQ-UHFFFAOYSA-N 0.000 description 1
- 150000003467 sulfuric acid derivatives Chemical class 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
- 238000003786 synthesis reaction Methods 0.000 description 1
- 150000003892 tartrate salts Chemical class 0.000 description 1
- 230000001225 therapeutic effect Effects 0.000 description 1
- 238000005292 vacuum distillation Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C217/00—Compounds containing amino and etherified hydroxy groups bound to the same carbon skeleton
- C07C217/02—Compounds containing amino and etherified hydroxy groups bound to the same carbon skeleton having etherified hydroxy groups and amino groups bound to acyclic carbon atoms of the same carbon skeleton
- C07C217/04—Compounds containing amino and etherified hydroxy groups bound to the same carbon skeleton having etherified hydroxy groups and amino groups bound to acyclic carbon atoms of the same carbon skeleton the carbon skeleton being acyclic and saturated
- C07C217/06—Compounds containing amino and etherified hydroxy groups bound to the same carbon skeleton having etherified hydroxy groups and amino groups bound to acyclic carbon atoms of the same carbon skeleton the carbon skeleton being acyclic and saturated having only one etherified hydroxy group and one amino group bound to the carbon skeleton, which is not further substituted
- C07C217/08—Compounds containing amino and etherified hydroxy groups bound to the same carbon skeleton having etherified hydroxy groups and amino groups bound to acyclic carbon atoms of the same carbon skeleton the carbon skeleton being acyclic and saturated having only one etherified hydroxy group and one amino group bound to the carbon skeleton, which is not further substituted the oxygen atom of the etherified hydroxy group being further bound to an acyclic carbon atom
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C219/00—Compounds containing amino and esterified hydroxy groups bound to the same carbon skeleton
- C07C219/02—Compounds containing amino and esterified hydroxy groups bound to the same carbon skeleton having esterified hydroxy groups and amino groups bound to acyclic carbon atoms of the same carbon skeleton
- C07C219/04—Compounds containing amino and esterified hydroxy groups bound to the same carbon skeleton having esterified hydroxy groups and amino groups bound to acyclic carbon atoms of the same carbon skeleton the carbon skeleton being acyclic and saturated
- C07C219/14—Compounds containing amino and esterified hydroxy groups bound to the same carbon skeleton having esterified hydroxy groups and amino groups bound to acyclic carbon atoms of the same carbon skeleton the carbon skeleton being acyclic and saturated having at least one of the hydroxy groups esterified by a carboxylic acid having the esterifying carboxyl group bound to a carbon atom of a six-membered aromatic ring
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C213/00—Preparation of compounds containing amino and hydroxy, amino and etherified hydroxy or amino and esterified hydroxy groups bound to the same carbon skeleton
- C07C213/06—Preparation of compounds containing amino and hydroxy, amino and etherified hydroxy or amino and esterified hydroxy groups bound to the same carbon skeleton from hydroxy amines by reactions involving the etherification or esterification of hydroxy groups
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Applications Claiming Priority (3)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US632561XA | 1943-10-05 | 1943-10-05 | |
| US53820144A | 1944-05-31 | 1944-05-31 | |
| US717817A US2497394A (en) | 1943-10-05 | 1946-12-21 | Alkylaminoalkyl benzoates |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE837848C true DE837848C (de) | 1952-06-30 |
Family
ID=32234075
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DES2606A Expired DE837848C (de) | 1943-10-05 | 1950-04-02 | Verfahren zur Herstellung von Benzoesaeureestern sekundaerer Alkyl-sek. Aminopropanole und -butanole |
Country Status (5)
| Country | Link |
|---|---|
| US (1) | US2497394A (OSRAM) |
| DE (1) | DE837848C (OSRAM) |
| FR (1) | FR951637A (OSRAM) |
| GB (1) | GB632561A (OSRAM) |
| NL (1) | NL75127C (OSRAM) |
Families Citing this family (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| NL259662A (OSRAM) * | 1961-01-03 | |||
| GB1177407A (en) * | 1967-05-12 | 1970-01-14 | Science Union & Cie | New Benzoic Acid Esters |
| US4219660A (en) * | 1977-06-24 | 1980-08-26 | Hoffmann-La Roche Inc. | Conjugated diene derivatives |
| US4405642A (en) * | 1980-11-28 | 1983-09-20 | American Hospital Supply Corporation | Method for treatment or prophylaxis of cardiac disorders |
| US4402974A (en) * | 1981-06-23 | 1983-09-06 | American Hospital Supply Corporation | Method for treating glaucoma by the topical administration of selectively metabolized beta-blocking agents |
Family Cites Families (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US837899A (en) * | 1906-03-14 | 1906-12-04 | Chem Fab Vorm E Schering | Alkylaminomethylpentyl benzoate. |
| US1513730A (en) * | 1922-10-20 | 1924-11-04 | Abbott Lab | Anesthetic compound |
| US2363081A (en) * | 1941-08-09 | 1944-11-21 | Novocol Chemical Mfg Co Inc | Anesthetic compounds, intermediates, and processes therefor |
| US2363083A (en) * | 1943-07-29 | 1944-11-21 | Novocol Chemical Mfg Co Inc | Anesthetic compounds |
| US2442797A (en) * | 1943-10-05 | 1948-06-08 | Sharp & Dohme Inc | Para-amino benzoic acid esters |
-
0
- NL NL75127D patent/NL75127C/xx active
-
1946
- 1946-12-21 US US717817A patent/US2497394A/en not_active Expired - Lifetime
-
1947
- 1947-08-07 FR FR951637D patent/FR951637A/fr not_active Expired
-
1948
- 1948-02-27 GB GB6200/48A patent/GB632561A/en not_active Expired
-
1950
- 1950-04-02 DE DES2606A patent/DE837848C/de not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| FR951637A (fr) | 1949-10-31 |
| NL75127C (OSRAM) | |
| US2497394A (en) | 1950-02-14 |
| GB632561A (en) | 1949-11-28 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE1493856B2 (de) | 1-aryloxy-3-(n-alkylamino)-2-propanole, verfahren zu ihrer herstellung und diese verbindungen enthaltende pharmazeutische mittel | |
| DE2732825A1 (de) | 2,4,6-trijodbenzoesaeurederivate, verfahren zu ihrer herstellung und diese verbindungen enthaltende roentgenkontrastmittel | |
| DE837848C (de) | Verfahren zur Herstellung von Benzoesaeureestern sekundaerer Alkyl-sek. Aminopropanole und -butanole | |
| CH380746A (de) | Verfahren zur Herstellung neuer sekundärer Amine | |
| DE934651C (de) | Verfahren zur Herstellung von tetrasubstituierten Diaminoalkanen | |
| AT265256B (de) | Verfahren zur Herstellung neuer 2-Aryltetrahydropyran-3-amine und ihrer Salze | |
| DE2542791C2 (de) | N,N'-Disubstituierte Naphthylacetamidine | |
| DE1918253A1 (de) | Verbessertes Verfahren zur Herstellung von 3-Hydroxyisoxazolverbindungen | |
| DD150060A5 (de) | Verfahren zur herstellung von neuen phenthiazin-derivaten | |
| EP0550383A1 (de) | Kristalline fumarsaure Salze von 9,9-Alkylen-3,7-diazabicyclononan-Verbindungen enthaltende Arzneimittel | |
| DE2512702C2 (de) | Substituierte 1-Amino-3-phenyl-indole, deren Salze und Verfahren zu ihrer Herstellung | |
| DE2725245A1 (de) | Methylaminderivate, verfahren zu deren herstellung und diese enthaltende pharmazeutische oder veterinaermedizinische zusammensetzungen | |
| DE1670143C3 (OSRAM) | ||
| DE862602C (de) | Verfahren zur Herstellung von Halogendiamidinen und ihren Salzen | |
| AT289138B (de) | Verfahren zur Herstellung von neuen substituierten Phenylcarbaminsäureestern von zyklischen Aminoalkoholen und ihren optischen Isomeren sowie ihren Säureadditionssalzen | |
| DE1122070C2 (de) | Verfahren zur Herstellung von diuretisch wirksamen Disulfamylanilinverbindungen | |
| AT238181B (de) | Verfahren zur Herstellung neuer Pyrrolidinverbindungen | |
| DE940828C (de) | Verfahren zur Herstellung von Estern des Penicillins mit Phenolen und Thiophenolen | |
| DE2628042B2 (de) | 3-Amino-tricyclo [53.1.0.3A1 -undecan, dessen Säureadditionssalze und Verfahren zur Herstellung dieser Verbindungen | |
| AT231432B (de) | Verfahren zur Herstellung von neuen Bis - bzw. Tetrakisbenzoesäureestern und -phenylessigsäureestern und ihren Salzen | |
| DE1900948C (de) | Cis- und trans-2-Methyl-5-(3, 4, S-trimethoxybenzamidoJ-decahydroisochinolin | |
| DE2822473A1 (de) | Alkanolaminderivate, verfahren zu ihrer herstellung und sie enthaltende pharmazeutische zusammensetzungen | |
| DE1768505B2 (de) | Phenathylaminverbindungen und Ver fahren zu ihrer Herstellung | |
| DE1670284C3 (de) | Penicilline | |
| DE2518516C3 (de) | 2-(3,45-Trimethoxybenzyl)-3,4-dimethylpyridin |