DE819437C - Schaltungsanordnung zur elektrischen Beeinflussung der Fortpflanzungs-geschwindigkeit (Phasengeschwindigkeit) eines uebertragenden Vierpols - Google Patents
Schaltungsanordnung zur elektrischen Beeinflussung der Fortpflanzungs-geschwindigkeit (Phasengeschwindigkeit) eines uebertragenden VierpolsInfo
- Publication number
- DE819437C DE819437C DEP20755A DEP0020755A DE819437C DE 819437 C DE819437 C DE 819437C DE P20755 A DEP20755 A DE P20755A DE P0020755 A DEP0020755 A DE P0020755A DE 819437 C DE819437 C DE 819437C
- Authority
- DE
- Germany
- Prior art keywords
- speed
- phase
- conductor
- circuit arrangement
- sheaths
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 239000004020 conductor Substances 0.000 claims description 11
- 230000010355 oscillation Effects 0.000 claims description 10
- 230000035699 permeability Effects 0.000 claims description 5
- 230000005294 ferromagnetic effect Effects 0.000 claims description 4
- 239000003302 ferromagnetic material Substances 0.000 claims description 3
- 239000000463 material Substances 0.000 claims description 3
- 229910000859 α-Fe Inorganic materials 0.000 claims description 3
- 230000000694 effects Effects 0.000 claims 1
- 238000004804 winding Methods 0.000 description 6
- 230000005415 magnetization Effects 0.000 description 3
- JRPBQTZRNDNNOP-UHFFFAOYSA-N barium titanate Chemical compound [Ba+2].[Ba+2].[O-][Ti]([O-])([O-])[O-] JRPBQTZRNDNNOP-UHFFFAOYSA-N 0.000 description 1
- 229910002113 barium titanate Inorganic materials 0.000 description 1
- 239000003990 capacitor Substances 0.000 description 1
- 238000010276 construction Methods 0.000 description 1
- 239000003989 dielectric material Substances 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- LJCNRYVRMXRIQR-OLXYHTOASA-L potassium sodium L-tartrate Chemical compound [Na+].[K+].[O-]C(=O)[C@H](O)[C@@H](O)C([O-])=O LJCNRYVRMXRIQR-OLXYHTOASA-L 0.000 description 1
- 235000011006 sodium potassium tartrate Nutrition 0.000 description 1
Classifications
-
- H—ELECTRICITY
- H03—ELECTRONIC CIRCUITRY
- H03C—MODULATION
- H03C3/00—Angle modulation
- H03C3/10—Angle modulation by means of variable impedance
- H03C3/12—Angle modulation by means of variable impedance by means of a variable reactive element
- H03C3/18—Angle modulation by means of variable impedance by means of a variable reactive element the element being a current-dependent inductor
-
- H—ELECTRICITY
- H03—ELECTRONIC CIRCUITRY
- H03H—IMPEDANCE NETWORKS, e.g. RESONANT CIRCUITS; RESONATORS
- H03H7/00—Multiple-port networks comprising only passive electrical elements as network components
- H03H7/30—Time-delay networks
-
- H—ELECTRICITY
- H03—ELECTRONIC CIRCUITRY
- H03K—PULSE TECHNIQUE
- H03K5/00—Manipulating of pulses not covered by one of the other main groups of this subclass
- H03K5/13—Arrangements having a single output and transforming input signals into pulses delivered at desired time intervals
- H03K5/14—Arrangements having a single output and transforming input signals into pulses delivered at desired time intervals by the use of delay lines
Landscapes
- Physics & Mathematics (AREA)
- Nonlinear Science (AREA)
- Engineering & Computer Science (AREA)
- Power Engineering (AREA)
- Ac-Ac Conversion (AREA)
- Train Traffic Observation, Control, And Security (AREA)
- Coils Or Transformers For Communication (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| NL261009X | 1947-01-04 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE819437C true DE819437C (de) | 1951-10-31 |
Family
ID=19781512
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DEP20755A Expired DE819437C (de) | 1947-01-04 | 1948-11-05 | Schaltungsanordnung zur elektrischen Beeinflussung der Fortpflanzungs-geschwindigkeit (Phasengeschwindigkeit) eines uebertragenden Vierpols |
Country Status (6)
| Country | Link |
|---|---|
| US (1) | US2565231A (Direct) |
| BE (1) | BE479340A (Direct) |
| CH (1) | CH261009A (Direct) |
| DE (1) | DE819437C (Direct) |
| FR (1) | FR959185A (Direct) |
| GB (1) | GB641279A (Direct) |
Cited By (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1038620B (de) * | 1955-08-15 | 1958-09-11 | Gen Electric | UEbertragungsleitung fuer die Anpassung oder Abstimmung elektrischer Kreise fuer hochfrequente elektrische Wellen |
| DE1116748B (de) * | 1952-08-02 | 1961-11-09 | Standard Elektrik Lorenz Ag | Kanalauswaehlschaltung zur synchronen Zusammenfassung zweier Pulsfolgen |
| DE1227167B (de) * | 1957-11-27 | 1966-10-20 | Telefunken Patent | Elektronisch steuerbare Verzoegerungsleitung |
| DE1231806B (de) * | 1960-03-23 | 1967-01-05 | Licentia Gmbh | Anordnung zum Schutz einer Halbleiter-Gleichrichteranordnung |
| DE1241006B (de) * | 1957-02-09 | 1967-05-24 | Int Standard Electric Corp | Laufzeitglied fuer Impulse gleicher Polaritaet und daraus gebildete Kettenschaltung |
Families Citing this family (17)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2650350A (en) * | 1948-11-04 | 1953-08-25 | Gen Electric | Angular modulating system |
| US2752559A (en) * | 1951-05-31 | 1956-06-26 | Sperry Rand Corp | Amplifying system |
| US2742613A (en) * | 1951-07-26 | 1956-04-17 | Cgs Lab Inc | Variable time delay system |
| US2762984A (en) * | 1952-06-18 | 1956-09-11 | Du Mont Allen B Lab Inc | Continuously variable pulse delay system |
| US3046500A (en) * | 1952-12-31 | 1962-07-24 | Trak Electronics Company Inc | Electrically variable delay line |
| US2907957A (en) * | 1952-12-31 | 1959-10-06 | Cgs Lab Inc | Electrically variable delay line |
| US2776411A (en) * | 1953-01-26 | 1957-01-01 | Bell Telephone Labor Inc | Delay lines |
| US2871453A (en) * | 1953-10-27 | 1959-01-27 | Philco Corp | Signal shaping system |
| DE976758C (de) * | 1954-10-11 | 1964-04-16 | Kienzle Apparate Gmbh | Vorrichtung zur Erzeugung elektrischer Impulsgruppen |
| US2797326A (en) * | 1954-11-02 | 1957-06-25 | Rca Corp | Frequency synthesis system |
| US2973490A (en) * | 1955-03-17 | 1961-02-28 | Allen Bradley Co | Electrical wave filter apparatus |
| US2916709A (en) * | 1955-04-15 | 1959-12-08 | Rca Corp | Electrical delay line |
| US2923882A (en) * | 1955-11-14 | 1960-02-02 | Henry K Bradford | Signalling apparatus |
| US3085188A (en) * | 1957-03-05 | 1963-04-09 | Siemens Ag | Power-valve reactor, particularly for magnetically controlled power rectifiers |
| US2883536A (en) * | 1958-03-05 | 1959-04-21 | John D Salisbury | Electronic phase control circuit |
| US3053934A (en) * | 1959-04-21 | 1962-09-11 | Erie Resistor Corp | Amplifier system for stereo sound |
| GB1014733A (en) * | 1962-09-19 | 1965-12-31 | Nat Res Dev | Microwave phase shifter |
Family Cites Families (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US1677191A (en) * | 1923-05-26 | 1928-07-17 | American Telephone & Telegraph | Modulating arrangement |
| US1737169A (en) * | 1924-10-29 | 1929-11-26 | Drahtlose Telegraphie Gmbh | Controlling means on current conductors for high-frequency purposes |
| US1792756A (en) * | 1924-11-20 | 1931-02-17 | Drahtlose Telegraphie Gmbh | Modulation system |
| GB406674A (en) * | 1931-09-19 | 1934-02-28 | Marconi Wireless Telegraph Co | Improvements in or relating to modulated carrier wave transmitting systems |
| US2085418A (en) * | 1933-12-27 | 1937-06-29 | Rca Corp | Variable terminal impedance signaling system |
| US2445783A (en) * | 1944-07-24 | 1948-07-27 | Standard Telephones Cables Ltd | Transmission system |
| FR956108A (Direct) * | 1946-12-18 | 1950-01-26 |
-
0
- FR FR959185D patent/FR959185A/fr not_active Expired
- BE BE479340D patent/BE479340A/xx unknown
-
1947
- 1947-12-19 US US792746A patent/US2565231A/en not_active Expired - Lifetime
- 1947-12-31 CH CH261009D patent/CH261009A/de unknown
-
1948
- 1948-01-01 GB GB31/48A patent/GB641279A/en not_active Expired
- 1948-11-05 DE DEP20755A patent/DE819437C/de not_active Expired
Cited By (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1116748B (de) * | 1952-08-02 | 1961-11-09 | Standard Elektrik Lorenz Ag | Kanalauswaehlschaltung zur synchronen Zusammenfassung zweier Pulsfolgen |
| DE1038620B (de) * | 1955-08-15 | 1958-09-11 | Gen Electric | UEbertragungsleitung fuer die Anpassung oder Abstimmung elektrischer Kreise fuer hochfrequente elektrische Wellen |
| DE1241006B (de) * | 1957-02-09 | 1967-05-24 | Int Standard Electric Corp | Laufzeitglied fuer Impulse gleicher Polaritaet und daraus gebildete Kettenschaltung |
| DE1227167B (de) * | 1957-11-27 | 1966-10-20 | Telefunken Patent | Elektronisch steuerbare Verzoegerungsleitung |
| DE1231806B (de) * | 1960-03-23 | 1967-01-05 | Licentia Gmbh | Anordnung zum Schutz einer Halbleiter-Gleichrichteranordnung |
Also Published As
| Publication number | Publication date |
|---|---|
| FR959185A (Direct) | 1950-03-25 |
| CH261009A (de) | 1949-04-15 |
| BE479340A (Direct) | |
| US2565231A (en) | 1951-08-21 |
| GB641279A (en) | 1950-08-09 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE888269C (de) | Schwingungserzeuger mit einer Wanderfeldroehre, die in ihrem aeusseren Rueckkopplungskanal ein Filter und einen Phasenschieber enthaelt | |
| DE2738626C3 (de) | Impulsmodulator | |
| DE1791231B1 (de) | Symmetrischer breitbandtransformator | |
| DE1474510B2 (de) | Durch schiebeimpulse gesteuerte schieberegister insbesondere fuer zeitmultiplex systeme | |
| DE2840346C2 (de) | Aus Schaltern, Kondensatoren und Verstärkern bestehendes Filter für elektrische Schwingungen | |
| DE1053044B (de) | Mit gyromagnetischem Effekt arbeitender Frequenzumsetzer fuer Ultrahochfrequenzen | |
| DE2657649C2 (de) | Filter für sehr kurze elektromagnetische Wellen | |
| DE745757C (de) | Elektromechanisches Impedanzelement mit einem sich im wesentlichen in einer Richtung erstreckenden und gespannten Schwingungsglied, welches aus einem Stromkreis elektrisch erregt wird | |
| DE69706876T2 (de) | Übertragungsleiter- oder verzögerungsleitungswandler | |
| DE2545650C2 (de) | Übertragungssystem in Fernmeldeanlagen | |
| DE1491391B1 (de) | Lauffeldroehre mit mindestens zwei Lauffeldabschnitten | |
| DE1815172C3 (de) | Integrierbarer spulenloser Bandpaß höheren Grades | |
| DE2511800B2 (de) | Mikrowellenfilter mit im Dual-Mode betriebenen Hohlraumresonatoren und zusätzlichen Überkopplungen | |
| DE940052C (de) | Anordnung zur mechanischen Abstuetzung von Schwingspulen von hochfrequenten Kreisen | |
| DE1616918C2 (de) | Elektromechanisches Bandfilter | |
| DE1474510C (de) | Durch Schiebeimpulse gesteuerte Schieberegister, insbesondere für Zeitmultiplex-Systeme | |
| DE878955C (de) | Einrichtung zur Erzeugung und Tastung der Traegerfrequenzen fuer ein Mehrfach-Wechselstrom-Telegraphiesystem | |
| DE1278546B (de) | Schaltungsanordnung zur impulsweisen Energieuebertragung ueber ein Reaktanznetzwerk | |
| DE722615C (de) | Anordnung zur Ankopplung mehrerer Traegerstromkanaele an Starkstromleitungen | |
| DE1616918B1 (de) | Elektromechanisches Bandfilter | |
| DE2550995C3 (de) | Mehrstufiger Hochspannungsgenerator für schwingende Prüfschaltspannungen | |
| DE1297694B (de) | Quadraturmodulator | |
| DE658498C (de) | Vorrichtung zur Wandlung des Bereiches elektrischer Frequenzen | |
| DE673122C (de) | Verfahren zur Erhoehung der Selektivitaet durch Entdaempfen von elektrischen Schwingungskreisen | |
| DE1098247B (de) | Parametron-Resonatorschaltung |