DE8101456U1 - Magnetbandkassette, insbesondere kompaktkassette - Google Patents
Magnetbandkassette, insbesondere kompaktkassetteInfo
- Publication number
- DE8101456U1 DE8101456U1 DE19818101456U DE8101456U DE8101456U1 DE 8101456 U1 DE8101456 U1 DE 8101456U1 DE 19818101456 U DE19818101456 U DE 19818101456U DE 8101456 U DE8101456 U DE 8101456U DE 8101456 U1 DE8101456 U1 DE 8101456U1
- Authority
- DE
- Germany
- Prior art keywords
- winding core
- cassette
- opening
- edge parts
- housing
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 238000004804 winding Methods 0.000 claims description 49
- 239000011888 foil Substances 0.000 claims description 22
- 230000015572 biosynthetic process Effects 0.000 claims 1
- 238000005755 formation reaction Methods 0.000 claims 1
- 230000014509 gene expression Effects 0.000 claims 1
- 230000000694 effects Effects 0.000 description 3
- 238000004519 manufacturing process Methods 0.000 description 3
- 239000000463 material Substances 0.000 description 3
- 238000003860 storage Methods 0.000 description 3
- 238000004049 embossing Methods 0.000 description 2
- 230000009467 reduction Effects 0.000 description 2
- 241000283690 Bos taurus Species 0.000 description 1
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 1
- 241000219873 Vicia Species 0.000 description 1
- 235000010716 Vigna mungo Nutrition 0.000 description 1
- 244000042295 Vigna mungo Species 0.000 description 1
- 230000000052 comparative effect Effects 0.000 description 1
- 230000036461 convulsion Effects 0.000 description 1
- 230000007547 defect Effects 0.000 description 1
- 229910002804 graphite Inorganic materials 0.000 description 1
- 239000010439 graphite Substances 0.000 description 1
- 230000001788 irregular Effects 0.000 description 1
- 210000004072 lung Anatomy 0.000 description 1
- 238000005259 measurement Methods 0.000 description 1
- INHWXZFVSTUXPN-UHFFFAOYSA-J molybdenum(4+) disulfite Chemical compound [Mo+4].[O-]S([O-])=O.[O-]S([O-])=O INHWXZFVSTUXPN-UHFFFAOYSA-J 0.000 description 1
- 229920000728 polyester Polymers 0.000 description 1
- 229920000915 polyvinyl chloride Polymers 0.000 description 1
- 239000004800 polyvinyl chloride Substances 0.000 description 1
- 238000005096 rolling process Methods 0.000 description 1
- 229920002545 silicone oil Polymers 0.000 description 1
- 238000003856 thermoforming Methods 0.000 description 1
Classifications
-
- G—PHYSICS
- G11—INFORMATION STORAGE
- G11B—INFORMATION STORAGE BASED ON RELATIVE MOVEMENT BETWEEN RECORD CARRIER AND TRANSDUCER
- G11B23/00—Record carriers not specific to the method of recording or reproducing; Accessories, e.g. containers, specially adapted for co-operation with the recording or reproducing apparatus ; Intermediate mediums; Apparatus or processes specially adapted for their manufacture
- G11B23/02—Containers; Storing means both adapted to cooperate with the recording or reproducing means
- G11B23/04—Magazines; Cassettes for webs or filaments
- G11B23/08—Magazines; Cassettes for webs or filaments for housing webs or filaments having two distinct ends
- G11B23/087—Magazines; Cassettes for webs or filaments for housing webs or filaments having two distinct ends using two different reels or cores
- G11B23/08707—Details
- G11B23/08757—Guiding means
- G11B23/08764—Liner sheets
Landscapes
- Storage Of Web-Like Or Filamentary Materials (AREA)
- Packaging Of Annular Or Rod-Shaped Articles, Wearing Apparel, Cassettes, Or The Like (AREA)
Priority Applications (8)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19818101456U DE8101456U1 (de) | 1981-01-22 | 1981-01-22 | Magnetbandkassette, insbesondere kompaktkassette |
| IT8220473U IT8220473V0 (it) | 1981-01-22 | 1982-01-14 | Cassetta per nastro in particolare cassetta per nastro magnetico. |
| CH319/82A CH654135A5 (de) | 1981-01-22 | 1982-01-19 | Bandkassette, insbesondere magnetbandkassette. |
| JP1982005140U JPS637982Y2 (US20030220297A1-20031127-C00074.png) | 1981-01-22 | 1982-01-20 | |
| AT0020682A AT373714B (de) | 1981-01-22 | 1982-01-21 | Bandkassette, insbesondere magnetbandkassette |
| GB8201651A GB2095211B (en) | 1981-01-22 | 1982-01-21 | Tape cassettes with liners |
| US06/341,885 US4438892A (en) | 1981-01-22 | 1982-01-22 | Tape cassette, especially a magnetic tape cassette |
| FR8200987A FR2498363A1 (fr) | 1981-01-22 | 1982-01-22 | Cassette de bande, notamment cassette de bande magnetique |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19818101456U DE8101456U1 (de) | 1981-01-22 | 1981-01-22 | Magnetbandkassette, insbesondere kompaktkassette |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE8101456U1 true DE8101456U1 (de) | 1981-08-06 |
Family
ID=6723915
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19818101456U Expired DE8101456U1 (de) | 1981-01-22 | 1981-01-22 | Magnetbandkassette, insbesondere kompaktkassette |
Country Status (8)
Families Citing this family (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS6047182U (ja) * | 1983-09-07 | 1985-04-03 | 富士写真フイルム株式会社 | 磁気テ−プカセット |
| DE8415333U1 (de) * | 1984-05-19 | 1984-11-22 | Basf Ag, 6700 Ludwigshafen | Magnetbandkassette, insbesondere kompaktkassette |
| DE8509882U1 (de) * | 1985-04-02 | 1985-07-25 | Basf Ag, 6700 Ludwigshafen | Bandkassette, insbesondere Magnetbandkassette |
| IT210557Z2 (it) * | 1986-12-04 | 1988-12-30 | Atb Spa | Struttra di mascherina per cassette di nastro magnetico con mezzi di bloccaggio rispetto all'involucro scatolare. |
| US5482222A (en) * | 1993-01-07 | 1996-01-09 | V-Lite Corporation | Lightweight solid-core video cassette cartridge |
| US5568899A (en) * | 1995-05-05 | 1996-10-29 | V-Lite Corporation | Lightweight video cassette cartridge |
| US5584440A (en) * | 1995-11-06 | 1996-12-17 | V-Lite Corporation | Lightweight video cassette cartridge |
Family Cites Families (11)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE7330078U (de) * | 1973-11-29 | Basf Ag | Magnetbandkassette, insbesondere Kompaktkassette | |
| US3712559A (en) * | 1969-11-05 | 1973-01-23 | Information Terminals Corp | Tape cassette and improvements therefor |
| US3826489A (en) * | 1971-01-25 | 1974-07-30 | Data Packaging Corp | Tape cassette |
| FR2188233B3 (US20030220297A1-20031127-C00074.png) * | 1972-06-07 | 1976-05-21 | Basf Ag | |
| DE2251746C3 (de) * | 1972-10-21 | 1982-05-19 | Basf Ag, 6700 Ludwigshafen | Magnetbandkassette, insbesondere Kompaktkassette |
| CA1010002A (en) * | 1973-04-25 | 1977-05-10 | Minnesota Mining And Manufacturing Company | Guide roller biasing shim liner |
| US3891159A (en) * | 1973-04-25 | 1975-06-24 | Minnesota Mining & Mfg | Guide roller biasing shim liner |
| DE2327828C3 (de) * | 1973-06-01 | 1984-06-20 | Agfa-Gevaert Ag, 5090 Leverkusen | Bandwickellagerung in Magnetbandkassetten |
| JPS5073618A (US20030220297A1-20031127-C00074.png) * | 1973-08-17 | 1975-06-17 | ||
| JPS5914948Y2 (ja) * | 1979-03-19 | 1984-05-02 | ティーディーケイ株式会社 | カセツト |
| US4368497A (en) * | 1980-02-20 | 1983-01-11 | Olympus Optical Company Ltd. | Tape cassette |
-
1981
- 1981-01-22 DE DE19818101456U patent/DE8101456U1/de not_active Expired
-
1982
- 1982-01-14 IT IT8220473U patent/IT8220473V0/it unknown
- 1982-01-19 CH CH319/82A patent/CH654135A5/de not_active IP Right Cessation
- 1982-01-20 JP JP1982005140U patent/JPS637982Y2/ja not_active Expired
- 1982-01-21 AT AT0020682A patent/AT373714B/de not_active IP Right Cessation
- 1982-01-21 GB GB8201651A patent/GB2095211B/en not_active Expired
- 1982-01-22 US US06/341,885 patent/US4438892A/en not_active Expired - Fee Related
- 1982-01-22 FR FR8200987A patent/FR2498363A1/fr active Granted
Also Published As
| Publication number | Publication date |
|---|---|
| GB2095211A (en) | 1982-09-29 |
| GB2095211B (en) | 1985-02-13 |
| CH654135A5 (de) | 1986-01-31 |
| ATA20682A (de) | 1983-06-15 |
| JPS57173185U (US20030220297A1-20031127-C00074.png) | 1982-11-01 |
| AT373714B (de) | 1984-02-10 |
| IT8220473V0 (it) | 1982-01-14 |
| FR2498363B1 (US20030220297A1-20031127-C00074.png) | 1984-11-30 |
| FR2498363A1 (fr) | 1982-07-23 |
| US4438892A (en) | 1984-03-27 |
| JPS637982Y2 (US20030220297A1-20031127-C00074.png) | 1988-03-09 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE69006049T2 (de) | Filmkassette. | |
| DE2501866C3 (de) | Magnetbandkassette | |
| DE68912800T2 (de) | Filmkassette. | |
| DE8335294U1 (de) | Andruckfeder für Bandkassetten und Bandkassetten damit | |
| DE2557519C3 (de) | Bandkassette mit Bandspulen-Bremsvorrichtung | |
| DE8101456U1 (de) | Magnetbandkassette, insbesondere kompaktkassette | |
| DE60027612T2 (de) | Magnetbandkassette | |
| DE2251746C3 (de) | Magnetbandkassette, insbesondere Kompaktkassette | |
| DE69112452T2 (de) | Bandkassette-Lademechanismus. | |
| DE2854602C2 (de) | Behälter für Magnetbandkassetten | |
| DE2637016C2 (US20030220297A1-20031127-C00074.png) | ||
| DE8418179U1 (de) | Bandkassette mit andruckfeder | |
| DE69116043T2 (de) | Bandspule für eine kassette | |
| DE2429582C3 (de) | Bandkassette | |
| DE3331160C2 (US20030220297A1-20031127-C00074.png) | ||
| EP0390020B1 (de) | Andruckfeder für Bandkassetten und Bandkassetten damit | |
| DE1954486A1 (de) | Behaelter oder Ausgabevorrichtung fuer Rollen aus einem Bahnmaterial wie beispielsweise Papier,Metallfolien od.dgl. | |
| DE69521087T2 (de) | Kassettenstruktur mit Deckel | |
| DE2638074A1 (de) | Endlosbandkassette | |
| DE3106016A1 (de) | Magnetbandkassette | |
| DE69511313T2 (de) | Löschsperrengehäuse für Einzelspulenkassette | |
| DE68907551T2 (de) | Bandkassette. | |
| DE1926296A1 (de) | Vorrichtung zum Abheben und Fuehren des freien Endes eines auf einer Spule aufgewickelten Streifens od.dgl. | |
| DE3003335A1 (de) | Kassettenbandgeraet | |
| DE2623150B2 (de) | Spulenkörper für eine Magnetbandkassette |
