DE752696A - - Google Patents
Info
- Publication number
- DE752696A DE752696A DE752696A DE 752696 A DE752696 A DE 752696A DE 752696 A DE752696 A DE 752696A
- Authority
- DE
- Germany
- Prior art keywords
- carbonic acid
- dioxy
- acid
- benzoic acid
- pyrocatechol
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- BVKZGUZCCUSVTD-UHFFFAOYSA-N carbonic acid Chemical compound OC(O)=O BVKZGUZCCUSVTD-UHFFFAOYSA-N 0.000 claims description 6
- 239000005711 Benzoic acid Substances 0.000 claims description 5
- 238000000034 method Methods 0.000 claims description 4
- 238000006243 chemical reaction Methods 0.000 claims description 3
- 238000010521 absorption reaction Methods 0.000 claims description 2
- 150000001765 catechin Chemical class 0.000 claims 1
- ADRVNXBAWSRFAJ-UHFFFAOYSA-N catechin Natural products OC1Cc2cc(O)cc(O)c2OC1c3ccc(O)c(O)c3 ADRVNXBAWSRFAJ-UHFFFAOYSA-N 0.000 claims 1
- 235000005487 catechin Nutrition 0.000 claims 1
- YCIMNLLNPGFGHC-UHFFFAOYSA-N catechol Chemical compound OC1=CC=CC=C1O YCIMNLLNPGFGHC-UHFFFAOYSA-N 0.000 description 10
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 9
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 description 4
- 239000002253 acid Substances 0.000 description 3
- 159000000000 sodium salts Chemical class 0.000 description 3
- PEDCQBHIVMGVHV-UHFFFAOYSA-N Glycerine Chemical compound OCC(O)CO PEDCQBHIVMGVHV-UHFFFAOYSA-N 0.000 description 2
- 239000001569 carbon dioxide Substances 0.000 description 2
- 229910002092 carbon dioxide Inorganic materials 0.000 description 2
- 238000010438 heat treatment Methods 0.000 description 2
- IJJWOSAXNHWBPR-HUBLWGQQSA-N 5-[(3as,4s,6ar)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]-n-(6-hydrazinyl-6-oxohexyl)pentanamide Chemical compound N1C(=O)N[C@@H]2[C@H](CCCCC(=O)NCCCCCC(=O)NN)SC[C@@H]21 IJJWOSAXNHWBPR-HUBLWGQQSA-N 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate Chemical compound [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 description 1
- QXNVGIXVLWOKEQ-UHFFFAOYSA-N Disodium Chemical compound [Na][Na] QXNVGIXVLWOKEQ-UHFFFAOYSA-N 0.000 description 1
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 1
- JOGPSICFISISRF-ZDUSSCGKSA-N [2-methoxy-5-[[[(2s)-1-methoxy-3-methyl-1-oxobutan-2-yl]amino]methyl]phenyl]boronic acid Chemical compound COC(=O)[C@H](C(C)C)NCC1=CC=C(OC)C(B(O)O)=C1 JOGPSICFISISRF-ZDUSSCGKSA-N 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 235000011187 glycerol Nutrition 0.000 description 1
- 229910052739 hydrogen Inorganic materials 0.000 description 1
- 239000001257 hydrogen Substances 0.000 description 1
- 210000004072 lung Anatomy 0.000 description 1
- 229910052751 metal Inorganic materials 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- 238000012805 post-processing Methods 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
Family
ID=
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2855231C3 (de) | Kontinuierliches Verfahren zur Herstellung von Glykolen | |
| DE918093C (de) | Verfahren zur Herstellung von substituierten Essigsaeuren mit Ausnahme von Glykolsaeure | |
| DE3207746A1 (de) | Verfahren zur herstellung von trimethylolpropan | |
| DE2944295C2 (de) | Verfahren zur Herstellung von racemischer p-Hydroxy-Mandelsäure | |
| DE752696A (OSRAM) | ||
| DE2026538B2 (de) | Verfahren zur gleichzeitigen Herstellung von 2-Amino-l-butanol und 2-Amino-2-äthyl-l 3-propandiol | |
| DE60107121T2 (de) | Verfahren zur herstellung von fluormethylhexafluorisopropyl-ether | |
| DE1643275B2 (de) | Verfahren zur Herstellung von 1,3-Diaminopropanol-(2) | |
| DE2614827C2 (de) | Verfahren zur Herstellung von 3-Phenylpyridazon-(6) | |
| DE694992C (de) | Verfahren zur Herstellung niederer aliphatischer primaerer Oxyalkylamine | |
| DE851194C (de) | Verfahren zur Herstellung von monomerem ªŠ-Caprolactam | |
| DE943165C (de) | Verfahren zur kontinuierlichen Herstellung von Hydroxylaminsulfatloesungen | |
| DE670475C (de) | Verfahren zur Herstellung von Halogenalkylen | |
| DE734475C (de) | Verfahren zur Herstellung von Polyaminoaethern | |
| DE584840C (de) | Verfahren zur Darstellung von Vinylaethern | |
| DE864251C (de) | Verfahren zur Herstellung hydroaromatischer Aldehyde und bzw. oder Alkohole | |
| DE674966C (de) | Verfahren zur Herstellung von Formamid | |
| DE803837C (de) | Verfahren zur Herstellung von n-Butenylamin | |
| DE1125419B (de) | Verfahren zur Herstellung von 1, 3-Bis-(ªÏ-carboxyalkyl)-harnstoffen | |
| DE622308C (de) | Verfahren zur Herstellung von o-Aminonaphthalincarbonsaeuren | |
| DE645725C (de) | Herstellung von Alkalinitraten aus Alkalichloriden und Salpetersaeure | |
| DE747518C (de) | Verfahren zur Herstellung von kapillaraktiven Schwefelsaeureestern | |
| DE919666C (de) | Verfahren zur Herstellung von Carbonsaeuregruppen tragenden Kunstharzaustauschern auf phenolischer Grundlage | |
| DE895898C (de) | Verfahren zur Herstellung von ª‡-alkylsubstituierten Carbonsaeuren | |
| DE863795C (de) | Verfahren zur Herstellung von 1, 2, 6-Hexantriol |