DE69713109T2 - Verbindungen mit wachstumshormon freisetzenden eigenschaften - Google Patents
Verbindungen mit wachstumshormon freisetzenden eigenschaftenInfo
- Publication number
- DE69713109T2 DE69713109T2 DE69713109T DE69713109T DE69713109T2 DE 69713109 T2 DE69713109 T2 DE 69713109T2 DE 69713109 T DE69713109 T DE 69713109T DE 69713109 T DE69713109 T DE 69713109T DE 69713109 T2 DE69713109 T2 DE 69713109T2
- Authority
- DE
- Germany
- Prior art keywords
- ethyl
- methyl
- naphthyl
- mmol
- solution
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired - Lifetime
Links
- 102000018997 Growth Hormone Human genes 0.000 title claims abstract description 39
- 108010051696 Growth Hormone Proteins 0.000 title claims abstract description 39
- 239000000122 growth hormone Substances 0.000 title claims abstract description 39
- 230000003578 releasing effect Effects 0.000 title description 5
- 150000001875 compounds Chemical class 0.000 claims abstract description 114
- 241001465754 Metazoa Species 0.000 claims abstract description 14
- 238000004519 manufacturing process Methods 0.000 claims abstract description 11
- 230000012010 growth Effects 0.000 claims abstract description 10
- 239000003814 drug Substances 0.000 claims abstract description 9
- 210000002268 wool Anatomy 0.000 claims abstract description 5
- 235000013336 milk Nutrition 0.000 claims abstract description 4
- 239000008267 milk Substances 0.000 claims abstract description 4
- 210000004080 milk Anatomy 0.000 claims abstract description 4
- 239000000203 mixture Substances 0.000 claims description 37
- 229910052739 hydrogen Inorganic materials 0.000 claims description 28
- 239000001257 hydrogen Substances 0.000 claims description 28
- 125000004169 (C1-C6) alkyl group Chemical group 0.000 claims description 27
- -1 amino, hydroxyl Chemical group 0.000 claims description 27
- 150000003839 salts Chemical class 0.000 claims description 19
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical group [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 14
- 125000003118 aryl group Chemical group 0.000 claims description 14
- 159000000021 acetate salts Chemical class 0.000 claims description 13
- 229910052736 halogen Inorganic materials 0.000 claims description 13
- 150000002367 halogens Chemical group 0.000 claims description 13
- 206010062767 Hypophysitis Diseases 0.000 claims description 12
- 210000003635 pituitary gland Anatomy 0.000 claims description 12
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 11
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims description 9
- 239000008194 pharmaceutical composition Substances 0.000 claims description 9
- 230000004936 stimulating effect Effects 0.000 claims description 9
- 206010053759 Growth retardation Diseases 0.000 claims description 8
- 239000004480 active ingredient Substances 0.000 claims description 8
- 239000003937 drug carrier Substances 0.000 claims description 8
- 231100000001 growth retardation Toxicity 0.000 claims description 8
- 125000004191 (C1-C6) alkoxy group Chemical group 0.000 claims description 7
- 230000015556 catabolic process Effects 0.000 claims description 7
- 239000003085 diluting agent Substances 0.000 claims description 7
- 230000000694 effects Effects 0.000 claims description 7
- 150000002431 hydrogen Chemical class 0.000 claims description 7
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 7
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 claims description 6
- 208000011580 syndromic disease Diseases 0.000 claims description 6
- 102000004169 proteins and genes Human genes 0.000 claims description 5
- 108090000623 proteins and genes Proteins 0.000 claims description 5
- XXAPNPUABGNKAW-GDLZYMKVSA-N 3-(aminomethyl)-n-[(2r)-1-[2-[2-(2-hydroxyethoxy)phenyl]ethyl-methylamino]-3-naphthalen-2-yl-1-oxopropan-2-yl]benzamide Chemical compound O=C([C@@H](CC=1C=C2C=CC=CC2=CC=1)NC(=O)C=1C=C(CN)C=CC=1)N(C)CCC1=CC=CC=C1OCCO XXAPNPUABGNKAW-GDLZYMKVSA-N 0.000 claims description 4
- 208000017667 Chronic Disease Diseases 0.000 claims description 4
- 206010056438 Growth hormone deficiency Diseases 0.000 claims description 4
- 208000008589 Obesity Diseases 0.000 claims description 4
- 208000001647 Renal Insufficiency Diseases 0.000 claims description 4
- 208000020221 Short stature Diseases 0.000 claims description 4
- 150000001408 amides Chemical class 0.000 claims description 4
- 230000007423 decrease Effects 0.000 claims description 4
- 201000010099 disease Diseases 0.000 claims description 4
- 230000013632 homeostatic process Effects 0.000 claims description 4
- 210000000987 immune system Anatomy 0.000 claims description 4
- 230000006698 induction Effects 0.000 claims description 4
- 201000006370 kidney failure Diseases 0.000 claims description 4
- 235000020824 obesity Nutrition 0.000 claims description 4
- 230000029663 wound healing Effects 0.000 claims description 4
- PKVGEUCCBFDWEF-YBLZLUOVSA-N (e)-5-[[(2r)-2-hydroxypropyl]amino]-n,5-dimethyl-n-[(2r)-1-[methyl(2-phenylethyl)amino]-3-naphthalen-2-yl-1-oxopropan-2-yl]hex-2-enamide Chemical compound O=C([C@@H](CC=1C=C2C=CC=CC2=CC=1)N(C)C(=O)/C=C/CC(C)(C)NC[C@H](O)C)N(C)CCC1=CC=CC=C1 PKVGEUCCBFDWEF-YBLZLUOVSA-N 0.000 claims description 3
- IEEUKABHJLYTDI-UDKPXMKSSA-N (e)-5-amino-n,5-dimethyl-n-[(2r)-1-[methyl(2-phenylethyl)amino]-3-naphthalen-2-yl-1-oxopropan-2-yl]hex-2-enamide Chemical compound O=C([C@@H](CC=1C=C2C=CC=CC2=CC=1)N(C)C(=O)\C=C\CC(C)(C)N)N(C)CCC1=CC=CC=C1 IEEUKABHJLYTDI-UDKPXMKSSA-N 0.000 claims description 3
- NKTMLMJWHNDQDF-VISBSAOHSA-N (e)-5-amino-n,5-dimethyl-n-[(2r)-1-[methyl(2-thiophen-2-ylethyl)amino]-3-naphthalen-2-yl-1-oxopropan-2-yl]hex-2-enamide Chemical compound O=C([C@@H](CC=1C=C2C=CC=CC2=CC=1)N(C)C(=O)\C=C\CC(C)(C)N)N(C)CCC1=CC=CS1 NKTMLMJWHNDQDF-VISBSAOHSA-N 0.000 claims description 3
- WAMMBZKCAXKZKW-LZZUIANGSA-N (e)-5-amino-n-[(2r)-1-[2-[2-(2-hydroxyethoxy)phenyl]ethyl-methylamino]-3-naphthalen-2-yl-1-oxopropan-2-yl]-n,5-dimethylhex-2-enamide Chemical compound O=C([C@@H](CC=1C=C2C=CC=CC2=CC=1)N(C)C(=O)\C=C\CC(C)(C)N)N(C)CCC1=CC=CC=C1OCCO WAMMBZKCAXKZKW-LZZUIANGSA-N 0.000 claims description 3
- QUDVOSPQRDYTCI-BYFPVTHSSA-N (e)-5-amino-n-[(2r)-1-[2-[2-(benzenesulfonamido)phenyl]ethyl-methylamino]-3-naphthalen-2-yl-1-oxopropan-2-yl]-n,5-dimethylhex-2-enamide Chemical compound O=C([C@@H](CC=1C=C2C=CC=CC2=CC=1)N(C)C(=O)\C=C\CC(C)(C)N)N(C)CCC1=CC=CC=C1NS(=O)(=O)C1=CC=CC=C1 QUDVOSPQRDYTCI-BYFPVTHSSA-N 0.000 claims description 3
- BOSXPQNYNMINOQ-MGUPHCMFSA-N (e)-5-amino-n-[(2r)-1-[2-[2-(methanesulfonamido)phenyl]ethyl-methylamino]-3-naphthalen-2-yl-1-oxopropan-2-yl]-n,5-dimethylhex-2-enamide Chemical compound O=C([C@@H](CC=1C=C2C=CC=CC2=CC=1)N(C)C(=O)\C=C\CC(C)(C)N)N(C)CCC1=CC=CC=C1NS(C)(=O)=O BOSXPQNYNMINOQ-MGUPHCMFSA-N 0.000 claims description 3
- ITQNUYSUYRVNQP-LZZUIANGSA-N (e)-5-amino-n-[(2r)-1-[2-[2-[(2-aminoacetyl)amino]phenyl]ethyl-methylamino]-3-naphthalen-2-yl-1-oxopropan-2-yl]-n,5-dimethylhex-2-enamide Chemical compound O=C([C@@H](CC=1C=C2C=CC=CC2=CC=1)N(C)C(=O)\C=C\CC(C)(C)N)N(C)CCC1=CC=CC=C1NC(=O)CN ITQNUYSUYRVNQP-LZZUIANGSA-N 0.000 claims description 3
- COPOOZYPAUETCC-FEBJRPPSSA-N (e)-n,5-dimethyl-5-(methylamino)-n-[(2r)-1-[methyl(2-phenylethyl)amino]-3-naphthalen-2-yl-1-oxopropan-2-yl]hex-2-enamide Chemical compound O=C([C@@H](CC=1C=C2C=CC=CC2=CC=1)N(C)C(=O)/C=C/CC(C)(C)NC)N(C)CCC1=CC=CC=C1 COPOOZYPAUETCC-FEBJRPPSSA-N 0.000 claims description 3
- GYIPHGRIGGSXCL-BVEXFFHSSA-N (e)-n-[(2r)-1-[2-[2-(2-hydroxyethoxy)phenyl]ethyl-methylamino]-3-naphthalen-2-yl-1-oxopropan-2-yl]-n,5-dimethyl-5-(methylamino)hex-2-enamide Chemical compound O=C([C@@H](CC=1C=C2C=CC=CC2=CC=1)N(C)C(=O)/C=C/CC(C)(C)NC)N(C)CCC1=CC=CC=C1OCCO GYIPHGRIGGSXCL-BVEXFFHSSA-N 0.000 claims description 3
- YEJLGCGPEJEPLW-ZSTWXAJCSA-N 3-(1-aminoethyl)-n-methyl-n-[(2r)-1-[methyl(2-thiophen-2-ylethyl)amino]-3-naphthalen-2-yl-1-oxopropan-2-yl]benzamide Chemical compound CC(N)C1=CC=CC(C(=O)N(C)[C@H](CC=2C=C3C=CC=CC3=CC=2)C(=O)N(C)CCC=2SC=CC=2)=C1 YEJLGCGPEJEPLW-ZSTWXAJCSA-N 0.000 claims description 3
- 241001494479 Pecora Species 0.000 claims description 3
- 239000002552 dosage form Substances 0.000 claims description 3
- 230000002503 metabolic effect Effects 0.000 claims description 3
- 230000002685 pulmonary effect Effects 0.000 claims description 3
- XYTIFQRQPIRQKL-LNFHGXOESA-N (e)-5-amino-n,5-dimethyl-n-[(2r)-1-[methyl(2-thiophen-2-ylethyl)amino]-1-oxo-3-(4-phenylphenyl)propan-2-yl]hex-2-enamide Chemical compound O=C([C@@H](CC=1C=CC(=CC=1)C=1C=CC=CC=1)N(C)C(=O)\C=C\CC(C)(C)N)N(C)CCC1=CC=CS1 XYTIFQRQPIRQKL-LNFHGXOESA-N 0.000 claims description 2
- LRHAXAVCVRWWKU-PVBLUSGHSA-N (e)-n,5-dimethyl-5-(methylamino)-n-[(2r)-1-[methyl(2-thiophen-2-ylethyl)amino]-3-naphthalen-2-yl-1-oxopropan-2-yl]hex-2-enamide Chemical compound O=C([C@@H](CC=1C=C2C=CC=CC2=CC=1)N(C)C(=O)/C=C/CC(C)(C)NC)N(C)CCC1=CC=CS1 LRHAXAVCVRWWKU-PVBLUSGHSA-N 0.000 claims description 2
- 208000030507 AIDS Diseases 0.000 claims description 2
- 208000024827 Alzheimer disease Diseases 0.000 claims description 2
- 208000010392 Bone Fractures Diseases 0.000 claims description 2
- 206010006895 Cachexia Diseases 0.000 claims description 2
- 208000014311 Cushing syndrome Diseases 0.000 claims description 2
- 208000001362 Fetal Growth Retardation Diseases 0.000 claims description 2
- 206010070531 Foetal growth restriction Diseases 0.000 claims description 2
- 208000037171 Hypercorticoidism Diseases 0.000 claims description 2
- 206010060378 Hyperinsulinaemia Diseases 0.000 claims description 2
- 206010028980 Neoplasm Diseases 0.000 claims description 2
- 208000000713 Nesidioblastosis Diseases 0.000 claims description 2
- 208000004286 Osteochondrodysplasias Diseases 0.000 claims description 2
- 208000001132 Osteoporosis Diseases 0.000 claims description 2
- 201000010769 Prader-Willi syndrome Diseases 0.000 claims description 2
- 206010072610 Skeletal dysplasia Diseases 0.000 claims description 2
- 201000005255 adrenal gland hyperfunction Diseases 0.000 claims description 2
- 230000032683 aging Effects 0.000 claims description 2
- 208000022531 anorexia Diseases 0.000 claims description 2
- 230000010072 bone remodeling Effects 0.000 claims description 2
- 201000011510 cancer Diseases 0.000 claims description 2
- 210000000845 cartilage Anatomy 0.000 claims description 2
- 230000001925 catabolic effect Effects 0.000 claims description 2
- 238000006243 chemical reaction Methods 0.000 claims description 2
- 206010061428 decreased appetite Diseases 0.000 claims description 2
- 230000003111 delayed effect Effects 0.000 claims description 2
- 208000030941 fetal growth restriction Diseases 0.000 claims description 2
- 239000003862 glucocorticoid Substances 0.000 claims description 2
- 230000003451 hyperinsulinaemic effect Effects 0.000 claims description 2
- 201000008980 hyperinsulinism Diseases 0.000 claims description 2
- 230000005980 lung dysfunction Effects 0.000 claims description 2
- 210000003205 muscle Anatomy 0.000 claims description 2
- 210000000963 osteoblast Anatomy 0.000 claims description 2
- 230000016087 ovulation Effects 0.000 claims description 2
- 238000007911 parenteral administration Methods 0.000 claims description 2
- 230000000541 pulsatile effect Effects 0.000 claims description 2
- 238000011084 recovery Methods 0.000 claims description 2
- 230000008439 repair process Effects 0.000 claims description 2
- 201000000980 schizophrenia Diseases 0.000 claims description 2
- 230000035882 stress Effects 0.000 claims description 2
- 238000001356 surgical procedure Methods 0.000 claims description 2
- 229940037128 systemic glucocorticoids Drugs 0.000 claims description 2
- 230000005313 thymus development Effects 0.000 claims description 2
- 210000001541 thymus gland Anatomy 0.000 claims description 2
- 208000001072 type 2 diabetes mellitus Diseases 0.000 claims description 2
- KXDAEFPNCMNJSK-UHFFFAOYSA-N Benzamide Chemical compound NC(=O)C1=CC=CC=C1 KXDAEFPNCMNJSK-UHFFFAOYSA-N 0.000 claims 2
- VFRSADQPWYCXDG-LEUCUCNGSA-N ethyl (2s,5s)-5-methylpyrrolidine-2-carboxylate;2,2,2-trifluoroacetic acid Chemical compound OC(=O)C(F)(F)F.CCOC(=O)[C@@H]1CC[C@H](C)N1 VFRSADQPWYCXDG-LEUCUCNGSA-N 0.000 claims 2
- VIMOBOVSUKYOAI-LNFHGXOESA-N (e)-5-amino-n-[(2r)-1-[2-[2-(2-hydroxyethoxy)phenyl]ethyl-methylamino]-3-naphthalen-2-yl-1-oxopropan-2-yl]-5-methylhex-2-enamide Chemical compound O=C([C@@H](CC=1C=C2C=CC=CC2=CC=1)NC(=O)\C=C\CC(C)(C)N)N(C)CCC1=CC=CC=C1OCCO VIMOBOVSUKYOAI-LNFHGXOESA-N 0.000 claims 1
- 206010062016 Immunosuppression Diseases 0.000 claims 1
- 230000001506 immunosuppresive effect Effects 0.000 claims 1
- 230000017363 positive regulation of growth Effects 0.000 claims 1
- 108090000765 processed proteins & peptides Proteins 0.000 abstract description 12
- 238000000034 method Methods 0.000 abstract description 11
- 102000004196 processed proteins & peptides Human genes 0.000 abstract description 7
- 238000002360 preparation method Methods 0.000 abstract description 5
- 230000001817 pituitary effect Effects 0.000 abstract description 4
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 543
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 387
- 239000000243 solution Substances 0.000 description 238
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 167
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 162
- HEDRZPFGACZZDS-MICDWDOJSA-N Trichloro(2H)methane Chemical compound [2H]C(Cl)(Cl)Cl HEDRZPFGACZZDS-MICDWDOJSA-N 0.000 description 156
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 155
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 147
- 239000002904 solvent Substances 0.000 description 107
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 87
- 239000011541 reaction mixture Substances 0.000 description 87
- 238000005160 1H NMR spectroscopy Methods 0.000 description 84
- IMNFDUFMRHMDMM-UHFFFAOYSA-N N-Heptane Chemical compound CCCCCCC IMNFDUFMRHMDMM-UHFFFAOYSA-N 0.000 description 84
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 81
- 235000019341 magnesium sulphate Nutrition 0.000 description 81
- 239000000377 silicon dioxide Substances 0.000 description 80
- 239000012043 crude product Substances 0.000 description 76
- DTQVDTLACAAQTR-UHFFFAOYSA-N Trifluoroacetic acid Chemical compound OC(=O)C(F)(F)F DTQVDTLACAAQTR-UHFFFAOYSA-N 0.000 description 72
- 238000003818 flash chromatography Methods 0.000 description 68
- 235000017557 sodium bicarbonate Nutrition 0.000 description 67
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 67
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 58
- 239000003480 eluent Substances 0.000 description 55
- 239000010410 layer Substances 0.000 description 52
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 50
- 239000007864 aqueous solution Substances 0.000 description 43
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 43
- 239000012074 organic phase Substances 0.000 description 42
- 229920006395 saturated elastomer Polymers 0.000 description 38
- 239000007787 solid Substances 0.000 description 37
- QGZKDVFQNNGYKY-UHFFFAOYSA-N ammonia Natural products N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 35
- 239000012044 organic layer Substances 0.000 description 34
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 33
- 239000008346 aqueous phase Substances 0.000 description 33
- 238000010792 warming Methods 0.000 description 32
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 30
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 30
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 30
- WBHQBSYUUJJSRZ-UHFFFAOYSA-M sodium bisulfate Chemical compound [Na+].OS([O-])(=O)=O WBHQBSYUUJJSRZ-UHFFFAOYSA-M 0.000 description 29
- 229910000342 sodium bisulfate Inorganic materials 0.000 description 29
- FPQQSJJWHUJYPU-UHFFFAOYSA-N 3-(dimethylamino)propyliminomethylidene-ethylazanium;chloride Chemical compound Cl.CCN=C=NCCCN(C)C FPQQSJJWHUJYPU-UHFFFAOYSA-N 0.000 description 28
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 27
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 27
- JGFZNNIVVJXRND-UHFFFAOYSA-N N,N-Diisopropylethylamine (DIPEA) Chemical compound CCN(C(C)C)C(C)C JGFZNNIVVJXRND-UHFFFAOYSA-N 0.000 description 26
- 238000004128 high performance liquid chromatography Methods 0.000 description 25
- 238000004949 mass spectrometry Methods 0.000 description 25
- FPIRBHDGWMWJEP-UHFFFAOYSA-N 1-hydroxy-7-azabenzotriazole Chemical compound C1=CN=C2N(O)N=NC2=C1 FPIRBHDGWMWJEP-UHFFFAOYSA-N 0.000 description 24
- 229960000583 acetic acid Drugs 0.000 description 17
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 16
- 235000011054 acetic acid Nutrition 0.000 description 16
- BZLVMXJERCGZMT-UHFFFAOYSA-N Methyl tert-butyl ether Chemical compound COC(C)(C)C BZLVMXJERCGZMT-UHFFFAOYSA-N 0.000 description 15
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 15
- 238000004108 freeze drying Methods 0.000 description 13
- NRPOEGFAIJAQIE-VOTSOKGWSA-N (e)-5-methyl-5-[(2-methylpropan-2-yl)oxycarbonylamino]hex-2-enoic acid Chemical compound CC(C)(C)OC(=O)NC(C)(C)C\C=C\C(O)=O NRPOEGFAIJAQIE-VOTSOKGWSA-N 0.000 description 12
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 12
- KRKNYBCHXYNGOX-UHFFFAOYSA-N citric acid Chemical compound OC(=O)CC(O)(C(O)=O)CC(O)=O KRKNYBCHXYNGOX-UHFFFAOYSA-N 0.000 description 12
- 239000012071 phase Substances 0.000 description 12
- 239000000872 buffer Substances 0.000 description 11
- 238000011835 investigation Methods 0.000 description 10
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 10
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 9
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 9
- WTGCDTYRZPRKIL-MRXNPFEDSA-N (2r)-2-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]-3-naphthalen-2-ylpropanoic acid Chemical compound C1=CC=CC2=CC(C[C@@H](N(C)C(=O)OC(C)(C)C)C(O)=O)=CC=C21 WTGCDTYRZPRKIL-MRXNPFEDSA-N 0.000 description 8
- DYHSDKLCOJIUFX-UHFFFAOYSA-N tert-butoxycarbonyl anhydride Chemical compound CC(C)(C)OC(=O)OC(=O)OC(C)(C)C DYHSDKLCOJIUFX-UHFFFAOYSA-N 0.000 description 8
- LFKDJXLFVYVEFG-UHFFFAOYSA-N tert-butyl carbamate Chemical compound CC(C)(C)OC(N)=O LFKDJXLFVYVEFG-UHFFFAOYSA-N 0.000 description 8
- 102100033367 Appetite-regulating hormone Human genes 0.000 description 7
- 239000007788 liquid Substances 0.000 description 7
- 230000000638 stimulation Effects 0.000 description 7
- 239000000725 suspension Substances 0.000 description 7
- WFDIJRYMOXRFFG-UHFFFAOYSA-N Acetic anhydride Chemical compound CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 description 6
- IAZDPXIOMUYVGZ-WFGJKAKNSA-N Dimethyl sulfoxide Chemical compound [2H]C([2H])([2H])S(=O)C([2H])([2H])[2H] IAZDPXIOMUYVGZ-WFGJKAKNSA-N 0.000 description 6
- BAVYZALUXZFZLV-UHFFFAOYSA-N Methylamine Chemical compound NC BAVYZALUXZFZLV-UHFFFAOYSA-N 0.000 description 6
- 241000700159 Rattus Species 0.000 description 6
- 210000004027 cell Anatomy 0.000 description 6
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 6
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 6
- 229910052740 iodine Inorganic materials 0.000 description 6
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 6
- 238000000746 purification Methods 0.000 description 6
- 238000010992 reflux Methods 0.000 description 6
- 238000012360 testing method Methods 0.000 description 6
- 210000001519 tissue Anatomy 0.000 description 6
- GRUPUGMHKPCNFQ-HXUWFJFHSA-N (2r)-n-methyl-2-(methylamino)-3-naphthalen-2-yl-n-(2-thiophen-2-ylethyl)propanamide Chemical compound O=C([C@@H](CC=1C=C2C=CC=CC2=CC=1)NC)N(C)CCC1=CC=CS1 GRUPUGMHKPCNFQ-HXUWFJFHSA-N 0.000 description 5
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 5
- 102000004190 Enzymes Human genes 0.000 description 5
- 108090000790 Enzymes Proteins 0.000 description 5
- 239000000095 Growth Hormone-Releasing Hormone Substances 0.000 description 5
- 102100022831 Somatoliberin Human genes 0.000 description 5
- 101710142969 Somatoliberin Proteins 0.000 description 5
- 238000006731 degradation reaction Methods 0.000 description 5
- 229940088598 enzyme Drugs 0.000 description 5
- 108010077689 gamma-aminobutyryl-2-methyltryptophyl-2-methyltryptophyl-2-methyltryptophyl-lysinamide Proteins 0.000 description 5
- 239000011630 iodine Substances 0.000 description 5
- 238000002955 isolation Methods 0.000 description 5
- 239000012047 saturated solution Substances 0.000 description 5
- 210000002966 serum Anatomy 0.000 description 5
- 239000012279 sodium borohydride Substances 0.000 description 5
- 229910000033 sodium borohydride Inorganic materials 0.000 description 5
- OGMCENUNFXNYPJ-UHFFFAOYSA-N tert-butyl n-[2-(2-aminophenyl)ethyl]-n-methylcarbamate Chemical compound CC(C)(C)OC(=O)N(C)CCC1=CC=CC=C1N OGMCENUNFXNYPJ-UHFFFAOYSA-N 0.000 description 5
- JGRBGTOLTGWPRJ-JOCHJYFZSA-N (2r)-2-amino-n-[2-[2-(2-hydroxyethoxy)phenyl]ethyl]-n-methyl-3-naphthalen-2-ylpropanamide Chemical compound O=C([C@H](N)CC=1C=C2C=CC=CC2=CC=1)N(C)CCC1=CC=CC=C1OCCO JGRBGTOLTGWPRJ-JOCHJYFZSA-N 0.000 description 4
- GCXQPGVKIIZBCV-HSZRJFAPSA-N (2r)-n-[2-[2-(2-hydroxyethoxy)phenyl]ethyl]-n-methyl-2-(methylamino)-3-naphthalen-2-ylpropanamide Chemical compound O=C([C@@H](CC=1C=C2C=CC=CC2=CC=1)NC)N(C)CCC1=CC=CC=C1OCCO GCXQPGVKIIZBCV-HSZRJFAPSA-N 0.000 description 4
- PHWYHLZCMCWUJY-JOCHJYFZSA-N (2r)-n-methyl-2-(methylamino)-3-naphthalen-2-yl-n-(2-phenylethyl)propanamide Chemical compound O=C([C@@H](CC=1C=C2C=CC=CC2=CC=1)NC)N(C)CCC1=CC=CC=C1 PHWYHLZCMCWUJY-JOCHJYFZSA-N 0.000 description 4
- MUIJITJDBKKILF-UHFFFAOYSA-N 2-[2-[2-(methylamino)ethyl]phenoxy]ethanol Chemical compound CNCCC1=CC=CC=C1OCCO MUIJITJDBKKILF-UHFFFAOYSA-N 0.000 description 4
- 238000005481 NMR spectroscopy Methods 0.000 description 4
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid Chemical compound OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 4
- 239000012267 brine Substances 0.000 description 4
- 150000001793 charged compounds Chemical class 0.000 description 4
- 238000004587 chromatography analysis Methods 0.000 description 4
- 238000004440 column chromatography Methods 0.000 description 4
- HQKMJHAJHXVSDF-UHFFFAOYSA-L magnesium stearate Chemical compound [Mg+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O HQKMJHAJHXVSDF-UHFFFAOYSA-L 0.000 description 4
- BDAGIHXWWSANSR-UHFFFAOYSA-N methanoic acid Natural products OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 description 4
- 239000002808 molecular sieve Substances 0.000 description 4
- IKSCPAWBLQEUAG-UHFFFAOYSA-N n-methyl-2-thiophen-2-ylethanamine Chemical compound CNCCC1=CC=CS1 IKSCPAWBLQEUAG-UHFFFAOYSA-N 0.000 description 4
- 239000000523 sample Substances 0.000 description 4
- URGAHOPLAPQHLN-UHFFFAOYSA-N sodium aluminosilicate Chemical compound [Na+].[Al+3].[O-][Si]([O-])=O.[O-][Si]([O-])=O URGAHOPLAPQHLN-UHFFFAOYSA-N 0.000 description 4
- BEOOHQFXGBMRKU-UHFFFAOYSA-N sodium cyanoborohydride Chemical compound [Na+].[B-]C#N BEOOHQFXGBMRKU-UHFFFAOYSA-N 0.000 description 4
- HPALAKNZSZLMCH-UHFFFAOYSA-M sodium;chloride;hydrate Chemical compound O.[Na+].[Cl-] HPALAKNZSZLMCH-UHFFFAOYSA-M 0.000 description 4
- FQFILJKFZCVHNH-UHFFFAOYSA-N tert-butyl n-[3-[(5-bromo-2-chloropyrimidin-4-yl)amino]propyl]carbamate Chemical compound CC(C)(C)OC(=O)NCCCNC1=NC(Cl)=NC=C1Br FQFILJKFZCVHNH-UHFFFAOYSA-N 0.000 description 4
- QHPYBXGVHANYTB-XMMPIXPASA-N (2r)-n-[2-[2-(3-hydroxypropoxy)phenyl]ethyl]-n-methyl-2-(methylamino)-3-naphthalen-2-ylpropanamide Chemical compound O=C([C@@H](CC=1C=C2C=CC=CC2=CC=1)NC)N(C)CCC1=CC=CC=C1OCCCO QHPYBXGVHANYTB-XMMPIXPASA-N 0.000 description 3
- DSQPLPYLPLPCGZ-MUUNZHRXSA-N (2r)-n-[2-[2-(benzenesulfonamido)phenyl]ethyl]-n-methyl-2-(methylamino)-3-naphthalen-2-ylpropanamide Chemical compound O=C([C@@H](CC=1C=C2C=CC=CC2=CC=1)NC)N(C)CCC1=CC=CC=C1NS(=O)(=O)C1=CC=CC=C1 DSQPLPYLPLPCGZ-MUUNZHRXSA-N 0.000 description 3
- XRDRGRQACLOLKF-HSZRJFAPSA-N (2r)-n-[2-[2-(methanesulfonamido)phenyl]ethyl]-n-methyl-2-(methylamino)-3-naphthalen-2-ylpropanamide Chemical compound O=C([C@@H](CC=1C=C2C=CC=CC2=CC=1)NC)N(C)CCC1=CC=CC=C1NS(C)(=O)=O XRDRGRQACLOLKF-HSZRJFAPSA-N 0.000 description 3
- MDEZSPBZNGJMIK-HSZRJFAPSA-N (2r)-n-methyl-2-(methylamino)-3-naphthalen-2-yl-n-(3-phenylpropyl)propanamide Chemical compound O=C([C@@H](CC=1C=C2C=CC=CC2=CC=1)NC)N(C)CCCC1=CC=CC=C1 MDEZSPBZNGJMIK-HSZRJFAPSA-N 0.000 description 3
- WPIBPYQCJGQYJE-MJQDKKEISA-N (e)-5-[[(2r)-2-[dimethyl-[(2-methylpropan-2-yl)oxy]silyl]oxypropyl]amino]-n,5-dimethyl-n-[(2r)-1-[methyl(2-phenylethyl)amino]-3-naphthalen-2-yl-1-oxopropan-2-yl]hex-2-enamide Chemical compound O=C([C@@H](CC=1C=C2C=CC=CC2=CC=1)N(C)C(=O)/C=C/CC(C)(C)NC[C@@H](C)O[Si](C)(C)OC(C)(C)C)N(C)CCC1=CC=CC=C1 WPIBPYQCJGQYJE-MJQDKKEISA-N 0.000 description 3
- KPUIBITXUURMJF-BQYQJAHWSA-N (e)-5-methyl-5-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]hex-2-enoic acid Chemical compound CC(C)(C)OC(=O)N(C)C(C)(C)C\C=C\C(O)=O KPUIBITXUURMJF-BQYQJAHWSA-N 0.000 description 3
- QBIAOTCAAUFLKP-UHFFFAOYSA-N 3-[2-[2-(methylamino)ethyl]phenoxy]propan-1-ol Chemical compound CNCCC1=CC=CC=C1OCCCO QBIAOTCAAUFLKP-UHFFFAOYSA-N 0.000 description 3
- UCYNJUHJNFGICB-DIPNUNPCSA-N 9h-fluoren-9-ylmethyl n-[2-[2-[2-[methyl-[(2r)-2-(methylamino)-3-naphthalen-2-ylpropanoyl]amino]ethyl]anilino]-2-oxoethyl]carbamate Chemical compound C12=CC=CC=C2C2=CC=CC=C2C1COC(=O)NCC(=O)NC1=CC=CC=C1CCN(C)C(=O)[C@H](NC)CC1=CC=C(C=CC=C2)C2=C1 UCYNJUHJNFGICB-DIPNUNPCSA-N 0.000 description 3
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 3
- 102100022749 Aminopeptidase N Human genes 0.000 description 3
- 108091003079 Bovine Serum Albumin Proteins 0.000 description 3
- 108010049990 CD13 Antigens Proteins 0.000 description 3
- 102000051325 Glucagon Human genes 0.000 description 3
- 108060003199 Glucagon Proteins 0.000 description 3
- WMFOQBRAJBCJND-UHFFFAOYSA-M Lithium hydroxide Chemical compound [Li+].[OH-] WMFOQBRAJBCJND-UHFFFAOYSA-M 0.000 description 3
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 3
- DNIAPMSPPWPWGF-UHFFFAOYSA-N Propylene glycol Chemical compound CC(O)CO DNIAPMSPPWPWGF-UHFFFAOYSA-N 0.000 description 3
- 108090000631 Trypsin Proteins 0.000 description 3
- 102000004142 Trypsin Human genes 0.000 description 3
- 239000002253 acid Substances 0.000 description 3
- 125000003545 alkoxy group Chemical group 0.000 description 3
- 125000000217 alkyl group Chemical group 0.000 description 3
- BFNBIHQBYMNNAN-UHFFFAOYSA-N ammonium sulfate Chemical compound N.N.OS(O)(=O)=O BFNBIHQBYMNNAN-UHFFFAOYSA-N 0.000 description 3
- 229910052921 ammonium sulfate Inorganic materials 0.000 description 3
- 235000011130 ammonium sulphate Nutrition 0.000 description 3
- 229940098773 bovine serum albumin Drugs 0.000 description 3
- 229910052799 carbon Inorganic materials 0.000 description 3
- 150000002148 esters Chemical class 0.000 description 3
- FEMLEJLXNKJPFL-CMDGGOBGSA-N ethyl (e)-5-methyl-5-[(2-methylpropan-2-yl)oxycarbonylamino]hex-2-enoate Chemical compound CCOC(=O)\C=C\CC(C)(C)NC(=O)OC(C)(C)C FEMLEJLXNKJPFL-CMDGGOBGSA-N 0.000 description 3
- QMYJQVPZCRLRHJ-UHFFFAOYSA-N ethyl 2-[2-[2-(methylamino)-2-oxoethyl]phenoxy]acetate Chemical compound CCOC(=O)COC1=CC=CC=C1CC(=O)NC QMYJQVPZCRLRHJ-UHFFFAOYSA-N 0.000 description 3
- 239000012458 free base Substances 0.000 description 3
- MASNOZXLGMXCHN-ZLPAWPGGSA-N glucagon Chemical compound C([C@@H](C(=O)N[C@H](C(=O)N[C@@H](CCC(N)=O)C(=O)N[C@@H](CC=1C2=CC=CC=C2NC=1)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CCSC)C(=O)N[C@@H](CC(N)=O)C(=O)N[C@@H]([C@@H](C)O)C(O)=O)C(C)C)NC(=O)[C@H](CC(O)=O)NC(=O)[C@H](CCC(N)=O)NC(=O)[C@H](C)NC(=O)[C@H](CCCNC(N)=N)NC(=O)[C@H](CCCNC(N)=N)NC(=O)[C@H](CO)NC(=O)[C@H](CC(O)=O)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](CC=1C=CC(O)=CC=1)NC(=O)[C@H](CCCCN)NC(=O)[C@H](CO)NC(=O)[C@H](CC=1C=CC(O)=CC=1)NC(=O)[C@H](CC(O)=O)NC(=O)[C@H](CO)NC(=O)[C@@H](NC(=O)[C@H](CC=1C=CC=CC=1)NC(=O)[C@@H](NC(=O)CNC(=O)[C@H](CCC(N)=O)NC(=O)[C@H](CO)NC(=O)[C@@H](N)CC=1NC=NC=1)[C@@H](C)O)[C@@H](C)O)C1=CC=CC=C1 MASNOZXLGMXCHN-ZLPAWPGGSA-N 0.000 description 3
- 229960004666 glucagon Drugs 0.000 description 3
- 229940088597 hormone Drugs 0.000 description 3
- 239000005556 hormone Substances 0.000 description 3
- HBWLGAIQNVAFGS-UHFFFAOYSA-N n-(2-thiophen-2-ylethyl)formamide Chemical compound O=CNCCC1=CC=CS1 HBWLGAIQNVAFGS-UHFFFAOYSA-N 0.000 description 3
- IJELUJLKMVZBTA-UHFFFAOYSA-N n-[2-[2-(methylamino)ethyl]phenyl]methanesulfonamide Chemical compound CNCCC1=CC=CC=C1NS(C)(=O)=O IJELUJLKMVZBTA-UHFFFAOYSA-N 0.000 description 3
- JKFQTSXUKNGFQF-UHFFFAOYSA-N n-methyl-2-(2-nitrophenyl)ethanamine Chemical compound CNCCC1=CC=CC=C1[N+]([O-])=O JKFQTSXUKNGFQF-UHFFFAOYSA-N 0.000 description 3
- VYKHIPPRCFLHGC-UHFFFAOYSA-N n-methyl-2-(2-phenylmethoxyphenyl)ethanamine Chemical compound CNCCC1=CC=CC=C1OCC1=CC=CC=C1 VYKHIPPRCFLHGC-UHFFFAOYSA-N 0.000 description 3
- MLHBZVFOTDJTPK-UHFFFAOYSA-N n-methyl-3-phenylpropan-1-amine Chemical compound CNCCCC1=CC=CC=C1 MLHBZVFOTDJTPK-UHFFFAOYSA-N 0.000 description 3
- 238000004987 plasma desorption mass spectroscopy Methods 0.000 description 3
- 229910000027 potassium carbonate Inorganic materials 0.000 description 3
- NLKNQRATVPKPDG-UHFFFAOYSA-M potassium iodide Chemical compound [K+].[I-] NLKNQRATVPKPDG-UHFFFAOYSA-M 0.000 description 3
- 238000000926 separation method Methods 0.000 description 3
- IXTJFBPUSDJOOZ-RUZDIDTESA-N tert-butyl (2r)-2-(naphthalen-2-ylmethyl)-3-oxo-4-(2-phenylethyl)piperazine-1-carboxylate Chemical compound CC(C)(C)OC(=O)N([C@@H](C1=O)CC=2C=C3C=CC=CC3=CC=2)CCN1CCC1=CC=CC=C1 IXTJFBPUSDJOOZ-RUZDIDTESA-N 0.000 description 3
- VNOWIHHJPAJYHL-UHFFFAOYSA-N tert-butyl n-(2-methyl-4-oxobutan-2-yl)carbamate Chemical compound CC(C)(C)OC(=O)NC(C)(C)CC=O VNOWIHHJPAJYHL-UHFFFAOYSA-N 0.000 description 3
- PGMODFIUGUASGZ-RUZDIDTESA-N tert-butyl n-[(2r)-1-[2-[2-(2-hydroxyethoxy)phenyl]ethyl-methylamino]-3-naphthalen-2-yl-1-oxopropan-2-yl]carbamate Chemical compound O=C([C@@H](CC=1C=C2C=CC=CC2=CC=1)NC(=O)OC(C)(C)C)N(C)CCC1=CC=CC=C1OCCO PGMODFIUGUASGZ-RUZDIDTESA-N 0.000 description 3
- ATUQAIUZNHEELU-AREMUKBSSA-N tert-butyl n-[(2r)-1-[2-[2-(methanesulfonamido)phenyl]ethyl-methylamino]-3-naphthalen-2-yl-1-oxopropan-2-yl]-n-methylcarbamate Chemical compound O=C([C@@H](CC=1C=C2C=CC=CC2=CC=1)N(C)C(=O)OC(C)(C)C)N(C)CCC1=CC=CC=C1NS(C)(=O)=O ATUQAIUZNHEELU-AREMUKBSSA-N 0.000 description 3
- COYDBRGLODAADT-RRHRGVEJSA-N tert-butyl n-[(2r)-1-[2-[2-[[2-(9h-fluoren-9-ylmethoxycarbonylamino)acetyl]amino]phenyl]ethyl-methylamino]-3-naphthalen-2-yl-1-oxopropan-2-yl]-n-methylcarbamate Chemical compound C1=CC=CC2=CC(C[C@H](C(=O)N(CCC=3C(=CC=CC=3)NC(=O)CNC(=O)OCC3C4=CC=CC=C4C4=CC=CC=C43)C)N(C)C(=O)OC(C)(C)C)=CC=C21 COYDBRGLODAADT-RRHRGVEJSA-N 0.000 description 3
- RZKYLTAOFXUGQT-VUGWLOFNSA-N tert-butyl n-[(e)-2-methyl-6-[methyl-[(2r)-1-[methyl(2-phenylethyl)amino]-3-naphthalen-2-yl-1-oxopropan-2-yl]amino]-6-oxohex-4-en-2-yl]carbamate Chemical compound O=C([C@@H](CC=1C=C2C=CC=CC2=CC=1)N(C)C(=O)\C=C\CC(C)(C)NC(=O)OC(C)(C)C)N(C)CCC1=CC=CC=C1 RZKYLTAOFXUGQT-VUGWLOFNSA-N 0.000 description 3
- QXOGOBCTWHELDJ-AJFHRXSQSA-N tert-butyl n-[(e)-2-methyl-6-[methyl-[(2r)-1-[methyl(2-thiophen-2-ylethyl)amino]-1-oxo-3-(4-phenylphenyl)propan-2-yl]amino]-6-oxohex-4-en-2-yl]carbamate Chemical compound O=C([C@@H](CC=1C=CC(=CC=1)C=1C=CC=CC=1)N(C)C(=O)\C=C\CC(C)(C)NC(=O)OC(C)(C)C)N(C)CCC1=CC=CS1 QXOGOBCTWHELDJ-AJFHRXSQSA-N 0.000 description 3
- ADPJKBGCYWFJBM-MGUPHCMFSA-N tert-butyl n-[(e)-2-methyl-6-[methyl-[(2r)-1-[methyl(2-thiophen-2-ylethyl)amino]-3-naphthalen-2-yl-1-oxopropan-2-yl]amino]-6-oxohex-4-en-2-yl]carbamate Chemical compound O=C([C@@H](CC=1C=C2C=CC=CC2=CC=1)N(C)C(=O)\C=C\CC(C)(C)NC(=O)OC(C)(C)C)N(C)CCC1=CC=CS1 ADPJKBGCYWFJBM-MGUPHCMFSA-N 0.000 description 3
- ZQYYWEQDOVXIMF-PTBVXMEYSA-N tert-butyl n-[(e)-2-methyl-6-[methyl-[(2r)-1-[methyl(3-phenylpropyl)amino]-3-naphthalen-2-yl-1-oxopropan-2-yl]amino]-6-oxohex-4-en-2-yl]carbamate Chemical compound O=C([C@@H](CC=1C=C2C=CC=CC2=CC=1)N(C)C(=O)\C=C\CC(C)(C)NC(=O)OC(C)(C)C)N(C)CCCC1=CC=CC=C1 ZQYYWEQDOVXIMF-PTBVXMEYSA-N 0.000 description 3
- ALMRAYMWVXRWSG-AJFHRXSQSA-N tert-butyl n-[(e)-6-[[(2r)-1-[2-[2-(2-hydroxyethoxy)phenyl]ethyl-methylamino]-3-naphthalen-2-yl-1-oxopropan-2-yl]amino]-2-methyl-6-oxohex-4-en-2-yl]carbamate Chemical compound O=C([C@@H](CC=1C=C2C=CC=CC2=CC=1)NC(=O)\C=C\CC(C)(C)NC(=O)OC(C)(C)C)N(C)CCC1=CC=CC=C1OCCO ALMRAYMWVXRWSG-AJFHRXSQSA-N 0.000 description 3
- MGACKQQSBCULAV-UGEDMRGCSA-N tert-butyl n-[(e)-6-[[(2r)-1-[2-[2-(benzenesulfonamido)phenyl]ethyl-methylamino]-3-naphthalen-2-yl-1-oxopropan-2-yl]-methylamino]-2-methyl-6-oxohex-4-en-2-yl]carbamate Chemical compound O=C([C@@H](CC=1C=C2C=CC=CC2=CC=1)N(C)C(=O)\C=C\CC(C)(C)NC(=O)OC(C)(C)C)N(C)CCC1=CC=CC=C1NS(=O)(=O)C1=CC=CC=C1 MGACKQQSBCULAV-UGEDMRGCSA-N 0.000 description 3
- SSHATODEVYSGMB-OISAQCFMSA-N tert-butyl n-[(e)-6-[[(2r)-1-[2-[2-(methanesulfonamido)phenyl]ethyl-methylamino]-3-naphthalen-2-yl-1-oxopropan-2-yl]-methylamino]-2-methyl-6-oxohex-4-en-2-yl]carbamate Chemical compound O=C([C@@H](CC=1C=C2C=CC=CC2=CC=1)N(C)C(=O)\C=C\CC(C)(C)NC(=O)OC(C)(C)C)N(C)CCC1=CC=CC=C1NS(C)(=O)=O SSHATODEVYSGMB-OISAQCFMSA-N 0.000 description 3
- AXPDNXNENCEPIP-UHFFFAOYSA-N tert-butyl n-[2-(2-hydroxyphenyl)ethyl]-n-methylcarbamate Chemical compound CC(C)(C)OC(=O)N(C)CCC1=CC=CC=C1O AXPDNXNENCEPIP-UHFFFAOYSA-N 0.000 description 3
- SLOGJROQBYVYSN-UHFFFAOYSA-N tert-butyl n-[2-[2-(3-hydroxypropoxy)phenyl]ethyl]-n-methylcarbamate Chemical compound CC(C)(C)OC(=O)N(C)CCC1=CC=CC=C1OCCCO SLOGJROQBYVYSN-UHFFFAOYSA-N 0.000 description 3
- QFXQAMWVBWDXIJ-UHFFFAOYSA-N tert-butyl n-[2-[2-(methanesulfonamido)phenyl]ethyl]-n-methylcarbamate Chemical compound CC(C)(C)OC(=O)N(C)CCC1=CC=CC=C1NS(C)(=O)=O QFXQAMWVBWDXIJ-UHFFFAOYSA-N 0.000 description 3
- DPXWHUAINQKQGG-UHFFFAOYSA-N tert-butyl n-[2-[2-[[2-(9h-fluoren-9-ylmethoxycarbonylamino)acetyl]amino]phenyl]ethyl]-n-methylcarbamate Chemical compound CC(C)(C)OC(=O)N(C)CCC1=CC=CC=C1NC(=O)CNC(=O)OCC1C2=CC=CC=C2C2=CC=CC=C21 DPXWHUAINQKQGG-UHFFFAOYSA-N 0.000 description 3
- QVXRETVKPOPWNI-RUZDIDTESA-N tert-butyl n-methyl-n-[(2r)-1-[methyl(2-thiophen-2-ylethyl)amino]-1-oxo-3-(4-phenylphenyl)propan-2-yl]carbamate Chemical compound O=C([C@@H](CC=1C=CC(=CC=1)C=1C=CC=CC=1)N(C)C(=O)OC(C)(C)C)N(C)CCC1=CC=CS1 QVXRETVKPOPWNI-RUZDIDTESA-N 0.000 description 3
- RCLDGOPOQHVUGY-HSZRJFAPSA-N tert-butyl n-methyl-n-[(2r)-1-[methyl(2-thiophen-2-ylethyl)amino]-3-naphthalen-2-yl-1-oxopropan-2-yl]carbamate Chemical compound O=C([C@@H](CC=1C=C2C=CC=CC2=CC=1)N(C)C(=O)OC(C)(C)C)N(C)CCC1=CC=CS1 RCLDGOPOQHVUGY-HSZRJFAPSA-N 0.000 description 3
- PTHANPCZBHOMGL-AREMUKBSSA-N tert-butyl n-methyl-n-[(2r)-1-[methyl(3-phenylpropyl)amino]-3-naphthalen-2-yl-1-oxopropan-2-yl]carbamate Chemical compound O=C([C@@H](CC=1C=C2C=CC=CC2=CC=1)N(C)C(=O)OC(C)(C)C)N(C)CCCC1=CC=CC=C1 PTHANPCZBHOMGL-AREMUKBSSA-N 0.000 description 3
- LDRCSXFMBNAQSL-OHBRYSKOSA-N tert-butyl n-methyl-n-[(e)-2-methyl-6-[methyl-[(2r)-1-[methyl(2-phenylethyl)amino]-3-naphthalen-2-yl-1-oxopropan-2-yl]amino]-6-oxohex-4-en-2-yl]carbamate Chemical compound O=C([C@@H](CC=1C=C2C=CC=CC2=CC=1)N(C)C(=O)\C=C\CC(C)(C)N(C)C(=O)OC(C)(C)C)N(C)CCC1=CC=CC=C1 LDRCSXFMBNAQSL-OHBRYSKOSA-N 0.000 description 3
- KJDSVUQKZBQRBA-UHFFFAOYSA-N tert-butyl n-methyl-n-[2-(2-nitrophenyl)ethyl]carbamate Chemical compound CC(C)(C)OC(=O)N(C)CCC1=CC=CC=C1[N+]([O-])=O KJDSVUQKZBQRBA-UHFFFAOYSA-N 0.000 description 3
- AIIXIHKHSADRGN-UHFFFAOYSA-N tert-butyl n-methyl-n-[2-(2-phenylmethoxyphenyl)ethyl]carbamate Chemical compound CC(C)(C)OC(=O)N(C)CCC1=CC=CC=C1OCC1=CC=CC=C1 AIIXIHKHSADRGN-UHFFFAOYSA-N 0.000 description 3
- 239000012588 trypsin Substances 0.000 description 3
- CCVYRRGZDBSHFU-UHFFFAOYSA-N (2-hydroxyphenyl)acetic acid Chemical compound OC(=O)CC1=CC=CC=C1O CCVYRRGZDBSHFU-UHFFFAOYSA-N 0.000 description 2
- ZUSDIXVXKSYBLT-GOSISDBHSA-N (2r)-2-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]-3-(4-phenylphenyl)propanoic acid Chemical compound C1=CC(C[C@@H](N(C)C(=O)OC(C)(C)C)C(O)=O)=CC=C1C1=CC=CC=C1 ZUSDIXVXKSYBLT-GOSISDBHSA-N 0.000 description 2
- ASLTYORRFWSCEY-JOCHJYFZSA-N (2r)-n-methyl-2-(methylamino)-3-(4-phenylphenyl)-n-(2-thiophen-2-ylethyl)propanamide Chemical compound C([C@@H](NC)C(=O)N(C)CCC=1SC=CC=1)C(C=C1)=CC=C1C1=CC=CC=C1 ASLTYORRFWSCEY-JOCHJYFZSA-N 0.000 description 2
- MYLLYGVXNGGEDL-CQSZACIVSA-N (3r)-3-(naphthalen-2-ylmethyl)piperazin-2-one Chemical compound O=C1NCCN[C@@H]1CC1=CC=C(C=CC=C2)C2=C1 MYLLYGVXNGGEDL-CQSZACIVSA-N 0.000 description 2
- HAAUASBAIUJHAN-LXOXETEGSA-N (4s)-4-[[(2s)-2-amino-4-methylsulfanylbutanoyl]amino]-5-[[(2s)-1-[[(2s)-1-[[(2s)-1-[[(2s)-1-(carboxymethylamino)-3-(1h-indol-3-yl)-1-oxopropan-2-yl]amino]-5-(diaminomethylideneamino)-1-oxopentan-2-yl]amino]-1-oxo-3-phenylpropan-2-yl]amino]-3-(1h-imidazol- Chemical compound C([C@H](NC(=O)[C@H](CCC(O)=O)NC(=O)[C@@H](N)CCSC)C(=O)N[C@@H](CC=1C=CC=CC=1)C(=O)N[C@@H](CCCN=C(N)N)C(=O)N[C@@H](CC=1C2=CC=CC=C2NC=1)C(=O)NCC(O)=O)C1=CN=CN1 HAAUASBAIUJHAN-LXOXETEGSA-N 0.000 description 2
- LMDZBCPBFSXMTL-UHFFFAOYSA-N 1-ethyl-3-(3-dimethylaminopropyl)carbodiimide Chemical compound CCN=C=NCCCN(C)C LMDZBCPBFSXMTL-UHFFFAOYSA-N 0.000 description 2
- PJUPKRYGDFTMTM-UHFFFAOYSA-N 1-hydroxybenzotriazole;hydrate Chemical compound O.C1=CC=C2N(O)N=NC2=C1 PJUPKRYGDFTMTM-UHFFFAOYSA-N 0.000 description 2
- VBICKXHEKHSIBG-UHFFFAOYSA-N 1-monostearoylglycerol Chemical compound CCCCCCCCCCCCCCCCCC(=O)OCC(O)CO VBICKXHEKHSIBG-UHFFFAOYSA-N 0.000 description 2
- DJQVPXPEXAWGRE-UHFFFAOYSA-N 2,3-dihydrotriazolo[4,5-b]pyridin-7-one Chemical compound O=C1C=CN=C2NNN=C12 DJQVPXPEXAWGRE-UHFFFAOYSA-N 0.000 description 2
- FSNCWQAANDOQAW-UHFFFAOYSA-N 2-(2-hydroxyphenyl)-n-methylacetamide Chemical compound CNC(=O)CC1=CC=CC=C1O FSNCWQAANDOQAW-UHFFFAOYSA-N 0.000 description 2
- JKMHFZQWWAIEOD-UHFFFAOYSA-N 2-[4-(2-hydroxyethyl)piperazin-1-yl]ethanesulfonic acid Chemical compound OCC[NH+]1CCN(CCS([O-])(=O)=O)CC1 JKMHFZQWWAIEOD-UHFFFAOYSA-N 0.000 description 2
- 125000000022 2-aminoethyl group Chemical group [H]C([*])([H])C([H])([H])N([H])[H] 0.000 description 2
- IZHVBANLECCAGF-UHFFFAOYSA-N 2-hydroxy-3-(octadecanoyloxy)propyl octadecanoate Chemical compound CCCCCCCCCCCCCCCCCC(=O)OCC(O)COC(=O)CCCCCCCCCCCCCCCCC IZHVBANLECCAGF-UHFFFAOYSA-N 0.000 description 2
- OSWFIVFLDKOXQC-UHFFFAOYSA-N 4-(3-methoxyphenyl)aniline Chemical compound COC1=CC=CC(C=2C=CC(N)=CC=2)=C1 OSWFIVFLDKOXQC-UHFFFAOYSA-N 0.000 description 2
- USFZMSVCRYTOJT-UHFFFAOYSA-N Ammonium acetate Chemical compound N.CC(O)=O USFZMSVCRYTOJT-UHFFFAOYSA-N 0.000 description 2
- 239000005695 Ammonium acetate Substances 0.000 description 2
- ATRRKUHOCOJYRX-UHFFFAOYSA-N Ammonium bicarbonate Chemical compound [NH4+].OC([O-])=O ATRRKUHOCOJYRX-UHFFFAOYSA-N 0.000 description 2
- 229910000013 Ammonium bicarbonate Inorganic materials 0.000 description 2
- 108010064733 Angiotensins Proteins 0.000 description 2
- 102000015427 Angiotensins Human genes 0.000 description 2
- KHBQMWCZKVMBLN-UHFFFAOYSA-N Benzenesulfonamide Chemical compound NS(=O)(=O)C1=CC=CC=C1 KHBQMWCZKVMBLN-UHFFFAOYSA-N 0.000 description 2
- 239000005711 Benzoic acid Substances 0.000 description 2
- 108090000087 Carboxypeptidase B Proteins 0.000 description 2
- 102000003670 Carboxypeptidase B Human genes 0.000 description 2
- 102000005572 Cathepsin A Human genes 0.000 description 2
- 108010059081 Cathepsin A Proteins 0.000 description 2
- 108090000317 Chymotrypsin Proteins 0.000 description 2
- 229920000858 Cyclodextrin Polymers 0.000 description 2
- RGHNJXZEOKUKBD-SQOUGZDYSA-N D-gluconic acid Chemical compound OC[C@@H](O)[C@@H](O)[C@H](O)[C@@H](O)C(O)=O RGHNJXZEOKUKBD-SQOUGZDYSA-N 0.000 description 2
- VZCYOOQTPOCHFL-OWOJBTEDSA-N Fumaric acid Chemical compound OC(=O)\C=C\C(O)=O VZCYOOQTPOCHFL-OWOJBTEDSA-N 0.000 description 2
- WQZGKKKJIJFFOK-GASJEMHNSA-N Glucose Natural products OC[C@H]1OC(O)[C@H](O)[C@@H](O)[C@@H]1O WQZGKKKJIJFFOK-GASJEMHNSA-N 0.000 description 2
- 239000007995 HEPES buffer Substances 0.000 description 2
- 108090000723 Insulin-Like Growth Factor I Proteins 0.000 description 2
- AFVFQIVMOAPDHO-UHFFFAOYSA-N Methanesulfonic acid Chemical compound CS(O)(=O)=O AFVFQIVMOAPDHO-UHFFFAOYSA-N 0.000 description 2
- 108010067372 Pancreatic elastase Proteins 0.000 description 2
- 102000016387 Pancreatic elastase Human genes 0.000 description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 2
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 2
- 102000005157 Somatostatin Human genes 0.000 description 2
- 108010056088 Somatostatin Proteins 0.000 description 2
- DTQVDTLACAAQTR-UHFFFAOYSA-M Trifluoroacetate Chemical compound [O-]C(=O)C(F)(F)F DTQVDTLACAAQTR-UHFFFAOYSA-M 0.000 description 2
- RIUHTCYCVSHAPY-UHFFFAOYSA-N [2-[2-[2-(methylamino)ethyl]anilino]-2-oxoethyl]carbamic acid Chemical compound CNCCC1=CC=CC=C1NC(=O)CNC(O)=O RIUHTCYCVSHAPY-UHFFFAOYSA-N 0.000 description 2
- 230000001133 acceleration Effects 0.000 description 2
- 230000009471 action Effects 0.000 description 2
- 239000008186 active pharmaceutical agent Substances 0.000 description 2
- 239000000443 aerosol Substances 0.000 description 2
- 235000019257 ammonium acetate Nutrition 0.000 description 2
- 229940043376 ammonium acetate Drugs 0.000 description 2
- 235000012538 ammonium bicarbonate Nutrition 0.000 description 2
- 239000001099 ammonium carbonate Substances 0.000 description 2
- 238000004458 analytical method Methods 0.000 description 2
- 239000012298 atmosphere Substances 0.000 description 2
- 235000010233 benzoic acid Nutrition 0.000 description 2
- 239000012496 blank sample Substances 0.000 description 2
- 239000000969 carrier Substances 0.000 description 2
- 239000001913 cellulose Substances 0.000 description 2
- 229920002678 cellulose Polymers 0.000 description 2
- 229960002376 chymotrypsin Drugs 0.000 description 2
- 125000004122 cyclic group Chemical group 0.000 description 2
- 239000007857 degradation product Substances 0.000 description 2
- 235000014113 dietary fatty acids Nutrition 0.000 description 2
- 208000035475 disorder Diseases 0.000 description 2
- 239000006185 dispersion Substances 0.000 description 2
- 238000002330 electrospray ionisation mass spectrometry Methods 0.000 description 2
- 239000003797 essential amino acid Substances 0.000 description 2
- 235000020776 essential amino acid Nutrition 0.000 description 2
- 239000000194 fatty acid Substances 0.000 description 2
- 229930195729 fatty acid Natural products 0.000 description 2
- 238000004401 flow injection analysis Methods 0.000 description 2
- 235000019253 formic acid Nutrition 0.000 description 2
- 239000007903 gelatin capsule Substances 0.000 description 2
- 238000010438 heat treatment Methods 0.000 description 2
- NPZTUJOABDZTLV-UHFFFAOYSA-N hydroxybenzotriazole Substances O=C1C=CC=C2NNN=C12 NPZTUJOABDZTLV-UHFFFAOYSA-N 0.000 description 2
- 210000003016 hypothalamus Anatomy 0.000 description 2
- 125000002883 imidazolyl group Chemical group 0.000 description 2
- 238000000338 in vitro Methods 0.000 description 2
- 238000001727 in vivo Methods 0.000 description 2
- 125000001041 indolyl group Chemical group 0.000 description 2
- INQOMBQAUSQDDS-UHFFFAOYSA-N iodomethane Chemical compound IC INQOMBQAUSQDDS-UHFFFAOYSA-N 0.000 description 2
- 150000002500 ions Chemical class 0.000 description 2
- JVTAAEKCZFNVCJ-UHFFFAOYSA-N lactic acid Chemical compound CC(O)C(O)=O JVTAAEKCZFNVCJ-UHFFFAOYSA-N 0.000 description 2
- 235000019359 magnesium stearate Nutrition 0.000 description 2
- 239000000463 material Substances 0.000 description 2
- 239000002609 medium Substances 0.000 description 2
- 238000002844 melting Methods 0.000 description 2
- 230000008018 melting Effects 0.000 description 2
- CVXIWUKKHBZQDI-GOSISDBHSA-N methyl (2r)-2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethylamino]-3-naphthalen-2-ylpropanoate Chemical compound C1=CC=CC2=CC(C[C@H](C(=O)OC)NCCNC(=O)OC(C)(C)C)=CC=C21 CVXIWUKKHBZQDI-GOSISDBHSA-N 0.000 description 2
- 238000012544 monitoring process Methods 0.000 description 2
- 239000001788 mono and diglycerides of fatty acids Substances 0.000 description 2
- DTMJCJINCCWTTG-UHFFFAOYSA-N n-(3-phenylpropyl)formamide Chemical compound O=CNCCCC1=CC=CC=C1 DTMJCJINCCWTTG-UHFFFAOYSA-N 0.000 description 2
- ONHWNARPSWLBLK-UHFFFAOYSA-N n-methyl-2-(2-nitrophenyl)acetamide Chemical compound CNC(=O)CC1=CC=CC=C1[N+]([O-])=O ONHWNARPSWLBLK-UHFFFAOYSA-N 0.000 description 2
- RITUYECJZZQANJ-UHFFFAOYSA-N n-methyl-2-(2-phenylmethoxyphenyl)acetamide Chemical compound CNC(=O)CC1=CC=CC=C1OCC1=CC=CC=C1 RITUYECJZZQANJ-UHFFFAOYSA-N 0.000 description 2
- SASNBVQSOZSTPD-UHFFFAOYSA-N n-methylphenethylamine Chemical compound CNCCC1=CC=CC=C1 SASNBVQSOZSTPD-UHFFFAOYSA-N 0.000 description 2
- 125000001624 naphthyl group Chemical group 0.000 description 2
- 230000003287 optical effect Effects 0.000 description 2
- 125000001715 oxadiazolyl group Chemical group 0.000 description 2
- CTSLXHKWHWQRSH-UHFFFAOYSA-N oxalyl chloride Chemical compound ClC(=O)C(Cl)=O CTSLXHKWHWQRSH-UHFFFAOYSA-N 0.000 description 2
- XNGIFLGASWRNHJ-UHFFFAOYSA-N phthalic acid Chemical compound OC(=O)C1=CC=CC=C1C(O)=O XNGIFLGASWRNHJ-UHFFFAOYSA-N 0.000 description 2
- 239000002244 precipitate Substances 0.000 description 2
- 230000002265 prevention Effects 0.000 description 2
- 239000000047 product Substances 0.000 description 2
- 230000017854 proteolysis Effects 0.000 description 2
- 125000004076 pyridyl group Chemical group 0.000 description 2
- 125000002943 quinolinyl group Chemical group N1=C(C=CC2=CC=CC=C12)* 0.000 description 2
- YGSDEFSMJLZEOE-UHFFFAOYSA-N salicylic acid Chemical compound OC(=O)C1=CC=CC=C1O YGSDEFSMJLZEOE-UHFFFAOYSA-N 0.000 description 2
- HFHDHCJBZVLPGP-UHFFFAOYSA-N schardinger α-dextrin Chemical compound O1C(C(C2O)O)C(CO)OC2OC(C(C2O)O)C(CO)OC2OC(C(C2O)O)C(CO)OC2OC(C(O)C2O)C(CO)OC2OC(C(C2O)O)C(CO)OC2OC2C(O)C(O)C1OC2CO HFHDHCJBZVLPGP-UHFFFAOYSA-N 0.000 description 2
- 230000000580 secretagogue effect Effects 0.000 description 2
- 239000012312 sodium hydride Substances 0.000 description 2
- 229910000104 sodium hydride Inorganic materials 0.000 description 2
- AKHNMLFCWUSKQB-UHFFFAOYSA-L sodium thiosulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=S AKHNMLFCWUSKQB-UHFFFAOYSA-L 0.000 description 2
- 235000019345 sodium thiosulphate Nutrition 0.000 description 2
- NHXLMOGPVYXJNR-ATOGVRKGSA-N somatostatin Chemical compound C([C@H]1C(=O)N[C@H](C(N[C@@H](CO)C(=O)N[C@@H](CSSC[C@@H](C(=O)N[C@@H](CCCCN)C(=O)N[C@@H](CC(N)=O)C(=O)N[C@@H](CC=2C=CC=CC=2)C(=O)N[C@@H](CC=2C=CC=CC=2)C(=O)N[C@@H](CC=2C3=CC=CC=C3NC=2)C(=O)N[C@@H](CCCCN)C(=O)N[C@H](C(=O)N1)[C@@H](C)O)NC(=O)CNC(=O)[C@H](C)N)C(O)=O)=O)[C@H](O)C)C1=CC=CC=C1 NHXLMOGPVYXJNR-ATOGVRKGSA-N 0.000 description 2
- 229960000553 somatostatin Drugs 0.000 description 2
- 239000006188 syrup Substances 0.000 description 2
- 235000020357 syrup Nutrition 0.000 description 2
- 239000003826 tablet Substances 0.000 description 2
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 2
- QHSUFODBDZQCHO-UHFFFAOYSA-N tert-butyl n-(4-hydroxy-2-methylbutan-2-yl)carbamate Chemical compound CC(C)(C)OC(=O)NC(C)(C)CCO QHSUFODBDZQCHO-UHFFFAOYSA-N 0.000 description 2
- DWPRBYCPTWSMEF-AREMUKBSSA-N tert-butyl n-[(2r)-1-[2-[2-(2-hydroxyethoxy)phenyl]ethyl-methylamino]-3-naphthalen-2-yl-1-oxopropan-2-yl]-n-methylcarbamate Chemical compound O=C([C@@H](CC=1C=C2C=CC=CC2=CC=1)N(C)C(=O)OC(C)(C)C)N(C)CCC1=CC=CC=C1OCCO DWPRBYCPTWSMEF-AREMUKBSSA-N 0.000 description 2
- FHXFYLBFBHJQOI-WJOKGBTCSA-N tert-butyl n-[(2r)-1-[2-[2-(benzenesulfonamido)phenyl]ethyl-methylamino]-3-naphthalen-2-yl-1-oxopropan-2-yl]-n-methylcarbamate Chemical compound O=C([C@@H](CC=1C=C2C=CC=CC2=CC=1)N(C)C(=O)OC(C)(C)C)N(C)CCC1=CC=CC=C1NS(=O)(=O)C1=CC=CC=C1 FHXFYLBFBHJQOI-WJOKGBTCSA-N 0.000 description 2
- FRHGMPRMZCJWTD-ODMPMCBYSA-N tert-butyl n-[(e)-6-[[(2r)-1-[2-[2-(2-hydroxyethoxy)phenyl]ethyl-methylamino]-3-naphthalen-2-yl-1-oxopropan-2-yl]-methylamino]-2-methyl-6-oxohex-4-en-2-yl]carbamate Chemical compound O=C([C@@H](CC=1C=C2C=CC=CC2=CC=1)N(C)C(=O)\C=C\CC(C)(C)NC(=O)OC(C)(C)C)N(C)CCC1=CC=CC=C1OCCO FRHGMPRMZCJWTD-ODMPMCBYSA-N 0.000 description 2
- XDKBZGVDRJSORA-BMXGUMNWSA-N tert-butyl n-[1-[3-[methyl-[(2r)-1-[methyl(2-thiophen-2-ylethyl)amino]-3-naphthalen-2-yl-1-oxopropan-2-yl]carbamoyl]phenyl]ethyl]carbamate Chemical compound CC(C)(C)OC(=O)NC(C)C1=CC=CC(C(=O)N(C)[C@H](CC=2C=C3C=CC=CC3=CC=2)C(=O)N(C)CCC=2SC=CC=2)=C1 XDKBZGVDRJSORA-BMXGUMNWSA-N 0.000 description 2
- URLJARPNICDPGN-KPHCWXNXSA-N tert-butyl n-methyl-n-[(e)-2-methyl-6-[methyl-[(2r)-1-[methyl(2-thiophen-2-ylethyl)amino]-3-naphthalen-2-yl-1-oxopropan-2-yl]amino]-6-oxohex-4-en-2-yl]carbamate Chemical compound O=C([C@@H](CC=1C=C2C=CC=CC2=CC=1)N(C)C(=O)\C=C\CC(C)(C)N(C)C(=O)OC(C)(C)C)N(C)CCC1=CC=CS1 URLJARPNICDPGN-KPHCWXNXSA-N 0.000 description 2
- 125000001544 thienyl group Chemical group 0.000 description 2
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 2
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 2
- 238000000825 ultraviolet detection Methods 0.000 description 2
- 239000003643 water by type Substances 0.000 description 2
- WMUZDBZPDLHUMW-UHFFFAOYSA-N (2-nitrophenyl)acetic acid Chemical compound OC(=O)CC1=CC=CC=C1[N+]([O-])=O WMUZDBZPDLHUMW-UHFFFAOYSA-N 0.000 description 1
- NBVVKAUSAGHTSU-QGZVFWFLSA-N (2r)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-(4-phenylphenyl)propanoic acid Chemical compound C1=CC(C[C@@H](NC(=O)OC(C)(C)C)C(O)=O)=CC=C1C1=CC=CC=C1 NBVVKAUSAGHTSU-QGZVFWFLSA-N 0.000 description 1
- URKWHOVNPHQQTM-OAHLLOKOSA-N (2r)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-naphthalen-2-ylpropanoic acid Chemical compound C1=CC=CC2=CC(C[C@@H](NC(=O)OC(C)(C)C)C(O)=O)=CC=C21 URKWHOVNPHQQTM-OAHLLOKOSA-N 0.000 description 1
- YMIIHJBTQLZXBV-MRVPVSSYSA-N (2r)-2-[tert-butyl(dimethyl)silyl]oxypropanal Chemical compound O=C[C@@H](C)O[Si](C)(C)C(C)(C)C YMIIHJBTQLZXBV-MRVPVSSYSA-N 0.000 description 1
- VIYKYVYAKVNDPS-HKGPVOKGSA-N (2s)-2-azanyl-3-[3,4-bis(oxidanyl)phenyl]propanoic acid Chemical compound OC(=O)[C@@H](N)CC1=CC=C(O)C(O)=C1.OC(=O)[C@@H](N)CC1=CC=C(O)C(O)=C1 VIYKYVYAKVNDPS-HKGPVOKGSA-N 0.000 description 1
- WZHKXNSOCOQYQX-FUAFALNISA-N (2s)-6-amino-2-[[(2r)-2-[[(2s)-2-[[(2s)-2-[[(2r)-2-[[(2s)-2-amino-3-(1h-imidazol-5-yl)propanoyl]amino]-3-(1h-indol-3-yl)propanoyl]amino]propanoyl]amino]-3-(1h-indol-3-yl)propanoyl]amino]-3-phenylpropanoyl]amino]hexanamide Chemical compound C([C@H](N)C(=O)N[C@H](CC=1C2=CC=CC=C2NC=1)C(=O)N[C@@H](C)C(=O)N[C@@H](CC=1C2=CC=CC=C2NC=1)C(=O)N[C@H](CC=1C=CC=CC=1)C(=O)N[C@@H](CCCCN)C(N)=O)C1=CN=CN1 WZHKXNSOCOQYQX-FUAFALNISA-N 0.000 description 1
- 125000005913 (C3-C6) cycloalkyl group Chemical group 0.000 description 1
- BKMADDIPSQRZPU-ONEGZZNKSA-N (e)-5-amino-5-methylhex-2-enoic acid Chemical compound CC(C)(N)C\C=C\C(O)=O BKMADDIPSQRZPU-ONEGZZNKSA-N 0.000 description 1
- ZKOVFTZDSOPHPD-VAACGYSUSA-N (e)-5-amino-n,5-dimethyl-n-[(2r)-1-[methyl(3-phenylpropyl)amino]-3-naphthalen-2-yl-1-oxopropan-2-yl]hex-2-enamide Chemical compound O=C([C@@H](CC=1C=C2C=CC=CC2=CC=1)N(C)C(=O)\C=C\CC(C)(C)N)N(C)CCCC1=CC=CC=C1 ZKOVFTZDSOPHPD-VAACGYSUSA-N 0.000 description 1
- OPYWSHGMSHPLKU-JDFRNFQTSA-N (e)-5-amino-n-[(2r)-1-[2-[2-(3-hydroxypropoxy)phenyl]ethyl-methylamino]-3-naphthalen-2-yl-1-oxopropan-2-yl]-n,5-dimethylhex-2-enamide Chemical compound O=C([C@@H](CC=1C=C2C=CC=CC2=CC=1)N(C)C(=O)\C=C\CC(C)(C)N)N(C)CCC1=CC=CC=C1OCCCO OPYWSHGMSHPLKU-JDFRNFQTSA-N 0.000 description 1
- LDVVTQMJQSCDMK-UHFFFAOYSA-N 1,3-dihydroxypropan-2-yl formate Chemical class OCC(CO)OC=O LDVVTQMJQSCDMK-UHFFFAOYSA-N 0.000 description 1
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 1
- ASOKPJOREAFHNY-UHFFFAOYSA-N 1-Hydroxybenzotriazole Chemical compound C1=CC=C2N(O)N=NC2=C1 ASOKPJOREAFHNY-UHFFFAOYSA-N 0.000 description 1
- RTBFRGCFXZNCOE-UHFFFAOYSA-N 1-methylsulfonylpiperidin-4-one Chemical compound CS(=O)(=O)N1CCC(=O)CC1 RTBFRGCFXZNCOE-UHFFFAOYSA-N 0.000 description 1
- IIZPXYDJLKNOIY-JXPKJXOSSA-N 1-palmitoyl-2-arachidonoyl-sn-glycero-3-phosphocholine Chemical compound CCCCCCCCCCCCCCCC(=O)OC[C@H](COP([O-])(=O)OCC[N+](C)(C)C)OC(=O)CCC\C=C/C\C=C/C\C=C/C\C=C/CCCCC IIZPXYDJLKNOIY-JXPKJXOSSA-N 0.000 description 1
- VFYKRBZHJFJOGQ-UHFFFAOYSA-N 2-(2-phenylmethoxyphenyl)acetic acid Chemical compound OC(=O)CC1=CC=CC=C1OCC1=CC=CC=C1 VFYKRBZHJFJOGQ-UHFFFAOYSA-N 0.000 description 1
- NDKDFTQNXLHCGO-UHFFFAOYSA-N 2-(9h-fluoren-9-ylmethoxycarbonylamino)acetic acid Chemical compound C1=CC=C2C(COC(=O)NCC(=O)O)C3=CC=CC=C3C2=C1 NDKDFTQNXLHCGO-UHFFFAOYSA-N 0.000 description 1
- LBLYYCQCTBFVLH-UHFFFAOYSA-N 2-Methylbenzenesulfonic acid Chemical compound CC1=CC=CC=C1S(O)(=O)=O LBLYYCQCTBFVLH-UHFFFAOYSA-N 0.000 description 1
- AFXKCBFBGDUFAM-UHFFFAOYSA-N 2-methylpropan-2-amine;hydrofluoride Chemical compound [F-].CC(C)(C)[NH3+] AFXKCBFBGDUFAM-UHFFFAOYSA-N 0.000 description 1
- WMPPDTMATNBGJN-UHFFFAOYSA-N 2-phenylethylbromide Chemical compound BrCCC1=CC=CC=C1 WMPPDTMATNBGJN-UHFFFAOYSA-N 0.000 description 1
- HVLUYXIJZLDNIS-UHFFFAOYSA-N 2-thiophen-2-ylethanamine Chemical compound NCCC1=CC=CS1 HVLUYXIJZLDNIS-UHFFFAOYSA-N 0.000 description 1
- JPZXHKDZASGCLU-GFCCVEGCSA-N 3-(2-Naphthyl)-D-Alanine Chemical compound C1=CC=CC2=CC(C[C@@H](N)C(O)=O)=CC=C21 JPZXHKDZASGCLU-GFCCVEGCSA-N 0.000 description 1
- RQFUZUMFPRMVDX-UHFFFAOYSA-N 3-Bromo-1-propanol Chemical compound OCCCBr RQFUZUMFPRMVDX-UHFFFAOYSA-N 0.000 description 1
- JWYITCUSPYOBSX-UHFFFAOYSA-N 3-[1-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl]benzoic acid Chemical compound CC(C)(C)OC(=O)NC(C)C1=CC=CC(C(O)=O)=C1 JWYITCUSPYOBSX-UHFFFAOYSA-N 0.000 description 1
- MQNHKLMHRZYTBZ-UHFFFAOYSA-N 3-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]benzoic acid Chemical compound CC(C)(C)OC(=O)NCC1=CC=CC(C(O)=O)=C1 MQNHKLMHRZYTBZ-UHFFFAOYSA-N 0.000 description 1
- SBCFGFDAZCTSRH-UHFFFAOYSA-N 3-acetylbenzonitrile Chemical compound CC(=O)C1=CC=CC(C#N)=C1 SBCFGFDAZCTSRH-UHFFFAOYSA-N 0.000 description 1
- BMYNFMYTOJXKLE-UHFFFAOYSA-N 3-azaniumyl-2-hydroxypropanoate Chemical compound NCC(O)C(O)=O BMYNFMYTOJXKLE-UHFFFAOYSA-N 0.000 description 1
- 125000004975 3-butenyl group Chemical group C(CC=C)* 0.000 description 1
- LHJVMOIOTPJSLS-UHFFFAOYSA-N 3-methyl-3-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid Chemical compound CC(C)(C)OC(=O)NC(C)(C)CC(O)=O LHJVMOIOTPJSLS-UHFFFAOYSA-N 0.000 description 1
- LYUQWQRTDLVQGA-UHFFFAOYSA-N 3-phenylpropylamine Chemical compound NCCCC1=CC=CC=C1 LYUQWQRTDLVQGA-UHFFFAOYSA-N 0.000 description 1
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 1
- 229910002012 Aerosil® Inorganic materials 0.000 description 1
- 229920001817 Agar Polymers 0.000 description 1
- GUBGYTABKSRVRQ-XLOQQCSPSA-N Alpha-Lactose Chemical compound O[C@@H]1[C@@H](O)[C@@H](O)[C@@H](CO)O[C@H]1O[C@@H]1[C@@H](CO)O[C@H](O)[C@H](O)[C@H]1O GUBGYTABKSRVRQ-XLOQQCSPSA-N 0.000 description 1
- 101710111255 Appetite-regulating hormone Proteins 0.000 description 1
- 101100495924 Arabidopsis thaliana DRD1 gene Proteins 0.000 description 1
- 239000004475 Arginine Substances 0.000 description 1
- 241000283690 Bos taurus Species 0.000 description 1
- 241000283707 Capra Species 0.000 description 1
- 229920002134 Carboxymethyl cellulose Polymers 0.000 description 1
- 102000005367 Carboxypeptidases Human genes 0.000 description 1
- 108010006303 Carboxypeptidases Proteins 0.000 description 1
- RGHNJXZEOKUKBD-UHFFFAOYSA-N D-gluconic acid Natural products OCC(O)C(O)C(O)C(O)C(O)=O RGHNJXZEOKUKBD-UHFFFAOYSA-N 0.000 description 1
- 102000016911 Deoxyribonucleases Human genes 0.000 description 1
- 108010053770 Deoxyribonucleases Proteins 0.000 description 1
- FEWJPZIEWOKRBE-JCYAYHJZSA-N Dextrotartaric acid Chemical compound OC(=O)[C@H](O)[C@@H](O)C(O)=O FEWJPZIEWOKRBE-JCYAYHJZSA-N 0.000 description 1
- 239000006144 Dulbecco’s modified Eagle's medium Substances 0.000 description 1
- 206010013883 Dwarfism Diseases 0.000 description 1
- 108010010803 Gelatin Proteins 0.000 description 1
- 101710119601 Growth hormone-releasing peptides Proteins 0.000 description 1
- 239000012981 Hank's balanced salt solution Substances 0.000 description 1
- 241001622557 Hesperia Species 0.000 description 1
- 102000004218 Insulin-Like Growth Factor I Human genes 0.000 description 1
- 108090001117 Insulin-Like Growth Factor II Proteins 0.000 description 1
- 102000048143 Insulin-Like Growth Factor II Human genes 0.000 description 1
- ODKSFYDXXFIFQN-BYPYZUCNSA-P L-argininium(2+) Chemical compound NC(=[NH2+])NCCC[C@H]([NH3+])C(O)=O ODKSFYDXXFIFQN-BYPYZUCNSA-P 0.000 description 1
- GUBGYTABKSRVRQ-QKKXKWKRSA-N Lactose Natural products OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)C(O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@H]1O GUBGYTABKSRVRQ-QKKXKWKRSA-N 0.000 description 1
- 235000010643 Leucaena leucocephala Nutrition 0.000 description 1
- 240000007472 Leucaena leucocephala Species 0.000 description 1
- 239000012448 Lithium borohydride Substances 0.000 description 1
- 241000124008 Mammalia Species 0.000 description 1
- 239000012359 Methanesulfonyl chloride Substances 0.000 description 1
- 102000014415 Muscarinic acetylcholine receptor Human genes 0.000 description 1
- 108050003473 Muscarinic acetylcholine receptor Proteins 0.000 description 1
- 239000000020 Nitrocellulose Substances 0.000 description 1
- 239000004677 Nylon Substances 0.000 description 1
- 235000019483 Peanut oil Nutrition 0.000 description 1
- 229920003171 Poly (ethylene oxide) Polymers 0.000 description 1
- OFOBLEOULBTSOW-UHFFFAOYSA-N Propanedioic acid Natural products OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 description 1
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical class [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 1
- 102000013275 Somatomedins Human genes 0.000 description 1
- 235000021355 Stearic acid Nutrition 0.000 description 1
- KDYFGRWQOYBRFD-UHFFFAOYSA-N Succinic acid Natural products OC(=O)CCC(O)=O KDYFGRWQOYBRFD-UHFFFAOYSA-N 0.000 description 1
- 229930006000 Sucrose Natural products 0.000 description 1
- CZMRCDWAGMRECN-UGDNZRGBSA-N Sucrose Chemical compound O[C@H]1[C@H](O)[C@@H](CO)O[C@@]1(CO)O[C@@H]1[C@H](O)[C@@H](O)[C@H](O)[C@@H](CO)O1 CZMRCDWAGMRECN-UGDNZRGBSA-N 0.000 description 1
- 241000282887 Suidae Species 0.000 description 1
- FEWJPZIEWOKRBE-UHFFFAOYSA-N Tartaric acid Natural products [H+].[H+].[O-]C(=O)C(O)C(O)C([O-])=O FEWJPZIEWOKRBE-UHFFFAOYSA-N 0.000 description 1
- OKJPEAGHQZHRQV-UHFFFAOYSA-N Triiodomethane Natural products IC(I)I OKJPEAGHQZHRQV-UHFFFAOYSA-N 0.000 description 1
- 101710162629 Trypsin inhibitor Proteins 0.000 description 1
- 229940122618 Trypsin inhibitor Drugs 0.000 description 1
- GXBMIBRIOWHPDT-UHFFFAOYSA-N Vasopressin Natural products N1C(=O)C(CC=2C=C(O)C=CC=2)NC(=O)C(N)CSSCC(C(=O)N2C(CCC2)C(=O)NC(CCCN=C(N)N)C(=O)NCC(N)=O)NC(=O)C(CC(N)=O)NC(=O)C(CCC(N)=O)NC(=O)C1CC1=CC=CC=C1 GXBMIBRIOWHPDT-UHFFFAOYSA-N 0.000 description 1
- 108010004977 Vasopressins Proteins 0.000 description 1
- 102000002852 Vasopressins Human genes 0.000 description 1
- 238000010521 absorption reaction Methods 0.000 description 1
- 230000003213 activating effect Effects 0.000 description 1
- 239000011149 active material Substances 0.000 description 1
- 239000000654 additive Substances 0.000 description 1
- 102000030621 adenylate cyclase Human genes 0.000 description 1
- 108060000200 adenylate cyclase Proteins 0.000 description 1
- 239000008272 agar Substances 0.000 description 1
- 235000010419 agar Nutrition 0.000 description 1
- 229910052783 alkali metal Inorganic materials 0.000 description 1
- 150000001340 alkali metals Chemical class 0.000 description 1
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 1
- 150000001342 alkaline earth metals Chemical class 0.000 description 1
- 125000005210 alkyl ammonium group Chemical group 0.000 description 1
- 150000005215 alkyl ethers Chemical class 0.000 description 1
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 1
- 229910021529 ammonia Inorganic materials 0.000 description 1
- JFCQEDHGNNZCLN-UHFFFAOYSA-N anhydrous glutaric acid Natural products OC(=O)CCCC(O)=O JFCQEDHGNNZCLN-UHFFFAOYSA-N 0.000 description 1
- 239000003242 anti bacterial agent Substances 0.000 description 1
- 239000008365 aqueous carrier Substances 0.000 description 1
- ODKSFYDXXFIFQN-UHFFFAOYSA-N arginine Natural products OC(=O)C(N)CCCNC(N)=N ODKSFYDXXFIFQN-UHFFFAOYSA-N 0.000 description 1
- KBZOIRJILGZLEJ-LGYYRGKSSA-N argipressin Chemical compound C([C@H]1C(=O)N[C@@H](CCC(N)=O)C(=O)N[C@@H](CC(N)=O)C(=O)N[C@@H](CSSC[C@@H](C(N[C@@H](CC=2C=CC(O)=CC=2)C(=O)N1)=O)N)C(=O)N1[C@@H](CCC1)C(=O)N[C@@H](CCCN=C(N)N)C(=O)NCC(N)=O)C1=CC=CC=C1 KBZOIRJILGZLEJ-LGYYRGKSSA-N 0.000 description 1
- 125000006615 aromatic heterocyclic group Chemical group 0.000 description 1
- 238000003556 assay Methods 0.000 description 1
- CSKNSYBAZOQPLR-UHFFFAOYSA-N benzenesulfonyl chloride Chemical compound ClS(=O)(=O)C1=CC=CC=C1 CSKNSYBAZOQPLR-UHFFFAOYSA-N 0.000 description 1
- 230000003115 biocidal effect Effects 0.000 description 1
- 230000037396 body weight Effects 0.000 description 1
- 229910052794 bromium Inorganic materials 0.000 description 1
- KDYFGRWQOYBRFD-NUQCWPJISA-N butanedioic acid Chemical compound O[14C](=O)CC[14C](O)=O KDYFGRWQOYBRFD-NUQCWPJISA-N 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- AIYUHDOJVYHVIT-UHFFFAOYSA-M caesium chloride Chemical compound [Cl-].[Cs+] AIYUHDOJVYHVIT-UHFFFAOYSA-M 0.000 description 1
- OSGAYBCDTDRGGQ-UHFFFAOYSA-L calcium sulfate Chemical compound [Ca+2].[O-]S([O-])(=O)=O OSGAYBCDTDRGGQ-UHFFFAOYSA-L 0.000 description 1
- 244000309466 calf Species 0.000 description 1
- 239000002775 capsule Substances 0.000 description 1
- 125000003917 carbamoyl group Chemical group [H]N([H])C(*)=O 0.000 description 1
- 125000002837 carbocyclic group Chemical group 0.000 description 1
- 150000001720 carbohydrates Chemical class 0.000 description 1
- KXDHJXZQYSOELW-UHFFFAOYSA-N carbonic acid monoamide Natural products NC(O)=O KXDHJXZQYSOELW-UHFFFAOYSA-N 0.000 description 1
- 239000001768 carboxy methyl cellulose Substances 0.000 description 1
- 235000010948 carboxy methyl cellulose Nutrition 0.000 description 1
- 239000003054 catalyst Substances 0.000 description 1
- 239000006285 cell suspension Substances 0.000 description 1
- 229910052801 chlorine Inorganic materials 0.000 description 1
- 239000011248 coating agent Substances 0.000 description 1
- 238000000576 coating method Methods 0.000 description 1
- 229940075614 colloidal silicon dioxide Drugs 0.000 description 1
- 238000007796 conventional method Methods 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 239000013078 crystal Substances 0.000 description 1
- 125000001995 cyclobutyl group Chemical group [H]C1([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- 125000002933 cyclohexyloxy group Chemical group C1(CCCCC1)O* 0.000 description 1
- 125000001511 cyclopentyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- 125000001559 cyclopropyl group Chemical group [H]C1([H])C([H])([H])C1([H])* 0.000 description 1
- 230000003247 decreasing effect Effects 0.000 description 1
- 238000003795 desorption Methods 0.000 description 1
- 229960003957 dexamethasone Drugs 0.000 description 1
- UREBDLICKHMUKA-CXSFZGCWSA-N dexamethasone Chemical compound C1CC2=CC(=O)C=C[C@]2(C)[C@]2(F)[C@@H]1[C@@H]1C[C@@H](C)[C@@](C(=O)CO)(O)[C@@]1(C)C[C@@H]2O UREBDLICKHMUKA-CXSFZGCWSA-N 0.000 description 1
- IJKVHSBPTUYDLN-UHFFFAOYSA-N dihydroxy(oxo)silane Chemical compound O[Si](O)=O IJKVHSBPTUYDLN-UHFFFAOYSA-N 0.000 description 1
- AYBSICMEDZIQTK-UHFFFAOYSA-K dipotassium sodium phosphoric acid phosphate Chemical compound [Na+].[K+].[K+].OP(O)(O)=O.[O-]P([O-])([O-])=O AYBSICMEDZIQTK-UHFFFAOYSA-K 0.000 description 1
- 231100000673 dose–response relationship Toxicity 0.000 description 1
- 238000000921 elemental analysis Methods 0.000 description 1
- 239000000839 emulsion Substances 0.000 description 1
- 230000037149 energy metabolism Effects 0.000 description 1
- 239000003623 enhancer Substances 0.000 description 1
- 239000012259 ether extract Substances 0.000 description 1
- PQJJJMRNHATNKG-UHFFFAOYSA-N ethyl bromoacetate Chemical compound CCOC(=O)CBr PQJJJMRNHATNKG-UHFFFAOYSA-N 0.000 description 1
- RIFGWPKJUGCATF-UHFFFAOYSA-N ethyl chloroformate Chemical compound CCOC(Cl)=O RIFGWPKJUGCATF-UHFFFAOYSA-N 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 230000008020 evaporation Effects 0.000 description 1
- 230000001747 exhibiting effect Effects 0.000 description 1
- 239000000284 extract Substances 0.000 description 1
- 230000004129 fatty acid metabolism Effects 0.000 description 1
- 150000004665 fatty acids Chemical class 0.000 description 1
- 239000007888 film coating Substances 0.000 description 1
- 238000009501 film coating Methods 0.000 description 1
- 239000000706 filtrate Substances 0.000 description 1
- 229910052731 fluorine Inorganic materials 0.000 description 1
- 235000021588 free fatty acids Nutrition 0.000 description 1
- 239000001530 fumaric acid Substances 0.000 description 1
- 239000008273 gelatin Substances 0.000 description 1
- 229920000159 gelatin Polymers 0.000 description 1
- 235000019322 gelatine Nutrition 0.000 description 1
- 235000011852 gelatine desserts Nutrition 0.000 description 1
- 239000012362 glacial acetic acid Substances 0.000 description 1
- 239000000174 gluconic acid Substances 0.000 description 1
- 235000012208 gluconic acid Nutrition 0.000 description 1
- 229950006191 gluconic acid Drugs 0.000 description 1
- ZDXPYRJPNDTMRX-UHFFFAOYSA-N glutamine Natural products OC(=O)C(N)CCC(N)=O ZDXPYRJPNDTMRX-UHFFFAOYSA-N 0.000 description 1
- 229940074045 glyceryl distearate Drugs 0.000 description 1
- 229940075507 glyceryl monostearate Drugs 0.000 description 1
- 108010015153 growth hormone releasing hexapeptide Proteins 0.000 description 1
- 239000003324 growth hormone secretagogue Substances 0.000 description 1
- 239000001963 growth medium Substances 0.000 description 1
- 239000007952 growth promoter Substances 0.000 description 1
- 125000004051 hexyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000003707 hexyloxy group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])O* 0.000 description 1
- 235000010979 hydroxypropyl methyl cellulose Nutrition 0.000 description 1
- 229920003088 hydroxypropyl methyl cellulose Polymers 0.000 description 1
- 230000006872 improvement Effects 0.000 description 1
- 238000002347 injection Methods 0.000 description 1
- 239000007924 injection Substances 0.000 description 1
- 125000004491 isohexyl group Chemical group C(CCC(C)C)* 0.000 description 1
- 125000001972 isopentyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 125000001786 isothiazolyl group Chemical group 0.000 description 1
- 125000000842 isoxazolyl group Chemical group 0.000 description 1
- 239000004310 lactic acid Substances 0.000 description 1
- 235000014655 lactic acid Nutrition 0.000 description 1
- 239000008101 lactose Substances 0.000 description 1
- 239000000787 lecithin Substances 0.000 description 1
- 235000010445 lecithin Nutrition 0.000 description 1
- 229940067606 lecithin Drugs 0.000 description 1
- 238000004895 liquid chromatography mass spectrometry Methods 0.000 description 1
- 239000007791 liquid phase Substances 0.000 description 1
- 239000006193 liquid solution Substances 0.000 description 1
- 239000006194 liquid suspension Substances 0.000 description 1
- 239000007937 lozenge Substances 0.000 description 1
- 238000012423 maintenance Methods 0.000 description 1
- VZCYOOQTPOCHFL-UPHRSURJSA-N maleic acid Chemical compound OC(=O)\C=C/C(O)=O VZCYOOQTPOCHFL-UPHRSURJSA-N 0.000 description 1
- 239000011976 maleic acid Substances 0.000 description 1
- 230000001404 mediated effect Effects 0.000 description 1
- 230000004060 metabolic process Effects 0.000 description 1
- 229940098779 methanesulfonic acid Drugs 0.000 description 1
- QARBMVPHQWIHKH-UHFFFAOYSA-N methanesulfonyl chloride Chemical compound CS(Cl)(=O)=O QARBMVPHQWIHKH-UHFFFAOYSA-N 0.000 description 1
- 239000013081 microcrystal Substances 0.000 description 1
- 239000002480 mineral oil Substances 0.000 description 1
- 235000010446 mineral oil Nutrition 0.000 description 1
- 150000007522 mineralic acids Chemical class 0.000 description 1
- 238000012986 modification Methods 0.000 description 1
- 230000004048 modification Effects 0.000 description 1
- LNOPIUAQISRISI-UHFFFAOYSA-N n'-hydroxy-2-propan-2-ylsulfonylethanimidamide Chemical compound CC(C)S(=O)(=O)CC(N)=NO LNOPIUAQISRISI-UHFFFAOYSA-N 0.000 description 1
- CBHYFZKCNVQNMV-UHFFFAOYSA-N n-[2-[2-(methylamino)ethyl]phenyl]benzenesulfonamide Chemical compound CNCCC1=CC=CC=C1NS(=O)(=O)C1=CC=CC=C1 CBHYFZKCNVQNMV-UHFFFAOYSA-N 0.000 description 1
- 230000001537 neural effect Effects 0.000 description 1
- 239000002858 neurotransmitter agent Substances 0.000 description 1
- 229920001220 nitrocellulos Polymers 0.000 description 1
- 229920001778 nylon Polymers 0.000 description 1
- QIQXTHQIDYTFRH-UHFFFAOYSA-N octadecanoic acid Chemical compound CCCCCCCCCCCCCCCCCC(O)=O QIQXTHQIDYTFRH-UHFFFAOYSA-N 0.000 description 1
- OQCDKBAXFALNLD-UHFFFAOYSA-N octadecanoic acid Natural products CCCCCCCC(C)CCCCCCCCC(O)=O OQCDKBAXFALNLD-UHFFFAOYSA-N 0.000 description 1
- 239000003921 oil Substances 0.000 description 1
- 235000019198 oils Nutrition 0.000 description 1
- 239000004006 olive oil Substances 0.000 description 1
- 235000008390 olive oil Nutrition 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- 125000002971 oxazolyl group Chemical group 0.000 description 1
- FJKROLUGYXJWQN-UHFFFAOYSA-N papa-hydroxy-benzoic acid Natural products OC(=O)C1=CC=C(O)C=C1 FJKROLUGYXJWQN-UHFFFAOYSA-N 0.000 description 1
- 239000000312 peanut oil Substances 0.000 description 1
- 239000001814 pectin Substances 0.000 description 1
- 235000010987 pectin Nutrition 0.000 description 1
- 229920001277 pectin Polymers 0.000 description 1
- 239000008188 pellet Substances 0.000 description 1
- 125000001147 pentyl group Chemical group C(CCCC)* 0.000 description 1
- 239000008024 pharmaceutical diluent Substances 0.000 description 1
- 230000000144 pharmacologic effect Effects 0.000 description 1
- 239000008363 phosphate buffer Substances 0.000 description 1
- WTJKGGKOPKCXLL-RRHRGVEJSA-N phosphatidylcholine Chemical compound CCCCCCCCCCCCCCCC(=O)OC[C@H](COP([O-])(=O)OCC[N+](C)(C)C)OC(=O)CCCCCCCC=CCCCCCCCC WTJKGGKOPKCXLL-RRHRGVEJSA-N 0.000 description 1
- 150000003904 phospholipids Chemical class 0.000 description 1
- 235000011007 phosphoric acid Nutrition 0.000 description 1
- MUKCXROGIQHFNN-UHFFFAOYSA-N piperazin-2-one Chemical compound O=C1CNCCN1.O=C1CNCCN1 MUKCXROGIQHFNN-UHFFFAOYSA-N 0.000 description 1
- 230000036470 plasma concentration Effects 0.000 description 1
- 239000004014 plasticizer Substances 0.000 description 1
- 229920001184 polypeptide Polymers 0.000 description 1
- LPNYRYFBWFDTMA-UHFFFAOYSA-N potassium tert-butoxide Chemical compound [K+].CC(C)(C)[O-] LPNYRYFBWFDTMA-UHFFFAOYSA-N 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- 239000003755 preservative agent Substances 0.000 description 1
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 238000001243 protein synthesis Methods 0.000 description 1
- 125000003373 pyrazinyl group Chemical group 0.000 description 1
- 125000003226 pyrazolyl group Chemical group 0.000 description 1
- 125000000714 pyrimidinyl group Chemical group 0.000 description 1
- 238000011002 quantification Methods 0.000 description 1
- 239000000018 receptor agonist Substances 0.000 description 1
- 229940044601 receptor agonist Drugs 0.000 description 1
- 102000005962 receptors Human genes 0.000 description 1
- 108020003175 receptors Proteins 0.000 description 1
- 230000026267 regulation of growth Effects 0.000 description 1
- 238000004007 reversed phase HPLC Methods 0.000 description 1
- 229960004889 salicylic acid Drugs 0.000 description 1
- 125000002914 sec-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 239000000741 silica gel Substances 0.000 description 1
- 229910002027 silica gel Inorganic materials 0.000 description 1
- 238000001877 single-ion monitoring Methods 0.000 description 1
- 238000012453 sprague-dawley rat model Methods 0.000 description 1
- 238000013112 stability test Methods 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 239000008117 stearic acid Substances 0.000 description 1
- 239000000758 substrate Substances 0.000 description 1
- 239000005720 sucrose Substances 0.000 description 1
- 239000001117 sulphuric acid Substances 0.000 description 1
- 235000011149 sulphuric acid Nutrition 0.000 description 1
- 239000004094 surface-active agent Substances 0.000 description 1
- 238000013268 sustained release Methods 0.000 description 1
- 239000012730 sustained-release form Substances 0.000 description 1
- 238000003786 synthesis reaction Methods 0.000 description 1
- 239000000454 talc Substances 0.000 description 1
- 229910052623 talc Inorganic materials 0.000 description 1
- 235000012222 talc Nutrition 0.000 description 1
- 239000011975 tartaric acid Substances 0.000 description 1
- 235000002906 tartaric acid Nutrition 0.000 description 1
- 229960001367 tartaric acid Drugs 0.000 description 1
- ACNRTYKOPZDRCO-UHFFFAOYSA-N tert-butyl n-(2-oxoethyl)carbamate Chemical compound CC(C)(C)OC(=O)NCC=O ACNRTYKOPZDRCO-UHFFFAOYSA-N 0.000 description 1
- WZRJBZKIAFYJPL-HHHXNRCGSA-N tert-butyl n-[(2r)-1-[2-[2-(3-hydroxypropoxy)phenyl]ethyl-methylamino]-3-naphthalen-2-yl-1-oxopropan-2-yl]-n-methylcarbamate Chemical compound O=C([C@@H](CC=1C=C2C=CC=CC2=CC=1)N(C)C(=O)OC(C)(C)C)N(C)CCC1=CC=CC=C1OCCCO WZRJBZKIAFYJPL-HHHXNRCGSA-N 0.000 description 1
- COYCLHHLHRFNTI-NWHOSPGDSA-N tert-butyl n-[(e)-6-[[(2r)-1-[2-[2-(2-hydroxyethoxy)phenyl]ethyl-methylamino]-3-naphthalen-2-yl-1-oxopropan-2-yl]-methylamino]-2-methyl-6-oxohex-4-en-2-yl]-n-methylcarbamate Chemical compound O=C([C@@H](CC=1C=C2C=CC=CC2=CC=1)N(C)C(=O)\C=C\CC(C)(C)N(C)C(=O)OC(C)(C)C)N(C)CCC1=CC=CC=C1OCCO COYCLHHLHRFNTI-NWHOSPGDSA-N 0.000 description 1
- WJOZTIPIGUWXHU-UHFFFAOYSA-N tert-butyl n-[2-[2-(benzenesulfonamido)phenyl]ethyl]-n-methylcarbamate Chemical compound CC(C)(C)OC(=O)N(C)CCC1=CC=CC=C1NS(=O)(=O)C1=CC=CC=C1 WJOZTIPIGUWXHU-UHFFFAOYSA-N 0.000 description 1
- KXMRYLLPSRGDBP-RUZDIDTESA-N tert-butyl n-methyl-n-[(2r)-1-[methyl(2-phenylethyl)amino]-3-naphthalen-2-yl-1-oxopropan-2-yl]carbamate Chemical compound O=C([C@@H](CC=1C=C2C=CC=CC2=CC=1)N(C)C(=O)OC(C)(C)C)N(C)CCC1=CC=CC=C1 KXMRYLLPSRGDBP-RUZDIDTESA-N 0.000 description 1
- 238000002560 therapeutic procedure Methods 0.000 description 1
- 125000001113 thiadiazolyl group Chemical group 0.000 description 1
- 125000000335 thiazolyl group Chemical group 0.000 description 1
- 238000004809 thin layer chromatography Methods 0.000 description 1
- 230000000699 topical effect Effects 0.000 description 1
- 230000014616 translation Effects 0.000 description 1
- GGUBFICZYGKNTD-UHFFFAOYSA-N triethyl phosphonoacetate Chemical compound CCOC(=O)CP(=O)(OCC)OCC GGUBFICZYGKNTD-UHFFFAOYSA-N 0.000 description 1
- MBYLVOKEDDQJDY-UHFFFAOYSA-N tris(2-aminoethyl)amine Chemical compound NCCN(CCN)CCN MBYLVOKEDDQJDY-UHFFFAOYSA-N 0.000 description 1
- 239000002753 trypsin inhibitor Substances 0.000 description 1
- 229960003726 vasopressin Drugs 0.000 description 1
- 239000003039 volatile agent Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D207/00—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom
- C07D207/02—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D207/04—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members
- C07D207/08—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members with hydrocarbon radicals, substituted by hetero atoms, attached to ring carbon atoms
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P5/00—Drugs for disorders of the endocrine system
- A61P5/06—Drugs for disorders of the endocrine system of the anterior pituitary hormones, e.g. TSH, ACTH, FSH, LH, PRL, GH
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C237/00—Carboxylic acid amides, the carbon skeleton of the acid part being further substituted by amino groups
- C07C237/02—Carboxylic acid amides, the carbon skeleton of the acid part being further substituted by amino groups having the carbon atoms of the carboxamide groups bound to acyclic carbon atoms of the carbon skeleton
- C07C237/22—Carboxylic acid amides, the carbon skeleton of the acid part being further substituted by amino groups having the carbon atoms of the carboxamide groups bound to acyclic carbon atoms of the carbon skeleton having nitrogen atoms of amino groups bound to the carbon skeleton of the acid part, further acylated
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C281/00—Derivatives of carbonic acid containing functional groups covered by groups C07C269/00 - C07C279/00 in which at least one nitrogen atom of these functional groups is further bound to another nitrogen atom not being part of a nitro or nitroso group
- C07C281/06—Compounds containing any of the groups, e.g. semicarbazides
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C311/00—Amides of sulfonic acids, i.e. compounds having singly-bound oxygen atoms of sulfo groups replaced by nitrogen atoms, not being part of nitro or nitroso groups
- C07C311/01—Sulfonamides having sulfur atoms of sulfonamide groups bound to acyclic carbon atoms
- C07C311/02—Sulfonamides having sulfur atoms of sulfonamide groups bound to acyclic carbon atoms of an acyclic saturated carbon skeleton
- C07C311/08—Sulfonamides having sulfur atoms of sulfonamide groups bound to acyclic carbon atoms of an acyclic saturated carbon skeleton having the nitrogen atom of at least one of the sulfonamide groups bound to a carbon atom of a six-membered aromatic ring
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C311/00—Amides of sulfonic acids, i.e. compounds having singly-bound oxygen atoms of sulfo groups replaced by nitrogen atoms, not being part of nitro or nitroso groups
- C07C311/15—Sulfonamides having sulfur atoms of sulfonamide groups bound to carbon atoms of six-membered aromatic rings
- C07C311/21—Sulfonamides having sulfur atoms of sulfonamide groups bound to carbon atoms of six-membered aromatic rings having the nitrogen atom of at least one of the sulfonamide groups bound to a carbon atom of a six-membered aromatic ring
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D217/00—Heterocyclic compounds containing isoquinoline or hydrogenated isoquinoline ring systems
- C07D217/02—Heterocyclic compounds containing isoquinoline or hydrogenated isoquinoline ring systems with only hydrogen atoms or radicals containing only carbon and hydrogen atoms, directly attached to carbon atoms of the nitrogen-containing ring; Alkylene-bis-isoquinolines
- C07D217/06—Heterocyclic compounds containing isoquinoline or hydrogenated isoquinoline ring systems with only hydrogen atoms or radicals containing only carbon and hydrogen atoms, directly attached to carbon atoms of the nitrogen-containing ring; Alkylene-bis-isoquinolines with the ring nitrogen atom acylated by carboxylic or carbonic acids, or with sulfur or nitrogen analogues thereof, e.g. carbamates
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D241/00—Heterocyclic compounds containing 1,4-diazine or hydrogenated 1,4-diazine rings
- C07D241/02—Heterocyclic compounds containing 1,4-diazine or hydrogenated 1,4-diazine rings not condensed with other rings
- C07D241/06—Heterocyclic compounds containing 1,4-diazine or hydrogenated 1,4-diazine rings not condensed with other rings having one or two double bonds between ring members or between ring members and non-ring members
- C07D241/08—Heterocyclic compounds containing 1,4-diazine or hydrogenated 1,4-diazine rings not condensed with other rings having one or two double bonds between ring members or between ring members and non-ring members with oxygen atoms directly attached to ring carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D333/00—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom
- C07D333/02—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom not condensed with other rings
- C07D333/04—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom not condensed with other rings not substituted on the ring sulphur atom
- C07D333/06—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom not condensed with other rings not substituted on the ring sulphur atom with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to the ring carbon atoms
- C07D333/14—Radicals substituted by singly bound hetero atoms other than halogen
- C07D333/20—Radicals substituted by singly bound hetero atoms other than halogen by nitrogen atoms
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Health & Medical Sciences (AREA)
- Life Sciences & Earth Sciences (AREA)
- General Health & Medical Sciences (AREA)
- Diabetes (AREA)
- Endocrinology (AREA)
- Chemical Kinetics & Catalysis (AREA)
- General Chemical & Material Sciences (AREA)
- Medicinal Chemistry (AREA)
- Nuclear Medicine, Radiotherapy & Molecular Imaging (AREA)
- Pharmacology & Pharmacy (AREA)
- Engineering & Computer Science (AREA)
- Animal Behavior & Ethology (AREA)
- Bioinformatics & Cheminformatics (AREA)
- Public Health (AREA)
- Veterinary Medicine (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Medicines That Contain Protein Lipid Enzymes And Other Medicines (AREA)
- Peptides Or Proteins (AREA)
- Heterocyclic Compounds Containing Sulfur Atoms (AREA)
- Hydrogenated Pyridines (AREA)
- Pyrrole Compounds (AREA)
- Acyclic And Carbocyclic Compounds In Medicinal Compositions (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DK80396 | 1996-07-22 | ||
| PCT/DK1997/000314 WO1998003473A1 (en) | 1996-07-22 | 1997-07-17 | Compounds with growth hormone releasing properties |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DE69713109D1 DE69713109D1 (de) | 2002-07-11 |
| DE69713109T2 true DE69713109T2 (de) | 2003-01-02 |
Family
ID=8097747
Family Applications (2)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE69713109T Expired - Lifetime DE69713109T2 (de) | 1996-07-22 | 1997-07-17 | Verbindungen mit wachstumshormon freisetzenden eigenschaften |
| DE69734215T Expired - Lifetime DE69734215T2 (de) | 1996-07-22 | 1997-07-17 | Verbindungen mit Wachstumshormon-freisetzenden Eigenschaften |
Family Applications After (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE69734215T Expired - Lifetime DE69734215T2 (de) | 1996-07-22 | 1997-07-17 | Verbindungen mit Wachstumshormon-freisetzenden Eigenschaften |
Country Status (8)
| Country | Link |
|---|---|
| US (3) | US5922770A (enExample) |
| EP (2) | EP0923539B1 (enExample) |
| JP (1) | JP4425992B2 (enExample) |
| AT (2) | ATE218537T1 (enExample) |
| AU (1) | AU3434697A (enExample) |
| DE (2) | DE69713109T2 (enExample) |
| WO (1) | WO1998003473A1 (enExample) |
| ZA (1) | ZA976371B (enExample) |
Families Citing this family (55)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US6127341A (en) * | 1997-06-20 | 2000-10-03 | Novo Nordisk A/S | Compounds with growth hormone releasing properties |
| JP4116097B2 (ja) * | 1997-06-20 | 2008-07-09 | ノボ ノルディスク アクティーゼルスカブ | 成長ホルモン放出特性をもつ化合物 |
| DE69941255D1 (de) * | 1998-05-11 | 2009-09-24 | Novo Nordisk As | Verbindungen mit wachstumshormon freisetzenden eigenschaften |
| TW450954B (en) * | 1998-05-14 | 2001-08-21 | Pharmacia & Amp Upjohn Company | Phenylsulfonamide-phenylethylamines useful as dopamine receptors |
| DE69943239D1 (de) * | 1998-06-30 | 2011-04-14 | Novo Nordisk As | Verbindungen mit wachstumshormon-freisetzenden eigenschaften |
| US6919315B1 (en) | 1998-06-30 | 2005-07-19 | Novo Nordisk A/S | Compounds with growth hormone releasing properties |
| US6358951B1 (en) * | 1998-08-21 | 2002-03-19 | Pfizer Inc. | Growth hormone secretagogues |
| EP1930021A3 (en) | 1999-02-18 | 2008-06-18 | Kaken Pharmaceutical Co., Ltd. | Novel amide derivatives as growth hormone secretagogues |
| UA73530C2 (uk) * | 1999-11-10 | 2005-08-15 | Ново Нордіск А/С | Сполука з властивостями вивільнювати гормон росту |
| DE60124080T2 (de) | 2000-03-23 | 2007-03-01 | Elan Pharmaceuticals, Inc., San Francisco | Verbindungen und verfahren zur behandlung der alzheimerschen krankheit |
| US6992081B2 (en) | 2000-03-23 | 2006-01-31 | Elan Pharmaceuticals, Inc. | Compounds to treat Alzheimer's disease |
| US6613801B2 (en) * | 2000-05-30 | 2003-09-02 | Transtech Pharma, Inc. | Method for the synthesis of compounds of formula I and their uses thereof |
| US7087632B2 (en) * | 2001-03-05 | 2006-08-08 | Transtech Pharma, Inc. | Benzimidazole derivatives as therapeutic agents |
| ES2333097T3 (es) | 2000-05-31 | 2010-02-17 | Raqualia Pharma Inc | Uso de secretagogos de la hormona de crecimiento para estimular la motilidad gastrointestinal. |
| EP1666452A2 (en) | 2000-06-30 | 2006-06-07 | Elan Pharmaceuticals, Inc. | Compounds to treat Alzheimer's disease |
| US20030096864A1 (en) * | 2000-06-30 | 2003-05-22 | Fang Lawrence Y. | Compounds to treat alzheimer's disease |
| US6846813B2 (en) * | 2000-06-30 | 2005-01-25 | Pharmacia & Upjohn Company | Compounds to treat alzheimer's disease |
| US7034182B2 (en) * | 2000-06-30 | 2006-04-25 | Elan Pharmaceuticals, Inc. | Compounds to treat Alzheimer's disease |
| PE20020276A1 (es) | 2000-06-30 | 2002-04-06 | Elan Pharm Inc | COMPUESTOS DE AMINA SUSTITUIDA COMO INHIBIDORES DE ß-SECRETASA PARA EL TRATAMIENTO DE ALZHEIMER |
| KR100900020B1 (ko) * | 2001-02-16 | 2009-06-01 | 알레릭스 뉴로사이언스, 인크. | Glyt-1 저해제로서의 티오펜 치환 아민 유도체 |
| EP1377295A4 (en) * | 2001-03-05 | 2007-05-09 | Transtech Pharma Inc | CARBOXYL ACID DERIVATIVES THERAPEUTIC AGENTS |
| BR0210721A (pt) * | 2001-06-27 | 2004-07-20 | Elan Pharm Inc | Composto, sal ou éster farmaceuticamente aceitável, método para fabricar um composto, e, método para tratar um paciente que tem, ou para evitar que o paciente adquira uma doença ou condição |
| US20070213407A1 (en) * | 2001-06-29 | 2007-09-13 | Elan Pharmaceuticals And Pharmacia & Upjohn Company Llc | Compounds to treat Alzheimer's disease |
| WO2003059880A1 (en) * | 2002-01-11 | 2003-07-24 | Sankyo Company, Limited | Amino alcohol derivative or phosphonic acid derivative and medicinal composition containing these |
| US7230133B2 (en) | 2003-05-01 | 2007-06-12 | Bristol-Myers Squibb Company | Malonamides and malonamide derivatives as modulators of chemokine receptor activity |
| WO2005000295A1 (en) * | 2003-05-20 | 2005-01-06 | Transtech Pharma, Inc. | Rage antagonists as agents to reverse amyloidosis and diseases associated therewith |
| US7476653B2 (en) | 2003-06-18 | 2009-01-13 | Tranzyme Pharma, Inc. | Macrocyclic modulators of the ghrelin receptor |
| WO2005027913A1 (en) * | 2003-09-19 | 2005-03-31 | Pfizer Products Inc. | Pharmaceutical compositions and methods comprising combinations of 2-alkylidene-19-nor-vitamin d derivatives and a growth hormone secretagogue |
| EP1733724A4 (en) | 2004-02-24 | 2010-07-07 | Sankyo Co | Aminoalcohol compound |
| EP1735055A1 (en) * | 2004-03-30 | 2006-12-27 | Sapphire Therapeutics, Inc. | Method of reducing c-reactive protein using growth hormone secretagogues |
| CN103772483A (zh) * | 2004-06-29 | 2014-05-07 | 赫尔辛医疗股份公司 | (3r)-1-(2-甲基丙氨酰-d-色氨酰)-3-(苯甲基)-3-哌啶羧酸1,2,2-三甲基酰肼的晶形 |
| AU2005272598B2 (en) * | 2004-08-12 | 2011-11-17 | Helsinn Therapeutics (U.S.), Inc. | Method of stimulating the motility of the gastrointestinal system using growth hormone secretagogues |
| CN101248184B (zh) | 2005-08-25 | 2013-01-16 | 宇部兴产株式会社 | 光学活性(S或R)-α-氨基酸及光学活性(S或R)-α-氨基酸酯的制造方法 |
| CU23558A1 (es) | 2006-02-28 | 2010-07-20 | Ct Ingenieria Genetica Biotech | Compuestos análogos a los secretagogos peptidicos de la hormona de crecimiento |
| US8889632B2 (en) | 2007-01-31 | 2014-11-18 | Dana-Farber Cancer Institute, Inc. | Stabilized p53 peptides and uses thereof |
| EA200901077A1 (ru) | 2007-02-09 | 2010-04-30 | Транзим Фарма, Инк. | Макроциклические модуляторы грелинового рецептора и их применение |
| MX2009008561A (es) * | 2007-02-13 | 2010-01-15 | Helsinn Therapeutics Us Inc | Metodo para tratar trastornos proliferativos celulares utilizando secretagogos. |
| JP5631201B2 (ja) | 2007-03-28 | 2014-11-26 | プレジデント アンド フェローズ オブ ハーバード カレッジ | ステッチングされたポリペプチド |
| TWI429436B (zh) * | 2007-04-10 | 2014-03-11 | Helsinn Therapeutics Us Inc | 使用生長激素促泌素治療或預防嘔吐之方法 |
| UA105657C2 (uk) | 2009-02-27 | 2014-06-10 | Хелсінн Терапьютікс (Ю.Ес.), Інк. | Поліпшені способи лікування мігрені на основі анамореліну |
| CA2772797C (en) | 2009-09-30 | 2018-09-25 | Transtech Pharma, Inc. | Substituted imidazole derivatives |
| KR20180058866A (ko) | 2010-08-13 | 2018-06-01 | 에일러론 테라퓨틱스 인코포레이티드 | 펩티도미메틱 거대고리 |
| BR112014009418A2 (pt) | 2011-10-18 | 2017-04-18 | Aileron Therapeutics Inc | macrociclos peptidomiméticos |
| CN112500466B (zh) | 2012-02-15 | 2022-05-03 | 艾瑞朗医疗公司 | 拟肽大环化合物 |
| WO2013123267A1 (en) | 2012-02-15 | 2013-08-22 | Aileron Therapeutics, Inc. | Triazole-crosslinked and thioether-crosslinked peptidomimetic macrocycles |
| US9717710B2 (en) | 2012-10-05 | 2017-08-01 | Vtv Therapeutics Llc | Treatment of mild and moderate Alzheimer's disease |
| MX2015005244A (es) | 2012-11-01 | 2015-07-14 | Aileron Therapeutics Inc | Aminoacidos disustituidos y metodos de preparacion y el uso de los mismos. |
| US9119832B2 (en) | 2014-02-05 | 2015-09-01 | The Regents Of The University Of California | Methods of treating mild brain injury |
| AU2015320549A1 (en) | 2014-09-24 | 2017-04-13 | Aileron Therapeutics, Inc. | Peptidomimetic macrocycles and uses thereof |
| SG11201707750YA (en) | 2015-03-20 | 2017-10-30 | Aileron Therapeutics Inc | Peptidomimetic macrocycles and uses thereof |
| US20170121385A1 (en) | 2015-10-28 | 2017-05-04 | Oxeia Biopharmaceuticals, Inc. | Methods of treating neurodegenerative conditions |
| EP3414783B1 (en) | 2016-02-09 | 2021-08-18 | Lumeova, Inc | Ultra-wideband, wireless optical high speed communication devices and systems |
| WO2019190822A1 (en) | 2018-03-28 | 2019-10-03 | Vtv Therapeutics Llc | Crystalline forms of [3-(4- {2-butyl-1-[4-(4-chloro-phenoxy)-phenyl]-1h-imidazol-4-yl} -phenoxy)-propyl]-diethyl-amine |
| WO2019190823A1 (en) | 2018-03-28 | 2019-10-03 | Vtv Therapeutics Llc | Pharmaceutically acceptable salts of [3-(4- {2-butyl-1-[4-(4-chlorophenoxy)-phenyl]-1h-imidazol-4-yl} -phenoxy)-propyl]-diethyl-amine |
| WO2020076668A1 (en) | 2018-10-10 | 2020-04-16 | Vtv Therapeutics Llc | Metabolites of [3-(4-{2-butyl-l-[4-(4-chloro-phenoxy)-phenyl]-lh-imidazol-4-yl } -phen ox y)-prop yl] -diethyl-amine |
Family Cites Families (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| FI962584A0 (fi) * | 1993-12-23 | 1996-06-20 | Novo Nordisk As | Kasvuhormonia vapauttavia ominaisuuksia sisältäviä yhdisteitä |
| DE69633003T2 (de) * | 1995-01-27 | 2005-08-18 | Novo Nordisk A/S | Verbindungen mit wachstumshormon-freisetzenden eigenschaften |
| CA2239711A1 (en) * | 1995-12-22 | 1997-07-03 | Novo Nordisk A/S | Compounds with growth hormone releasing properties |
-
1997
- 1997-07-17 WO PCT/DK1997/000314 patent/WO1998003473A1/en not_active Ceased
- 1997-07-17 AT AT97930368T patent/ATE218537T1/de not_active IP Right Cessation
- 1997-07-17 DE DE69713109T patent/DE69713109T2/de not_active Expired - Lifetime
- 1997-07-17 EP EP97930368A patent/EP0923539B1/en not_active Expired - Lifetime
- 1997-07-17 AT AT01123155T patent/ATE304528T1/de not_active IP Right Cessation
- 1997-07-17 US US08/896,550 patent/US5922770A/en not_active Expired - Lifetime
- 1997-07-17 DE DE69734215T patent/DE69734215T2/de not_active Expired - Lifetime
- 1997-07-17 EP EP01123155A patent/EP1184370B1/en not_active Expired - Lifetime
- 1997-07-17 JP JP50646598A patent/JP4425992B2/ja not_active Expired - Lifetime
- 1997-07-17 AU AU34346/97A patent/AU3434697A/en not_active Abandoned
- 1997-07-18 ZA ZA9706371A patent/ZA976371B/xx unknown
-
1999
- 1999-03-17 US US09/270,862 patent/US6127354A/en not_active Expired - Lifetime
-
2000
- 2000-07-19 US US09/619,227 patent/US6274584B1/en not_active Expired - Lifetime
Also Published As
| Publication number | Publication date |
|---|---|
| WO1998003473A1 (en) | 1998-01-29 |
| DE69734215D1 (de) | 2005-10-20 |
| AU3434697A (en) | 1998-02-10 |
| EP1184370A3 (en) | 2002-03-27 |
| US6274584B1 (en) | 2001-08-14 |
| US5922770A (en) | 1999-07-13 |
| US6127354A (en) | 2000-10-03 |
| EP0923539A1 (en) | 1999-06-23 |
| ATE218537T1 (de) | 2002-06-15 |
| JP2000515517A (ja) | 2000-11-21 |
| ZA976371B (en) | 1998-01-22 |
| EP1184370B1 (en) | 2005-09-14 |
| EP0923539B1 (en) | 2002-06-05 |
| EP1184370A2 (en) | 2002-03-06 |
| ATE304528T1 (de) | 2005-09-15 |
| JP4425992B2 (ja) | 2010-03-03 |
| DE69734215T2 (de) | 2006-06-29 |
| DE69713109D1 (de) | 2002-07-11 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE69713109T2 (de) | Verbindungen mit wachstumshormon freisetzenden eigenschaften | |
| DE69633003T2 (de) | Verbindungen mit wachstumshormon-freisetzenden eigenschaften | |
| JP4130519B2 (ja) | 成長ホルモン放出特性を有する化合物 | |
| DE60015173T2 (de) | Verbindung mit wachstumshormon-freisetzenden eigenschaften | |
| ES2331102T3 (es) | Compuestos con propiedades de liberacion de la hormona del crecimiento. | |
| DE69718469T2 (de) | Verbindungen mit wachtumshormon freisetzenden eigenschaften | |
| JP4116097B2 (ja) | 成長ホルモン放出特性をもつ化合物 | |
| EP1117642B1 (de) | Substituierte 1,3-diaryl-2-pyridin-2-yl-3-(pyridin-2-ylamino)-propanolderivate, verfahren zu deren herstellung, diese verbindungen enthaltende arzneimittel und deren verwendung | |
| WO1996024580A1 (en) | Compounds with growth hormone releasing properties | |
| DE69921611T2 (de) | Verbindungen mit wachstumshormon-freisetzenden eigenschaften | |
| WO1996024587A1 (en) | Compounds with growth hormone releasing properties | |
| RU2298547C2 (ru) | Соединения и фармацевтическая композиция, обладающие свойствами высвобождения гормона роста, способ стимуляции выделения гормона роста из гипофиза млекопитающего | |
| DE69908756T2 (de) | Matrix-metalloproteinase-inhibitoren | |
| US6566337B1 (en) | Compounds with growth hormone releasing properties | |
| DE69919195T2 (de) | Verbindungen mit wachstumshormon-freisetzender eigenschaft | |
| JP3007613B2 (ja) | 成長ホルモン放出特性を有する化合物 | |
| MXPA00006692A (en) | Compounds with growthhormone releasing properties |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| 8364 | No opposition during term of opposition | ||
| 8327 | Change in the person/name/address of the patent owner |
Owner name: SAPPHIRE THERAPEUTICS, INC., BRIDGEWATER, N.J., US |