DE69413878T2 - Terpolymer mit Segmenten von aromatischen Polyestern, Polysiloxanen und Polycarbonaten - Google Patents
Terpolymer mit Segmenten von aromatischen Polyestern, Polysiloxanen und PolycarbonatenInfo
- Publication number
- DE69413878T2 DE69413878T2 DE69413878T DE69413878T DE69413878T2 DE 69413878 T2 DE69413878 T2 DE 69413878T2 DE 69413878 T DE69413878 T DE 69413878T DE 69413878 T DE69413878 T DE 69413878T DE 69413878 T2 DE69413878 T2 DE 69413878T2
- Authority
- DE
- Germany
- Prior art keywords
- terpolymer
- segments
- hydrogen
- weight
- polycarbonate
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired - Fee Related
Links
- -1 polysiloxanes Polymers 0.000 title claims description 59
- 229920001897 terpolymer Polymers 0.000 title claims description 54
- 229920001296 polysiloxane Polymers 0.000 title claims description 32
- 229920000515 polycarbonate Polymers 0.000 title claims description 22
- 239000004417 polycarbonate Substances 0.000 title claims description 22
- 229920000728 polyester Polymers 0.000 title claims description 13
- 125000003118 aryl group Chemical group 0.000 title claims description 9
- 239000000203 mixture Substances 0.000 claims description 42
- 238000000034 method Methods 0.000 claims description 28
- KPUWHANPEXNPJT-UHFFFAOYSA-N disiloxane Chemical class [SiH3]O[SiH3] KPUWHANPEXNPJT-UHFFFAOYSA-N 0.000 claims description 25
- 239000004215 Carbon black (E152) Substances 0.000 claims description 20
- IISBACLAFKSPIT-UHFFFAOYSA-N bisphenol A Chemical compound C=1C=C(O)C=CC=1C(C)(C)C1=CC=C(O)C=C1 IISBACLAFKSPIT-UHFFFAOYSA-N 0.000 claims description 20
- 229930195733 hydrocarbon Natural products 0.000 claims description 20
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 16
- YGYAWVDWMABLBF-UHFFFAOYSA-N Phosgene Chemical compound ClC(Cl)=O YGYAWVDWMABLBF-UHFFFAOYSA-N 0.000 claims description 15
- 239000001257 hydrogen Substances 0.000 claims description 14
- 229910052739 hydrogen Inorganic materials 0.000 claims description 14
- 229930185605 Bisphenol Natural products 0.000 claims description 11
- 229920001169 thermoplastic Polymers 0.000 claims description 10
- 239000004416 thermosoftening plastic Substances 0.000 claims description 10
- BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate Chemical compound [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 claims description 9
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 claims description 8
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 8
- 239000002904 solvent Substances 0.000 claims description 8
- 239000003513 alkali Substances 0.000 claims description 6
- 125000001183 hydrocarbyl group Chemical group 0.000 claims description 5
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical group [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims description 4
- 229910052801 chlorine Inorganic materials 0.000 claims description 4
- 239000000460 chlorine Substances 0.000 claims description 4
- 125000000843 phenylene group Chemical group C1(=C(C=CC=C1)*)* 0.000 claims description 4
- 125000000217 alkyl group Chemical group 0.000 claims description 3
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Chemical group BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 claims description 3
- 229910052794 bromium Chemical group 0.000 claims description 3
- 238000004519 manufacturing process Methods 0.000 claims description 3
- 125000001309 chloro group Chemical group Cl* 0.000 claims description 2
- HBGGXOJOCNVPFY-UHFFFAOYSA-N diisononyl phthalate Chemical compound CC(C)CCCCCCOC(=O)C1=CC=CC=C1C(=O)OCCCCCCC(C)C HBGGXOJOCNVPFY-UHFFFAOYSA-N 0.000 claims 4
- 125000003545 alkoxy group Chemical group 0.000 claims 3
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 claims 2
- QIGBRXMKCJKVMJ-UHFFFAOYSA-N Hydroquinone Chemical compound OC1=CC=C(O)C=C1 QIGBRXMKCJKVMJ-UHFFFAOYSA-N 0.000 claims 1
- 230000004048 modification Effects 0.000 claims 1
- 238000012986 modification Methods 0.000 claims 1
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 84
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 36
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 35
- 150000002148 esters Chemical group 0.000 description 18
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 17
- 229920005989 resin Polymers 0.000 description 15
- 239000011347 resin Substances 0.000 description 15
- QBDSZLJBMIMQRS-UHFFFAOYSA-N p-Cumylphenol Chemical compound C=1C=C(O)C=CC=1C(C)(C)C1=CC=CC=C1 QBDSZLJBMIMQRS-UHFFFAOYSA-N 0.000 description 12
- NKTOLZVEWDHZMU-UHFFFAOYSA-N p-cumyl phenol Natural products CC1=CC=C(C)C(O)=C1 NKTOLZVEWDHZMU-UHFFFAOYSA-N 0.000 description 12
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 11
- 239000012044 organic layer Substances 0.000 description 10
- 239000000047 product Substances 0.000 description 10
- 125000005587 carbonate group Chemical group 0.000 description 9
- 229920001577 copolymer Polymers 0.000 description 9
- 238000002360 preparation method Methods 0.000 description 9
- 238000003756 stirring Methods 0.000 description 9
- LXEJRKJRKIFVNY-UHFFFAOYSA-N terephthaloyl chloride Chemical compound ClC(=O)C1=CC=C(C(Cl)=O)C=C1 LXEJRKJRKIFVNY-UHFFFAOYSA-N 0.000 description 9
- FDQSRULYDNDXQB-UHFFFAOYSA-N benzene-1,3-dicarbonyl chloride Chemical group ClC(=O)C1=CC=CC(C(Cl)=O)=C1 FDQSRULYDNDXQB-UHFFFAOYSA-N 0.000 description 8
- 229920000642 polymer Polymers 0.000 description 8
- OFOBLEOULBTSOW-UHFFFAOYSA-N Malonic acid Chemical compound OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 description 7
- BASFCYQUMIYNBI-UHFFFAOYSA-N platinum Chemical compound [Pt] BASFCYQUMIYNBI-UHFFFAOYSA-N 0.000 description 7
- 229920001400 block copolymer Polymers 0.000 description 6
- 125000004432 carbon atom Chemical group C* 0.000 description 6
- RRAFCDWBNXTKKO-UHFFFAOYSA-N Eugenol Natural products COC1=CC(CC=C)=CC=C1O RRAFCDWBNXTKKO-UHFFFAOYSA-N 0.000 description 5
- 239000003054 catalyst Substances 0.000 description 5
- 238000006243 chemical reaction Methods 0.000 description 5
- 230000000052 comparative effect Effects 0.000 description 5
- 239000000155 melt Substances 0.000 description 5
- 238000006116 polymerization reaction Methods 0.000 description 5
- 238000009833 condensation Methods 0.000 description 4
- 230000005494 condensation Effects 0.000 description 4
- MIHINWMALJZIBX-UHFFFAOYSA-N cyclohexa-2,4-dien-1-ol Chemical compound OC1CC=CC=C1 MIHINWMALJZIBX-UHFFFAOYSA-N 0.000 description 4
- 239000000463 material Substances 0.000 description 4
- 239000000376 reactant Substances 0.000 description 4
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 3
- WMFOQBRAJBCJND-UHFFFAOYSA-M Lithium hydroxide Chemical compound [Li+].[OH-] WMFOQBRAJBCJND-UHFFFAOYSA-M 0.000 description 3
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 3
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 3
- 150000002430 hydrocarbons Chemical class 0.000 description 3
- 230000007062 hydrolysis Effects 0.000 description 3
- 238000006460 hydrolysis reaction Methods 0.000 description 3
- 229910052697 platinum Inorganic materials 0.000 description 3
- 239000002243 precursor Substances 0.000 description 3
- 150000003254 radicals Chemical class 0.000 description 3
- VPWNQTHUCYMVMZ-UHFFFAOYSA-N 4,4'-sulfonyldiphenol Chemical class C1=CC(O)=CC=C1S(=O)(=O)C1=CC=C(O)C=C1 VPWNQTHUCYMVMZ-UHFFFAOYSA-N 0.000 description 2
- NPBVQXIMTZKSBA-UHFFFAOYSA-N Chavibetol Natural products COC1=CC=C(CC=C)C=C1O NPBVQXIMTZKSBA-UHFFFAOYSA-N 0.000 description 2
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 2
- 239000005770 Eugenol Substances 0.000 description 2
- 239000004609 Impact Modifier Substances 0.000 description 2
- 238000012695 Interfacial polymerization Methods 0.000 description 2
- UVMRYBDEERADNV-UHFFFAOYSA-N Pseudoeugenol Natural products COC1=CC(C(C)=C)=CC=C1O UVMRYBDEERADNV-UHFFFAOYSA-N 0.000 description 2
- 239000000654 additive Substances 0.000 description 2
- 229920003232 aliphatic polyester Polymers 0.000 description 2
- 125000001204 arachidyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
- 230000015572 biosynthetic process Effects 0.000 description 2
- 239000003795 chemical substances by application Substances 0.000 description 2
- MVPPADPHJFYWMZ-UHFFFAOYSA-N chlorobenzene Chemical compound ClC1=CC=CC=C1 MVPPADPHJFYWMZ-UHFFFAOYSA-N 0.000 description 2
- 239000004927 clay Substances 0.000 description 2
- 150000001875 compounds Chemical class 0.000 description 2
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 2
- 239000004205 dimethyl polysiloxane Substances 0.000 description 2
- ZUOUZKKEUPVFJK-UHFFFAOYSA-N diphenyl Chemical compound C1=CC=CC=C1C1=CC=CC=C1 ZUOUZKKEUPVFJK-UHFFFAOYSA-N 0.000 description 2
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 2
- 229960002217 eugenol Drugs 0.000 description 2
- 125000005843 halogen group Chemical group 0.000 description 2
- 150000002367 halogens Chemical class 0.000 description 2
- 238000001746 injection moulding Methods 0.000 description 2
- 238000000465 moulding Methods 0.000 description 2
- 125000002347 octyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 2
- 229920000435 poly(dimethylsiloxane) Polymers 0.000 description 2
- 239000003381 stabilizer Substances 0.000 description 2
- 239000000126 substance Substances 0.000 description 2
- YBKTXBVJUNMJBJ-UHFFFAOYSA-N 1,2,4,3-trioxasilolan-5-one Chemical compound C1(O[SiH2]OO1)=O YBKTXBVJUNMJBJ-UHFFFAOYSA-N 0.000 description 1
- WSLDOOZREJYCGB-UHFFFAOYSA-N 1,2-Dichloroethane Chemical compound ClCCCl WSLDOOZREJYCGB-UHFFFAOYSA-N 0.000 description 1
- CJWNFAKWHDOUKL-UHFFFAOYSA-N 2-(2-phenylpropan-2-yl)phenol Chemical compound C=1C=CC=C(O)C=1C(C)(C)C1=CC=CC=C1 CJWNFAKWHDOUKL-UHFFFAOYSA-N 0.000 description 1
- QIRNGVVZBINFMX-UHFFFAOYSA-N 2-allylphenol Chemical compound OC1=CC=CC=C1CC=C QIRNGVVZBINFMX-UHFFFAOYSA-N 0.000 description 1
- 125000000094 2-phenylethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])C([H])([H])* 0.000 description 1
- QHPQWRBYOIRBIT-UHFFFAOYSA-N 4-tert-butylphenol Chemical compound CC(C)(C)C1=CC=C(O)C=C1 QHPQWRBYOIRBIT-UHFFFAOYSA-N 0.000 description 1
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- SNRUBQQJIBEYMU-UHFFFAOYSA-N Dodecane Natural products CCCCCCCCCCCC SNRUBQQJIBEYMU-UHFFFAOYSA-N 0.000 description 1
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 description 1
- 238000001157 Fourier transform infrared spectrum Methods 0.000 description 1
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- 239000006057 Non-nutritive feed additive Substances 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 1
- 238000007259 addition reaction Methods 0.000 description 1
- 239000000853 adhesive Substances 0.000 description 1
- 230000001070 adhesive effect Effects 0.000 description 1
- 150000008044 alkali metal hydroxides Chemical class 0.000 description 1
- 239000002216 antistatic agent Substances 0.000 description 1
- 239000011260 aqueous acid Substances 0.000 description 1
- 150000005840 aryl radicals Chemical class 0.000 description 1
- 125000004104 aryloxy group Chemical group 0.000 description 1
- 125000002511 behenyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid Chemical compound OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 1
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 1
- 235000010290 biphenyl Nutrition 0.000 description 1
- 239000004305 biphenyl Substances 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 150000004649 carbonic acid derivatives Chemical class 0.000 description 1
- 230000015556 catabolic process Effects 0.000 description 1
- 230000003197 catalytic effect Effects 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 125000000068 chlorophenyl group Chemical group 0.000 description 1
- 238000000576 coating method Methods 0.000 description 1
- 239000003086 colorant Substances 0.000 description 1
- 238000013329 compounding Methods 0.000 description 1
- 239000012043 crude product Substances 0.000 description 1
- 125000001995 cyclobutyl group Chemical group [H]C1([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- 125000000582 cycloheptyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- 125000000640 cyclooctyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C([H])([H])C1([H])[H] 0.000 description 1
- 125000001511 cyclopentyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- 125000002704 decyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 230000007812 deficiency Effects 0.000 description 1
- 238000006731 degradation reaction Methods 0.000 description 1
- 230000008034 disappearance Effects 0.000 description 1
- 125000003438 dodecyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 238000001125 extrusion Methods 0.000 description 1
- 230000002349 favourable effect Effects 0.000 description 1
- 239000000945 filler Substances 0.000 description 1
- 238000011049 filling Methods 0.000 description 1
- 239000003063 flame retardant Substances 0.000 description 1
- 229910052731 fluorine Inorganic materials 0.000 description 1
- 239000011737 fluorine Substances 0.000 description 1
- 239000000446 fuel Substances 0.000 description 1
- 239000003365 glass fiber Substances 0.000 description 1
- 150000004820 halides Chemical class 0.000 description 1
- 229910052736 halogen Inorganic materials 0.000 description 1
- 125000000755 henicosyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000003187 heptyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000004051 hexyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 1
- 238000010348 incorporation Methods 0.000 description 1
- 238000002347 injection Methods 0.000 description 1
- 239000007924 injection Substances 0.000 description 1
- 239000011630 iodine Substances 0.000 description 1
- 229910052740 iodine Inorganic materials 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 125000002463 lignoceryl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- GRVDJDISBSALJP-UHFFFAOYSA-N methyloxidanyl Chemical compound [O]C GRVDJDISBSALJP-UHFFFAOYSA-N 0.000 description 1
- 239000003607 modifier Substances 0.000 description 1
- 239000006082 mold release agent Substances 0.000 description 1
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000001624 naphthyl group Chemical group 0.000 description 1
- 125000001196 nonadecyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000001400 nonyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- HMMGMWAXVFQUOA-UHFFFAOYSA-N octamethylcyclotetrasiloxane Chemical compound C[Si]1(C)O[Si](C)(C)O[Si](C)(C)O[Si](C)(C)O1 HMMGMWAXVFQUOA-UHFFFAOYSA-N 0.000 description 1
- 125000002460 pentacosyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 150000002989 phenols Chemical class 0.000 description 1
- 125000000951 phenoxy group Chemical group [H]C1=C([H])C([H])=C(O*)C([H])=C1[H] 0.000 description 1
- OJMIONKXNSYLSR-UHFFFAOYSA-N phosphorous acid Chemical compound OP(O)O OJMIONKXNSYLSR-UHFFFAOYSA-N 0.000 description 1
- 239000004033 plastic Substances 0.000 description 1
- 229920003023 plastic Polymers 0.000 description 1
- 239000004014 plasticizer Substances 0.000 description 1
- 229920005668 polycarbonate resin Polymers 0.000 description 1
- 239000004431 polycarbonate resin Substances 0.000 description 1
- 229940072033 potash Drugs 0.000 description 1
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Substances [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 1
- 235000015320 potassium carbonate Nutrition 0.000 description 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- QQONPFPTGQHPMA-UHFFFAOYSA-N propylene Natural products CC=C QQONPFPTGQHPMA-UHFFFAOYSA-N 0.000 description 1
- 125000004805 propylene group Chemical group [H]C([H])([H])C([H])([*:1])C([H])([H])[*:2] 0.000 description 1
- 238000000746 purification Methods 0.000 description 1
- WQGWDDDVZFFDIG-UHFFFAOYSA-N pyrogallol Chemical compound OC1=CC=CC(O)=C1O WQGWDDDVZFFDIG-UHFFFAOYSA-N 0.000 description 1
- 150000003856 quaternary ammonium compounds Chemical class 0.000 description 1
- 150000004023 quaternary phosphonium compounds Chemical class 0.000 description 1
- 239000011541 reaction mixture Substances 0.000 description 1
- 239000012744 reinforcing agent Substances 0.000 description 1
- 239000000565 sealant Substances 0.000 description 1
- 230000035939 shock Effects 0.000 description 1
- 229910001220 stainless steel Inorganic materials 0.000 description 1
- 239000010935 stainless steel Substances 0.000 description 1
- 125000004079 stearyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000001424 substituent group Chemical group 0.000 description 1
- 239000000454 talc Substances 0.000 description 1
- 229910052623 talc Inorganic materials 0.000 description 1
- 150000003512 tertiary amines Chemical class 0.000 description 1
- 239000010409 thin film Substances 0.000 description 1
- 125000003944 tolyl group Chemical group 0.000 description 1
- 125000002469 tricosyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 description 1
- UHUUYVZLXJHWDV-UHFFFAOYSA-N trimethyl(methylsilyloxy)silane Chemical compound C[SiH2]O[Si](C)(C)C UHUUYVZLXJHWDV-UHFFFAOYSA-N 0.000 description 1
- 125000002948 undecyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 description 1
- 229920002554 vinyl polymer Polymers 0.000 description 1
- 239000003039 volatile agent Substances 0.000 description 1
- 125000005023 xylyl group Chemical group 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08G—MACROMOLECULAR COMPOUNDS OBTAINED OTHERWISE THAN BY REACTIONS ONLY INVOLVING UNSATURATED CARBON-TO-CARBON BONDS
- C08G77/00—Macromolecular compounds obtained by reactions forming a linkage containing silicon with or without sulfur, nitrogen, oxygen or carbon in the main chain of the macromolecule
- C08G77/42—Block-or graft-polymers containing polysiloxane sequences
- C08G77/445—Block-or graft-polymers containing polysiloxane sequences containing polyester sequences
- C08G77/448—Block-or graft-polymers containing polysiloxane sequences containing polyester sequences containing polycarbonate sequences
Landscapes
- Chemical & Material Sciences (AREA)
- Health & Medical Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Medicinal Chemistry (AREA)
- Polymers & Plastics (AREA)
- Organic Chemistry (AREA)
- Polyesters Or Polycarbonates (AREA)
- Silicon Polymers (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US08/068,445 US5932677A (en) | 1993-05-27 | 1993-05-27 | Terpolymer having aromatic polyester, polysiloxane and polycarbonate segments |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DE69413878D1 DE69413878D1 (de) | 1998-11-19 |
| DE69413878T2 true DE69413878T2 (de) | 1999-05-12 |
Family
ID=22082638
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE69413878T Expired - Fee Related DE69413878T2 (de) | 1993-05-27 | 1994-05-18 | Terpolymer mit Segmenten von aromatischen Polyestern, Polysiloxanen und Polycarbonaten |
Country Status (5)
| Country | Link |
|---|---|
| US (1) | US5932677A (enExample) |
| EP (1) | EP0626416B1 (enExample) |
| JP (1) | JP3111135B2 (enExample) |
| DE (1) | DE69413878T2 (enExample) |
| ES (1) | ES2122170T3 (enExample) |
Families Citing this family (39)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US5616674A (en) * | 1994-05-10 | 1997-04-01 | General Electric Company | Method of preparing polycarbonate-polysiloxane block copolymers |
| US6103837A (en) * | 1995-06-06 | 2000-08-15 | Kanegafuchi Kagaku Kogyo Kabushiki Kaisha | Random siloxane copolymer, process for production thereof, and resin composition containing the copolymer |
| US7358305B2 (en) * | 1995-06-07 | 2008-04-15 | Acushnet Company | Golf balls containing impact modified non-ionic thermoplastic polycarbonate/polyester copolymers or blends |
| EP0857746A4 (en) | 1996-08-21 | 1999-11-24 | Kaneka Corp | PROCESS FOR PREPARING SILOXANE COPOLYMERS AND RESIN COMPOSITIONS CONTAINING SILOXANE COPOLYMERS PREPARED ACCORDING TO SAID PROCESS |
| US6136521A (en) * | 1997-02-20 | 2000-10-24 | Idemitsu Kosan Co., Ltd. | Polycarbonate, and molding and electrophotographic photoreceptor prepared therefrom |
| JP4338243B2 (ja) * | 1998-11-02 | 2009-10-07 | ユニチカ株式会社 | 被膜形成用樹脂 |
| JP4338244B2 (ja) * | 1998-11-05 | 2009-10-07 | ユニチカ株式会社 | 被膜形成用樹脂の製造方法 |
| JP4339431B2 (ja) * | 1998-11-25 | 2009-10-07 | ユニチカ株式会社 | 絶縁性被膜 |
| DE19910975A1 (de) * | 1999-03-09 | 2000-09-21 | Goldschmidt Ag Th | Carbonatgruppen enthaltende, mit linearen Polyestern modifizierte Polysiloxane und ihre Verwendung als Zsatzstoffe in Beschichtungen |
| US7169859B2 (en) * | 1999-05-18 | 2007-01-30 | General Electric Company | Weatherable, thermostable polymers having improved flow composition |
| US7605221B2 (en) * | 1999-05-18 | 2009-10-20 | Sabic Innovative Plastics Ip B.V. | Weatherable, thermostable polymers having improved flow composition |
| US7790292B2 (en) * | 1999-05-18 | 2010-09-07 | Sabic Innovative Plastics Ip B.V. | Polysiloxane copolymers, thermoplastic composition, and articles formed therefrom |
| US6492481B1 (en) * | 2000-07-10 | 2002-12-10 | General Electric Company | Substantially single phase silicone copolycarbonates, methods, and optical articles made therefrom |
| US6664015B1 (en) | 2002-06-12 | 2003-12-16 | Xerox Corporation | Sulfonated polyester-siloxane resin |
| US6818723B2 (en) | 2002-06-12 | 2004-11-16 | Xerox Corporation | Sulfonated polyester-siloxane resin |
| US6723864B2 (en) * | 2002-08-16 | 2004-04-20 | General Electric Company | Siloxane bischloroformates |
| US6805809B2 (en) | 2002-08-28 | 2004-10-19 | Board Of Trustees Of University Of Illinois | Decal transfer microfabrication |
| WO2005088759A2 (en) * | 2004-03-08 | 2005-09-22 | The Board Of Trustees Of The University Of Illinois | Microfluidic electrochemical reactors |
| US7491346B2 (en) * | 2004-05-20 | 2009-02-17 | Idemitsu Kosan Co., Ltd. | Polycarbonate resin and electrophotographic photosensitive member using same |
| US7662545B2 (en) * | 2004-10-14 | 2010-02-16 | The Board Of Trustees Of The University Of Illinois | Decal transfer lithography |
| US20060142486A1 (en) * | 2004-12-23 | 2006-06-29 | Derudder James L | Thermoplastic polycarbonate compositions, articles made therefrom and method of manufacture |
| US7321014B2 (en) * | 2004-12-29 | 2008-01-22 | General Electric Company | Transparent compositions, methods for the preparation thereof, and articles derived therefrom |
| US7432327B2 (en) | 2004-12-30 | 2008-10-07 | Sabic Innovative Plastics Ip B.V. | Transparent polymeric compositions comprising polysiloxane-polycarbonate copolymer, articles made therefrom and methods of making same |
| US7227149B2 (en) * | 2004-12-30 | 2007-06-05 | General Electric Company | Method and system for positron emission tomography image reconstruction |
| US7329476B2 (en) | 2005-03-31 | 2008-02-12 | Xerox Corporation | Toner compositions and process thereof |
| US7273917B2 (en) * | 2005-05-20 | 2007-09-25 | General Electric Company | Transparent compositions, methods for the preparation thereof, and articles derived therefrom |
| US7326764B2 (en) | 2005-05-20 | 2008-02-05 | General Electric Company | Transparent compositions, methods for the preparation thereof, and articles derived therefrom |
| US7323535B2 (en) * | 2005-05-20 | 2008-01-29 | General Electric Company | Transparent compositions, methods for the preparation thereof, and articles derived therefrom |
| US7323536B2 (en) | 2005-05-20 | 2008-01-29 | General Electric Company | Transparent compositions, methods for the preparation thereof, and articles derived therefrom |
| KR101289201B1 (ko) * | 2010-03-29 | 2013-07-29 | 주식회사 삼양사 | 에스테르 결합을 갖는 히드록시 말단 실록산, 폴리실록산-폴리카보네이트 공중합체 및 그 제조 방법 |
| KR101542615B1 (ko) * | 2012-05-21 | 2015-08-06 | 제일모직주식회사 | 신규 폴리실록산, 그 제조방법 및 이를 포함하는 폴리카보네이트-폴리실록산 공중합체 |
| JP6387355B2 (ja) | 2012-12-21 | 2018-09-05 | ダウ シリコーンズ コーポレーション | 層状ポリマー構造及び方法 |
| JP6150945B2 (ja) | 2013-07-01 | 2017-06-21 | エルジー・ケム・リミテッド | ポリオルガノシロキサン化合物、製造方法およびこれを含むコーポリカーボネート樹脂 |
| KR101779188B1 (ko) | 2014-09-05 | 2017-09-15 | 주식회사 엘지화학 | 코폴리카보네이트 및 이를 포함하는 조성물 |
| KR20160067714A (ko) | 2014-12-04 | 2016-06-14 | 주식회사 엘지화학 | 코폴리카보네이트 및 이를 포함하는 물품 |
| KR101685665B1 (ko) * | 2014-12-04 | 2016-12-12 | 주식회사 엘지화학 | 코폴리카보네이트 및 이를 포함하는 조성물 |
| KR20170009593A (ko) | 2015-07-17 | 2017-01-25 | 주식회사 엘지화학 | 신규한 폴리오르가노실록산 및 이를 포함하는 폴리카보네이트 수지 조성물 |
| WO2017119657A1 (ko) | 2016-01-07 | 2017-07-13 | 주식회사 엘지화학 | 신규한 폴리오르가노실록산, 및 이를 사용하여 제조되는 코폴리카보네이트 |
| KR101831886B1 (ko) | 2016-01-07 | 2018-04-04 | 주식회사 엘지화학 | 신규한 폴리오르가노실록산, 및 이를 사용하여 제조되는 코폴리카보네이트 |
Family Cites Families (18)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| BE532543A (enExample) * | 1953-10-16 | |||
| US3275601A (en) * | 1956-01-04 | 1966-09-27 | Bayer Ag | Manufacture of polycarbonates using tertiary amines, quaternary amines and salts thereof as catalysts |
| IT595468A (enExample) * | 1957-08-22 | |||
| US3030331A (en) * | 1957-08-22 | 1962-04-17 | Gen Electric | Process for preparing copolyesters comprising reacting a carbonyl halide with a dicarboxylic acid and a dihydroxy compound in the presence of a tertiary amine |
| US3189662A (en) * | 1961-01-23 | 1965-06-15 | Gen Electric | Organopolysiloxane-polycarbonate block copolymers |
| GB1045533A (en) * | 1963-02-21 | 1966-10-12 | Gen Electric | Flame-resistant polycarbonate compositions |
| US3419635A (en) * | 1966-01-03 | 1968-12-31 | Gen Electric | Room temperature vulcanizing organopolysiloxane-polycarbonate compositions |
| US3419634A (en) * | 1966-01-03 | 1968-12-31 | Gen Electric | Organopolysiloxane polycarbonate block copolymers |
| US3915926A (en) * | 1972-03-10 | 1975-10-28 | Gen Electric | Flame retardant thermoplastic compositions |
| US3832419A (en) * | 1973-03-23 | 1974-08-27 | Gen Electric | Organopolysiloxane-polycarbonate block copolymers |
| US3994988A (en) * | 1975-03-10 | 1976-11-30 | Baxter Laboratories, Inc. | Thermoplastic copolymers of polysiloxane polycarbonate and polyester constituents |
| US4188314A (en) * | 1976-12-14 | 1980-02-12 | General Electric Company | Shaped article obtained from a carbonate-polyester composition |
| DE3344911A1 (de) * | 1983-12-13 | 1985-06-13 | Bayer Ag, 5090 Leverkusen | Thermoplastische polysiloxan-polyester(carbonat)-blockcopolymere, ihre herstellung und verwendung |
| US4994532A (en) * | 1989-06-16 | 1991-02-19 | General Electric Company | Polycarbonate-silicone block copolymer compositions |
| DE3929401A1 (de) * | 1989-09-05 | 1991-03-07 | Bayer Ag | Thermoplastische polyestercarbonat-polysiloxan-blockcopolymere |
| US5025074A (en) * | 1990-08-27 | 1991-06-18 | General Electric Company | Flame retardant organopolysiloxane-polycarbonate triblock copolymers |
| US5283142A (en) * | 1991-02-21 | 1994-02-01 | Canon Kabushiki Kaisha | Image-holding member, and electrophotographic apparatus, apparatus unit, and facsimile machine employing the same |
| DE69224938T2 (de) * | 1991-07-01 | 1998-10-22 | Gen Electric | Terpolymer mit aliphatischen Polyestersegmenten, Polysiloxansegmenten und Polycarbonatsegmenten |
-
1993
- 1993-05-27 US US08/068,445 patent/US5932677A/en not_active Expired - Fee Related
-
1994
- 1994-04-26 JP JP06112295A patent/JP3111135B2/ja not_active Expired - Fee Related
- 1994-05-18 DE DE69413878T patent/DE69413878T2/de not_active Expired - Fee Related
- 1994-05-18 ES ES94303549T patent/ES2122170T3/es not_active Expired - Lifetime
- 1994-05-18 EP EP94303549A patent/EP0626416B1/en not_active Expired - Lifetime
Also Published As
| Publication number | Publication date |
|---|---|
| ES2122170T3 (es) | 1998-12-16 |
| JPH072999A (ja) | 1995-01-06 |
| EP0626416A3 (enExample) | 1994-12-28 |
| JP3111135B2 (ja) | 2000-11-20 |
| US5932677A (en) | 1999-08-03 |
| EP0626416B1 (en) | 1998-10-14 |
| DE69413878D1 (de) | 1998-11-19 |
| EP0626416A2 (en) | 1994-11-30 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE69413878T2 (de) | Terpolymer mit Segmenten von aromatischen Polyestern, Polysiloxanen und Polycarbonaten | |
| DE69224938T2 (de) | Terpolymer mit aliphatischen Polyestersegmenten, Polysiloxansegmenten und Polycarbonatsegmenten | |
| DE69232474T2 (de) | Mischungen aus Polycarbonat-Polysiloxan-Blockcopolymeren und Polycarbonaten oder Polyestercarbonatcopolymeren | |
| DE69415594T2 (de) | Siloxanpolyestercarbonatblockterpolymerzusammensetzungen und wärmebeständiges Polycarbonat | |
| DE69224937T2 (de) | Polycarbonat-Polysiloxan-Blockcopolymere | |
| DE69022567T2 (de) | Polycarbonat-polydimethylsiloxan copolymer und herstellungsverfahren. | |
| DE68925952T2 (de) | Harzzusammensetzung auf Basis von Polycarbonat | |
| DE69022557T2 (de) | Verfahren zur Herstellung von Copolyestercarbonaten. | |
| EP0146827B1 (de) | Thermoplastische Polysiloxan-Polyester(carbonat)-Block-copolymere, ihre Herstellung und Verwendung | |
| DE3884532T2 (de) | Polycarbonat-Polyisobutylen - Blockcopolymere. | |
| DE3520296A1 (de) | Verfahren zur herstellung von copolyphosphonaten mit hoher zaehigkeit | |
| DE69831714T2 (de) | Verzweigungsmittel für reaktive Extrusion | |
| DE3689778T2 (de) | Verfahren zur Herstellung von siloxan- und carbonatenthaltenden Blockcopolymeren. | |
| EP0383954B1 (en) | Branched polycarbonates and process for production thereof | |
| DE69532784T2 (de) | Herstellung von Copolyestercarbonaten nach dem Bischlorkohlensäureester-Prozess | |
| DE69025100T2 (de) | Verfahren zur Herstellung von Polycarbonaten mit kontrolliertem Molekulargewicht aus Bischloroformiaten | |
| DE69118159T2 (de) | Schlagfeste, flammhemmende, durchsichtige Mischungen aus aromatischem Polycarbonat und Poly(aryloxysiloxan) | |
| DE69419818T2 (de) | Bisphosphin-oxid Monomere und damit hergestellte Polycarbonate | |
| EP0075772B1 (de) | Verfahren zur Isolierung von Polycarbonaten auf Basis von 4,4-Dihydroxidiphenylsulfonen | |
| DE69226117T2 (de) | Polycarbonat/Polyestercarbonat-Zusammensetzung | |
| JPH0247486B2 (enExample) | ||
| DE3689013T2 (de) | Verzweigte 2,4,6-tris(4'-hydroxyaryl)-amino-s-Triazine enthaltende Polycarbonate. | |
| DE3638323A1 (de) | Cyclische oligomere enthaltende zubereitungen | |
| EP0014412B1 (de) | Thermoplastische Massen und Verfahren zu ihrer Herstellung | |
| DE69423178T2 (de) | Verzweigte Copolyestercarbonate |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| 8364 | No opposition during term of opposition | ||
| 8339 | Ceased/non-payment of the annual fee |