DE69208668T2 - Mischungen aus Polyester und Polycarbonat, die Phosphite enthalten - Google Patents
Mischungen aus Polyester und Polycarbonat, die Phosphite enthaltenInfo
- Publication number
- DE69208668T2 DE69208668T2 DE69208668T DE69208668T DE69208668T2 DE 69208668 T2 DE69208668 T2 DE 69208668T2 DE 69208668 T DE69208668 T DE 69208668T DE 69208668 T DE69208668 T DE 69208668T DE 69208668 T2 DE69208668 T2 DE 69208668T2
- Authority
- DE
- Germany
- Prior art keywords
- aromatic
- aliphatic
- carbon atoms
- phosphite
- composition
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired - Fee Related
Links
- 239000000203 mixture Substances 0.000 title claims abstract description 70
- 239000004417 polycarbonate Substances 0.000 title claims abstract description 26
- 229920000728 polyester Polymers 0.000 title claims abstract description 26
- 229920000515 polycarbonate Polymers 0.000 title claims abstract description 24
- AQSJGOWTSHOLKH-UHFFFAOYSA-N phosphite(3-) Chemical class [O-]P([O-])[O-] AQSJGOWTSHOLKH-UHFFFAOYSA-N 0.000 title claims description 8
- 125000003118 aryl group Chemical group 0.000 claims abstract description 42
- 125000001931 aliphatic group Chemical group 0.000 claims abstract description 38
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 claims abstract description 36
- -1 aromatic phosphite compounds Chemical class 0.000 claims abstract description 27
- IISBACLAFKSPIT-UHFFFAOYSA-N bisphenol A Chemical compound C=1C=C(O)C=CC=1C(C)(C)C1=CC=C(O)C=C1 IISBACLAFKSPIT-UHFFFAOYSA-N 0.000 claims abstract description 24
- 125000004432 carbon atom Chemical group C* 0.000 claims abstract description 23
- OFOBLEOULBTSOW-UHFFFAOYSA-N Malonic acid Chemical compound OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 claims abstract description 19
- 229920001634 Copolyester Polymers 0.000 claims abstract description 16
- 125000002723 alicyclic group Chemical group 0.000 claims abstract description 15
- 229940106691 bisphenol a Drugs 0.000 claims abstract description 9
- WGCNASOHLSPBMP-UHFFFAOYSA-N hydroxyacetaldehyde Natural products OCC=O WGCNASOHLSPBMP-UHFFFAOYSA-N 0.000 claims abstract description 9
- OJMIONKXNSYLSR-UHFFFAOYSA-N phosphorous acid Chemical class OP(O)O OJMIONKXNSYLSR-UHFFFAOYSA-N 0.000 claims description 29
- KKEYFWRCBNTPAC-UHFFFAOYSA-N terephthalic acid group Chemical group C(C1=CC=C(C(=O)O)C=C1)(=O)O KKEYFWRCBNTPAC-UHFFFAOYSA-N 0.000 claims description 16
- YIMQCDZDWXUDCA-UHFFFAOYSA-N [4-(hydroxymethyl)cyclohexyl]methanol Chemical compound OCC1CCC(CO)CC1 YIMQCDZDWXUDCA-UHFFFAOYSA-N 0.000 claims description 10
- QQVIHTHCMHWDBS-UHFFFAOYSA-N isophthalic acid Chemical group OC(=O)C1=CC=CC(C(O)=O)=C1 QQVIHTHCMHWDBS-UHFFFAOYSA-N 0.000 claims description 10
- ZJIPHXXDPROMEF-UHFFFAOYSA-N dihydroxyphosphanyl dihydrogen phosphite Chemical compound OP(O)OP(O)O ZJIPHXXDPROMEF-UHFFFAOYSA-N 0.000 claims description 9
- 238000009757 thermoplastic moulding Methods 0.000 claims description 4
- 229920000139 polyethylene terephthalate Polymers 0.000 claims description 2
- 239000005020 polyethylene terephthalate Substances 0.000 claims description 2
- 238000000465 moulding Methods 0.000 abstract description 3
- 239000003381 stabilizer Substances 0.000 description 13
- JKIJEFPNVSHHEI-UHFFFAOYSA-N Phenol, 2,4-bis(1,1-dimethylethyl)-, phosphite (3:1) Chemical compound CC(C)(C)C1=CC(C(C)(C)C)=CC=C1OP(OC=1C(=CC(=CC=1)C(C)(C)C)C(C)(C)C)OC1=CC=C(C(C)(C)C)C=C1C(C)(C)C JKIJEFPNVSHHEI-UHFFFAOYSA-N 0.000 description 12
- AIBRSVLEQRWAEG-UHFFFAOYSA-N 3,9-bis(2,4-ditert-butylphenoxy)-2,4,8,10-tetraoxa-3,9-diphosphaspiro[5.5]undecane Chemical compound CC(C)(C)C1=CC(C(C)(C)C)=CC=C1OP1OCC2(COP(OC=3C(=CC(=CC=3)C(C)(C)C)C(C)(C)C)OC2)CO1 AIBRSVLEQRWAEG-UHFFFAOYSA-N 0.000 description 11
- 238000001746 injection moulding Methods 0.000 description 8
- 239000011521 glass Substances 0.000 description 7
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 6
- 229920000642 polymer Polymers 0.000 description 6
- 239000000126 substance Substances 0.000 description 6
- 239000002253 acid Substances 0.000 description 5
- QPFMBZIOSGYJDE-UHFFFAOYSA-N 1,1,2,2-tetrachloroethane Chemical compound ClC(Cl)C(Cl)Cl QPFMBZIOSGYJDE-UHFFFAOYSA-N 0.000 description 4
- 239000004609 Impact Modifier Substances 0.000 description 4
- 238000000034 method Methods 0.000 description 4
- 239000008188 pellet Substances 0.000 description 4
- 230000008859 change Effects 0.000 description 3
- 150000002334 glycols Chemical class 0.000 description 3
- 239000000155 melt Substances 0.000 description 3
- 238000002844 melting Methods 0.000 description 3
- 230000008018 melting Effects 0.000 description 3
- 239000012779 reinforcing material Substances 0.000 description 3
- PXGZQGDTEZPERC-UHFFFAOYSA-N 1,4-cyclohexanedicarboxylic acid Chemical compound OC(=O)C1CCC(C(O)=O)CC1 PXGZQGDTEZPERC-UHFFFAOYSA-N 0.000 description 2
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 2
- DNIAPMSPPWPWGF-UHFFFAOYSA-N Propylene glycol Chemical compound CC(O)CO DNIAPMSPPWPWGF-UHFFFAOYSA-N 0.000 description 2
- PPBRXRYQALVLMV-UHFFFAOYSA-N Styrene Chemical compound C=CC1=CC=CC=C1 PPBRXRYQALVLMV-UHFFFAOYSA-N 0.000 description 2
- GWEVSGVZZGPLCZ-UHFFFAOYSA-N Titan oxide Chemical compound O=[Ti]=O GWEVSGVZZGPLCZ-UHFFFAOYSA-N 0.000 description 2
- CIUQDSCDWFSTQR-UHFFFAOYSA-N [C]1=CC=CC=C1 Chemical group [C]1=CC=CC=C1 CIUQDSCDWFSTQR-UHFFFAOYSA-N 0.000 description 2
- NIXOWILDQLNWCW-UHFFFAOYSA-N acrylic acid group Chemical group C(C=C)(=O)O NIXOWILDQLNWCW-UHFFFAOYSA-N 0.000 description 2
- 239000000654 additive Substances 0.000 description 2
- WNLRTRBMVRJNCN-UHFFFAOYSA-N adipic acid Chemical compound OC(=O)CCCCC(O)=O WNLRTRBMVRJNCN-UHFFFAOYSA-N 0.000 description 2
- 239000003963 antioxidant agent Substances 0.000 description 2
- 229920000402 bisphenol A polycarbonate polymer Polymers 0.000 description 2
- WERYXYBDKMZEQL-UHFFFAOYSA-N butane-1,4-diol Chemical compound OCCCCO WERYXYBDKMZEQL-UHFFFAOYSA-N 0.000 description 2
- 239000003795 chemical substances by application Substances 0.000 description 2
- 150000001991 dicarboxylic acids Chemical class 0.000 description 2
- 239000000975 dye Substances 0.000 description 2
- 150000002531 isophthalic acids Chemical class 0.000 description 2
- 239000010445 mica Substances 0.000 description 2
- 229910052618 mica group Inorganic materials 0.000 description 2
- BDJRBEYXGGNYIS-UHFFFAOYSA-N nonanedioic acid Chemical compound OC(=O)CCCCCCCC(O)=O BDJRBEYXGGNYIS-UHFFFAOYSA-N 0.000 description 2
- WLJVNTCWHIRURA-UHFFFAOYSA-N pimelic acid Chemical compound OC(=O)CCCCCC(O)=O WLJVNTCWHIRURA-UHFFFAOYSA-N 0.000 description 2
- 238000012545 processing Methods 0.000 description 2
- CXMXRPHRNRROMY-UHFFFAOYSA-N sebacic acid Chemical compound OC(=O)CCCCCCCCC(O)=O CXMXRPHRNRROMY-UHFFFAOYSA-N 0.000 description 2
- 238000001542 size-exclusion chromatography Methods 0.000 description 2
- 239000000243 solution Substances 0.000 description 2
- 239000002904 solvent Substances 0.000 description 2
- TYFQFVWCELRYAO-UHFFFAOYSA-N suberic acid Chemical compound OC(=O)CCCCCCC(O)=O TYFQFVWCELRYAO-UHFFFAOYSA-N 0.000 description 2
- 239000000454 talc Substances 0.000 description 2
- 229910052623 talc Inorganic materials 0.000 description 2
- KKEYFWRCBNTPAC-UHFFFAOYSA-L terephthalate(2-) Chemical compound [O-]C(=O)C1=CC=C(C([O-])=O)C=C1 KKEYFWRCBNTPAC-UHFFFAOYSA-L 0.000 description 2
- 150000003504 terephthalic acids Chemical class 0.000 description 2
- 229920001169 thermoplastic Polymers 0.000 description 2
- 239000004416 thermosoftening plastic Substances 0.000 description 2
- 235000012431 wafers Nutrition 0.000 description 2
- DNIAPMSPPWPWGF-VKHMYHEASA-N (+)-propylene glycol Chemical compound C[C@H](O)CO DNIAPMSPPWPWGF-VKHMYHEASA-N 0.000 description 1
- YPFDHNVEDLHUCE-UHFFFAOYSA-N 1,3-propanediol Substances OCCCO YPFDHNVEDLHUCE-UHFFFAOYSA-N 0.000 description 1
- QFGCFKJIPBRJGM-UHFFFAOYSA-N 12-[(2-methylpropan-2-yl)oxy]-12-oxododecanoic acid Chemical compound CC(C)(C)OC(=O)CCCCCCCCCCC(O)=O QFGCFKJIPBRJGM-UHFFFAOYSA-N 0.000 description 1
- FQXGHZNSUOHCLO-UHFFFAOYSA-N 2,2,4,4-tetramethyl-1,3-cyclobutanediol Chemical compound CC1(C)C(O)C(C)(C)C1O FQXGHZNSUOHCLO-UHFFFAOYSA-N 0.000 description 1
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 description 1
- NEQFBGHQPUXOFH-UHFFFAOYSA-N 4-(4-carboxyphenyl)benzoic acid Chemical compound C1=CC(C(=O)O)=CC=C1C1=CC=C(C(O)=O)C=C1 NEQFBGHQPUXOFH-UHFFFAOYSA-N 0.000 description 1
- DZFAKQZRZPHYLG-VOTSOKGWSA-N 4-[(e)-2-phenylethenyl]cyclohexa-2,4-diene-1,1-dicarboxylic acid Chemical compound C1=CC(C(=O)O)(C(O)=O)CC=C1\C=C\C1=CC=CC=C1 DZFAKQZRZPHYLG-VOTSOKGWSA-N 0.000 description 1
- 229920000049 Carbon (fiber) Polymers 0.000 description 1
- 238000012695 Interfacial polymerization Methods 0.000 description 1
- ALQSHHUCVQOPAS-UHFFFAOYSA-N Pentane-1,5-diol Chemical compound OCCCCCO ALQSHHUCVQOPAS-UHFFFAOYSA-N 0.000 description 1
- YGYAWVDWMABLBF-UHFFFAOYSA-N Phosgene Chemical compound ClC(Cl)=O YGYAWVDWMABLBF-UHFFFAOYSA-N 0.000 description 1
- OAICVXFJPJFONN-UHFFFAOYSA-N Phosphorus Chemical compound [P] OAICVXFJPJFONN-UHFFFAOYSA-N 0.000 description 1
- KDYFGRWQOYBRFD-UHFFFAOYSA-N Succinic acid Natural products OC(=O)CCC(O)=O KDYFGRWQOYBRFD-UHFFFAOYSA-N 0.000 description 1
- 239000012963 UV stabilizer Substances 0.000 description 1
- 239000006096 absorbing agent Substances 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 239000001361 adipic acid Substances 0.000 description 1
- 235000011037 adipic acid Nutrition 0.000 description 1
- 125000005907 alkyl ester group Chemical group 0.000 description 1
- 230000003078 antioxidant effect Effects 0.000 description 1
- 150000005840 aryl radicals Chemical class 0.000 description 1
- 239000011324 bead Substances 0.000 description 1
- 229920001400 block copolymer Polymers 0.000 description 1
- KDYFGRWQOYBRFD-NUQCWPJISA-N butanedioic acid Chemical compound O[14C](=O)CC[14C](O)=O KDYFGRWQOYBRFD-NUQCWPJISA-N 0.000 description 1
- 239000004917 carbon fiber Substances 0.000 description 1
- 238000006243 chemical reaction Methods 0.000 description 1
- 239000004927 clay Substances 0.000 description 1
- 229910052570 clay Inorganic materials 0.000 description 1
- 150000001875 compounds Chemical class 0.000 description 1
- 238000006482 condensation reaction Methods 0.000 description 1
- 239000011258 core-shell material Substances 0.000 description 1
- QLVWOKQMDLQXNN-UHFFFAOYSA-N dibutyl carbonate Chemical compound CCCCOC(=O)OCCCC QLVWOKQMDLQXNN-UHFFFAOYSA-N 0.000 description 1
- ROORDVPLFPIABK-UHFFFAOYSA-N diphenyl carbonate Chemical compound C=1C=CC=CC=1OC(=O)OC1=CC=CC=C1 ROORDVPLFPIABK-UHFFFAOYSA-N 0.000 description 1
- 125000003438 dodecyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 150000002148 esters Chemical group 0.000 description 1
- HQQADJVZYDDRJT-UHFFFAOYSA-N ethene;prop-1-ene Chemical group C=C.CC=C HQQADJVZYDDRJT-UHFFFAOYSA-N 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 239000000835 fiber Substances 0.000 description 1
- 239000000945 filler Substances 0.000 description 1
- 238000009472 formulation Methods 0.000 description 1
- 239000007789 gas Substances 0.000 description 1
- 239000003365 glass fiber Substances 0.000 description 1
- XXMIOPMDWAUFGU-UHFFFAOYSA-N hexane-1,6-diol Chemical compound OCCCCCCO XXMIOPMDWAUFGU-UHFFFAOYSA-N 0.000 description 1
- 125000004051 hexyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 239000008240 homogeneous mixture Substances 0.000 description 1
- 238000010348 incorporation Methods 0.000 description 1
- 239000004615 ingredient Substances 0.000 description 1
- 238000002347 injection Methods 0.000 description 1
- 239000007924 injection Substances 0.000 description 1
- 125000004491 isohexyl group Chemical group C(CCC(C)C)* 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 238000012423 maintenance Methods 0.000 description 1
- 230000014759 maintenance of location Effects 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 239000012803 melt mixture Substances 0.000 description 1
- 238000010128 melt processing Methods 0.000 description 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- 238000012986 modification Methods 0.000 description 1
- 230000004048 modification Effects 0.000 description 1
- WPUMVKJOWWJPRK-UHFFFAOYSA-N naphthalene-2,7-dicarboxylic acid Chemical compound C1=CC(C(O)=O)=CC2=CC(C(=O)O)=CC=C21 WPUMVKJOWWJPRK-UHFFFAOYSA-N 0.000 description 1
- SLCVBVWXLSEKPL-UHFFFAOYSA-N neopentyl glycol Chemical compound OCC(C)(C)CO SLCVBVWXLSEKPL-UHFFFAOYSA-N 0.000 description 1
- 239000011368 organic material Substances 0.000 description 1
- 125000001147 pentyl group Chemical group C(CCCC)* 0.000 description 1
- 229910052698 phosphorus Inorganic materials 0.000 description 1
- 239000011574 phosphorus Substances 0.000 description 1
- 150000003018 phosphorus compounds Chemical class 0.000 description 1
- 239000000049 pigment Substances 0.000 description 1
- 238000006068 polycondensation reaction Methods 0.000 description 1
- 229920002959 polymer blend Polymers 0.000 description 1
- 229920005594 polymer fiber Polymers 0.000 description 1
- 229920000874 polytetramethylene terephthalate Polymers 0.000 description 1
- 229920000166 polytrimethylene carbonate Polymers 0.000 description 1
- 230000008569 process Effects 0.000 description 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 230000005855 radiation Effects 0.000 description 1
- 230000009467 reduction Effects 0.000 description 1
- 150000004760 silicates Chemical class 0.000 description 1
- 238000000638 solvent extraction Methods 0.000 description 1
- 239000011877 solvent mixture Substances 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 125000004079 stearyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 230000001954 sterilising effect Effects 0.000 description 1
- 238000004659 sterilization and disinfection Methods 0.000 description 1
- 230000002195 synergetic effect Effects 0.000 description 1
- 229920001897 terpolymer Polymers 0.000 description 1
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 238000012360 testing method Methods 0.000 description 1
- 239000004408 titanium dioxide Substances 0.000 description 1
- 230000004580 weight loss Effects 0.000 description 1
- 239000010456 wollastonite Substances 0.000 description 1
- 229910052882 wollastonite Inorganic materials 0.000 description 1
- 238000004383 yellowing Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08L—COMPOSITIONS OF MACROMOLECULAR COMPOUNDS
- C08L67/00—Compositions of polyesters obtained by reactions forming a carboxylic ester link in the main chain; Compositions of derivatives of such polymers
- C08L67/02—Polyesters derived from dicarboxylic acids and dihydroxy compounds
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08K—Use of inorganic or non-macromolecular organic substances as compounding ingredients
- C08K5/00—Use of organic ingredients
- C08K5/49—Phosphorus-containing compounds
- C08K5/51—Phosphorus bound to oxygen
- C08K5/52—Phosphorus bound to oxygen only
- C08K5/524—Esters of phosphorous acids, e.g. of H3PO3
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08L—COMPOSITIONS OF MACROMOLECULAR COMPOUNDS
- C08L69/00—Compositions of polycarbonates; Compositions of derivatives of polycarbonates
Landscapes
- Chemical & Material Sciences (AREA)
- Health & Medical Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Medicinal Chemistry (AREA)
- Polymers & Plastics (AREA)
- Organic Chemistry (AREA)
- Compositions Of Macromolecular Compounds (AREA)
- Polyesters Or Polycarbonates (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US07/739,561 US5254610A (en) | 1991-08-02 | 1991-08-02 | Polyester/polycarbonate blends containing phosphites |
| PCT/US1992/006287 WO1993003092A1 (en) | 1991-08-02 | 1992-07-30 | Polyester/polycarbonate blends containing phosphites |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DE69208668D1 DE69208668D1 (de) | 1996-04-04 |
| DE69208668T2 true DE69208668T2 (de) | 1996-08-14 |
Family
ID=24972865
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE69208668T Expired - Fee Related DE69208668T2 (de) | 1991-08-02 | 1992-07-30 | Mischungen aus Polyester und Polycarbonat, die Phosphite enthalten |
Country Status (10)
| Country | Link |
|---|---|
| US (1) | US5254610A (show.php) |
| EP (1) | EP0598043B1 (show.php) |
| JP (1) | JP3217782B2 (show.php) |
| AT (1) | ATE134680T1 (show.php) |
| CA (1) | CA2114640A1 (show.php) |
| DE (1) | DE69208668T2 (show.php) |
| DK (1) | DK0598043T3 (show.php) |
| ES (1) | ES2084374T3 (show.php) |
| TW (1) | TW213942B (show.php) |
| WO (1) | WO1993003092A1 (show.php) |
Families Citing this family (47)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| WO1993022384A1 (en) * | 1992-05-07 | 1993-11-11 | Eastman Chemical Company | Clear copolyester/polycarbonate blends |
| BR9507767A (pt) * | 1994-05-27 | 1997-09-02 | Ciba Geigy Ag | Blendas poliéster/policarbonato com propriedades aperfeiçoadas |
| US5521236A (en) * | 1994-11-01 | 1996-05-28 | Akzo Nobel N.V. | Flame retarded stabilized polyester composition |
| US5491179A (en) * | 1994-11-23 | 1996-02-13 | Bayer Corporation | Thermally stable, gamma radiation-resistant blend of polycarbonate with polyester |
| US5552512A (en) * | 1995-10-06 | 1996-09-03 | Eastman Chemical Company | Thermoplastic copolyesters having improved gas barrier properties |
| US6177492B1 (en) * | 1998-03-03 | 2001-01-23 | Mitsubishi Engineering-Plastics Corporation | Thermoplastic resin composition |
| US6613823B1 (en) * | 1998-10-21 | 2003-09-02 | Phillips Petroleum Company | Phosphite additives in polyolefins |
| DE50008258D1 (de) * | 1999-08-13 | 2004-11-18 | Basell Polyolefine Gmbh | Copolymere von ethylen mit c3-c9 alpha-olefinen |
| JP2002012748A (ja) * | 2000-06-29 | 2002-01-15 | Tsutsunaka Plast Ind Co Ltd | 樹脂組成物 |
| US20020082360A1 (en) * | 2000-11-03 | 2002-06-27 | Conn Roy Lee | Films and articles formed from blends of polycarbonate and polyester |
| US6569957B2 (en) | 2000-11-03 | 2003-05-27 | Eastman Chemical Company | Blends of polycarbonate and polyester and sheets and films formed therefrom |
| KR100439788B1 (ko) * | 2001-06-27 | 2004-07-12 | 제일모직주식회사 | 환경응력균열저항이 우수한 폴리카보네이트계 수지조성물 |
| US6696510B2 (en) | 2001-12-10 | 2004-02-24 | Ticona Llc | Stabilized resin compositions |
| US6641920B2 (en) | 2002-02-08 | 2003-11-04 | Eastman Chemical Company | Ultraviolet protected multi-layer structures of copolyester/polycarbonate blends |
| US6723768B2 (en) * | 2002-03-27 | 2004-04-20 | Eastman Chemical Company | Polyester/polycarbonate blends with reduced yellowness |
| WO2003105922A2 (en) * | 2002-06-13 | 2003-12-24 | Existent, Inc. | Guidewire system |
| US20050288769A1 (en) * | 2002-06-13 | 2005-12-29 | Oren Globerman | Mechanical structures and implants using said structures |
| US7342059B2 (en) * | 2003-01-13 | 2008-03-11 | Eastman Chemical Company | Polyester-polycarbonate blends useful for extrusion blow-molding |
| US20040143041A1 (en) * | 2003-01-13 | 2004-07-22 | Pearson Jason Clay | Polyester compositions |
| WO2004065487A1 (en) * | 2003-01-13 | 2004-08-05 | Eastman Chemical Company | Polymer blends |
| US7297735B2 (en) * | 2003-03-05 | 2007-11-20 | Eastman Chemical Company | Polycarbonate compositions |
| US7482397B2 (en) * | 2003-01-13 | 2009-01-27 | Eastman Chemical Company | Polycarbonate compositions |
| US7125611B2 (en) * | 2003-02-26 | 2006-10-24 | Eastman Kodak Company | Polyester compositions useful for image-receiving layers |
| US7338992B2 (en) * | 2003-03-05 | 2008-03-04 | Eastman Chemical Company | Polyolefin compositions |
| EP1599532B1 (en) * | 2003-03-05 | 2017-05-17 | Eastman Chemical Company | Polymer compositions containing an ultraviolet light absorbing compound |
| US20040180994A1 (en) * | 2003-03-05 | 2004-09-16 | Pearson Jason Clay | Polyolefin compositions |
| US20050277713A1 (en) * | 2003-03-05 | 2005-12-15 | Pearson Jason C | Polymer blends |
| DE60320035T2 (de) * | 2003-03-05 | 2009-05-14 | Eastman Chemical Co., Kingsport | Polymerblends |
| US20040183053A1 (en) * | 2003-03-20 | 2004-09-23 | Pearson Jason Clay | Process for the preparation of a hindered amine light stabilizer salt |
| US20040192813A1 (en) * | 2003-03-20 | 2004-09-30 | Pearson Jason Clay | Polymer compositions containing an ultraviolet light absorbing compound |
| US20050277771A1 (en) * | 2003-03-20 | 2005-12-15 | Pearson Jason C | Process for the preparation of a hindered amine light stabilizer salt |
| US7078447B2 (en) | 2003-11-21 | 2006-07-18 | General Electric Company | Ionizing radiation stable polyarylestercarbonate compositions |
| US7345104B2 (en) * | 2003-12-16 | 2008-03-18 | Eastman Chemical Company | Polyester-polycarbonate blends useful for extrusion blow-molding |
| US8067525B2 (en) * | 2005-06-17 | 2011-11-29 | Eastman Chemical Company | Film(s) and/or sheet(s) comprising polyester compositions which comprise cyclobutanediol and have a certain combination of inherent viscosity and high glass transition temperature |
| US20070037960A1 (en) * | 2005-08-15 | 2007-02-15 | General Electric Company | Copolyester stilbene embossed film and methods of making the same |
| US7105627B1 (en) * | 2005-08-15 | 2006-09-12 | General Electric Company | Polyester stilbene composition |
| US8008384B2 (en) | 2006-06-20 | 2011-08-30 | Chemtura Corporation | Liquid butylaryl phosphite compositions |
| US20100076131A1 (en) * | 2006-06-20 | 2010-03-25 | Chemtura Corporation | Liquid butylaryl phosphite compositions and alkylate compositions for manufacturing same |
| US8188170B2 (en) | 2006-06-20 | 2012-05-29 | Chemtura Corporation | Polymers with low gel content and enhanced gas-fading |
| US7947769B2 (en) * | 2006-06-20 | 2011-05-24 | Chemtura Corporation | Liquid amylaryl phosphite compositions and alkylate compositions for manufacturing same |
| US8183311B2 (en) * | 2006-06-20 | 2012-05-22 | Chemtura Corporation | Liquid phosphite composition derived from cresols |
| US8178005B2 (en) * | 2006-06-20 | 2012-05-15 | Chemtura Corporation | Liquid phosphite compositions having different alkyl groups |
| US8008383B2 (en) | 2006-06-20 | 2011-08-30 | Chemtura Corporation | Liquid amylaryl phosphite compositions |
| US7888414B2 (en) * | 2006-06-20 | 2011-02-15 | Chemtura Corporation | Liquid phosphite blends as stabilizers |
| EP2459577A1 (en) | 2009-07-31 | 2012-06-06 | Chemtura Corporation | Liquid alkylated trisaryl phosphite compositions having two alkyl groups with different carbon number |
| US8735628B2 (en) | 2009-07-31 | 2014-05-27 | Addivant Usa Llc | Processes for forming alkylated aryl phosphite compositions from complex hydrocarbon streams |
| CN107075238B (zh) * | 2014-10-03 | 2019-04-09 | 株式会社钟化 | 用于聚碳酸酯及聚芳酯的流动性改进剂、聚碳酸酯树脂组合物、聚芳酯树脂组合物、以及树脂组合物的成型品 |
Family Cites Families (16)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3822225A (en) * | 1972-09-14 | 1974-07-02 | Westvaco Corp | Method of elastomer stabilization and products therefrom |
| DE2656748C2 (de) * | 1975-12-23 | 1985-11-28 | Ciba-Geigy Ag, Basel | Phosphitgemische, Verfahren zu ihrer Herstellung und ihre Verwendung zum Stabilisieren organischer Materialien |
| US4188314A (en) * | 1976-12-14 | 1980-02-12 | General Electric Company | Shaped article obtained from a carbonate-polyester composition |
| US4391954A (en) * | 1976-12-14 | 1983-07-05 | General Electric Company | Thermoplastic molding composition |
| US4088709A (en) * | 1977-07-01 | 1978-05-09 | Eastman Kodak Company | Phosphorus stabilized-polyester-polycarbonate molding compositions |
| JPS55747A (en) * | 1978-06-20 | 1980-01-07 | Adeka Argus Chem Co Ltd | Halogen-containing resin composition |
| US4786692A (en) * | 1982-12-20 | 1988-11-22 | General Electric Company | High strength, reduced heat distortion temperature thermoplastic composition |
| NL8403489A (nl) * | 1984-11-15 | 1986-06-02 | Stamicarbon | Thermoplastische vormmassa. |
| JPS61287954A (ja) * | 1985-06-14 | 1986-12-18 | Teijin Chem Ltd | ポリカ−ボネ−ト樹脂組成物 |
| US4680371A (en) * | 1986-02-25 | 1987-07-14 | Celanese Corporation | Preparation of aromatic polyester with improved stability by addition of phosphite during preparation |
| JPS62270653A (ja) * | 1986-05-19 | 1987-11-25 | Mitsubishi Gas Chem Co Inc | 熱可塑性樹脂組成物 |
| EP0286290A3 (en) * | 1987-04-10 | 1989-09-27 | Asahi Denka Kogyo Kabushiki Kaisha | Polymer composition |
| EP0320658A1 (en) * | 1987-12-16 | 1989-06-21 | General Electric Company | Polycarbonate composition containing phosphites |
| EP0320652A1 (en) * | 1987-12-16 | 1989-06-21 | General Electric Company | Copolyester carbonate composition containing phosphites |
| WO1991017209A1 (en) * | 1990-05-07 | 1991-11-14 | Eastman Kodak Company | Copolyesters of terephthalic acid and 1,4-cyclohexanedimethanol having improved melt stability |
| US5141975A (en) * | 1991-06-07 | 1992-08-25 | General Electric Company | Thermoplastic compositions containing hydrolytically stable phosphites |
-
1991
- 1991-08-02 US US07/739,561 patent/US5254610A/en not_active Expired - Lifetime
-
1992
- 1992-07-29 TW TW081106010A patent/TW213942B/zh active
- 1992-07-30 DK DK92917894.5T patent/DK0598043T3/da active
- 1992-07-30 ES ES92917894T patent/ES2084374T3/es not_active Expired - Lifetime
- 1992-07-30 WO PCT/US1992/006287 patent/WO1993003092A1/en not_active Ceased
- 1992-07-30 CA CA002114640A patent/CA2114640A1/en not_active Abandoned
- 1992-07-30 JP JP50370393A patent/JP3217782B2/ja not_active Expired - Fee Related
- 1992-07-30 EP EP92917894A patent/EP0598043B1/en not_active Expired - Lifetime
- 1992-07-30 DE DE69208668T patent/DE69208668T2/de not_active Expired - Fee Related
- 1992-07-30 AT AT92917894T patent/ATE134680T1/de not_active IP Right Cessation
Also Published As
| Publication number | Publication date |
|---|---|
| ATE134680T1 (de) | 1996-03-15 |
| TW213942B (show.php) | 1993-10-01 |
| ES2084374T3 (es) | 1996-05-01 |
| EP0598043B1 (en) | 1996-02-28 |
| DK0598043T3 (da) | 1996-03-18 |
| US5254610A (en) | 1993-10-19 |
| EP0598043A1 (en) | 1994-05-25 |
| DE69208668D1 (de) | 1996-04-04 |
| JP3217782B2 (ja) | 2001-10-15 |
| JPH07500361A (ja) | 1995-01-12 |
| WO1993003092A1 (en) | 1993-02-18 |
| CA2114640A1 (en) | 1993-02-18 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE69208668T2 (de) | Mischungen aus Polyester und Polycarbonat, die Phosphite enthalten | |
| DE69322500T2 (de) | Mehrkomponent mischungen aus polyester-polykarbonat mit verbesserter schlagzähigkeit und verarbeitbarkeit | |
| DE69512218T2 (de) | Hochschlagfeste gegenstände aus polyestermischungen | |
| DE2750733C2 (de) | Thermoplastische Formmasse | |
| DE69333179T2 (de) | Stabilisierung von Polybutylenterephthalat-Polyester Mischungen | |
| DE60301398T2 (de) | Polyester/polycarbonat blends mit verminderter gelbheit | |
| EP0503421B1 (de) | Mit Carbodiimiden modifizierte Polyesterfasern und Verfahren zu ihrer Herstellung | |
| DE68914982T2 (de) | Verstärkte giesszubereitungen, die auf poly(1,4-cyclohexylen-dimethylen-terephthalat) basieren mit verbesserten krystallisierungskennzeichen. | |
| DE2338615A1 (de) | Polyesterformmassen | |
| DE2515473B2 (de) | Flaminwidrige, lineare Polyester | |
| DE2460257B2 (de) | Mischungen eines thermoplastischen Copotyätheresters mit Polybutylenterephthalat | |
| DE69307688T2 (de) | Hochschlagzähe polyester-ethylencopolymer mischungen | |
| DE602004011157T2 (de) | Formbare Polyesterzusammensetzung | |
| DE2920246A1 (de) | Polyestermasse fuer die herstellung von formkoerpern und die daraus hergestellten formkoerper | |
| DE19842152A1 (de) | Verfahren zur Herstellung von hochviskosen Polyestern | |
| DE2922486A1 (de) | Polyaetherester-blockcopolymer sowie verfahren zur herstellung desselben | |
| DE69122106T2 (de) | Mischungen aus polyethylen-terephthalat und polyethylen-naphthalendikarboxylat, die einen phosphorstabilisator enthalten | |
| DE2524121A1 (de) | Thermoplastische polybutylenterephthalat-formmassen mit verbesserter kriechstromfestigkeit | |
| DE69006245T2 (de) | Harzzusammensetzung aus Polybutylenterephthalat und thermoplastischem Elastomer; Formkörper daraus. | |
| DE3210845A1 (de) | 2-methyl-1,3-propylenterephthalat-einheiten enthaltender polyester | |
| DE3873715T2 (de) | Harzmischung aus polybutylenterephthalat und bromiertes polystyrol sowie daraus geformte gegenstaende. | |
| DE2710729A1 (de) | Polymerzusammensetzung und ihr herstellungsverfahren | |
| DE69815111T2 (de) | Verfahren zur darstellung von hochfesten faserverstärkten polymercompositen | |
| DE69922713T2 (de) | Polyesterformmasse | |
| EP0392357A2 (de) | Glasfaserverstärkte thermoplastische Formmassen auf der Basis von Polyestern und Pfropfpolymerisaten |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| 8364 | No opposition during term of opposition | ||
| 8339 | Ceased/non-payment of the annual fee |