DE6606476U - Bauelement, insbesondere fuer eine vorzufertigende treppe. - Google Patents
Bauelement, insbesondere fuer eine vorzufertigende treppe.Info
- Publication number
- DE6606476U DE6606476U DE6606476U DE6606476U DE6606476U DE 6606476 U DE6606476 U DE 6606476U DE 6606476 U DE6606476 U DE 6606476U DE 6606476 U DE6606476 U DE 6606476U DE 6606476 U DE6606476 U DE 6606476U
- Authority
- DE
- Germany
- Prior art keywords
- sleeves
- sleeve
- component according
- outer sleeve
- another
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 239000000463 material Substances 0.000 claims description 9
- 238000006073 displacement reaction Methods 0.000 claims description 4
- 238000010276 construction Methods 0.000 claims description 3
- 230000000149 penetrating effect Effects 0.000 claims description 2
- 125000006850 spacer group Chemical group 0.000 description 4
- 238000007789 sealing Methods 0.000 description 3
- 238000003754 machining Methods 0.000 description 2
- 238000004519 manufacturing process Methods 0.000 description 2
- NJPPVKZQTLUDBO-UHFFFAOYSA-N novaluron Chemical compound C1=C(Cl)C(OC(F)(F)C(OC(F)(F)F)F)=CC=C1NC(=O)NC(=O)C1=C(F)C=CC=C1F NJPPVKZQTLUDBO-UHFFFAOYSA-N 0.000 description 2
- 229910000897 Babbitt (metal) Inorganic materials 0.000 description 1
- CWYNVVGOOAEACU-UHFFFAOYSA-N Fe2+ Chemical compound [Fe+2] CWYNVVGOOAEACU-UHFFFAOYSA-N 0.000 description 1
- 229910000831 Steel Inorganic materials 0.000 description 1
- 238000005299 abrasion Methods 0.000 description 1
- 239000010425 asbestos Substances 0.000 description 1
- 239000004568 cement Substances 0.000 description 1
- 239000002131 composite material Substances 0.000 description 1
- 230000007797 corrosion Effects 0.000 description 1
- 238000005260 corrosion Methods 0.000 description 1
- 239000004579 marble Substances 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- 230000002265 prevention Effects 0.000 description 1
- 229910052895 riebeckite Inorganic materials 0.000 description 1
- 239000010959 steel Substances 0.000 description 1
- 239000002023 wood Substances 0.000 description 1
Classifications
-
- E—FIXED CONSTRUCTIONS
- E04—BUILDING
- E04F—FINISHING WORK ON BUILDINGS, e.g. STAIRS, FLOORS
- E04F11/00—Stairways, ramps, or like structures; Balustrades; Handrails
- E04F11/02—Stairways; Layouts thereof
- E04F11/022—Stairways; Layouts thereof characterised by the supporting structure
- E04F11/035—Stairways consisting of a plurality of assembled modular parts without further support
-
- E—FIXED CONSTRUCTIONS
- E04—BUILDING
- E04F—FINISHING WORK ON BUILDINGS, e.g. STAIRS, FLOORS
- E04F11/00—Stairways, ramps, or like structures; Balustrades; Handrails
- E04F11/02—Stairways; Layouts thereof
- E04F11/104—Treads
- E04F11/112—Treads of metal or with an upper layer of metal
Landscapes
- Engineering & Computer Science (AREA)
- Architecture (AREA)
- Civil Engineering (AREA)
- Structural Engineering (AREA)
- Steps, Ramps, And Handrails (AREA)
- Pivots And Pivotal Connections (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| AT111966A AT270976B (de) | 1965-02-16 | 1966-02-08 | Montagefertige Treppe |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE6606476U true DE6606476U (de) | 1970-10-02 |
Family
ID=3506988
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE6606476U Expired DE6606476U (de) | 1966-02-08 | 1966-12-22 | Bauelement, insbesondere fuer eine vorzufertigende treppe. |
Country Status (4)
| Country | Link |
|---|---|
| US (1) | US3474882A (enExample) |
| BE (1) | BE693726A (enExample) |
| DE (1) | DE6606476U (enExample) |
| NL (1) | NL146568B (enExample) |
Families Citing this family (18)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3585769A (en) * | 1968-04-01 | 1971-06-22 | Verderio Giuseppe | Spiral or winding staircase with wooden steps and metal newel |
| US3686806A (en) * | 1970-01-09 | 1972-08-29 | Giuseppe Verderio | Spiral staircase with access way |
| IT977863B (it) * | 1972-10-17 | 1974-09-20 | Kenngott Kg | Scala per fabbricati |
| CH606697A5 (enExample) * | 1976-01-20 | 1978-11-15 | Herbert Ernst | |
| US4193585A (en) * | 1977-11-14 | 1980-03-18 | Roger Eandi | Handrail assembly for curved staircase |
| CA1121569A (en) * | 1980-09-12 | 1982-04-13 | Hans Stussi | Freestanding stair assembly and riser therefor |
| US4373609A (en) * | 1980-12-22 | 1983-02-15 | Victor De Donato | Stairway stringers constructed of cast, readily-assembled units |
| CA1145110A (en) * | 1981-03-30 | 1983-04-26 | Nicholas M. Stathopoulos | Modular staircase assembly |
| US4419851A (en) * | 1981-07-23 | 1983-12-13 | Brock Manufacturing, Inc. | Stair structure for storage bins |
| IT1145800B (it) * | 1981-12-31 | 1986-11-12 | Roberto Molinazzi | Supporto modulare per gradini di scale |
| ATE64976T1 (de) * | 1982-09-14 | 1991-07-15 | Yamazaki Keiichiro | Montagetreppeneinheit fuer eine treppe. |
| IT1201580B (it) * | 1986-10-16 | 1989-02-02 | Indexstudio Sas Di Molinazzi & | Supporto modulare per gradini di scale |
| FR2630483A1 (fr) * | 1988-04-22 | 1989-10-27 | Houze Jean | Escalier autoportant |
| CA2007032C (en) * | 1989-01-27 | 1997-09-30 | Keiichiro Yamazaki | Takedown staircase |
| US5134820A (en) * | 1990-10-16 | 1992-08-04 | Liu Ing Nan | Adjustable built-up stair |
| US5502933A (en) * | 1993-12-10 | 1996-04-02 | Skillern; Charles T. | Modular staircase system |
| WO1998054422A1 (en) * | 1997-05-28 | 1998-12-03 | Lee Lanphier | Modular traditional staircase |
| US12534919B2 (en) * | 2023-12-22 | 2026-01-27 | Fortress Iron, Lp | Reinforced adjustable stair tray |
Family Cites Families (10)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US11032A (en) * | 1854-06-06 | Improvement in seed-planters | ||
| US1046165A (en) * | 1911-08-25 | 1912-12-03 | Mogens Faerch | Self-fitting stair-riser. |
| US1419019A (en) * | 1919-07-12 | 1922-06-06 | Norton Co | Terrazzo safety tread |
| US2216250A (en) * | 1935-08-20 | 1940-10-01 | Henry P Nelson | Stair tread and floor slab surfacing |
| US2190446A (en) * | 1939-02-15 | 1940-02-13 | Fioritto Michael | Stair tread |
| US2593683A (en) * | 1949-07-20 | 1952-04-22 | George W Lyons | Prefabricated stair |
| US3114941A (en) * | 1956-10-18 | 1963-12-24 | Blumcraft Pittsburgh | Rail post assembly |
| US3099336A (en) * | 1960-11-14 | 1963-07-30 | Floyd L Hawkins | Prefabricated stair |
| GB1023921A (en) * | 1961-03-17 | 1966-03-30 | Hugh Stanford Evai I | Improvements in or relating to scaffold structures including prefabricated frame works |
| US3307653A (en) * | 1966-02-07 | 1967-03-07 | Herman O Gnehm | Demountable stairway unit |
-
1966
- 1966-12-22 DE DE6606476U patent/DE6606476U/de not_active Expired
-
1967
- 1967-02-02 US US613494A patent/US3474882A/en not_active Expired - Lifetime
- 1967-02-02 NL NL676701651A patent/NL146568B/xx unknown
- 1967-02-06 BE BE693726D patent/BE693726A/xx unknown
Also Published As
| Publication number | Publication date |
|---|---|
| NL6701651A (enExample) | 1967-08-09 |
| NL146568B (nl) | 1975-07-15 |
| US3474882A (en) | 1969-10-28 |
| DE1659756B1 (de) | 1971-08-05 |
| BE693726A (enExample) | 1967-07-17 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE6606476U (de) | Bauelement, insbesondere fuer eine vorzufertigende treppe. | |
| EP0616088A1 (de) | Ebener oder räumlicher Deckenrost aus Stäben und Knotenstücken, insbesondere begehbarer Deckenrost | |
| DE1003937B (de) | Gelaenderkonstruktion, insbesondere fuer Treppen | |
| DE2111699C3 (de) | Einen Handlauf und eine Vielzahl von Geländerstützen aufweisende Spindeltreppe | |
| DE2555041A1 (de) | Wendeltreppe | |
| DE9409626U1 (de) | Balkonkonstruktion | |
| DE1683121A1 (de) | Spindeltreppe | |
| DE1929713U (de) | Statisch tragende platte. | |
| DE102018112634B4 (de) | Fugenprofil | |
| EP0516999B1 (de) | Aus Leichtmetall bestehender Seitenholm für eine Treppe | |
| DE1659526A1 (de) | Spindeltreppe | |
| DE1509214A1 (de) | Wendeltreppe | |
| DE1659756C2 (de) | Tragkonstruktion für einen Treppenlauf | |
| EP0654568B1 (de) | Vorzufertigende Tragkonstruktion für einen Treppenlauf | |
| DE2025402A1 (de) | Wendeltreppe aus Holz | |
| DE2748039A1 (de) | Vorgefertigte montagetreppe | |
| DE961390C (de) | Frei tragende Wendeltreppe, vorzugsweise aus Holz | |
| AT336862B (de) | Spindeltreppe aus metall | |
| DE1992223U (de) | Freitragende Spindeltreppe | |
| DE1969760U (de) | Vorgefertigtes gelaender aus metall fuer bruecken, treppen, balkone u. dgl. | |
| DE3105646A1 (de) | Geschosstreppe | |
| DE202021105366U1 (de) | Gartendusche | |
| DE202006015391U1 (de) | Sichtschutz- oder Stütz-Wand | |
| DE3624151A1 (de) | Tragkonstruktion fuer einen treppenlauf | |
| DE7610747U1 (de) | Treppe |