DE4230470A1 - Cyclische Harnstoffderivate, diese Verbindungen enthaltende Arzneimittel und Verfahren zu ihrer Herstellung - Google Patents
Cyclische Harnstoffderivate, diese Verbindungen enthaltende Arzneimittel und Verfahren zu ihrer HerstellungInfo
- Publication number
- DE4230470A1 DE4230470A1 DE4230470A DE4230470A DE4230470A1 DE 4230470 A1 DE4230470 A1 DE 4230470A1 DE 4230470 A DE4230470 A DE 4230470A DE 4230470 A DE4230470 A DE 4230470A DE 4230470 A1 DE4230470 A1 DE 4230470A1
- Authority
- DE
- Germany
- Prior art keywords
- group
- carbon atoms
- alkyl
- phenyl
- substituted
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Withdrawn
Links
- ZMGMDXCADSRNCX-UHFFFAOYSA-N 5,6-dihydroxy-1,3-diazepan-2-one Chemical class OC1CNC(=O)NCC1O ZMGMDXCADSRNCX-UHFFFAOYSA-N 0.000 title claims abstract description 15
- 238000002360 preparation method Methods 0.000 title claims description 45
- 238000000034 method Methods 0.000 title claims description 13
- 230000008569 process Effects 0.000 title claims description 4
- 239000008194 pharmaceutical composition Substances 0.000 title claims 2
- -1 amino, amidino Chemical group 0.000 claims abstract description 254
- 125000000217 alkyl group Chemical group 0.000 claims abstract description 216
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims abstract description 115
- 125000003545 alkoxy group Chemical group 0.000 claims abstract description 74
- 125000002947 alkylene group Chemical group 0.000 claims abstract description 67
- 125000002993 cycloalkylene group Chemical group 0.000 claims abstract description 40
- 150000003839 salts Chemical class 0.000 claims abstract description 31
- 125000005551 pyridylene group Chemical group 0.000 claims abstract description 24
- 125000004956 cyclohexylene group Chemical group 0.000 claims abstract description 21
- 125000000843 phenylene group Chemical group C1(=C(C=CC=C1)*)* 0.000 claims abstract description 21
- 125000004103 aminoalkyl group Chemical group 0.000 claims abstract description 15
- 125000003118 aryl group Chemical group 0.000 claims abstract description 13
- 125000005550 pyrazinylene group Chemical group 0.000 claims abstract description 13
- 229910052799 carbon Inorganic materials 0.000 claims abstract description 11
- 125000004299 tetrazol-5-yl group Chemical group [H]N1N=NC(*)=N1 0.000 claims abstract description 11
- 125000004450 alkenylene group Chemical group 0.000 claims abstract description 10
- 125000005842 heteroatom Chemical group 0.000 claims abstract description 5
- 229910052760 oxygen Inorganic materials 0.000 claims abstract description 5
- 229910052717 sulfur Inorganic materials 0.000 claims abstract description 5
- 125000004432 carbon atom Chemical group C* 0.000 claims description 305
- 150000003254 radicals Chemical class 0.000 claims description 165
- 150000001875 compounds Chemical class 0.000 claims description 135
- 229910052757 nitrogen Inorganic materials 0.000 claims description 124
- 125000004433 nitrogen atom Chemical group N* 0.000 claims description 123
- 125000000753 cycloalkyl group Chemical group 0.000 claims description 91
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 claims description 89
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 83
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 claims description 69
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 62
- 239000000460 chlorine Substances 0.000 claims description 49
- 239000000203 mixture Substances 0.000 claims description 43
- 238000006243 chemical reaction Methods 0.000 claims description 40
- 125000001570 methylene group Chemical group [H]C([H])([*:1])[*:2] 0.000 claims description 39
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 claims description 36
- 239000002253 acid Substances 0.000 claims description 33
- 125000004093 cyano group Chemical group *C#N 0.000 claims description 29
- 229910052731 fluorine Inorganic materials 0.000 claims description 27
- 239000011737 fluorine Substances 0.000 claims description 27
- 125000001424 substituent group Chemical group 0.000 claims description 27
- 125000004453 alkoxycarbonyl group Chemical group 0.000 claims description 26
- 125000004390 alkyl sulfonyl group Chemical group 0.000 claims description 26
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 claims description 26
- 229910052801 chlorine Inorganic materials 0.000 claims description 24
- 229910052739 hydrogen Inorganic materials 0.000 claims description 22
- 230000000269 nucleophilic effect Effects 0.000 claims description 22
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 claims description 21
- 125000000472 sulfonyl group Chemical group *S(*)(=O)=O 0.000 claims description 21
- 125000003739 carbamimidoyl group Chemical group C(N)(=N)* 0.000 claims description 20
- 125000001153 fluoro group Chemical group F* 0.000 claims description 20
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 20
- 239000011541 reaction mixture Substances 0.000 claims description 20
- 125000001584 benzyloxycarbonyl group Chemical group C(=O)(OCC1=CC=CC=C1)* 0.000 claims description 18
- 125000000816 ethylene group Chemical group [H]C([H])([*:1])C([H])([H])[*:2] 0.000 claims description 18
- 125000000467 secondary amino group Chemical group [H]N([*:1])[*:2] 0.000 claims description 18
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 claims description 17
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 claims description 16
- 125000004647 alkyl sulfenyl group Chemical group 0.000 claims description 16
- 125000003884 phenylalkyl group Chemical group 0.000 claims description 16
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 claims description 15
- 125000001309 chloro group Chemical group Cl* 0.000 claims description 15
- 125000004801 4-cyanophenyl group Chemical group [H]C1=C([H])C(C#N)=C([H])C([H])=C1* 0.000 claims description 14
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 claims description 14
- 125000004644 alkyl sulfinyl group Chemical group 0.000 claims description 14
- 229920006395 saturated elastomer Polymers 0.000 claims description 14
- 125000003282 alkyl amino group Chemical group 0.000 claims description 13
- 125000003277 amino group Chemical group 0.000 claims description 13
- 125000004663 dialkyl amino group Chemical group 0.000 claims description 12
- 125000005678 ethenylene group Chemical group [H]C([*:1])=C([H])[*:2] 0.000 claims description 12
- 125000004430 oxygen atom Chemical group O* 0.000 claims description 12
- 125000005576 pyrimidinylene group Chemical group 0.000 claims description 12
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 claims description 11
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 11
- 229910052740 iodine Inorganic materials 0.000 claims description 11
- KZBUYRJDOAKODT-UHFFFAOYSA-N Chlorine Chemical compound ClCl KZBUYRJDOAKODT-UHFFFAOYSA-N 0.000 claims description 10
- 125000004448 alkyl carbonyl group Chemical group 0.000 claims description 10
- 150000001602 bicycloalkyls Chemical group 0.000 claims description 10
- 125000001246 bromo group Chemical group Br* 0.000 claims description 10
- 125000002071 phenylalkoxy group Chemical group 0.000 claims description 10
- 239000000126 substance Substances 0.000 claims description 10
- 125000004044 trifluoroacetyl group Chemical group FC(C(=O)*)(F)F 0.000 claims description 10
- 125000000143 2-carboxyethyl group Chemical group [H]OC(=O)C([H])([H])C([H])([H])* 0.000 claims description 9
- 238000004519 manufacturing process Methods 0.000 claims description 9
- 125000001989 1,3-phenylene group Chemical group [H]C1=C([H])C([*:1])=C([H])C([*:2])=C1[H] 0.000 claims description 8
- 125000001316 cycloalkyl alkyl group Chemical group 0.000 claims description 8
- 125000004356 hydroxy functional group Chemical group O* 0.000 claims description 8
- 239000012948 isocyanate Substances 0.000 claims description 8
- 150000002513 isocyanates Chemical class 0.000 claims description 8
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 claims description 7
- 125000004202 aminomethyl group Chemical group [H]N([H])C([H])([H])* 0.000 claims description 7
- 125000000000 cycloalkoxy group Chemical group 0.000 claims description 7
- YAMHXTCMCPHKLN-UHFFFAOYSA-N imidazolidin-2-one Chemical compound O=C1NCCN1 YAMHXTCMCPHKLN-UHFFFAOYSA-N 0.000 claims description 7
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 claims description 7
- UYWQUFXKFGHYNT-UHFFFAOYSA-N phenylmethyl ester of formic acid Natural products O=COCC1=CC=CC=C1 UYWQUFXKFGHYNT-UHFFFAOYSA-N 0.000 claims description 7
- 125000002813 thiocarbonyl group Chemical group *C(*)=S 0.000 claims description 7
- 125000004955 1,4-cyclohexylene group Chemical group [H]C1([H])C([H])([H])C([H])([*:1])C([H])([H])C([H])([H])C1([H])[*:2] 0.000 claims description 6
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical group [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims description 6
- VGGSQFUCUMXWEO-UHFFFAOYSA-N Ethene Chemical compound C=C VGGSQFUCUMXWEO-UHFFFAOYSA-N 0.000 claims description 6
- 239000005977 Ethylene Substances 0.000 claims description 6
- 150000007513 acids Chemical class 0.000 claims description 6
- UYTPUPDQBNUYGX-UHFFFAOYSA-N guanine Chemical compound O=C1NC(N)=NC2=C1N=CN2 UYTPUPDQBNUYGX-UHFFFAOYSA-N 0.000 claims description 6
- 125000001476 phosphono group Chemical group [H]OP(*)(=O)O[H] 0.000 claims description 6
- 125000002777 acetyl group Chemical group [H]C([H])([H])C(*)=O 0.000 claims description 5
- 125000003236 benzoyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C(*)=O 0.000 claims description 5
- 125000004966 cyanoalkyl group Chemical group 0.000 claims description 5
- 230000007062 hydrolysis Effects 0.000 claims description 5
- 238000006460 hydrolysis reaction Methods 0.000 claims description 5
- 150000007524 organic acids Chemical class 0.000 claims description 5
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 claims description 5
- 125000005931 tert-butyloxycarbonyl group Chemical group [H]C([H])([H])C(OC(*)=O)(C([H])([H])[H])C([H])([H])[H] 0.000 claims description 5
- 125000001140 1,4-phenylene group Chemical group [H]C1=C([H])C([*:2])=C([H])C([H])=C1[*:1] 0.000 claims description 4
- UMYSMPMAOXXXDE-UHFFFAOYSA-N 3-[3-[3-[4-(aminomethyl)phenyl]-2-oxoimidazolidin-1-yl]phenyl]propanoic acid Chemical compound C1=CC(CN)=CC=C1N1C(=O)N(C=2C=C(CCC(O)=O)C=CC=2)CC1 UMYSMPMAOXXXDE-UHFFFAOYSA-N 0.000 claims description 4
- MYMOFIZGZYHOMD-UHFFFAOYSA-N Dioxygen Chemical compound O=O MYMOFIZGZYHOMD-UHFFFAOYSA-N 0.000 claims description 4
- 125000005277 alkyl imino group Chemical group 0.000 claims description 4
- 125000004656 alkyl sulfonylamino group Chemical group 0.000 claims description 4
- 150000001412 amines Chemical class 0.000 claims description 4
- 230000027455 binding Effects 0.000 claims description 4
- URZRXKZZXXEWMS-UHFFFAOYSA-N butyl 3-[4-[3-(4-carbamimidoylphenyl)-2-oxoimidazolidin-1-yl]phenyl]propanoate Chemical compound C1=CC(CCC(=O)OCCCC)=CC=C1N1C(=O)N(C=2C=CC(=CC=2)C(N)=N)CC1 URZRXKZZXXEWMS-UHFFFAOYSA-N 0.000 claims description 4
- 125000006254 cycloalkyl carbonyl group Chemical group 0.000 claims description 4
- 125000005144 cycloalkylsulfonyl group Chemical group 0.000 claims description 4
- 125000002485 formyl group Chemical group [H]C(*)=O 0.000 claims description 4
- 238000007327 hydrogenolysis reaction Methods 0.000 claims description 4
- 125000005835 indanylene group Chemical group 0.000 claims description 4
- 150000003951 lactams Chemical group 0.000 claims description 4
- WEVBPZJOYPFJEH-UHFFFAOYSA-N methyl 3-[3-[3-[4-(aminomethyl)phenyl]-2-oxoimidazolidin-1-yl]phenyl]propanoate Chemical compound COC(=O)CCC1=CC=CC(N2C(N(CC2)C=2C=CC(CN)=CC=2)=O)=C1 WEVBPZJOYPFJEH-UHFFFAOYSA-N 0.000 claims description 4
- 125000004674 methylcarbonyl group Chemical group CC(=O)* 0.000 claims description 4
- 239000001301 oxygen Substances 0.000 claims description 4
- 125000003170 phenylsulfonyl group Chemical group C1(=CC=CC=C1)S(=O)(=O)* 0.000 claims description 4
- XXYOYPMUIMJSRC-UHFFFAOYSA-N propan-2-yl 3-[4-[3-(4-carbamimidoylphenyl)-2,5-dioxoimidazolidin-1-yl]phenyl]propanoate Chemical compound C1=CC(CCC(=O)OC(C)C)=CC=C1N1C(=O)N(C=2C=CC(=CC=2)C(N)=N)CC1=O XXYOYPMUIMJSRC-UHFFFAOYSA-N 0.000 claims description 4
- QETSJDXFTIVELG-UHFFFAOYSA-N propan-2-yl 3-[4-[3-(4-carbamimidoylphenyl)-2-oxoimidazol-1-yl]phenyl]propanoate Chemical compound C1=CC(CCC(=O)OC(C)C)=CC=C1N1C(=O)N(C=2C=CC(=CC=2)C(N)=N)C=C1 QETSJDXFTIVELG-UHFFFAOYSA-N 0.000 claims description 4
- DKWYVJQOCFGPRS-UHFFFAOYSA-N propan-2-yl 3-[4-[3-(4-carbamimidoylphenyl)-2-oxoimidazolidin-1-yl]phenyl]propanoate Chemical compound C1=CC(CCC(=O)OC(C)C)=CC=C1N1C(=O)N(C=2C=CC(=CC=2)C(N)=N)CC1 DKWYVJQOCFGPRS-UHFFFAOYSA-N 0.000 claims description 4
- 125000003373 pyrazinyl group Chemical group 0.000 claims description 4
- 125000002098 pyridazinyl group Chemical group 0.000 claims description 4
- 125000004076 pyridyl group Chemical group 0.000 claims description 4
- 125000000714 pyrimidinyl group Chemical group 0.000 claims description 4
- 125000004621 quinuclidinyl group Chemical group N12C(CC(CC1)CC2)* 0.000 claims description 4
- 125000000475 sulfinyl group Chemical group [*:2]S([*:1])=O 0.000 claims description 4
- 125000004434 sulfur atom Chemical group 0.000 claims description 4
- 125000000335 thiazolyl group Chemical group 0.000 claims description 4
- 238000012549 training Methods 0.000 claims description 4
- GBYJUXWNGDDAJW-UHFFFAOYSA-N 3-[4-[3-methyl-5-oxo-1-(2-piperidin-4-ylethyl)-1,2,4-triazol-4-yl]phenyl]propanoic acid Chemical compound O=C1N(C=2C=CC(CCC(O)=O)=CC=2)C(C)=NN1CCC1CCNCC1 GBYJUXWNGDDAJW-UHFFFAOYSA-N 0.000 claims description 3
- GIDPBJRDTAKRJW-CTYIDZIISA-N O=C1N([C@@H]2CC[C@@H](CCC(O)=O)CC2)C(C)=NN1C1=CC=C(C(N)=N)C=C1 Chemical compound O=C1N([C@@H]2CC[C@@H](CCC(O)=O)CC2)C(C)=NN1C1=CC=C(C(N)=N)C=C1 GIDPBJRDTAKRJW-CTYIDZIISA-N 0.000 claims description 3
- 125000004744 butyloxycarbonyl group Chemical group 0.000 claims description 3
- 239000000969 carrier Substances 0.000 claims description 3
- 230000008619 cell matrix interaction Effects 0.000 claims description 3
- 125000004122 cyclic group Chemical group 0.000 claims description 3
- 239000003085 diluting agent Substances 0.000 claims description 3
- 201000010099 disease Diseases 0.000 claims description 3
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 claims description 3
- 239000003814 drug Substances 0.000 claims description 3
- 150000007522 mineralic acids Chemical class 0.000 claims description 3
- 235000005985 organic acids Nutrition 0.000 claims description 3
- PKYMDCWIBCPLQY-UHFFFAOYSA-N propan-2-yl 3-[4-[4-(4-carbamimidoylphenyl)-5-oxo-1,2,4-triazol-1-yl]phenyl]propanoate Chemical compound C1=CC(CCC(=O)OC(C)C)=CC=C1N1C(=O)N(C=2C=CC(=CC=2)C(N)=N)C=N1 PKYMDCWIBCPLQY-UHFFFAOYSA-N 0.000 claims description 3
- 230000001681 protective effect Effects 0.000 claims description 3
- 238000001149 thermolysis Methods 0.000 claims description 3
- LZTSCEYDCZBRCJ-UHFFFAOYSA-N 1,2-dihydro-1,2,4-triazol-3-one Chemical class OC=1N=CNN=1 LZTSCEYDCZBRCJ-UHFFFAOYSA-N 0.000 claims description 2
- OPGOXBQEZQXTCV-UHFFFAOYSA-N 2-(butylsulfonylamino)-3-[4-[3-(4-carbamimidoylphenyl)-2-oxoimidazolidin-1-yl]phenyl]propanoic acid Chemical compound C1=CC(CC(NS(=O)(=O)CCCC)C(O)=O)=CC=C1N1C(=O)N(C=2C=CC(=CC=2)C(N)=N)CC1 OPGOXBQEZQXTCV-UHFFFAOYSA-N 0.000 claims description 2
- XMLADDCOSAQDHP-UHFFFAOYSA-N 3-[4-[1-(4-carbamimidoylphenyl)-5-oxo-3-phenyl-1,2,4-triazol-4-yl]phenyl]propanoic acid Chemical compound C1=CC(C(=N)N)=CC=C1N1C(=O)N(C=2C=CC(CCC(O)=O)=CC=2)C(C=2C=CC=CC=2)=N1 XMLADDCOSAQDHP-UHFFFAOYSA-N 0.000 claims description 2
- GBYIEVOHHJWHFX-UHFFFAOYSA-N 3-[4-[2-oxo-3-(2-piperidin-4-ylethyl)imidazolidin-1-yl]phenyl]propanoic acid Chemical compound C1=CC(CCC(=O)O)=CC=C1N1C(=O)N(CCC2CCNCC2)CC1 GBYIEVOHHJWHFX-UHFFFAOYSA-N 0.000 claims description 2
- ITGYVNGHUADVAD-UHFFFAOYSA-N 3-[4-[3-(1-carbamimidoylpiperidin-4-yl)-2-oxoimidazolidin-1-yl]phenyl]propanoic acid Chemical compound C1CN(C(=N)N)CCC1N1C(=O)N(C=2C=CC(CCC(O)=O)=CC=2)CC1 ITGYVNGHUADVAD-UHFFFAOYSA-N 0.000 claims description 2
- FXDWTINJZHKFPW-MQMHXKEQSA-N C1=CC(C(=N)N)=CC=C1N1C(=O)N([C@@H]2CC[C@@H](CCC(O)=O)CC2)C=N1 Chemical compound C1=CC(C(=N)N)=CC=C1N1C(=O)N([C@@H]2CC[C@@H](CCC(O)=O)CC2)C=N1 FXDWTINJZHKFPW-MQMHXKEQSA-N 0.000 claims description 2
- ZUQJRIFSHOJWJR-CTYIDZIISA-N C1=CC(C(=N)N)=CC=C1N1C(=O)N([C@@H]2CC[C@@H](CCC(O)=O)CC2)CC1 Chemical compound C1=CC(C(=N)N)=CC=C1N1C(=O)N([C@@H]2CC[C@@H](CCC(O)=O)CC2)CC1 ZUQJRIFSHOJWJR-CTYIDZIISA-N 0.000 claims description 2
- 125000005090 alkenylcarbonyl group Chemical group 0.000 claims description 2
- 125000004414 alkyl thio group Chemical group 0.000 claims description 2
- 125000004659 aryl alkyl thio group Chemical group 0.000 claims description 2
- 239000003795 chemical substances by application Substances 0.000 claims description 2
- 125000004210 cyclohexylmethyl group Chemical group [H]C([H])(*)C1([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C1([H])[H] 0.000 claims description 2
- 125000002933 cyclohexyloxy group Chemical group C1(CCCCC1)O* 0.000 claims description 2
- 125000001511 cyclopentyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 claims description 2
- DJRDLVHMCPGGID-UHFFFAOYSA-N methyl 3-[4-[3-(1-carbamimidoylpiperidin-4-yl)-2-oxoimidazolidin-1-yl]phenyl]propanoate Chemical compound C1=CC(CCC(=O)OC)=CC=C1N1C(=O)N(C2CCN(CC2)C(N)=N)CC1 DJRDLVHMCPGGID-UHFFFAOYSA-N 0.000 claims description 2
- 125000000951 phenoxy group Chemical group [H]C1=C([H])C([H])=C(O*)C([H])=C1[H] 0.000 claims description 2
- 125000005650 substituted phenylene group Chemical group 0.000 claims description 2
- 125000004646 sulfenyl group Chemical group S(*)* 0.000 claims description 2
- 125000005407 trans-1,4-cyclohexylene group Chemical group [H]C1([H])C([H])([H])[C@]([H])([*:2])C([H])([H])C([H])([H])[C@@]1([H])[*:1] 0.000 claims description 2
- UZJJVZZEONHVDV-UHFFFAOYSA-N 2-[[4-[3-methyl-5-oxo-1-(2-piperidin-4-ylethyl)-1,2,4-triazol-4-yl]phenyl]methyl]pentanoic acid Chemical compound C1=CC(CC(CCC)C(O)=O)=CC=C1N1C(=O)N(CCC2CCNCC2)N=C1C UZJJVZZEONHVDV-UHFFFAOYSA-N 0.000 claims 1
- 229920001577 copolymer Chemical class 0.000 claims 1
- 125000002795 guanidino group Chemical group C(N)(=N)N* 0.000 abstract description 4
- 125000004429 atom Chemical group 0.000 abstract description 3
- 125000001072 heteroaryl group Chemical group 0.000 abstract 3
- 125000003710 aryl alkyl group Chemical group 0.000 abstract 2
- 125000000732 arylene group Chemical group 0.000 abstract 2
- 125000002030 1,2-phenylene group Chemical group [H]C1=C([H])C([*:1])=C([*:2])C([H])=C1[H] 0.000 abstract 1
- 125000006356 alkylene carbonyl group Chemical group 0.000 abstract 1
- MDFFNEOEWAXZRQ-UHFFFAOYSA-N aminyl Chemical compound [NH2] MDFFNEOEWAXZRQ-UHFFFAOYSA-N 0.000 abstract 1
- 125000006367 bivalent amino carbonyl group Chemical group [H]N([*:1])C([*:2])=O 0.000 abstract 1
- 125000006297 carbonyl amino group Chemical group [H]N([*:2])C([*:1])=O 0.000 abstract 1
- 125000004446 heteroarylalkyl group Chemical group 0.000 abstract 1
- 125000005010 perfluoroalkyl group Chemical group 0.000 abstract 1
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 330
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 174
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Natural products CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 166
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 115
- 239000000741 silica gel Substances 0.000 description 115
- 229910002027 silica gel Inorganic materials 0.000 description 115
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 108
- 235000002639 sodium chloride Nutrition 0.000 description 78
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 75
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 67
- 239000012071 phase Substances 0.000 description 59
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 58
- 239000011780 sodium chloride Substances 0.000 description 58
- 239000000243 solution Substances 0.000 description 56
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 52
- 238000002844 melting Methods 0.000 description 48
- 230000008018 melting Effects 0.000 description 48
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 45
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 44
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 42
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 42
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 40
- 239000002904 solvent Substances 0.000 description 39
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 38
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 30
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 27
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 27
- 230000000875 corresponding effect Effects 0.000 description 27
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 description 26
- DTQVDTLACAAQTR-UHFFFAOYSA-N Trifluoroacetic acid Chemical compound OC(=O)C(F)(F)F DTQVDTLACAAQTR-UHFFFAOYSA-N 0.000 description 25
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 22
- 238000007792 addition Methods 0.000 description 22
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 22
- 125000001160 methoxycarbonyl group Chemical group [H]C([H])([H])OC(*)=O 0.000 description 21
- 239000001257 hydrogen Substances 0.000 description 20
- 239000000047 product Substances 0.000 description 20
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 18
- 239000002585 base Substances 0.000 description 17
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 16
- 229960000583 acetic acid Drugs 0.000 description 16
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 16
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 15
- 235000011121 sodium hydroxide Nutrition 0.000 description 14
- FVAUCKIRQBBSSJ-UHFFFAOYSA-M sodium iodide Inorganic materials [Na+].[I-] FVAUCKIRQBBSSJ-UHFFFAOYSA-M 0.000 description 14
- 238000001816 cooling Methods 0.000 description 13
- 239000012074 organic phase Substances 0.000 description 13
- RIOQSEWOXXDEQQ-UHFFFAOYSA-N triphenylphosphine Chemical compound C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1 RIOQSEWOXXDEQQ-UHFFFAOYSA-N 0.000 description 13
- QOSSAOTZNIDXMA-UHFFFAOYSA-N Dicylcohexylcarbodiimide Chemical compound C1CCCCC1N=C=NC1CCCCC1 QOSSAOTZNIDXMA-UHFFFAOYSA-N 0.000 description 12
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 12
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 12
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 12
- 238000004587 chromatography analysis Methods 0.000 description 12
- KRKNYBCHXYNGOX-UHFFFAOYSA-N citric acid Chemical compound OC(=O)CC(O)(C(O)=O)CC(O)=O KRKNYBCHXYNGOX-UHFFFAOYSA-N 0.000 description 12
- 125000005843 halogen group Chemical group 0.000 description 12
- BASFCYQUMIYNBI-UHFFFAOYSA-N platinum Chemical compound [Pt] BASFCYQUMIYNBI-UHFFFAOYSA-N 0.000 description 12
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Chemical compound BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 11
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 10
- 239000004480 active ingredient Substances 0.000 description 10
- 239000012362 glacial acetic acid Substances 0.000 description 10
- 239000005457 ice water Substances 0.000 description 10
- HQKMJHAJHXVSDF-UHFFFAOYSA-L magnesium stearate Chemical compound [Mg+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O HQKMJHAJHXVSDF-UHFFFAOYSA-L 0.000 description 10
- 239000002244 precipitate Substances 0.000 description 10
- 238000003756 stirring Methods 0.000 description 10
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 9
- SJRJJKPEHAURKC-UHFFFAOYSA-N N-Methylmorpholine Chemical compound CN1CCOCC1 SJRJJKPEHAURKC-UHFFFAOYSA-N 0.000 description 9
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 9
- 239000003054 catalyst Substances 0.000 description 9
- 229940086542 triethylamine Drugs 0.000 description 9
- GUBGYTABKSRVRQ-QKKXKWKRSA-N Lactose Chemical compound OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)C(O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@H]1O GUBGYTABKSRVRQ-QKKXKWKRSA-N 0.000 description 8
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 8
- 229910000027 potassium carbonate Inorganic materials 0.000 description 8
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 8
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 8
- JGFZNNIVVJXRND-UHFFFAOYSA-N N,N-Diisopropylethylamine (DIPEA) Chemical compound CCN(C(C)C)C(C)C JGFZNNIVVJXRND-UHFFFAOYSA-N 0.000 description 7
- 239000002775 capsule Substances 0.000 description 7
- 239000004202 carbamide Substances 0.000 description 7
- 239000000706 filtrate Substances 0.000 description 7
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 7
- 238000005984 hydrogenation reaction Methods 0.000 description 7
- 238000007363 ring formation reaction Methods 0.000 description 7
- 239000003826 tablet Substances 0.000 description 7
- XTHFKEDIFFGKHM-UHFFFAOYSA-N Dimethoxyethane Chemical compound COCCOC XTHFKEDIFFGKHM-UHFFFAOYSA-N 0.000 description 6
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 6
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Chemical compound NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 description 6
- 239000013543 active substance Substances 0.000 description 6
- 238000009835 boiling Methods 0.000 description 6
- 229910052794 bromium Inorganic materials 0.000 description 6
- PFKFTWBEEFSNDU-UHFFFAOYSA-N carbonyldiimidazole Chemical compound C1=CN=CN1C(=O)N1C=CN=C1 PFKFTWBEEFSNDU-UHFFFAOYSA-N 0.000 description 6
- 238000003776 cleavage reaction Methods 0.000 description 6
- 125000001841 imino group Chemical group [H]N=* 0.000 description 6
- BDAGIHXWWSANSR-UHFFFAOYSA-N methanoic acid Natural products OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 description 6
- 229910052763 palladium Inorganic materials 0.000 description 6
- 229910052697 platinum Inorganic materials 0.000 description 6
- LPNYRYFBWFDTMA-UHFFFAOYSA-N potassium tert-butoxide Chemical compound [K+].CC(C)(C)[O-] LPNYRYFBWFDTMA-UHFFFAOYSA-N 0.000 description 6
- 230000007017 scission Effects 0.000 description 6
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical group [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 5
- 102000008186 Collagen Human genes 0.000 description 5
- 108010035532 Collagen Proteins 0.000 description 5
- 229920002261 Corn starch Polymers 0.000 description 5
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 5
- DKGAVHZHDRPRBM-UHFFFAOYSA-N Tert-Butanol Chemical compound CC(C)(C)O DKGAVHZHDRPRBM-UHFFFAOYSA-N 0.000 description 5
- 229920001436 collagen Polymers 0.000 description 5
- 239000008120 corn starch Substances 0.000 description 5
- 229940099112 cornstarch Drugs 0.000 description 5
- 239000012024 dehydrating agents Substances 0.000 description 5
- 150000002148 esters Chemical class 0.000 description 5
- 125000003754 ethoxycarbonyl group Chemical group C(=O)(OCC)* 0.000 description 5
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 5
- 235000019359 magnesium stearate Nutrition 0.000 description 5
- 210000002381 plasma Anatomy 0.000 description 5
- 125000006239 protecting group Chemical group 0.000 description 5
- 239000012312 sodium hydride Substances 0.000 description 5
- 229910000104 sodium hydride Inorganic materials 0.000 description 5
- 235000009518 sodium iodide Nutrition 0.000 description 5
- 239000007858 starting material Substances 0.000 description 5
- MHCVCKDNQYMGEX-UHFFFAOYSA-N 1,1'-biphenyl;phenoxybenzene Chemical group C1=CC=CC=C1C1=CC=CC=C1.C=1C=CC=CC=1OC1=CC=CC=C1 MHCVCKDNQYMGEX-UHFFFAOYSA-N 0.000 description 4
- 125000000954 2-hydroxyethyl group Chemical group [H]C([*])([H])C([H])([H])O[H] 0.000 description 4
- 125000004800 4-bromophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1Br 0.000 description 4
- BMTAFVWTTFSTOG-UHFFFAOYSA-N Butylate Chemical compound CCSC(=O)N(CC(C)C)CC(C)C BMTAFVWTTFSTOG-UHFFFAOYSA-N 0.000 description 4
- FBPFZTCFMRRESA-KVTDHHQDSA-N D-Mannitol Chemical compound OC[C@@H](O)[C@@H](O)[C@H](O)[C@H](O)CO FBPFZTCFMRRESA-KVTDHHQDSA-N 0.000 description 4
- FEWJPZIEWOKRBE-JCYAYHJZSA-N Dextrotartaric acid Chemical compound OC(=O)[C@H](O)[C@@H](O)C(O)=O FEWJPZIEWOKRBE-JCYAYHJZSA-N 0.000 description 4
- 229930195725 Mannitol Natural products 0.000 description 4
- BZLVMXJERCGZMT-UHFFFAOYSA-N Methyl tert-butyl ether Chemical compound COC(C)(C)C BZLVMXJERCGZMT-UHFFFAOYSA-N 0.000 description 4
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 4
- FEWJPZIEWOKRBE-UHFFFAOYSA-N Tartaric acid Natural products [H+].[H+].[O-]C(=O)C(O)C(O)C([O-])=O FEWJPZIEWOKRBE-UHFFFAOYSA-N 0.000 description 4
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 4
- 239000008346 aqueous phase Substances 0.000 description 4
- 210000004369 blood Anatomy 0.000 description 4
- 239000008280 blood Substances 0.000 description 4
- IJOOHPMOJXWVHK-UHFFFAOYSA-N chlorotrimethylsilane Chemical compound C[Si](C)(C)Cl IJOOHPMOJXWVHK-UHFFFAOYSA-N 0.000 description 4
- 235000015165 citric acid Nutrition 0.000 description 4
- 238000011049 filling Methods 0.000 description 4
- LGALSVCJAFSCJP-UHFFFAOYSA-N imidazolidin-2-one;hydrochloride Chemical compound Cl.O=C1NCCN1 LGALSVCJAFSCJP-UHFFFAOYSA-N 0.000 description 4
- 230000005764 inhibitory process Effects 0.000 description 4
- 239000003446 ligand Substances 0.000 description 4
- 239000000594 mannitol Substances 0.000 description 4
- 235000010355 mannitol Nutrition 0.000 description 4
- 230000003287 optical effect Effects 0.000 description 4
- 150000007530 organic bases Chemical class 0.000 description 4
- 125000005740 oxycarbonyl group Chemical group [*:1]OC([*:2])=O 0.000 description 4
- 239000003208 petroleum Substances 0.000 description 4
- 210000004623 platelet-rich plasma Anatomy 0.000 description 4
- 239000011591 potassium Substances 0.000 description 4
- 229910052700 potassium Inorganic materials 0.000 description 4
- 230000009467 reduction Effects 0.000 description 4
- 238000006722 reduction reaction Methods 0.000 description 4
- 238000010992 reflux Methods 0.000 description 4
- DUIOPKIIICUYRZ-UHFFFAOYSA-N semicarbazide Chemical compound NNC(N)=O DUIOPKIIICUYRZ-UHFFFAOYSA-N 0.000 description 4
- 125000002130 sulfonic acid ester group Chemical group 0.000 description 4
- 239000011975 tartaric acid Substances 0.000 description 4
- 235000002906 tartaric acid Nutrition 0.000 description 4
- 238000012360 testing method Methods 0.000 description 4
- VZGDMQKNWNREIO-UHFFFAOYSA-N tetrachloromethane Chemical compound ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 description 4
- CSRZQMIRAZTJOY-UHFFFAOYSA-N trimethylsilyl iodide Chemical compound C[Si](C)(C)I CSRZQMIRAZTJOY-UHFFFAOYSA-N 0.000 description 4
- OSWFIVFLDKOXQC-UHFFFAOYSA-N 4-(3-methoxyphenyl)aniline Chemical compound COC1=CC=CC(C=2C=CC(N)=CC=2)=C1 OSWFIVFLDKOXQC-UHFFFAOYSA-N 0.000 description 3
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 3
- WFDIJRYMOXRFFG-UHFFFAOYSA-N Acetic anhydride Chemical compound CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 description 3
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 3
- WVDDGKGOMKODPV-UHFFFAOYSA-N Benzyl alcohol Chemical compound OCC1=CC=CC=C1 WVDDGKGOMKODPV-UHFFFAOYSA-N 0.000 description 3
- WMFOQBRAJBCJND-UHFFFAOYSA-M Lithium hydroxide Chemical compound [Li+].[OH-] WMFOQBRAJBCJND-UHFFFAOYSA-M 0.000 description 3
- DNIAPMSPPWPWGF-UHFFFAOYSA-N Propylene glycol Chemical compound CC(O)CO DNIAPMSPPWPWGF-UHFFFAOYSA-N 0.000 description 3
- 239000007868 Raney catalyst Substances 0.000 description 3
- 229910000564 Raney nickel Inorganic materials 0.000 description 3
- NPXOKRUENSOPAO-UHFFFAOYSA-N Raney nickel Chemical compound [Al].[Ni] NPXOKRUENSOPAO-UHFFFAOYSA-N 0.000 description 3
- 230000002776 aggregation Effects 0.000 description 3
- 238000004220 aggregation Methods 0.000 description 3
- 230000029936 alkylation Effects 0.000 description 3
- 238000005804 alkylation reaction Methods 0.000 description 3
- 150000001408 amides Chemical class 0.000 description 3
- 229960000510 ammonia Drugs 0.000 description 3
- 229910021529 ammonia Inorganic materials 0.000 description 3
- 125000000051 benzyloxy group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])O* 0.000 description 3
- 125000004185 ester group Chemical group 0.000 description 3
- IIEWJVIFRVWJOD-UHFFFAOYSA-N ethyl cyclohexane Natural products CCC1CCCCC1 IIEWJVIFRVWJOD-UHFFFAOYSA-N 0.000 description 3
- FAMRKDQNMBBFBR-UHFFFAOYSA-N ethyl n-ethoxycarbonyliminocarbamate Chemical compound CCOC(=O)N=NC(=O)OCC FAMRKDQNMBBFBR-UHFFFAOYSA-N 0.000 description 3
- 235000019253 formic acid Nutrition 0.000 description 3
- 230000002401 inhibitory effect Effects 0.000 description 3
- 239000000543 intermediate Substances 0.000 description 3
- 125000005948 methanesulfonyloxy group Chemical group 0.000 description 3
- 150000002825 nitriles Chemical class 0.000 description 3
- 239000008188 pellet Substances 0.000 description 3
- XHXFXVLFKHQFAL-UHFFFAOYSA-N phosphoryl trichloride Chemical compound ClP(Cl)(Cl)=O XHXFXVLFKHQFAL-UHFFFAOYSA-N 0.000 description 3
- 125000004482 piperidin-4-yl group Chemical group N1CCC(CC1)* 0.000 description 3
- 239000001267 polyvinylpyrrolidone Substances 0.000 description 3
- 229920000036 polyvinylpyrrolidone Polymers 0.000 description 3
- 235000013855 polyvinylpyrrolidone Nutrition 0.000 description 3
- NLKNQRATVPKPDG-UHFFFAOYSA-M potassium iodide Chemical compound [K+].[I-] NLKNQRATVPKPDG-UHFFFAOYSA-M 0.000 description 3
- 239000000843 powder Substances 0.000 description 3
- 229910000029 sodium carbonate Inorganic materials 0.000 description 3
- 125000005717 substituted cycloalkylene group Chemical group 0.000 description 3
- 239000000725 suspension Substances 0.000 description 3
- 125000000026 trimethylsilyl group Chemical class [H]C([H])([H])[Si]([*])(C([H])([H])[H])C([H])([H])[H] 0.000 description 3
- NOOLISFMXDJSKH-KXUCPTDWSA-N (-)-Menthol Chemical compound CC(C)[C@@H]1CC[C@@H](C)C[C@H]1O NOOLISFMXDJSKH-KXUCPTDWSA-N 0.000 description 2
- HZAXFHJVJLSVMW-UHFFFAOYSA-N 2-Aminoethan-1-ol Chemical compound NCCO HZAXFHJVJLSVMW-UHFFFAOYSA-N 0.000 description 2
- ZWEHNKRNPOVVGH-UHFFFAOYSA-N 2-Butanone Chemical compound CCC(C)=O ZWEHNKRNPOVVGH-UHFFFAOYSA-N 0.000 description 2
- ZNYUCPYYWNTPMI-UHFFFAOYSA-N 3-[4-[1-(4-carbamimidoylphenyl)-3-methyl-5-oxo-1,2,4-triazol-4-yl]phenyl]-2-methylpropanoic acid Chemical compound C1=CC(CC(C)C(O)=O)=CC=C1N1C(=O)N(C=2C=CC(=CC=2)C(N)=N)N=C1C ZNYUCPYYWNTPMI-UHFFFAOYSA-N 0.000 description 2
- HFBZBAUVXXYHQG-UHFFFAOYSA-N 3-[4-[2-oxo-3-(2-piperidin-4-ylethyl)imidazolidin-1-yl]phenyl]propanoic acid;hydrochloride Chemical compound Cl.C1=CC(CCC(=O)O)=CC=C1N1C(=O)N(CCC2CCNCC2)CC1 HFBZBAUVXXYHQG-UHFFFAOYSA-N 0.000 description 2
- YBMPYNAAQZWDHY-UHFFFAOYSA-N 3-[4-[3-(4-bromophenyl)-2-oxoimidazolidin-1-yl]phenyl]propanamide Chemical compound C1=CC(CCC(=O)N)=CC=C1N1C(=O)N(C=2C=CC(Br)=CC=2)CC1 YBMPYNAAQZWDHY-UHFFFAOYSA-N 0.000 description 2
- QDBQVLILYLULLC-UHFFFAOYSA-N 3-[4-[3-(4-bromophenyl)-2-oxoimidazolidin-1-yl]phenyl]propanoic acid Chemical compound C1=CC(CCC(=O)O)=CC=C1N1C(=O)N(C=2C=CC(Br)=CC=2)CC1 QDBQVLILYLULLC-UHFFFAOYSA-N 0.000 description 2
- VHYFNPMBLIVWCW-UHFFFAOYSA-N 4-Dimethylaminopyridine Chemical compound CN(C)C1=CC=NC=C1 VHYFNPMBLIVWCW-UHFFFAOYSA-N 0.000 description 2
- JQRVPLFAMNQFSD-UHFFFAOYSA-N 4-ethyl-1h-1,2,4-triazol-5-one Chemical compound CCN1C=NNC1=O JQRVPLFAMNQFSD-UHFFFAOYSA-N 0.000 description 2
- IJIBRSFAXRFPPN-UHFFFAOYSA-N 5-bromo-2-methoxybenzaldehyde Chemical compound COC1=CC=C(Br)C=C1C=O IJIBRSFAXRFPPN-UHFFFAOYSA-N 0.000 description 2
- HBAQYPYDRFILMT-UHFFFAOYSA-N 8-[3-(1-cyclopropylpyrazol-4-yl)-1H-pyrazolo[4,3-d]pyrimidin-5-yl]-3-methyl-3,8-diazabicyclo[3.2.1]octan-2-one Chemical class C1(CC1)N1N=CC(=C1)C1=NNC2=C1N=C(N=C2)N1C2C(N(CC1CC2)C)=O HBAQYPYDRFILMT-UHFFFAOYSA-N 0.000 description 2
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonia chloride Chemical compound [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 2
- LBVPRYMQUYDCDO-UHFFFAOYSA-N C1=CC(CCC(=O)OCC)=CC=C1N(CCO)C(=O)NC1=CC=C(Br)C=C1 Chemical compound C1=CC(CCC(=O)OCC)=CC=C1N(CCO)C(=O)NC1=CC=C(Br)C=C1 LBVPRYMQUYDCDO-UHFFFAOYSA-N 0.000 description 2
- HEAMDMDZRYJDSQ-XUTJKUGGSA-N C1C[C@@H](C(=O)OCC)CC[C@@H]1N1C(=O)N(C=2C=CC(=CC=2)C2CCN(CC2)C(=O)C(F)(F)F)CC1 Chemical compound C1C[C@@H](C(=O)OCC)CC[C@@H]1N1C(=O)N(C=2C=CC(=CC=2)C2CCN(CC2)C(=O)C(F)(F)F)CC1 HEAMDMDZRYJDSQ-XUTJKUGGSA-N 0.000 description 2
- PGKKXMWRINBWAL-JCNLHEQBSA-N C1C[C@@H](CCC(=O)OC)CC[C@@H]1NC(=O)N(CC(=O)OC)C1=CC=C(C#N)C=C1 Chemical compound C1C[C@@H](CCC(=O)OC)CC[C@@H]1NC(=O)N(CC(=O)OC)C1=CC=C(C#N)C=C1 PGKKXMWRINBWAL-JCNLHEQBSA-N 0.000 description 2
- KXFHWHUFHHSCQN-WOVMCDHWSA-N C1C[C@@H](CCC(=O)OC)CC[C@H]1N1C(=O)N(C=2C=CC(=CC=2)C#N)N=C1C Chemical compound C1C[C@@H](CCC(=O)OC)CC[C@H]1N1C(=O)N(C=2C=CC(=CC=2)C#N)N=C1C KXFHWHUFHHSCQN-WOVMCDHWSA-N 0.000 description 2
- NOOLISFMXDJSKH-UHFFFAOYSA-N DL-menthol Natural products CC(C)C1CCC(C)CC1O NOOLISFMXDJSKH-UHFFFAOYSA-N 0.000 description 2
- WSFSSNUMVMOOMR-UHFFFAOYSA-N Formaldehyde Chemical compound O=C WSFSSNUMVMOOMR-UHFFFAOYSA-N 0.000 description 2
- VZCYOOQTPOCHFL-OWOJBTEDSA-N Fumaric acid Chemical compound OC(=O)\C=C\C(O)=O VZCYOOQTPOCHFL-OWOJBTEDSA-N 0.000 description 2
- 239000001828 Gelatine Substances 0.000 description 2
- PEDCQBHIVMGVHV-UHFFFAOYSA-N Glycerine Chemical compound OCC(O)CO PEDCQBHIVMGVHV-UHFFFAOYSA-N 0.000 description 2
- WGCNASOHLSPBMP-UHFFFAOYSA-N Glycolaldehyde Chemical compound OCC=O WGCNASOHLSPBMP-UHFFFAOYSA-N 0.000 description 2
- OAKJQQAXSVQMHS-UHFFFAOYSA-N Hydrazine Chemical compound NN OAKJQQAXSVQMHS-UHFFFAOYSA-N 0.000 description 2
- WTDHULULXKLSOZ-UHFFFAOYSA-N Hydroxylamine hydrochloride Chemical compound Cl.ON WTDHULULXKLSOZ-UHFFFAOYSA-N 0.000 description 2
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 2
- 239000012448 Lithium borohydride Substances 0.000 description 2
- AFVFQIVMOAPDHO-UHFFFAOYSA-N Methanesulfonic acid Chemical compound CS(O)(=O)=O AFVFQIVMOAPDHO-UHFFFAOYSA-N 0.000 description 2
- 239000012359 Methanesulfonyl chloride Substances 0.000 description 2
- BAVYZALUXZFZLV-UHFFFAOYSA-N Methylamine Chemical compound NC BAVYZALUXZFZLV-UHFFFAOYSA-N 0.000 description 2
- 101100345589 Mus musculus Mical1 gene Proteins 0.000 description 2
- 206010028980 Neoplasm Diseases 0.000 description 2
- WQDUMFSSJAZKTM-UHFFFAOYSA-N Sodium methoxide Chemical compound [Na+].[O-]C WQDUMFSSJAZKTM-UHFFFAOYSA-N 0.000 description 2
- 241000011102 Thera Species 0.000 description 2
- 230000010933 acylation Effects 0.000 description 2
- 238000005917 acylation reaction Methods 0.000 description 2
- 125000003368 amide group Chemical group 0.000 description 2
- 239000003708 ampul Substances 0.000 description 2
- RDOXTESZEPMUJZ-UHFFFAOYSA-N anisole Chemical compound COC1=CC=CC=C1 RDOXTESZEPMUJZ-UHFFFAOYSA-N 0.000 description 2
- 230000002785 anti-thrombosis Effects 0.000 description 2
- 239000003146 anticoagulant agent Substances 0.000 description 2
- 125000004104 aryloxy group Chemical group 0.000 description 2
- 230000037396 body weight Effects 0.000 description 2
- 239000012267 brine Substances 0.000 description 2
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
- 125000003917 carbamoyl group Chemical group [H]N([H])C(*)=O 0.000 description 2
- 150000001721 carbon Chemical group 0.000 description 2
- 238000009903 catalytic hydrogenation reaction Methods 0.000 description 2
- 210000004027 cell Anatomy 0.000 description 2
- MVPPADPHJFYWMZ-UHFFFAOYSA-N chlorobenzene Chemical compound ClC1=CC=CC=C1 MVPPADPHJFYWMZ-UHFFFAOYSA-N 0.000 description 2
- PAFZNILMFXTMIY-UHFFFAOYSA-N cyclohexylamine Chemical compound NC1CCCCC1 PAFZNILMFXTMIY-UHFFFAOYSA-N 0.000 description 2
- NNBZCPXTIHJBJL-UHFFFAOYSA-N decalin Chemical compound C1CCCC2CCCCC21 NNBZCPXTIHJBJL-UHFFFAOYSA-N 0.000 description 2
- 230000000694 effects Effects 0.000 description 2
- 229920000159 gelatin Polymers 0.000 description 2
- 235000019322 gelatine Nutrition 0.000 description 2
- 239000008187 granular material Substances 0.000 description 2
- 229940093915 gynecological organic acid Drugs 0.000 description 2
- 150000002431 hydrogen Chemical class 0.000 description 2
- 125000002962 imidazol-1-yl group Chemical group [*]N1C([H])=NC([H])=C1[H] 0.000 description 2
- 238000001727 in vivo Methods 0.000 description 2
- 239000012442 inert solvent Substances 0.000 description 2
- 239000003112 inhibitor Substances 0.000 description 2
- 239000007924 injection Substances 0.000 description 2
- 238000002347 injection Methods 0.000 description 2
- 238000002955 isolation Methods 0.000 description 2
- JVTAAEKCZFNVCJ-UHFFFAOYSA-N lactic acid Chemical compound CC(O)C(O)=O JVTAAEKCZFNVCJ-UHFFFAOYSA-N 0.000 description 2
- 239000008101 lactose Substances 0.000 description 2
- 238000005259 measurement Methods 0.000 description 2
- 229910052987 metal hydride Inorganic materials 0.000 description 2
- 150000004681 metal hydrides Chemical class 0.000 description 2
- QARBMVPHQWIHKH-UHFFFAOYSA-N methanesulfonyl chloride Chemical compound CS(Cl)(=O)=O QARBMVPHQWIHKH-UHFFFAOYSA-N 0.000 description 2
- UOWFNLQPRQMOKW-UHFFFAOYSA-N methyl 3-(4-aminophenyl)-2-(butylsulfonylamino)propanoate Chemical compound CCCCS(=O)(=O)NC(C(=O)OC)CC1=CC=C(N)C=C1 UOWFNLQPRQMOKW-UHFFFAOYSA-N 0.000 description 2
- QENHLSATBUEPJW-UHFFFAOYSA-N methyl 3-[4-(2-chloroethylcarbamoylamino)phenyl]propanoate Chemical compound COC(=O)CCC1=CC=C(NC(=O)NCCCl)C=C1 QENHLSATBUEPJW-UHFFFAOYSA-N 0.000 description 2
- 238000002156 mixing Methods 0.000 description 2
- LQNUZADURLCDLV-UHFFFAOYSA-N nitrobenzene Chemical compound [O-][N+](=O)C1=CC=CC=C1 LQNUZADURLCDLV-UHFFFAOYSA-N 0.000 description 2
- 230000009871 nonspecific binding Effects 0.000 description 2
- GLDOVTGHNKAZLK-UHFFFAOYSA-N octadecan-1-ol Chemical compound CCCCCCCCCCCCCCCCCCO GLDOVTGHNKAZLK-UHFFFAOYSA-N 0.000 description 2
- LPNBBFKOUUSUDB-UHFFFAOYSA-N p-toluic acid Chemical compound CC1=CC=C(C(O)=O)C=C1 LPNBBFKOUUSUDB-UHFFFAOYSA-N 0.000 description 2
- UHZYTMXLRWXGPK-UHFFFAOYSA-N phosphorus pentachloride Chemical compound ClP(Cl)(Cl)(Cl)Cl UHZYTMXLRWXGPK-UHFFFAOYSA-N 0.000 description 2
- 229920000137 polyphosphoric acid Polymers 0.000 description 2
- NROKBHXJSPEDAR-UHFFFAOYSA-M potassium fluoride Chemical compound [F-].[K+] NROKBHXJSPEDAR-UHFFFAOYSA-M 0.000 description 2
- 235000008476 powdered milk Nutrition 0.000 description 2
- 230000002265 prevention Effects 0.000 description 2
- BDERNNFJNOPAEC-UHFFFAOYSA-N propan-1-ol Chemical compound CCCO BDERNNFJNOPAEC-UHFFFAOYSA-N 0.000 description 2
- 238000000926 separation method Methods 0.000 description 2
- NDVLTYZPCACLMA-UHFFFAOYSA-N silver oxide Chemical compound [O-2].[Ag+].[Ag+] NDVLTYZPCACLMA-UHFFFAOYSA-N 0.000 description 2
- 239000012279 sodium borohydride Substances 0.000 description 2
- 229910000033 sodium borohydride Inorganic materials 0.000 description 2
- 239000001509 sodium citrate Substances 0.000 description 2
- BEOOHQFXGBMRKU-UHFFFAOYSA-N sodium cyanoborohydride Chemical compound [Na+].[B-]C#N BEOOHQFXGBMRKU-UHFFFAOYSA-N 0.000 description 2
- LPXPTNMVRIOKMN-UHFFFAOYSA-M sodium nitrite Chemical compound [Na+].[O-]N=O LPXPTNMVRIOKMN-UHFFFAOYSA-M 0.000 description 2
- HPALAKNZSZLMCH-UHFFFAOYSA-M sodium;chloride;hydrate Chemical compound O.[Na+].[Cl-] HPALAKNZSZLMCH-UHFFFAOYSA-M 0.000 description 2
- 239000007787 solid Substances 0.000 description 2
- 208000010110 spontaneous platelet aggregation Diseases 0.000 description 2
- 229960004793 sucrose Drugs 0.000 description 2
- 239000006228 supernatant Substances 0.000 description 2
- LMBFAGIMSUYTBN-MPZNNTNKSA-N teixobactin Chemical compound C([C@H](C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H](CCC(N)=O)C(=O)N[C@H]([C@@H](C)CC)C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H]1C(N[C@@H](C)C(=O)N[C@@H](C[C@@H]2NC(=N)NC2)C(=O)N[C@H](C(=O)O[C@H]1C)[C@@H](C)CC)=O)NC)C1=CC=CC=C1 LMBFAGIMSUYTBN-MPZNNTNKSA-N 0.000 description 2
- 125000001412 tetrahydropyranyl group Chemical group 0.000 description 2
- DLYUQMMRRRQYAE-UHFFFAOYSA-N tetraphosphorus decaoxide Chemical compound O1P(O2)(=O)OP3(=O)OP1(=O)OP2(=O)O3 DLYUQMMRRRQYAE-UHFFFAOYSA-N 0.000 description 2
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 2
- YNJBWRMUSHSURL-UHFFFAOYSA-N trichloroacetic acid Chemical compound OC(=O)C(Cl)(Cl)Cl YNJBWRMUSHSURL-UHFFFAOYSA-N 0.000 description 2
- 229960004319 trichloroacetic acid Drugs 0.000 description 2
- 238000001665 trituration Methods 0.000 description 2
- 150000003672 ureas Chemical class 0.000 description 2
- 239000008215 water for injection Substances 0.000 description 2
- 229940075966 (+)- menthol Drugs 0.000 description 1
- NOOLISFMXDJSKH-AEJSXWLSSA-N (+)-menthol Chemical compound CC(C)[C@H]1CC[C@H](C)C[C@@H]1O NOOLISFMXDJSKH-AEJSXWLSSA-N 0.000 description 1
- QBYIENPQHBMVBV-HFEGYEGKSA-N (2R)-2-hydroxy-2-phenylacetic acid Chemical compound O[C@@H](C(O)=O)c1ccccc1.O[C@@H](C(O)=O)c1ccccc1 QBYIENPQHBMVBV-HFEGYEGKSA-N 0.000 description 1
- AAWZDTNXLSGCEK-LNVDRNJUSA-N (3r,5r)-1,3,4,5-tetrahydroxycyclohexane-1-carboxylic acid Chemical compound O[C@@H]1CC(O)(C(O)=O)C[C@@H](O)C1O AAWZDTNXLSGCEK-LNVDRNJUSA-N 0.000 description 1
- JAVFRTUJARGWMW-UHFFFAOYSA-N (4,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl) 3-[4-[1-(4-carbamimidoylphenyl)-3-methyl-5-oxo-1,2,4-triazol-4-yl]phenyl]propanoate;hydrochloride Chemical compound Cl.CC1C(C2(C)C)CC2CC1OC(=O)CCC(C=C1)=CC=C1N(C1=O)C(C)=NN1C1=CC=C(C(N)=N)C=C1 JAVFRTUJARGWMW-UHFFFAOYSA-N 0.000 description 1
- MIOPJNTWMNEORI-GMSGAONNSA-N (S)-camphorsulfonic acid Chemical compound C1C[C@@]2(CS(O)(=O)=O)C(=O)C[C@@H]1C2(C)C MIOPJNTWMNEORI-GMSGAONNSA-N 0.000 description 1
- BJEPYKJPYRNKOW-REOHCLBHSA-N (S)-malic acid Chemical compound OC(=O)[C@@H](O)CC(O)=O BJEPYKJPYRNKOW-REOHCLBHSA-N 0.000 description 1
- USVVENVKYJZFMW-ONEGZZNKSA-N (e)-carboxyiminocarbamic acid Chemical compound OC(=O)\N=N\C(O)=O USVVENVKYJZFMW-ONEGZZNKSA-N 0.000 description 1
- MIJCDUFXLHDCRP-UHFFFAOYSA-N 1-(2-carboxyoxy-5-nitrophenyl)ethyl acetate Chemical compound CC(=O)OC(C)C1=CC([N+]([O-])=O)=CC=C1OC(O)=O MIJCDUFXLHDCRP-UHFFFAOYSA-N 0.000 description 1
- ABPHFBVQZKODLB-UHFFFAOYSA-N 1-(4-bromophenyl)-3-[4-[2-(1-trityltetrazol-5-yl)ethyl]phenyl]imidazolidin-2-one Chemical compound C1=CC(Br)=CC=C1N1C(=O)N(C=2C=CC(CCC=3N(N=NN=3)C(C=3C=CC=CC=3)(C=3C=CC=CC=3)C=3C=CC=CC=3)=CC=2)CC1 ABPHFBVQZKODLB-UHFFFAOYSA-N 0.000 description 1
- ASOKPJOREAFHNY-UHFFFAOYSA-N 1-Hydroxybenzotriazole Chemical compound C1=CC=C2N(O)N=NC2=C1 ASOKPJOREAFHNY-UHFFFAOYSA-N 0.000 description 1
- CTOOVEKBVXCYME-UHFFFAOYSA-N 1-cyclohexyloxycarbonyloxyethyl 3-[4-[1-(4-carbamimidoylphenyl)-3-methyl-5-oxo-1,2,4-triazol-4-yl]phenyl]propanoate;hydrochloride Chemical compound Cl.C1CCCCC1OC(=O)OC(C)OC(=O)CCC(C=C1)=CC=C1N(C1=O)C(C)=NN1C1=CC=C(C(N)=N)C=C1 CTOOVEKBVXCYME-UHFFFAOYSA-N 0.000 description 1
- CXBDYQVECUFKRK-UHFFFAOYSA-N 1-methoxybutane Chemical compound CCCCOC CXBDYQVECUFKRK-UHFFFAOYSA-N 0.000 description 1
- LNSCNEJNLACZPA-UHFFFAOYSA-N 2,3-dihydroxy-2,3-bis(2-methylphenyl)butanedioic acid Chemical compound CC1=CC=CC=C1C(O)(C(O)=O)C(O)(C(O)=O)C1=CC=CC=C1C LNSCNEJNLACZPA-UHFFFAOYSA-N 0.000 description 1
- QISZEIUDLXDZRF-UHFFFAOYSA-N 2-(butylsulfonylamino)-3-[4-[3-(4-carbamimidoylphenyl)-2-oxoimidazolidin-1-yl]phenyl]propanoic acid;hydrochloride Chemical compound Cl.C1=CC(CC(NS(=O)(=O)CCCC)C(O)=O)=CC=C1N1C(=O)N(C=2C=CC(=CC=2)C(N)=N)CC1 QISZEIUDLXDZRF-UHFFFAOYSA-N 0.000 description 1
- RFBFEMGDPHVVNC-UHFFFAOYSA-N 2-(methanesulfonamido)-3-[4-[3-methyl-5-oxo-1-(2-piperidin-4-ylethyl)-1,2,4-triazol-4-yl]phenyl]propanoic acid;hydrochloride Chemical compound Cl.O=C1N(C=2C=CC(CC(NS(C)(=O)=O)C(O)=O)=CC=2)C(C)=NN1CCC1CCNCC1 RFBFEMGDPHVVNC-UHFFFAOYSA-N 0.000 description 1
- KIWIEMCRCJIVJL-UHFFFAOYSA-N 2-[[4-[1-(4-carbamimidoylphenyl)-3-methyl-5-oxo-1,2,4-triazol-4-yl]phenyl]methyl]pentanoic acid Chemical compound C1=CC(CC(CCC)C(O)=O)=CC=C1N1C(=O)N(C=2C=CC(=CC=2)C(N)=N)N=C1C KIWIEMCRCJIVJL-UHFFFAOYSA-N 0.000 description 1
- KMNOHVFGDIUGFU-UHFFFAOYSA-N 2-[[4-[2-oxo-3-(2-piperidin-4-ylethyl)imidazolidin-1-yl]phenyl]methyl]pentanoic acid;hydrochloride Chemical compound Cl.C1=CC(CC(CCC)C(O)=O)=CC=C1N1C(=O)N(CCC2CCNCC2)CC1 KMNOHVFGDIUGFU-UHFFFAOYSA-N 0.000 description 1
- KMGUEILFFWDGFV-UHFFFAOYSA-N 2-benzoyl-2-benzoyloxy-3-hydroxybutanedioic acid Chemical compound C=1C=CC=CC=1C(=O)C(C(C(O)=O)O)(C(O)=O)OC(=O)C1=CC=CC=C1 KMGUEILFFWDGFV-UHFFFAOYSA-N 0.000 description 1
- 125000001340 2-chloroethyl group Chemical group [H]C([H])(Cl)C([H])([H])* 0.000 description 1
- LBLYYCQCTBFVLH-UHFFFAOYSA-M 2-methylbenzenesulfonate Chemical compound CC1=CC=CC=C1S([O-])(=O)=O LBLYYCQCTBFVLH-UHFFFAOYSA-M 0.000 description 1
- NOZUSDSRQUWUPO-UHFFFAOYSA-N 2-methylpropyl 3-[4-[1-(4-carbamimidoylphenyl)-3-methyl-5-oxo-1,2,4-triazol-4-yl]phenyl]propanoate Chemical compound C1=CC(CCC(=O)OCC(C)C)=CC=C1N1C(=O)N(C=2C=CC(=CC=2)C(N)=N)N=C1C NOZUSDSRQUWUPO-UHFFFAOYSA-N 0.000 description 1
- 125000004135 2-norbornyl group Chemical group [H]C1([H])C([H])([H])C2([H])C([H])([H])C1([H])C([H])([H])C2([H])* 0.000 description 1
- SRJBCDRFXOZHMY-UHFFFAOYSA-N 3-[4-[1-(4-carbamimidoylphenyl)-3-methyl-5-oxo-1,2,4-triazol-4-yl]phenyl]propanoic acid Chemical compound O=C1N(C=2C=CC(CCC(O)=O)=CC=2)C(C)=NN1C1=CC=C(C(N)=N)C=C1 SRJBCDRFXOZHMY-UHFFFAOYSA-N 0.000 description 1
- YLMNTLVVHQRQLU-UHFFFAOYSA-N 3-[4-[1-(4-carbamimidoylphenyl)-5-oxo-3-(trifluoromethyl)-1,2,4-triazol-4-yl]phenyl]propanoic acid Chemical compound C1=CC(C(=N)N)=CC=C1N1C(=O)N(C=2C=CC(CCC(O)=O)=CC=2)C(C(F)(F)F)=N1 YLMNTLVVHQRQLU-UHFFFAOYSA-N 0.000 description 1
- OHYCITPQGUVMHM-UHFFFAOYSA-N 3-[4-[1-[2-(1,4-diazepan-1-yl)ethyl]-3-methyl-5-oxo-1,2,4-triazol-4-yl]phenyl]propanoic acid;dihydrochloride Chemical compound Cl.Cl.O=C1N(C=2C=CC(CCC(O)=O)=CC=2)C(C)=NN1CCN1CCCNCC1 OHYCITPQGUVMHM-UHFFFAOYSA-N 0.000 description 1
- AJNBHYRQBKZTNG-UHFFFAOYSA-N 3-[4-[1-[2-(azepan-4-yl)ethyl]-3-methyl-5-oxo-1,2,4-triazol-4-yl]phenyl]propanoic acid;hydrochloride Chemical compound Cl.O=C1N(C=2C=CC(CCC(O)=O)=CC=2)C(C)=NN1CCC1CCCNCC1 AJNBHYRQBKZTNG-UHFFFAOYSA-N 0.000 description 1
- IWWSGCUWRXZFNZ-UHFFFAOYSA-N 3-[4-[2-oxo-3-(2-piperidin-4-ylethyl)-1,3-diazinan-1-yl]phenyl]propanoic acid;hydrochloride Chemical compound Cl.C1=CC(CCC(=O)O)=CC=C1N1C(=O)N(CCC2CCNCC2)CCC1 IWWSGCUWRXZFNZ-UHFFFAOYSA-N 0.000 description 1
- JLZPAQZOMLZJPF-UHFFFAOYSA-N 3-[4-[3-(4-bromophenyl)-2-oxoimidazolidin-1-yl]phenyl]propanenitrile Chemical compound C1=CC(Br)=CC=C1N1C(=O)N(C=2C=CC(CCC#N)=CC=2)CC1 JLZPAQZOMLZJPF-UHFFFAOYSA-N 0.000 description 1
- IFXDHPYYAOZYOD-UHFFFAOYSA-N 3-[4-[3-(4-carbamimidoylphenyl)-2-oxoimidazolidin-1-yl]phenyl]-2-(3-phenylpropanoylamino)propanoic acid;hydrochloride Chemical compound Cl.C1=CC(C(=N)N)=CC=C1N1C(=O)N(C=2C=CC(CC(NC(=O)CCC=3C=CC=CC=3)C(O)=O)=CC=2)CC1 IFXDHPYYAOZYOD-UHFFFAOYSA-N 0.000 description 1
- DDFLHZKOHSXFIA-UHFFFAOYSA-N 3-[4-[3-(4-carbamimidoylphenyl)-2-oxoimidazolidin-1-yl]phenyl]-2-(hexanoylamino)propanoic acid;hydrochloride Chemical compound Cl.C1=CC(CC(NC(=O)CCCCC)C(O)=O)=CC=C1N1C(=O)N(C=2C=CC(=CC=2)C(N)=N)CC1 DDFLHZKOHSXFIA-UHFFFAOYSA-N 0.000 description 1
- JJYXFCHWVJXFBB-UHFFFAOYSA-N 3-[4-[3-[4-(aminomethyl)cyclohexyl]-2-oxoimidazolidin-1-yl]phenyl]propanoic acid Chemical compound C1CC(CN)CCC1N1C(=O)N(C=2C=CC(CCC(O)=O)=CC=2)CC1 JJYXFCHWVJXFBB-UHFFFAOYSA-N 0.000 description 1
- YUPNBLFQFNBFHO-UHFFFAOYSA-N 3-[4-[3-methyl-5-oxo-1-(2-piperidin-4-ylethyl)-1,2,4-triazol-4-yl]phenyl]propanoic acid;phenylmethanesulfonic acid Chemical compound OS(=O)(=O)CC1=CC=CC=C1.O=C1N(C=2C=CC(CCC(O)=O)=CC=2)C(C)=NN1CCC1CCNCC1 YUPNBLFQFNBFHO-UHFFFAOYSA-N 0.000 description 1
- BJKCOGAZVWGISF-UHFFFAOYSA-N 3-[4-[3-methyl-5-oxo-1-[4-[(e)-n'-phenylmethoxycarbonylcarbamimidoyl]phenyl]-1,2,4-triazol-4-yl]phenyl]propanoic acid Chemical compound O=C1N(C=2C=CC(CCC(O)=O)=CC=2)C(C)=NN1C(C=C1)=CC=C1C(N)=NC(=O)OCC1=CC=CC=C1 BJKCOGAZVWGISF-UHFFFAOYSA-N 0.000 description 1
- XMTUFRKPVKCKOR-UHFFFAOYSA-N 4-(2,2-diethoxyethylamino)benzonitrile Chemical compound CCOC(OCC)CNC1=CC=C(C#N)C=C1 XMTUFRKPVKCKOR-UHFFFAOYSA-N 0.000 description 1
- XVMSFILGAMDHEY-UHFFFAOYSA-N 6-(4-aminophenyl)sulfonylpyridin-3-amine Chemical compound C1=CC(N)=CC=C1S(=O)(=O)C1=CC=C(N)C=N1 XVMSFILGAMDHEY-UHFFFAOYSA-N 0.000 description 1
- QGZKDVFQNNGYKY-UHFFFAOYSA-O Ammonium Chemical compound [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 description 1
- ATRRKUHOCOJYRX-UHFFFAOYSA-N Ammonium bicarbonate Chemical class [NH4+].OC([O-])=O ATRRKUHOCOJYRX-UHFFFAOYSA-N 0.000 description 1
- 239000004475 Arginine Substances 0.000 description 1
- 201000001320 Atherosclerosis Diseases 0.000 description 1
- 108010039209 Blood Coagulation Factors Proteins 0.000 description 1
- 102000015081 Blood Coagulation Factors Human genes 0.000 description 1
- AUXYNOKNNKUIQB-WOVMCDHWSA-N C(#N)C1=CC=C(C=C1)N1C(N(C=C1)[C@@H]1CC[C@@H](CC1)CCC(=O)OC)=O Chemical compound C(#N)C1=CC=C(C=C1)N1C(N(C=C1)[C@@H]1CC[C@@H](CC1)CCC(=O)OC)=O AUXYNOKNNKUIQB-WOVMCDHWSA-N 0.000 description 1
- KXFHWHUFHHSCQN-JCNLHEQBSA-N C(#N)C1=CC=C(C=C1)N1N=C(N(C1=O)[C@@H]1CC[C@H](CC1)CCC(=O)OC)C Chemical compound C(#N)C1=CC=C(C=C1)N1N=C(N(C1=O)[C@@H]1CC[C@H](CC1)CCC(=O)OC)C KXFHWHUFHHSCQN-JCNLHEQBSA-N 0.000 description 1
- BMZRNHVKNMUHLO-KOMQPUFPSA-N C(N)(=N)C1=CC=C(C=C1)N1C(N(CC1)[C@@H]1CC[C@H](CC1)CCC(=O)OC)=O Chemical compound C(N)(=N)C1=CC=C(C=C1)N1C(N(CC1)[C@@H]1CC[C@H](CC1)CCC(=O)OC)=O BMZRNHVKNMUHLO-KOMQPUFPSA-N 0.000 description 1
- AKYQTTZQNMCEKN-NNUKFRKNSA-N C1=CC(C(=N)N)=CC=C1N1C(=O)N([C@@H]2CC[C@@H](CCC(O)=O)CC2)C(=O)C1 Chemical compound C1=CC(C(=N)N)=CC=C1N1C(=O)N([C@@H]2CC[C@@H](CCC(O)=O)CC2)C(=O)C1 AKYQTTZQNMCEKN-NNUKFRKNSA-N 0.000 description 1
- AOCGSHYNGKAYSD-NNUKFRKNSA-N C1=CC(C(=N)N)=CC=C1N1C(=O)N([C@@H]2CC[C@@H](CCC(O)=O)CC2)N=C1 Chemical compound C1=CC(C(=N)N)=CC=C1N1C(=O)N([C@@H]2CC[C@@H](CCC(O)=O)CC2)N=C1 AOCGSHYNGKAYSD-NNUKFRKNSA-N 0.000 description 1
- ZUQJRIFSHOJWJR-OTVXOJSOSA-N C1=CC(C(=N)N)=CC=C1N1C(=O)N([C@H]2CC[C@@H](CCC(O)=O)CC2)CC1 Chemical compound C1=CC(C(=N)N)=CC=C1N1C(=O)N([C@H]2CC[C@@H](CCC(O)=O)CC2)CC1 ZUQJRIFSHOJWJR-OTVXOJSOSA-N 0.000 description 1
- APWWANLTCNUWJU-UHFFFAOYSA-N C1CNCCC1C2=CC=C(C=C2)N3CN(C=C3)CCCCC(=O)O Chemical compound C1CNCCC1C2=CC=C(C=C2)N3CN(C=C3)CCCCC(=O)O APWWANLTCNUWJU-UHFFFAOYSA-N 0.000 description 1
- XTBUREVEVMWBIT-UHFFFAOYSA-N C1CNCCC1N2CN(C=C2)C3=CC=C(C=C3)CCCCC(=O)O Chemical compound C1CNCCC1N2CN(C=C2)C3=CC=C(C=C3)CCCCC(=O)O XTBUREVEVMWBIT-UHFFFAOYSA-N 0.000 description 1
- JPZGNLSHXVHRGM-XUTJKUGGSA-N C1C[C@@H](C(=O)OCC)CC[C@@H]1N(CCO)C(=O)NC1=CC=C(C2CCN(CC2)C(=O)C(F)(F)F)C=C1 Chemical compound C1C[C@@H](C(=O)OCC)CC[C@@H]1N(CCO)C(=O)NC1=CC=C(C2CCN(CC2)C(=O)C(F)(F)F)C=C1 JPZGNLSHXVHRGM-XUTJKUGGSA-N 0.000 description 1
- AOOGJYFUTYXSRO-KOMQPUFPSA-N C1C[C@@H](CCC(=O)OC)CC[C@@H]1N1C(=O)N(C=2C=CC(=CC=2)C#N)N=C1 Chemical compound C1C[C@@H](CCC(=O)OC)CC[C@@H]1N1C(=O)N(C=2C=CC(=CC=2)C#N)N=C1 AOOGJYFUTYXSRO-KOMQPUFPSA-N 0.000 description 1
- ALCACFJFAHRYJO-JCNLHEQBSA-N C1C[C@@H](CCC(=O)OC)CC[C@@H]1NC(=O)N(NC(C)=O)C1=CC=C(C#N)C=C1 Chemical compound C1C[C@@H](CCC(=O)OC)CC[C@@H]1NC(=O)N(NC(C)=O)C1=CC=C(C#N)C=C1 ALCACFJFAHRYJO-JCNLHEQBSA-N 0.000 description 1
- RGMNILABYPTNNZ-FZNQNYSPSA-N C1C[C@@H](CCC(=O)OC)CC[C@H]1N1C(=O)N(C=2C=CC(=CC=2)C(N)=N)N=C1C Chemical compound C1C[C@@H](CCC(=O)OC)CC[C@H]1N1C(=O)N(C=2C=CC(=CC=2)C(N)=N)N=C1C RGMNILABYPTNNZ-FZNQNYSPSA-N 0.000 description 1
- ALCACFJFAHRYJO-WOVMCDHWSA-N C1C[C@@H](CCC(=O)OC)CC[C@H]1NC(=O)N(NC(C)=O)C1=CC=C(C#N)C=C1 Chemical compound C1C[C@@H](CCC(=O)OC)CC[C@H]1NC(=O)N(NC(C)=O)C1=CC=C(C#N)C=C1 ALCACFJFAHRYJO-WOVMCDHWSA-N 0.000 description 1
- UOKQMVNGEGTEBV-UHFFFAOYSA-N C=1C=C(CCC(=O)OC)C=CC=1NC(=O)N(CC(OCC)OCC)C(CC1)CCC21OCCO2 Chemical compound C=1C=C(CCC(=O)OC)C=CC=1NC(=O)N(CC(OCC)OCC)C(CC1)CCC21OCCO2 UOKQMVNGEGTEBV-UHFFFAOYSA-N 0.000 description 1
- HGNZXQBAWOCPQC-UHFFFAOYSA-N CC(CCC(C1(C)C)C11C(CCC(C=C2)=CC=C2N(C(C)=NN2C(C=C3)=CC=C3C(N)=N)C2=O)=O)C1OCCC1CCCCC1 Chemical compound CC(CCC(C1(C)C)C11C(CCC(C=C2)=CC=C2N(C(C)=NN2C(C=C3)=CC=C3C(N)=N)C2=O)=O)C1OCCC1CCCCC1 HGNZXQBAWOCPQC-UHFFFAOYSA-N 0.000 description 1
- WTJWSBQONJNJNR-UHFFFAOYSA-N CCCC(C(=O)OC)CC1=CC=C(NC(=O)NCCCl)C=C1 Chemical compound CCCC(C(=O)OC)CC1=CC=C(NC(=O)NCCCl)C=C1 WTJWSBQONJNJNR-UHFFFAOYSA-N 0.000 description 1
- 229920002134 Carboxymethyl cellulose Polymers 0.000 description 1
- OOTGCINPYGKSPC-NRZPPVGBSA-N Cl.C(N)(=N)C1=CC=C(C=C1)N1C(N(CC1)[C@@H]1CC[C@H](CC1)OCC(=O)OC)=O Chemical compound Cl.C(N)(=N)C1=CC=C(C=C1)N1C(N(CC1)[C@@H]1CC[C@H](CC1)OCC(=O)OC)=O OOTGCINPYGKSPC-NRZPPVGBSA-N 0.000 description 1
- FIKBGHADCXPXQF-AELULUIVSA-N Cl.C1C[C@@H](CCC(=O)OC(C)C)CC[C@@H]1N1C(=O)N(C=2C=CC(=CC=2)C(N)=N)N=C1C Chemical compound Cl.C1C[C@@H](CCC(=O)OC(C)C)CC[C@@H]1N1C(=O)N(C=2C=CC(=CC=2)C(N)=N)N=C1C FIKBGHADCXPXQF-AELULUIVSA-N 0.000 description 1
- FIKBGHADCXPXQF-YMPPOUHLSA-N Cl.C1C[C@@H](CCC(=O)OC(C)C)CC[C@H]1N1C(=O)N(C=2C=CC(=CC=2)C(N)=N)N=C1C Chemical compound Cl.C1C[C@@H](CCC(=O)OC(C)C)CC[C@H]1N1C(=O)N(C=2C=CC(=CC=2)C(N)=N)N=C1C FIKBGHADCXPXQF-YMPPOUHLSA-N 0.000 description 1
- KLJLSRNUQXDTFH-SWQINVOKSA-N Cl.C1C[C@@H](CCC(=O)OC)CC[C@@H]1N1C(=O)N(C=2C=CC(=CC=2)C(N)=N)C=C1 Chemical compound Cl.C1C[C@@H](CCC(=O)OC)CC[C@@H]1N1C(=O)N(C=2C=CC(=CC=2)C(N)=N)C=C1 KLJLSRNUQXDTFH-SWQINVOKSA-N 0.000 description 1
- BZWNBQUVWCIVTG-FFPCIGOZSA-N Cl.COC(=O)[C@@H]1CC[C@H](CC1)N1C(N(CC1)C1=CC=C(C=C1)C1CCNCC1)=O Chemical compound Cl.COC(=O)[C@@H]1CC[C@H](CC1)N1C(N(CC1)C1=CC=C(C=C1)C1CCNCC1)=O BZWNBQUVWCIVTG-FFPCIGOZSA-N 0.000 description 1
- WNGLFUSVCZMVLO-UHFFFAOYSA-N Cl.O=C1N(C=2C=CC(CCC(=O)OC3CCCCC3)=CC=2)C(C)=NN1C1=CC=C(C(N)=N)C=C1 Chemical compound Cl.O=C1N(C=2C=CC(CCC(=O)OC3CCCCC3)=CC=2)C(C)=NN1C1=CC=C(C(N)=N)C=C1 WNGLFUSVCZMVLO-UHFFFAOYSA-N 0.000 description 1
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 description 1
- 229910021595 Copper(I) iodide Inorganic materials 0.000 description 1
- AAWZDTNXLSGCEK-UHFFFAOYSA-N Cordycepinsaeure Natural products OC1CC(O)(C(O)=O)CC(O)C1O AAWZDTNXLSGCEK-UHFFFAOYSA-N 0.000 description 1
- XFXPMWWXUTWYJX-UHFFFAOYSA-N Cyanide Chemical compound N#[C-] XFXPMWWXUTWYJX-UHFFFAOYSA-N 0.000 description 1
- FBPFZTCFMRRESA-FSIIMWSLSA-N D-Glucitol Natural products OC[C@H](O)[C@H](O)[C@@H](O)[C@H](O)CO FBPFZTCFMRRESA-FSIIMWSLSA-N 0.000 description 1
- 229920000045 Dermatan sulfate Polymers 0.000 description 1
- RWSOTUBLDIXVET-UHFFFAOYSA-N Dihydrogen sulfide Chemical compound S RWSOTUBLDIXVET-UHFFFAOYSA-N 0.000 description 1
- ZAFNJMIOTHYJRJ-UHFFFAOYSA-N Diisopropyl ether Chemical compound CC(C)OC(C)C ZAFNJMIOTHYJRJ-UHFFFAOYSA-N 0.000 description 1
- QUSNBJAOOMFDIB-UHFFFAOYSA-N Ethylamine Chemical compound CCN QUSNBJAOOMFDIB-UHFFFAOYSA-N 0.000 description 1
- WHUUTDBJXJRKMK-UHFFFAOYSA-N Glutamic acid Natural products OC(=O)C(N)CCC(O)=O WHUUTDBJXJRKMK-UHFFFAOYSA-N 0.000 description 1
- HTTJABKRGRZYRN-UHFFFAOYSA-N Heparin Chemical compound OC1C(NC(=O)C)C(O)OC(COS(O)(=O)=O)C1OC1C(OS(O)(=O)=O)C(O)C(OC2C(C(OS(O)(=O)=O)C(OC3C(C(O)C(O)C(O3)C(O)=O)OS(O)(=O)=O)C(CO)O2)NS(O)(=O)=O)C(C(O)=O)O1 HTTJABKRGRZYRN-UHFFFAOYSA-N 0.000 description 1
- 102000007625 Hirudins Human genes 0.000 description 1
- 108010007267 Hirudins Proteins 0.000 description 1
- 208000026350 Inborn Genetic disease Diseases 0.000 description 1
- 206010061218 Inflammation Diseases 0.000 description 1
- ODKSFYDXXFIFQN-BYPYZUCNSA-P L-argininium(2+) Chemical compound NC(=[NH2+])NCCC[C@H]([NH3+])C(O)=O ODKSFYDXXFIFQN-BYPYZUCNSA-P 0.000 description 1
- CKLJMWTZIZZHCS-REOHCLBHSA-N L-aspartic acid Chemical compound OC(=O)[C@@H](N)CC(O)=O CKLJMWTZIZZHCS-REOHCLBHSA-N 0.000 description 1
- WHUUTDBJXJRKMK-VKHMYHEASA-N L-glutamic acid Chemical compound OC(=O)[C@@H](N)CCC(O)=O WHUUTDBJXJRKMK-VKHMYHEASA-N 0.000 description 1
- 241000282560 Macaca mulatta Species 0.000 description 1
- 206010027476 Metastases Diseases 0.000 description 1
- 241001465754 Metazoa Species 0.000 description 1
- 229920000168 Microcrystalline cellulose Polymers 0.000 description 1
- KWYHDKDOAIKMQN-UHFFFAOYSA-N N,N,N',N'-tetramethylethylenediamine Chemical compound CN(C)CCN(C)C KWYHDKDOAIKMQN-UHFFFAOYSA-N 0.000 description 1
- NQTADLQHYWFPDB-UHFFFAOYSA-N N-Hydroxysuccinimide Chemical compound ON1C(=O)CCC1=O NQTADLQHYWFPDB-UHFFFAOYSA-N 0.000 description 1
- SECXISVLQFMRJM-UHFFFAOYSA-N N-Methylpyrrolidone Chemical compound CN1CCCC1=O SECXISVLQFMRJM-UHFFFAOYSA-N 0.000 description 1
- LIWAQLJGPBVORC-UHFFFAOYSA-N N-ethyl-N-methylamine Natural products CCNC LIWAQLJGPBVORC-UHFFFAOYSA-N 0.000 description 1
- IOVCWXUNBOPUCH-UHFFFAOYSA-M Nitrite anion Chemical compound [O-]N=O IOVCWXUNBOPUCH-UHFFFAOYSA-M 0.000 description 1
- SNIOPGDIGTZGOP-UHFFFAOYSA-N Nitroglycerin Chemical compound [O-][N+](=O)OCC(O[N+]([O-])=O)CO[N+]([O-])=O SNIOPGDIGTZGOP-UHFFFAOYSA-N 0.000 description 1
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 1
- GLWCHIHJBVNQNI-UHFFFAOYSA-N O=C(C(F)(F)F)N(CC1)CCC1C(C=C1)=CC=C1N1C=NCC1 Chemical class O=C(C(F)(F)F)N(CC1)CCC1C(C=C1)=CC=C1N1C=NCC1 GLWCHIHJBVNQNI-UHFFFAOYSA-N 0.000 description 1
- GIDPBJRDTAKRJW-OTVXOJSOSA-N O=C1N([C@H]2CC[C@@H](CCC(O)=O)CC2)C(C)=NN1C1=CC=C(C(N)=N)C=C1 Chemical compound O=C1N([C@H]2CC[C@@H](CCC(O)=O)CC2)C(C)=NN1C1=CC=C(C(N)=N)C=C1 GIDPBJRDTAKRJW-OTVXOJSOSA-N 0.000 description 1
- WBQRTJLRWZCOLK-UHFFFAOYSA-N ON=C1CCCC2=CC(=CC=C12)N1C(N(CC1)C1=CC=C(C=C1)CCC(=O)OC)=O Chemical compound ON=C1CCCC2=CC(=CC=C12)N1C(N(CC1)C1=CC=C(C=C1)CCC(=O)OC)=O WBQRTJLRWZCOLK-UHFFFAOYSA-N 0.000 description 1
- 208000001132 Osteoporosis Diseases 0.000 description 1
- YGYAWVDWMABLBF-UHFFFAOYSA-N Phosgene Chemical compound ClC(Cl)=O YGYAWVDWMABLBF-UHFFFAOYSA-N 0.000 description 1
- 239000002202 Polyethylene glycol Substances 0.000 description 1
- 101800004937 Protein C Proteins 0.000 description 1
- 102000017975 Protein C Human genes 0.000 description 1
- 201000004681 Psoriasis Diseases 0.000 description 1
- 208000010378 Pulmonary Embolism Diseases 0.000 description 1
- AAWZDTNXLSGCEK-ZHQZDSKASA-N Quinic acid Natural products O[C@H]1CC(O)(C(O)=O)C[C@H](O)C1O AAWZDTNXLSGCEK-ZHQZDSKASA-N 0.000 description 1
- IWYDHOAUDWTVEP-UHFFFAOYSA-N R-2-phenyl-2-hydroxyacetic acid Natural products OC(=O)C(O)C1=CC=CC=C1 IWYDHOAUDWTVEP-UHFFFAOYSA-N 0.000 description 1
- 101800001700 Saposin-D Proteins 0.000 description 1
- 108010023197 Streptokinase Proteins 0.000 description 1
- 229930006000 Sucrose Natural products 0.000 description 1
- CZMRCDWAGMRECN-UGDNZRGBSA-N Sucrose Chemical compound O[C@H]1[C@H](O)[C@@H](CO)O[C@@]1(CO)O[C@@H]1[C@H](O)[C@@H](O)[C@H](O)[C@@H](CO)O1 CZMRCDWAGMRECN-UGDNZRGBSA-N 0.000 description 1
- 208000007536 Thrombosis Diseases 0.000 description 1
- 102000003938 Thromboxane Receptors Human genes 0.000 description 1
- 108090000300 Thromboxane Receptors Proteins 0.000 description 1
- GSEJCLTVZPLZKY-UHFFFAOYSA-N Triethanolamine Chemical compound OCCN(CCO)CCO GSEJCLTVZPLZKY-UHFFFAOYSA-N 0.000 description 1
- 101150046432 Tril gene Proteins 0.000 description 1
- 108090000435 Urokinase-type plasminogen activator Proteins 0.000 description 1
- 102000003990 Urokinase-type plasminogen activator Human genes 0.000 description 1
- 150000001242 acetic acid derivatives Chemical class 0.000 description 1
- WFKJMOAMFFIYOQ-UHFFFAOYSA-N acetic acid methyl 2-(butylsulfonylamino)-3-[4-[3-(4-carbamimidoylphenyl)-2-oxoimidazolidin-1-yl]phenyl]propanoate Chemical compound CC(O)=O.C1=CC(CC(NS(=O)(=O)CCCC)C(=O)OC)=CC=C1N1C(=O)N(C=2C=CC(=CC=2)C(N)=N)CC1 WFKJMOAMFFIYOQ-UHFFFAOYSA-N 0.000 description 1
- 208000037919 acquired disease Diseases 0.000 description 1
- 230000009471 action Effects 0.000 description 1
- 125000004423 acyloxy group Chemical group 0.000 description 1
- 230000001476 alcoholic effect Effects 0.000 description 1
- 125000001931 aliphatic group Chemical group 0.000 description 1
- 229910052783 alkali metal Inorganic materials 0.000 description 1
- 150000001340 alkali metals Chemical class 0.000 description 1
- 125000005194 alkoxycarbonyloxy group Chemical group 0.000 description 1
- 150000003973 alkyl amines Chemical group 0.000 description 1
- 239000002168 alkylating agent Substances 0.000 description 1
- 229940100198 alkylating agent Drugs 0.000 description 1
- BJEPYKJPYRNKOW-UHFFFAOYSA-N alpha-hydroxysuccinic acid Natural products OC(=O)C(O)CC(O)=O BJEPYKJPYRNKOW-UHFFFAOYSA-N 0.000 description 1
- 150000001409 amidines Chemical class 0.000 description 1
- 235000019270 ammonium chloride Nutrition 0.000 description 1
- 238000002399 angioplasty Methods 0.000 description 1
- 150000008064 anhydrides Chemical class 0.000 description 1
- 230000001093 anti-cancer Effects 0.000 description 1
- 230000003110 anti-inflammatory effect Effects 0.000 description 1
- 229940127219 anticoagulant drug Drugs 0.000 description 1
- 229940082988 antihypertensives serotonin antagonists Drugs 0.000 description 1
- 239000003420 antiserotonin agent Substances 0.000 description 1
- 239000003125 aqueous solvent Substances 0.000 description 1
- ODKSFYDXXFIFQN-UHFFFAOYSA-N arginine Natural products OC(=O)C(N)CCCNC(N)=N ODKSFYDXXFIFQN-UHFFFAOYSA-N 0.000 description 1
- 125000005110 aryl thio group Chemical group 0.000 description 1
- 235000003704 aspartic acid Nutrition 0.000 description 1
- CBHOOMGKXCMKIR-UHFFFAOYSA-N azane;methanol Chemical compound N.OC CBHOOMGKXCMKIR-UHFFFAOYSA-N 0.000 description 1
- 235000019445 benzyl alcohol Nutrition 0.000 description 1
- OQFSQFPPLPISGP-UHFFFAOYSA-N beta-carboxyaspartic acid Natural products OC(=O)C(N)C(C(O)=O)C(O)=O OQFSQFPPLPISGP-UHFFFAOYSA-N 0.000 description 1
- 230000004071 biological effect Effects 0.000 description 1
- 230000005540 biological transmission Effects 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 239000003114 blood coagulation factor Substances 0.000 description 1
- 210000000988 bone and bone Anatomy 0.000 description 1
- IYYIVELXUANFED-UHFFFAOYSA-N bromo(trimethyl)silane Chemical compound C[Si](C)(C)Br IYYIVELXUANFED-UHFFFAOYSA-N 0.000 description 1
- HQABUPZFAYXKJW-UHFFFAOYSA-N butan-1-amine Chemical compound CCCCN HQABUPZFAYXKJW-UHFFFAOYSA-N 0.000 description 1
- WEDIIKBPDQQQJU-UHFFFAOYSA-N butane-1-sulfonyl chloride Chemical compound CCCCS(Cl)(=O)=O WEDIIKBPDQQQJU-UHFFFAOYSA-N 0.000 description 1
- AXCZMVOFGPJBDE-UHFFFAOYSA-L calcium dihydroxide Chemical compound [OH-].[OH-].[Ca+2] AXCZMVOFGPJBDE-UHFFFAOYSA-L 0.000 description 1
- 239000000920 calcium hydroxide Substances 0.000 description 1
- 229910001861 calcium hydroxide Inorganic materials 0.000 description 1
- 150000004649 carbonic acid derivatives Chemical class 0.000 description 1
- 150000001728 carbonyl compounds Chemical class 0.000 description 1
- 239000001768 carboxy methyl cellulose Substances 0.000 description 1
- 235000010948 carboxy methyl cellulose Nutrition 0.000 description 1
- 239000008112 carboxymethyl-cellulose Substances 0.000 description 1
- 229940105329 carboxymethylcellulose Drugs 0.000 description 1
- 229940082638 cardiac stimulant phosphodiesterase inhibitors Drugs 0.000 description 1
- 230000015556 catabolic process Effects 0.000 description 1
- 230000003197 catalytic effect Effects 0.000 description 1
- 238000005119 centrifugation Methods 0.000 description 1
- 208000026106 cerebrovascular disease Diseases 0.000 description 1
- 230000008859 change Effects 0.000 description 1
- 239000003638 chemical reducing agent Substances 0.000 description 1
- 150000001805 chlorine compounds Chemical class 0.000 description 1
- 238000005345 coagulation Methods 0.000 description 1
- 230000015271 coagulation Effects 0.000 description 1
- 239000012141 concentrate Substances 0.000 description 1
- LSXDOTMGLUJQCM-UHFFFAOYSA-M copper(i) iodide Chemical compound I[Cu] LSXDOTMGLUJQCM-UHFFFAOYSA-M 0.000 description 1
- 238000002425 crystallisation Methods 0.000 description 1
- 230000008025 crystallization Effects 0.000 description 1
- REBOEZWOXXKHBI-UHFFFAOYSA-N cycloheptyl 3-[4-[1-(4-carbamimidoylphenyl)-3-methyl-5-oxo-1,2,4-triazol-4-yl]phenyl]propanoate Chemical compound O=C1N(C=2C=CC(CCC(=O)OC3CCCCCC3)=CC=2)C(C)=NN1C1=CC=C(C(N)=N)C=C1 REBOEZWOXXKHBI-UHFFFAOYSA-N 0.000 description 1
- HPXRVTGHNJAIIH-UHFFFAOYSA-N cyclohexanol Chemical compound OC1CCCCC1 HPXRVTGHNJAIIH-UHFFFAOYSA-N 0.000 description 1
- BRCFLFNGZSQHIT-UHFFFAOYSA-N cyclohexyl 3-[4-[1-(4-carbamimidoylphenyl)-3-methyl-5-oxo-1,2,4-triazol-4-yl]phenyl]propanoate Chemical compound O=C1N(C=2C=CC(CCC(=O)OC3CCCCC3)=CC=2)C(C)=NN1C1=CC=C(C(N)=N)C=C1 BRCFLFNGZSQHIT-UHFFFAOYSA-N 0.000 description 1
- MASNBGWQBIYUGF-UHFFFAOYSA-N cyclohexyl 3-[4-[1-[4-[(e)-n'-ethoxycarbonylcarbamimidoyl]phenyl]-3-methyl-5-oxo-1,2,4-triazol-4-yl]phenyl]propanoate Chemical compound C1=CC(C(N)=NC(=O)OCC)=CC=C1N1C(=O)N(C=2C=CC(CCC(=O)OC3CCCCC3)=CC=2)C(C)=N1 MASNBGWQBIYUGF-UHFFFAOYSA-N 0.000 description 1
- WGEVDEGVWWPMBG-UHFFFAOYSA-N cyclooctyl 3-[4-[1-(4-carbamimidoylphenyl)-3-methyl-5-oxo-1,2,4-triazol-4-yl]phenyl]propanoate Chemical compound O=C1N(C=2C=CC(CCC(=O)OC3CCCCCCC3)=CC=2)C(C)=NN1C1=CC=C(C(N)=N)C=C1 WGEVDEGVWWPMBG-UHFFFAOYSA-N 0.000 description 1
- 125000004851 cyclopentylmethyl group Chemical group C1(CCCC1)C* 0.000 description 1
- 238000006731 degradation reaction Methods 0.000 description 1
- 230000018044 dehydration Effects 0.000 description 1
- 238000006297 dehydration reaction Methods 0.000 description 1
- AVJBPWGFOQAPRH-FWMKGIEWSA-L dermatan sulfate Chemical compound CC(=O)N[C@H]1[C@H](O)O[C@H](CO)[C@H](OS([O-])(=O)=O)[C@@H]1O[C@H]1[C@H](O)[C@@H](O)[C@H](O)[C@H](C([O-])=O)O1 AVJBPWGFOQAPRH-FWMKGIEWSA-L 0.000 description 1
- 229940051593 dermatan sulfate Drugs 0.000 description 1
- 206010012601 diabetes mellitus Diseases 0.000 description 1
- 150000004985 diamines Chemical class 0.000 description 1
- ZBCBWPMODOFKDW-UHFFFAOYSA-N diethanolamine Chemical compound OCCNCCO ZBCBWPMODOFKDW-UHFFFAOYSA-N 0.000 description 1
- FAMRKDQNMBBFBR-BQYQJAHWSA-N diethyl azodicarboxylate Substances CCOC(=O)\N=N\C(=O)OCC FAMRKDQNMBBFBR-BQYQJAHWSA-N 0.000 description 1
- 239000000539 dimer Substances 0.000 description 1
- 239000008298 dragée Substances 0.000 description 1
- KAQKFAOMNZTLHT-VVUHWYTRSA-N epoprostenol Chemical compound O1C(=CCCCC(O)=O)C[C@@H]2[C@@H](/C=C/[C@@H](O)CCCCC)[C@H](O)C[C@@H]21 KAQKFAOMNZTLHT-VVUHWYTRSA-N 0.000 description 1
- 229960001123 epoprostenol Drugs 0.000 description 1
- AEOCXXJPGCBFJA-UHFFFAOYSA-N ethionamide Chemical compound CCC1=CC(C(N)=S)=CC=N1 AEOCXXJPGCBFJA-UHFFFAOYSA-N 0.000 description 1
- ABDWUZCXRJSITD-UHFFFAOYSA-N ethyl 3-(4-isocyanatophenyl)butanoate Chemical compound CCOC(=O)CC(C)C1=CC=C(N=C=O)C=C1 ABDWUZCXRJSITD-UHFFFAOYSA-N 0.000 description 1
- ZJKAIJZQXVASJN-UHFFFAOYSA-N ethyl 3-[4-[1-(4-carbamimidoylphenyl)-3-methyl-5-oxo-1,2,4-triazol-4-yl]phenyl]propanoate;hydrochloride Chemical compound Cl.C1=CC(CCC(=O)OCC)=CC=C1N1C(=O)N(C=2C=CC(=CC=2)C(N)=N)N=C1C ZJKAIJZQXVASJN-UHFFFAOYSA-N 0.000 description 1
- BZMZDZNPUFQORB-UHFFFAOYSA-N ethyl 3-[4-[1-(4-cyanophenyl)-3-methyl-5-oxo-1,2,4-triazol-4-yl]phenyl]butanoate Chemical compound C1=CC(C(C)CC(=O)OCC)=CC=C1N1C(=O)N(C=2C=CC(=CC=2)C#N)N=C1C BZMZDZNPUFQORB-UHFFFAOYSA-N 0.000 description 1
- HJULVMOMIWSMJB-UHFFFAOYSA-N ethyl 3-[4-[3-(4-bromophenyl)-2-oxoimidazolidin-1-yl]phenyl]propanoate Chemical compound C1=CC(CCC(=O)OCC)=CC=C1N1C(=O)N(C=2C=CC(Br)=CC=2)CC1 HJULVMOMIWSMJB-UHFFFAOYSA-N 0.000 description 1
- GAPFHDVKNAIQLX-UHFFFAOYSA-N ethyl 3-[4-[3-(4-carbamimidoylphenyl)-2-oxoimidazol-1-yl]phenyl]propanoate Chemical compound C1=CC(CCC(=O)OCC)=CC=C1N1C(=O)N(C=2C=CC(=CC=2)C(N)=N)C=C1 GAPFHDVKNAIQLX-UHFFFAOYSA-N 0.000 description 1
- ZXJZVIJKVGSVBF-UHFFFAOYSA-N ethyl 3-[4-[[acetamido-(4-cyanophenyl)carbamoyl]amino]phenyl]-2-methylpropanoate Chemical compound C1=CC(CC(C)C(=O)OCC)=CC=C1NC(=O)N(NC(C)=O)C1=CC=C(C#N)C=C1 ZXJZVIJKVGSVBF-UHFFFAOYSA-N 0.000 description 1
- CGRNPFWLXYMTHI-UHFFFAOYSA-N ethyl 3-[4-[[acetamido-(4-cyanophenyl)carbamoyl]amino]phenyl]butanoate Chemical compound C1=CC(C(C)CC(=O)OCC)=CC=C1NC(=O)N(NC(C)=O)C1=CC=C(C#N)C=C1 CGRNPFWLXYMTHI-UHFFFAOYSA-N 0.000 description 1
- 125000004494 ethyl ester group Chemical group 0.000 description 1
- JXMLAPZRDDWRRV-UHFFFAOYSA-N ethyl n-(ethoxycarbonylamino)carbamate Chemical compound CCOC(=O)NNC(=O)OCC JXMLAPZRDDWRRV-UHFFFAOYSA-N 0.000 description 1
- 239000004744 fabric Substances 0.000 description 1
- 229940012952 fibrinogen Drugs 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 239000001530 fumaric acid Substances 0.000 description 1
- 125000000524 functional group Chemical group 0.000 description 1
- 239000000499 gel Substances 0.000 description 1
- 208000016361 genetic disease Diseases 0.000 description 1
- 230000002068 genetic effect Effects 0.000 description 1
- 235000013922 glutamic acid Nutrition 0.000 description 1
- 229960002989 glutamic acid Drugs 0.000 description 1
- 239000004220 glutamic acid Substances 0.000 description 1
- 235000011187 glycerol Nutrition 0.000 description 1
- 229940116364 hard fat Drugs 0.000 description 1
- 229960002897 heparin Drugs 0.000 description 1
- 229920000669 heparin Polymers 0.000 description 1
- 150000002391 heterocyclic compounds Chemical class 0.000 description 1
- WQPDUTSPKFMPDP-OUMQNGNKSA-N hirudin Chemical compound C([C@@H](C(=O)N[C@@H](CCC(O)=O)C(=O)N[C@@H](CCC(O)=O)C(=O)N[C@@H]([C@@H](C)CC)C(=O)N1[C@@H](CCC1)C(=O)N[C@@H](CCC(O)=O)C(=O)N[C@@H](CCC(O)=O)C(=O)N[C@@H](CC=1C=CC(OS(O)(=O)=O)=CC=1)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CCC(N)=O)C(O)=O)NC(=O)[C@H](CC(O)=O)NC(=O)CNC(=O)[C@H](CC(O)=O)NC(=O)[C@H](CC(N)=O)NC(=O)[C@H](CC=1NC=NC=1)NC(=O)[C@H](CO)NC(=O)[C@H](CCC(N)=O)NC(=O)[C@H]1N(CCC1)C(=O)[C@H](CCCCN)NC(=O)[C@H]1N(CCC1)C(=O)[C@@H](NC(=O)CNC(=O)[C@H](CCC(O)=O)NC(=O)CNC(=O)[C@@H](NC(=O)[C@@H](NC(=O)[C@H]1NC(=O)[C@H](CCC(N)=O)NC(=O)[C@H](CC(N)=O)NC(=O)[C@H](CCCCN)NC(=O)[C@H](CCC(O)=O)NC(=O)CNC(=O)[C@H](CC(O)=O)NC(=O)[C@H](CO)NC(=O)CNC(=O)[C@H](CC(C)C)NC(=O)[C@H]([C@@H](C)CC)NC(=O)[C@@H]2CSSC[C@@H](C(=O)N[C@@H](CCC(O)=O)C(=O)NCC(=O)N[C@@H](CO)C(=O)N[C@@H](CC(N)=O)C(=O)N[C@H](C(=O)N[C@H](C(NCC(=O)N[C@@H](CCC(N)=O)C(=O)NCC(=O)N[C@@H](CC(N)=O)C(=O)N[C@@H](CCCCN)C(=O)N2)=O)CSSC1)C(C)C)NC(=O)[C@H](CC(C)C)NC(=O)[C@H]1NC(=O)[C@H](CC(C)C)NC(=O)[C@H](CC(N)=O)NC(=O)[C@H](CCC(N)=O)NC(=O)CNC(=O)[C@H](CO)NC(=O)[C@H](CCC(O)=O)NC(=O)[C@H]([C@@H](C)O)NC(=O)[C@@H](NC(=O)[C@H](CC(O)=O)NC(=O)[C@@H](NC(=O)[C@H](CC=2C=CC(O)=CC=2)NC(=O)[C@@H](NC(=O)[C@@H](N)C(C)C)C(C)C)[C@@H](C)O)CSSC1)C(C)C)[C@@H](C)O)[C@@H](C)O)C1=CC=CC=C1 WQPDUTSPKFMPDP-OUMQNGNKSA-N 0.000 description 1
- 229940006607 hirudin Drugs 0.000 description 1
- 229940088597 hormone Drugs 0.000 description 1
- 239000005556 hormone Substances 0.000 description 1
- 229960000443 hydrochloric acid Drugs 0.000 description 1
- 229910000037 hydrogen sulfide Inorganic materials 0.000 description 1
- AKPUJVVHYUHGKY-UHFFFAOYSA-N hydron;propan-2-ol;chloride Chemical compound Cl.CC(C)O AKPUJVVHYUHGKY-UHFFFAOYSA-N 0.000 description 1
- JGJLWPGRMCADHB-UHFFFAOYSA-N hypobromite Inorganic materials Br[O-] JGJLWPGRMCADHB-UHFFFAOYSA-N 0.000 description 1
- 230000004054 inflammatory process Effects 0.000 description 1
- 230000003993 interaction Effects 0.000 description 1
- 230000008611 intercellular interaction Effects 0.000 description 1
- 238000001990 intravenous administration Methods 0.000 description 1
- 230000002427 irreversible effect Effects 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 239000004310 lactic acid Substances 0.000 description 1
- 235000014655 lactic acid Nutrition 0.000 description 1
- 229960004873 levomenthol Drugs 0.000 description 1
- 239000012280 lithium aluminium hydride Substances 0.000 description 1
- 229940057948 magnesium stearate Drugs 0.000 description 1
- 239000001630 malic acid Substances 0.000 description 1
- 235000011090 malic acid Nutrition 0.000 description 1
- 229960002510 mandelic acid Drugs 0.000 description 1
- 229910052751 metal Inorganic materials 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- 230000009401 metastasis Effects 0.000 description 1
- 229940098779 methanesulfonic acid Drugs 0.000 description 1
- 229940057952 methanol Drugs 0.000 description 1
- UZKWTJUDCOPSNM-UHFFFAOYSA-N methoxybenzene Substances CCCCOC=C UZKWTJUDCOPSNM-UHFFFAOYSA-N 0.000 description 1
- FPIDWXZESMHROX-UHFFFAOYSA-N methyl 2-(butylsulfonylamino)-3-[4-(2-hydroxyethylamino)phenyl]propanoate Chemical compound CCCCS(=O)(=O)NC(C(=O)OC)CC1=CC=C(NCCO)C=C1 FPIDWXZESMHROX-UHFFFAOYSA-N 0.000 description 1
- LUJXOLLZUQLMCT-UHFFFAOYSA-N methyl 2-(butylsulfonylamino)-3-[4-[3-(4-cyanophenyl)-2-oxoimidazolidin-1-yl]phenyl]propanoate Chemical compound C1=CC(CC(NS(=O)(=O)CCCC)C(=O)OC)=CC=C1N1C(=O)N(C=2C=CC(=CC=2)C#N)CC1 LUJXOLLZUQLMCT-UHFFFAOYSA-N 0.000 description 1
- BAFFMMYIVDVSET-UHFFFAOYSA-N methyl 2-(butylsulfonylamino)-3-[4-[3-methyl-5-oxo-1-(2-piperidin-4-ylethyl)-1,2,4-triazol-4-yl]phenyl]propanoate;hydrochloride Chemical compound Cl.C1=CC(CC(NS(=O)(=O)CCCC)C(=O)OC)=CC=C1N1C(=O)N(CCC2CCNCC2)N=C1C BAFFMMYIVDVSET-UHFFFAOYSA-N 0.000 description 1
- PVKNEMIRXBYFEH-UHFFFAOYSA-N methyl 2-(methanesulfonamido)-3-[4-[3-methyl-5-oxo-1-(2-piperidin-4-ylethyl)-1,2,4-triazol-4-yl]phenyl]propanoate;hydrochloride Chemical compound Cl.C1=CC(CC(C(=O)OC)NS(C)(=O)=O)=CC=C1N1C(=O)N(CCC2CCNCC2)N=C1C PVKNEMIRXBYFEH-UHFFFAOYSA-N 0.000 description 1
- OFBTYZINSDFOQB-UHFFFAOYSA-N methyl 2-[[4-(2-oxoimidazolidin-1-yl)phenyl]methyl]pentanoate Chemical compound C1=CC(CC(CCC)C(=O)OC)=CC=C1N1C(=O)NCC1 OFBTYZINSDFOQB-UHFFFAOYSA-N 0.000 description 1
- NCPFIASYXZSQCA-UHFFFAOYSA-N methyl 2-[[4-(3-methyl-5-oxo-1h-1,2,4-triazol-4-yl)phenyl]methyl]butanoate Chemical compound C1=CC(CC(CC)C(=O)OC)=CC=C1N1C(=O)NN=C1C NCPFIASYXZSQCA-UHFFFAOYSA-N 0.000 description 1
- WVRVPXQAAYMGKN-UHFFFAOYSA-N methyl 2-[[4-(acetamidocarbamoylamino)phenyl]methyl]-3-methylbutanoate Chemical compound COC(=O)C(C(C)C)CC1=CC=C(NC(=O)NNC(C)=O)C=C1 WVRVPXQAAYMGKN-UHFFFAOYSA-N 0.000 description 1
- ALFBYDASXZWFMK-UHFFFAOYSA-N methyl 2-[[4-(acetamidocarbamoylamino)phenyl]methyl]butanoate Chemical compound COC(=O)C(CC)CC1=CC=C(NC(=O)NNC(C)=O)C=C1 ALFBYDASXZWFMK-UHFFFAOYSA-N 0.000 description 1
- ZRQGMRADZHHPNX-UHFFFAOYSA-N methyl 2-[[4-(acetamidocarbamoylamino)phenyl]methyl]pentanoate Chemical compound CCCC(C(=O)OC)CC1=CC=C(NC(=O)NNC(C)=O)C=C1 ZRQGMRADZHHPNX-UHFFFAOYSA-N 0.000 description 1
- RUARNSVSQCIRBR-UHFFFAOYSA-N methyl 2-[[4-[1-(4-carbamimidoylphenyl)-3-methyl-5-oxo-1,2,4-triazol-4-yl]phenyl]methyl]pentanoate;hydrochloride Chemical compound Cl.C1=CC(CC(CCC)C(=O)OC)=CC=C1N1C(=O)N(C=2C=CC(=CC=2)C(N)=N)N=C1C RUARNSVSQCIRBR-UHFFFAOYSA-N 0.000 description 1
- APHIEIBPVQPLIW-UHFFFAOYSA-N methyl 2-[[4-[3-methyl-5-oxo-1-(2-piperidin-4-ylethyl)-1,2,4-triazol-4-yl]phenyl]methyl]butanoate;hydrochloride Chemical compound Cl.C1=CC(CC(CC)C(=O)OC)=CC=C1N1C(=O)N(CCC2CCNCC2)N=C1C APHIEIBPVQPLIW-UHFFFAOYSA-N 0.000 description 1
- IEILAPPWEXYFPB-UHFFFAOYSA-N methyl 2-[[4-[[acetamido-(4-cyanophenyl)carbamoyl]amino]phenyl]methyl]pentanoate Chemical compound C1=CC(CC(CCC)C(=O)OC)=CC=C1NC(=O)N(NC(C)=O)C1=CC=C(C#N)C=C1 IEILAPPWEXYFPB-UHFFFAOYSA-N 0.000 description 1
- RYEQORYPWLIKEF-UHFFFAOYSA-N methyl 2-methyl-3-[4-[3-methyl-5-oxo-1-(2-piperidin-4-ylethyl)-1,2,4-triazol-4-yl]phenyl]propanoate;hydrochloride Chemical compound Cl.C1=CC(CC(C)C(=O)OC)=CC=C1N1C(=O)N(CCC2CCNCC2)N=C1C RYEQORYPWLIKEF-UHFFFAOYSA-N 0.000 description 1
- WWSFWZLCUWAFBS-UHFFFAOYSA-N methyl 3-[3-[1-(4-cyanophenyl)-3-methyl-5-oxo-1,2,4-triazol-4-yl]phenyl]propanoate Chemical compound COC(=O)CCC1=CC=CC(N2C(N(C=3C=CC(=CC=3)C#N)N=C2C)=O)=C1 WWSFWZLCUWAFBS-UHFFFAOYSA-N 0.000 description 1
- IBNXDNZKPYVCAB-UHFFFAOYSA-N methyl 3-[3-[[acetamido-(4-cyanophenyl)carbamoyl]amino]phenyl]propanoate Chemical compound COC(=O)CCC1=CC=CC(NC(=O)N(NC(C)=O)C=2C=CC(=CC=2)C#N)=C1 IBNXDNZKPYVCAB-UHFFFAOYSA-N 0.000 description 1
- ONGZFGQRQQZCBM-UHFFFAOYSA-N methyl 3-[4-(2-hydroxyethylamino)phenyl]propanoate Chemical compound COC(=O)CCC1=CC=C(NCCO)C=C1 ONGZFGQRQQZCBM-UHFFFAOYSA-N 0.000 description 1
- GSBDXJUWVHUBNQ-UHFFFAOYSA-N methyl 3-[4-(acetamidocarbamoylamino)phenyl]-2-methylpropanoate Chemical compound COC(=O)C(C)CC1=CC=C(NC(=O)NNC(C)=O)C=C1 GSBDXJUWVHUBNQ-UHFFFAOYSA-N 0.000 description 1
- DSIBBSNLWDJZKS-UHFFFAOYSA-N methyl 3-[4-(acetamidocarbamoylamino)phenyl]propanoate Chemical compound COC(=O)CCC1=CC=C(NC(=O)NNC(C)=O)C=C1 DSIBBSNLWDJZKS-UHFFFAOYSA-N 0.000 description 1
- WYBMPUNHZWVCQL-UHFFFAOYSA-N methyl 3-[4-[1-(4-carbamimidoylphenyl)-3-methyl-5-oxo-1,2,4-triazol-4-yl]phenyl]butanoate;hydrochloride Chemical compound Cl.C1=CC(C(C)CC(=O)OC)=CC=C1N1C(=O)N(C=2C=CC(=CC=2)C(N)=N)N=C1C WYBMPUNHZWVCQL-UHFFFAOYSA-N 0.000 description 1
- MQRZVUKVKINNFQ-UHFFFAOYSA-N methyl 3-[4-[1-(4-cyanophenyl)-5-oxo-3-phenyl-1,2,4-triazol-4-yl]phenyl]propanoate Chemical compound C1=CC(CCC(=O)OC)=CC=C1N1C(=O)N(C=2C=CC(=CC=2)C#N)N=C1C1=CC=CC=C1 MQRZVUKVKINNFQ-UHFFFAOYSA-N 0.000 description 1
- PQJMRRSELFSEEI-UHFFFAOYSA-N methyl 3-[4-[2-oxo-3-(4-oxocyclohexyl)imidazol-1-yl]phenyl]propanoate Chemical compound C1=CC(CCC(=O)OC)=CC=C1N1C(=O)N(C2CCC(=O)CC2)C=C1 PQJMRRSELFSEEI-UHFFFAOYSA-N 0.000 description 1
- GWKNXMZEMRXMBT-UHFFFAOYSA-N methyl 3-[4-[2-oxo-3-(5-oxo-7,8-dihydro-6h-naphthalen-2-yl)imidazolidin-1-yl]phenyl]propanoate Chemical compound C1=CC(CCC(=O)OC)=CC=C1N1C(=O)N(C=2C=C3CCCC(=O)C3=CC=2)CC1 GWKNXMZEMRXMBT-UHFFFAOYSA-N 0.000 description 1
- MZKLYLQLIUVKSK-UHFFFAOYSA-N methyl 3-[4-[3-(4-carbamimidoylphenyl)-2-oxoimidazolidin-1-yl]phenyl]propanoate;hydrochloride Chemical compound Cl.C1=CC(CCC(=O)OC)=CC=C1N1C(=O)N(C=2C=CC(=CC=2)C(N)=N)CC1 MZKLYLQLIUVKSK-UHFFFAOYSA-N 0.000 description 1
- MUAYSTXKXGWASM-UHFFFAOYSA-N methyl 3-[4-[3-(4-cyanocyclohexyl)-2-oxoimidazol-1-yl]phenyl]propanoate Chemical compound C1=CC(CCC(=O)OC)=CC=C1N1C(=O)N(C2CCC(CC2)C#N)C=C1 MUAYSTXKXGWASM-UHFFFAOYSA-N 0.000 description 1
- CIPWKSWMERFSPJ-UHFFFAOYSA-N methyl 3-[4-[3-(4-cyanophenyl)-2-oxoimidazolidin-1-yl]cyclohexyl]propanoate Chemical compound C1CC(CCC(=O)OC)CCC1N1C(=O)N(C=2C=CC(=CC=2)C#N)CC1 CIPWKSWMERFSPJ-UHFFFAOYSA-N 0.000 description 1
- OOFYAFXBAQSSIO-UHFFFAOYSA-N methyl 3-[4-[3-methyl-1-[2-(1-methylpiperidin-4-yl)ethyl]-5-oxo-1,2,4-triazol-4-yl]phenyl]propanoate;hydrochloride Chemical compound Cl.C1=CC(CCC(=O)OC)=CC=C1N1C(=O)N(CCC2CCN(C)CC2)N=C1C OOFYAFXBAQSSIO-UHFFFAOYSA-N 0.000 description 1
- JIHXNTCNDHKRJW-UHFFFAOYSA-N methyl 3-[4-[3-methyl-5-oxo-1-(2-oxo-2-piperazin-1-ylethyl)-1,2,4-triazol-4-yl]phenyl]propanoate;hydrochloride Chemical compound Cl.C1=CC(CCC(=O)OC)=CC=C1N1C(=O)N(CC(=O)N2CCNCC2)N=C1C JIHXNTCNDHKRJW-UHFFFAOYSA-N 0.000 description 1
- HEROOVBHOBCWAC-UHFFFAOYSA-N methyl 3-[4-[[(4-cyanophenyl)-[(2,2,2-trifluoroacetyl)amino]carbamoyl]amino]phenyl]propanoate Chemical compound C1=CC(CCC(=O)OC)=CC=C1NC(=O)N(NC(=O)C(F)(F)F)C1=CC=C(C#N)C=C1 HEROOVBHOBCWAC-UHFFFAOYSA-N 0.000 description 1
- IUHIGWWVQZTCCR-UHFFFAOYSA-N methyl 3-[4-[[benzamido-(4-cyanophenyl)carbamoyl]amino]phenyl]propanoate Chemical compound C1=CC(CCC(=O)OC)=CC=C1NC(=O)N(C=1C=CC(=CC=1)C#N)NC(=O)C1=CC=CC=C1 IUHIGWWVQZTCCR-UHFFFAOYSA-N 0.000 description 1
- FUFUQQWIXMPZFU-UHFFFAOYSA-N methyl 4-nitrophenylalaninate Chemical compound COC(=O)C(N)CC1=CC=C([N+]([O-])=O)C=C1 FUFUQQWIXMPZFU-UHFFFAOYSA-N 0.000 description 1
- HHTAHUXDCUXAKH-UHFFFAOYSA-N methyl 5-[4-[[(1-benzylpiperidin-4-yl)-(2-hydroxyethyl)carbamoyl]amino]phenyl]pentanoate Chemical compound C1=CC(CCCCC(=O)OC)=CC=C1NC(=O)N(CCO)C1CCN(CC=2C=CC=CC=2)CC1 HHTAHUXDCUXAKH-UHFFFAOYSA-N 0.000 description 1
- 230000011987 methylation Effects 0.000 description 1
- 238000007069 methylation reaction Methods 0.000 description 1
- 239000008108 microcrystalline cellulose Substances 0.000 description 1
- 229940016286 microcrystalline cellulose Drugs 0.000 description 1
- 235000019813 microcrystalline cellulose Nutrition 0.000 description 1
- 208000010125 myocardial infarction Diseases 0.000 description 1
- JGTMYSCLPBUTSC-UHFFFAOYSA-N n'-(4-cyanophenyl)acetohydrazide Chemical compound CC(=O)NNC1=CC=C(C#N)C=C1 JGTMYSCLPBUTSC-UHFFFAOYSA-N 0.000 description 1
- 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- GOQYKNQRPGWPLP-UHFFFAOYSA-N n-heptadecyl alcohol Natural products CCCCCCCCCCCCCCCCCO GOQYKNQRPGWPLP-UHFFFAOYSA-N 0.000 description 1
- 230000010807 negative regulation of binding Effects 0.000 description 1
- 125000002560 nitrile group Chemical group 0.000 description 1
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 description 1
- 150000002905 orthoesters Chemical class 0.000 description 1
- KJIFKLIQANRMOU-UHFFFAOYSA-N oxidanium;4-methylbenzenesulfonate Chemical compound O.CC1=CC=C(S(O)(=O)=O)C=C1 KJIFKLIQANRMOU-UHFFFAOYSA-N 0.000 description 1
- 150000002923 oximes Chemical class 0.000 description 1
- LXNAVEXFUKBNMK-UHFFFAOYSA-N palladium(II) acetate Substances [Pd].CC(O)=O.CC(O)=O LXNAVEXFUKBNMK-UHFFFAOYSA-N 0.000 description 1
- YJVFFLUZDVXJQI-UHFFFAOYSA-L palladium(ii) acetate Chemical compound [Pd+2].CC([O-])=O.CC([O-])=O YJVFFLUZDVXJQI-UHFFFAOYSA-L 0.000 description 1
- 230000000144 pharmacologic effect Effects 0.000 description 1
- 239000002571 phosphodiesterase inhibitor Substances 0.000 description 1
- 229960004838 phosphoric acid Drugs 0.000 description 1
- FAIAAWCVCHQXDN-UHFFFAOYSA-N phosphorus trichloride Chemical compound ClP(Cl)Cl FAIAAWCVCHQXDN-UHFFFAOYSA-N 0.000 description 1
- 125000001557 phthalyl group Chemical group C(=O)(O)C1=C(C(=O)*)C=CC=C1 0.000 description 1
- 239000002504 physiological saline solution Substances 0.000 description 1
- 125000003386 piperidinyl group Chemical group 0.000 description 1
- 229920001223 polyethylene glycol Polymers 0.000 description 1
- NNFCIKHAZHQZJG-UHFFFAOYSA-N potassium cyanide Chemical compound [K+].N#[C-] NNFCIKHAZHQZJG-UHFFFAOYSA-N 0.000 description 1
- 239000011698 potassium fluoride Substances 0.000 description 1
- 235000003270 potassium fluoride Nutrition 0.000 description 1
- 150000003141 primary amines Chemical class 0.000 description 1
- IVQUTOVREZLTTB-UHFFFAOYSA-N propan-2-yl 3-[4-[1-(4-carbamimidoylphenyl)-3-methyl-5-oxo-1,2,4-triazol-4-yl]phenyl]propanoate Chemical compound C1=CC(CCC(=O)OC(C)C)=CC=C1N1C(=O)N(C=2C=CC(=CC=2)C(N)=N)N=C1C IVQUTOVREZLTTB-UHFFFAOYSA-N 0.000 description 1
- LACRDHODFHLVAI-UHFFFAOYSA-N propan-2-yl 3-[4-[1-(4-carbamimidoylphenyl)-5-oxo-3-(trifluoromethyl)-1,2,4-triazol-4-yl]phenyl]propanoate;hydrochloride Chemical compound Cl.C1=CC(CCC(=O)OC(C)C)=CC=C1N1C(=O)N(C=2C=CC(=CC=2)C(N)=N)N=C1C(F)(F)F LACRDHODFHLVAI-UHFFFAOYSA-N 0.000 description 1
- JBEGWQLNOMGIMF-UHFFFAOYSA-N propan-2-yl 3-[4-[3-(4-carbamimidoylphenyl)-2-oxoimidazolidin-1-yl]phenyl]propanoate;hydrochloride Chemical compound Cl.C1=CC(CCC(=O)OC(C)C)=CC=C1N1C(=O)N(C=2C=CC(=CC=2)C(N)=N)CC1 JBEGWQLNOMGIMF-UHFFFAOYSA-N 0.000 description 1
- LPFXHRXAASUGID-UHFFFAOYSA-N propan-2-yl 3-[4-[3-(4-carbamimidoylphenyl)-5-methyl-2-oxoimidazol-1-yl]phenyl]propanoate Chemical compound C1=CC(CCC(=O)OC(C)C)=CC=C1N1C(=O)N(C=2C=CC(=CC=2)C(N)=N)C=C1C LPFXHRXAASUGID-UHFFFAOYSA-N 0.000 description 1
- PRCGLFMQCCSACE-UHFFFAOYSA-N propan-2-yl 3-[4-[3-[4-[(e)-n'-(1-acetyloxyethoxycarbonyl)carbamimidoyl]phenyl]-2-oxoimidazolidin-1-yl]phenyl]propanoate Chemical compound C1=CC(CCC(=O)OC(C)C)=CC=C1N1C(=O)N(C=2C=CC(=CC=2)C(=N)NC(=O)OC(C)OC(C)=O)CC1 PRCGLFMQCCSACE-UHFFFAOYSA-N 0.000 description 1
- 229960005335 propanol Drugs 0.000 description 1
- 229960000856 protein c Drugs 0.000 description 1
- 238000000746 purification Methods 0.000 description 1
- 239000002464 receptor antagonist Substances 0.000 description 1
- 229940044551 receptor antagonist Drugs 0.000 description 1
- 238000001953 recrystallisation Methods 0.000 description 1
- 238000005932 reductive alkylation reaction Methods 0.000 description 1
- 229910052703 rhodium Inorganic materials 0.000 description 1
- 239000010948 rhodium Substances 0.000 description 1
- BALRIWPTGHDDFF-UHFFFAOYSA-N rhodium Chemical compound [Rh].[Rh] BALRIWPTGHDDFF-UHFFFAOYSA-N 0.000 description 1
- 239000011833 salt mixture Substances 0.000 description 1
- 108010073863 saruplase Proteins 0.000 description 1
- 238000003345 scintillation counting Methods 0.000 description 1
- DCKVNWZUADLDEH-UHFFFAOYSA-N sec-butyl acetate Chemical compound CCC(C)OC(C)=O DCKVNWZUADLDEH-UHFFFAOYSA-N 0.000 description 1
- 230000035939 shock Effects 0.000 description 1
- 229910001923 silver oxide Inorganic materials 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- NLJMYIDDQXHKNR-UHFFFAOYSA-K sodium citrate Chemical compound O.O.[Na+].[Na+].[Na+].[O-]C(=O)CC(O)(CC([O-])=O)C([O-])=O NLJMYIDDQXHKNR-UHFFFAOYSA-K 0.000 description 1
- 235000010288 sodium nitrite Nutrition 0.000 description 1
- 239000011877 solvent mixture Substances 0.000 description 1
- 239000000600 sorbitol Substances 0.000 description 1
- 239000007921 spray Substances 0.000 description 1
- 229960005202 streptokinase Drugs 0.000 description 1
- 239000005720 sucrose Substances 0.000 description 1
- 230000006103 sulfonylation Effects 0.000 description 1
- 238000005694 sulfonylation reaction Methods 0.000 description 1
- 229940032330 sulfuric acid Drugs 0.000 description 1
- FZUJWWOKDIGOKH-UHFFFAOYSA-N sulfuric acid hydrochloride Chemical compound Cl.OS(O)(=O)=O FZUJWWOKDIGOKH-UHFFFAOYSA-N 0.000 description 1
- 239000000829 suppository Substances 0.000 description 1
- 238000003786 synthesis reaction Methods 0.000 description 1
- YBNJZIDYXCGAPX-UHFFFAOYSA-N tert-butyl 4-(2-hydroxyethyl)piperidine-1-carboxylate Chemical compound CC(C)(C)OC(=O)N1CCC(CCO)CC1 YBNJZIDYXCGAPX-UHFFFAOYSA-N 0.000 description 1
- WSNYPQZNUKSYBI-UHFFFAOYSA-N tert-butyl 4-(2-methylsulfonyloxyethyl)piperidine-1-carboxylate Chemical compound CC(C)(C)OC(=O)N1CCC(CCOS(C)(=O)=O)CC1 WSNYPQZNUKSYBI-UHFFFAOYSA-N 0.000 description 1
- OMXYMAUTALTRFZ-UHFFFAOYSA-N tert-butyl 4-[2-[4-[4-(2-methoxycarbonylpentyl)phenyl]-3-methyl-5-oxo-1,2,4-triazol-1-yl]ethyl]piperidine-1-carboxylate Chemical compound C1=CC(CC(CCC)C(=O)OC)=CC=C1N1C(=O)N(CCC2CCN(CC2)C(=O)OC(C)(C)C)N=C1C OMXYMAUTALTRFZ-UHFFFAOYSA-N 0.000 description 1
- 150000003509 tertiary alcohols Chemical class 0.000 description 1
- 238000002560 therapeutic procedure Methods 0.000 description 1
- 150000007970 thio esters Chemical class 0.000 description 1
- 230000002537 thrombolytic effect Effects 0.000 description 1
- RZWIIPASKMUIAC-VQTJNVASSA-N thromboxane Chemical compound CCCCCCCC[C@H]1OCCC[C@@H]1CCCCCCC RZWIIPASKMUIAC-VQTJNVASSA-N 0.000 description 1
- CFOAUYCPAUGDFF-UHFFFAOYSA-N tosmic Chemical compound CC1=CC=C(S(=O)(=O)C[N+]#[C-])C=C1 CFOAUYCPAUGDFF-UHFFFAOYSA-N 0.000 description 1
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 1
- 238000012546 transfer Methods 0.000 description 1
- 239000005051 trimethylchlorosilane Substances 0.000 description 1
- JBWKIWSBJXDJDT-UHFFFAOYSA-N triphenylmethyl chloride Chemical compound C=1C=CC=CC=1C(C=1C=CC=CC=1)(Cl)C1=CC=CC=C1 JBWKIWSBJXDJDT-UHFFFAOYSA-N 0.000 description 1
- HRXKRNGNAMMEHJ-UHFFFAOYSA-K trisodium citrate Chemical compound [Na+].[Na+].[Na+].[O-]C(=O)CC(O)(CC([O-])=O)C([O-])=O HRXKRNGNAMMEHJ-UHFFFAOYSA-K 0.000 description 1
- 229940038773 trisodium citrate Drugs 0.000 description 1
- 125000002221 trityl group Chemical group [H]C1=C([H])C([H])=C([H])C([H])=C1C([*])(C1=C(C(=C(C(=C1[H])[H])[H])[H])[H])C1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 description 1
- 238000005866 tritylation reaction Methods 0.000 description 1
- 229960005356 urokinase Drugs 0.000 description 1
- 210000003462 vein Anatomy 0.000 description 1
- PXXNTAGJWPJAGM-UHFFFAOYSA-N vertaline Natural products C1C2C=3C=C(OC)C(OC)=CC=3OC(C=C3)=CC=C3CCC(=O)OC1CC1N2CCCC1 PXXNTAGJWPJAGM-UHFFFAOYSA-N 0.000 description 1
- 229940019333 vitamin k antagonists Drugs 0.000 description 1
- 238000010626 work up procedure Methods 0.000 description 1
- 239000008096 xylene Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D401/00—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom
- C07D401/02—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom containing two hetero rings
- C07D401/04—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom containing two hetero rings directly linked by a ring-member-to-ring-member bond
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D233/00—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings
- C07D233/04—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings having one double bond between ring members or between a ring member and a non-ring member
- C07D233/28—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings having one double bond between ring members or between a ring member and a non-ring member with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D233/30—Oxygen or sulfur atoms
- C07D233/32—One oxygen atom
- C07D233/36—One oxygen atom with hydrocarbon radicals, substituted by nitrogen atoms, attached to ring nitrogen atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D233/00—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings
- C07D233/04—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings having one double bond between ring members or between a ring member and a non-ring member
- C07D233/28—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings having one double bond between ring members or between a ring member and a non-ring member with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D233/44—Nitrogen atoms not forming part of a nitro radical
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D233/00—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings
- C07D233/54—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings having two double bonds between ring members or between ring members and non-ring members
- C07D233/66—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings having two double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D233/70—One oxygen atom
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D233/00—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings
- C07D233/54—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings having two double bonds between ring members or between ring members and non-ring members
- C07D233/66—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings having two double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D233/72—Two oxygen atoms, e.g. hydantoin
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D235/00—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, condensed with other rings
- C07D235/02—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, condensed with other rings condensed with carbocyclic rings or ring systems
- C07D235/04—Benzimidazoles; Hydrogenated benzimidazoles
- C07D235/24—Benzimidazoles; Hydrogenated benzimidazoles with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached in position 2
- C07D235/26—Oxygen atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D239/00—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings
- C07D239/02—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings not condensed with other rings
- C07D239/06—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings not condensed with other rings having one double bond between ring members or between a ring member and a non-ring member
- C07D239/08—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings not condensed with other rings having one double bond between ring members or between a ring member and a non-ring member with hetero atoms directly attached in position 2
- C07D239/10—Oxygen or sulfur atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D249/00—Heterocyclic compounds containing five-membered rings having three nitrogen atoms as the only ring hetero atoms
- C07D249/02—Heterocyclic compounds containing five-membered rings having three nitrogen atoms as the only ring hetero atoms not condensed with other rings
- C07D249/08—1,2,4-Triazoles; Hydrogenated 1,2,4-triazoles
- C07D249/10—1,2,4-Triazoles; Hydrogenated 1,2,4-triazoles with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D249/12—Oxygen or sulfur atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D401/00—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom
- C07D401/02—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom containing two hetero rings
- C07D401/06—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom containing two hetero rings linked by a carbon chain containing only aliphatic carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D401/00—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom
- C07D401/02—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom containing two hetero rings
- C07D401/10—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom containing two hetero rings linked by a carbon chain containing aromatic rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D417/00—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and sulfur atoms as the only ring hetero atoms, not provided for by group C07D415/00
- C07D417/02—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and sulfur atoms as the only ring hetero atoms, not provided for by group C07D415/00 containing two hetero rings
- C07D417/06—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and sulfur atoms as the only ring hetero atoms, not provided for by group C07D415/00 containing two hetero rings linked by a carbon chain containing only aliphatic carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D453/00—Heterocyclic compounds containing quinuclidine or iso-quinuclidine ring systems, e.g. quinine alkaloids
- C07D453/02—Heterocyclic compounds containing quinuclidine or iso-quinuclidine ring systems, e.g. quinine alkaloids containing not further condensed quinuclidine ring systems
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
Priority Applications (23)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE4230470A DE4230470A1 (de) | 1992-09-11 | 1992-09-11 | Cyclische Harnstoffderivate, diese Verbindungen enthaltende Arzneimittel und Verfahren zu ihrer Herstellung |
| DE19934302052 DE4302052A1 (de) | 1992-09-11 | 1993-01-26 | Cyclische Harnstoffderivate, diese Verbindungen enthaltende Arzneimittel und Verfahren zu ihrer Herstellung |
| DE19934309213 DE4309213A1 (de) | 1992-09-11 | 1993-03-22 | Cyclische Harnstoffderivate, diese Verbindungen enthaltende Arzneimittel und Verfahren zu ihrer Herstellung |
| SK943-93A SK94393A3 (en) | 1992-09-11 | 1993-09-06 | Cyclic derivatives of urea, process for their production and their pharmaceutical agents with the content of those |
| EP19930114401 EP0587134A3 (en) | 1992-09-11 | 1993-09-08 | Cyclic urea derivatives, medicaments containing them and process for their preparation |
| TW082107365A TW239135B (enExample) | 1992-09-11 | 1993-09-08 | |
| FI933942A FI933942A7 (fi) | 1992-09-11 | 1993-09-09 | Sykliset ureajohdokset, näitä yhdisteitä sisältävät lääkeaineet ja menetelmä niiden valmistamiseksi |
| IL106955A IL106955A0 (en) | 1992-09-11 | 1993-09-09 | Cyclic urea derivatives |
| BG98103A BG98103A (bg) | 1992-09-11 | 1993-09-09 | Циклични карбамидни производни, лекарствени средства съдържащи тези съединения и метод за техното получаване |
| AU46249/93A AU4624993A (en) | 1992-09-11 | 1993-09-10 | Cyclic urea derivatives |
| US08/120,008 US5681841A (en) | 1992-09-11 | 1993-09-10 | Cyclic urea derivatives, pharmaceutical compositions containing these compounds and processes for preparing them |
| CA002105934A CA2105934A1 (en) | 1992-09-11 | 1993-09-10 | Cyclic urea derivatives |
| MX9305566A MX9305566A (es) | 1992-09-11 | 1993-09-10 | Derivados de urea ciclicos, medicamentos que contienen estos compuestos y procedimientos para su preparacion. |
| ZA936689A ZA936689B (en) | 1992-09-11 | 1993-09-10 | Cyclic urea derivatives, pharmaceutical compositions containing these compounds and processes for preparing them |
| PL93300347A PL300347A1 (en) | 1992-09-11 | 1993-09-10 | Cyclic urea derivatives, therapeutic agents containing them and method of obtaining sames |
| NO933248A NO933248L (no) | 1992-09-11 | 1993-09-10 | Cykliske urinstoffderivater, legemidler inneholdende disse forbindelser, og fremgangsmåte for deres fremstilling |
| CZ931881A CZ188193A3 (en) | 1992-09-11 | 1993-09-10 | Cyclic derivatives of urea, process of their preparation and pharmaceutical preparations in which they are comprised |
| HU9302577A HUT71496A (en) | 1992-09-11 | 1993-09-10 | Cyclic carbamide derivatives, pharmaceutical compositions containing them and process for preparing them |
| NZ248633A NZ248633A (en) | 1992-09-11 | 1993-09-10 | Substituted imidazole and triazole derivatives and pharmaceutical compositions |
| KR1019930018293A KR940007023A (ko) | 1992-09-11 | 1993-09-11 | 사이클릭 우레아 유도체, 이를 함유하는 약제학적 조성물 및 이의 제조방법 |
| CN 93114711 CN1092769A (zh) | 1992-09-11 | 1993-09-11 | 环脲衍生物,含有这些化合物的药物组合物以及制备它们的方法 |
| JP5226864A JPH06263740A (ja) | 1992-09-11 | 1993-09-13 | 環状尿素誘導体、これらの化合物を含む医薬組成物及びそれらの調製方法 |
| US08/864,528 US5880284A (en) | 1992-09-11 | 1997-05-28 | Cyclic urea derivatives, pharmaceutical compositions containing these compounds and processes for preparing them |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE4230470A DE4230470A1 (de) | 1992-09-11 | 1992-09-11 | Cyclische Harnstoffderivate, diese Verbindungen enthaltende Arzneimittel und Verfahren zu ihrer Herstellung |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE4230470A1 true DE4230470A1 (de) | 1994-04-14 |
Family
ID=6467761
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE4230470A Withdrawn DE4230470A1 (de) | 1992-09-11 | 1992-09-11 | Cyclische Harnstoffderivate, diese Verbindungen enthaltende Arzneimittel und Verfahren zu ihrer Herstellung |
Country Status (3)
| Country | Link |
|---|---|
| DE (1) | DE4230470A1 (enExample) |
| TW (1) | TW239135B (enExample) |
| ZA (1) | ZA936689B (enExample) |
-
1992
- 1992-09-11 DE DE4230470A patent/DE4230470A1/de not_active Withdrawn
-
1993
- 1993-09-08 TW TW082107365A patent/TW239135B/zh active
- 1993-09-10 ZA ZA936689A patent/ZA936689B/xx unknown
Also Published As
| Publication number | Publication date |
|---|---|
| ZA936689B (en) | 1995-03-10 |
| TW239135B (enExample) | 1995-01-21 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| EP0587134A2 (de) | Cyclische Harnstoffderivate, diese Verbindungen enthaltende Arzneimittel und Verfahren zu ihrer Herstellung | |
| EP0503548B1 (de) | Cyclische Harnstoffderivate, diese Verbindungen enthaltende Arzneimittel und Verfahren zu ihrer Herstellung | |
| DE69119089T2 (de) | N-substituierte imidazol-2-on-verbindungen zur behandlung von zirkulatorischen störungen | |
| EP0612741B1 (de) | Cyclische Derivate, diese Verbindungen enthaltende Arzneimittel und Verfahren zu ihrer Herstellung | |
| DE4302051A1 (de) | 5-gliedrige Heterocyclen, Verfahren zu ihrer Herstellung und diese Verbindungen enthaltende Arzneimittel | |
| EP1487821B1 (de) | Benzodiazepin-substituierte piperdine zur verwendung in der behandlung von cardiovaskulären erkrankungen | |
| EP1095025B1 (de) | Benzimidazole, deren herstellung und deren verwendung als arzneimittel | |
| WO2001032649A1 (de) | Arylalkane, arylalkene und aryl-azaalkane, diese verbindungen enthaltende arzneimittel und verfahren zu ihrer herstellung | |
| DE4429079A1 (de) | Cyclische Harnstoffderivate, diese Verbindungen enthaltende Arzneimittel und Verfahren zu ihrer Herstellung | |
| DE4031287A1 (de) | Benzimidazole, diese verbindungen enthaltende arzneimittel und verfahren zu ihrer herstellung | |
| DE4243858A1 (de) | Aminosäurederivate, diese Verbindungen enthaltende Arzneimittel und Verfahren zu ihrer Herstellung | |
| DE4304650A1 (de) | Kondensierte 5-gliedrige Heterocyclen, Verfahren zu ihrer Herstellung und diese Verbindungen enthaltende Arzneimittel | |
| WO1996004271A1 (de) | Kondensierte azepinderivate, diese verbindungen enthaltende arzneimittel und verfahren zu ihrer herstellung | |
| EP1176144B1 (de) | Neue N-Triazolylmethyl-Piperazinderivate als Neurokininrezeptor-Antagonisten | |
| EP1210335A1 (de) | Aminocarbonyl-substituierte benzimidazolderivate, verfahren zu ihrer herstellung und ihre verwendung als arzneimittel | |
| EP0639575A1 (de) | Bicyclische Heterocyclen, diese Verbindungen enthaltende Arzneimittel und Verfahren zu ihrer Herstellung | |
| EP1244636A1 (de) | Benzimidazole, deren herstellung und deren verwendung als antithrombotika | |
| DE69634183T2 (de) | Substituierte Heterocyclen | |
| DE19804085A1 (de) | 5-Gliedrige heterocyclische kondensierte Benzoderivate, deren Herstellung und deren Verwendung als Arzneimittel | |
| EP0824515B1 (de) | Substituierte phenylamidine, diese verbindungen enthaltende arzneimittel und verfahren zu ihrer herstellung | |
| DE19907813A1 (de) | Substituierte bicyclische Heterocyclen, deren Herstellung und deren Verwendung als Arzneimittel | |
| DE19539091A1 (de) | 5-gliedrige Heterocyclen, diese Verbindungen enthaltende Arzneimittel und deren Verwendung sowie Verfahren zur ihrer Herstellung | |
| DE4230470A1 (de) | Cyclische Harnstoffderivate, diese Verbindungen enthaltende Arzneimittel und Verfahren zu ihrer Herstellung | |
| DE4309213A1 (de) | Cyclische Harnstoffderivate, diese Verbindungen enthaltende Arzneimittel und Verfahren zu ihrer Herstellung | |
| WO1997048702A1 (de) | Benzazepinderivate, diese verbindungen enthaltende arzneimittel und verfahren zu ihrer herstellung |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| AG | Has addition no. |
Ref country code: DE Ref document number: 4302052 Format of ref document f/p: P |
|
| AG | Has addition no. |
Ref country code: DE Ref document number: 4309213 Format of ref document f/p: P |
|
| 8141 | Disposal/no request for examination |