DE4142978C1 - - Google Patents
Info
- Publication number
- DE4142978C1 DE4142978C1 DE4142978A DE4142978A DE4142978C1 DE 4142978 C1 DE4142978 C1 DE 4142978C1 DE 4142978 A DE4142978 A DE 4142978A DE 4142978 A DE4142978 A DE 4142978A DE 4142978 C1 DE4142978 C1 DE 4142978C1
- Authority
- DE
- Germany
- Prior art keywords
- atoms
- acid
- layer
- copolyamide
- composite according
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired - Fee Related
Links
- 239000010410 layer Substances 0.000 claims description 130
- 230000004888 barrier function Effects 0.000 claims description 65
- KKEYFWRCBNTPAC-UHFFFAOYSA-N Terephthalic acid Chemical compound OC(=O)C1=CC=C(C(O)=O)C=C1 KKEYFWRCBNTPAC-UHFFFAOYSA-N 0.000 claims description 61
- QQVIHTHCMHWDBS-UHFFFAOYSA-N isophthalic acid Chemical compound OC(=O)C1=CC=CC(C(O)=O)=C1 QQVIHTHCMHWDBS-UHFFFAOYSA-N 0.000 claims description 60
- 239000002131 composite material Substances 0.000 claims description 45
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 44
- NAQMVNRVTILPCV-UHFFFAOYSA-N hexane-1,6-diamine Chemical compound NCCCCCCN NAQMVNRVTILPCV-UHFFFAOYSA-N 0.000 claims description 42
- 238000004806 packaging method and process Methods 0.000 claims description 36
- 239000000203 mixture Substances 0.000 claims description 35
- -1 aliphatic diamine Chemical class 0.000 claims description 32
- OFOBLEOULBTSOW-UHFFFAOYSA-N Malonic acid Chemical compound OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 claims description 25
- 150000004985 diamines Chemical class 0.000 claims description 22
- 125000004429 atom Chemical group 0.000 claims description 20
- 229920000642 polymer Polymers 0.000 claims description 18
- 239000011241 protective layer Substances 0.000 claims description 17
- 125000001931 aliphatic group Chemical group 0.000 claims description 16
- 125000003118 aryl group Chemical group 0.000 claims description 15
- 238000009835 boiling Methods 0.000 claims description 14
- 150000003951 lactams Chemical class 0.000 claims description 12
- 229920000515 polycarbonate Polymers 0.000 claims description 11
- 239000004417 polycarbonate Substances 0.000 claims description 11
- JBKVHLHDHHXQEQ-UHFFFAOYSA-N epsilon-caprolactam Chemical compound O=C1CCCCCN1 JBKVHLHDHHXQEQ-UHFFFAOYSA-N 0.000 claims description 10
- WNLRTRBMVRJNCN-UHFFFAOYSA-N adipic acid Chemical compound OC(=O)CCCCC(O)=O WNLRTRBMVRJNCN-UHFFFAOYSA-N 0.000 claims description 8
- TVIDDXQYHWJXFK-UHFFFAOYSA-N dodecanedioic acid Chemical compound OC(=O)CCCCCCCCCCC(O)=O TVIDDXQYHWJXFK-UHFFFAOYSA-N 0.000 claims description 8
- 239000000178 monomer Substances 0.000 claims description 8
- 239000004793 Polystyrene Substances 0.000 claims description 6
- 230000001681 protective effect Effects 0.000 claims description 6
- IGSBHTZEJMPDSZ-UHFFFAOYSA-N 4-[(4-amino-3-methylcyclohexyl)methyl]-2-methylcyclohexan-1-amine Chemical compound C1CC(N)C(C)CC1CC1CC(C)C(N)CC1 IGSBHTZEJMPDSZ-UHFFFAOYSA-N 0.000 claims description 5
- 239000004372 Polyvinyl alcohol Substances 0.000 claims description 5
- 229920002451 polyvinyl alcohol Polymers 0.000 claims description 5
- SLXKOJJOQWFEFD-UHFFFAOYSA-N 6-aminohexanoic acid Chemical compound NCCCCCC(O)=O SLXKOJJOQWFEFD-UHFFFAOYSA-N 0.000 claims description 4
- JHWNWJKBPDFINM-UHFFFAOYSA-N Laurolactam Chemical compound O=C1CCCCCCCCCCCN1 JHWNWJKBPDFINM-UHFFFAOYSA-N 0.000 claims description 4
- 239000004698 Polyethylene Substances 0.000 claims description 4
- 239000001361 adipic acid Substances 0.000 claims description 4
- 235000011037 adipic acid Nutrition 0.000 claims description 4
- 150000001335 aliphatic alkanes Chemical class 0.000 claims description 4
- 235000014113 dietary fatty acids Nutrition 0.000 claims description 4
- JMLPVHXESHXUSV-UHFFFAOYSA-N dodecane-1,1-diamine Chemical compound CCCCCCCCCCCC(N)N JMLPVHXESHXUSV-UHFFFAOYSA-N 0.000 claims description 4
- 229930195729 fatty acid Natural products 0.000 claims description 4
- 239000000194 fatty acid Substances 0.000 claims description 4
- 150000004665 fatty acids Chemical class 0.000 claims description 4
- 238000004519 manufacturing process Methods 0.000 claims description 4
- 229920000573 polyethylene Polymers 0.000 claims description 4
- 239000004743 Polypropylene Substances 0.000 claims description 3
- 229920002239 polyacrylonitrile Polymers 0.000 claims description 3
- 229920000139 polyethylene terephthalate Polymers 0.000 claims description 3
- 239000005020 polyethylene terephthalate Substances 0.000 claims description 3
- 229920001155 polypropylene Polymers 0.000 claims description 3
- 229920002223 polystyrene Polymers 0.000 claims description 3
- 229920000915 polyvinyl chloride Polymers 0.000 claims description 3
- 239000004800 polyvinyl chloride Substances 0.000 claims description 3
- WTXXSZUATXIAJO-OWBHPGMISA-N (Z)-14-methylpentadec-2-enoic acid Chemical group CC(CCCCCCCCCC\C=C/C(=O)O)C WTXXSZUATXIAJO-OWBHPGMISA-N 0.000 claims description 2
- PBLZLIFKVPJDCO-UHFFFAOYSA-N 12-aminododecanoic acid Chemical compound NCCCCCCCCCCCC(O)=O PBLZLIFKVPJDCO-UHFFFAOYSA-N 0.000 claims description 2
- 239000002253 acid Substances 0.000 claims description 2
- 150000007513 acids Chemical class 0.000 claims description 2
- 238000000071 blow moulding Methods 0.000 claims description 2
- 125000004432 carbon atom Chemical group C* 0.000 claims description 2
- 229920002492 poly(sulfone) Polymers 0.000 claims description 2
- 229920001470 polyketone Polymers 0.000 claims description 2
- 229920001021 polysulfide Polymers 0.000 claims description 2
- 239000005077 polysulfide Substances 0.000 claims description 2
- 150000008117 polysulfides Polymers 0.000 claims description 2
- 229920002689 polyvinyl acetate Polymers 0.000 claims description 2
- 239000011118 polyvinyl acetate Substances 0.000 claims description 2
- 229920006024 semi-aromatic copolyamide Polymers 0.000 claims description 2
- FDLQZKYLHJJBHD-UHFFFAOYSA-N [3-(aminomethyl)phenyl]methanamine Chemical compound NCC1=CC=CC(CN)=C1 FDLQZKYLHJJBHD-UHFFFAOYSA-N 0.000 claims 2
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 10
- 239000001301 oxygen Substances 0.000 description 10
- 229910052760 oxygen Inorganic materials 0.000 description 10
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 description 8
- 239000004952 Polyamide Substances 0.000 description 8
- 235000013361 beverage Nutrition 0.000 description 8
- 238000004140 cleaning Methods 0.000 description 8
- 229920002647 polyamide Polymers 0.000 description 8
- 235000013305 food Nutrition 0.000 description 7
- 239000007789 gas Substances 0.000 description 5
- 230000009477 glass transition Effects 0.000 description 5
- 239000004677 Nylon Substances 0.000 description 4
- 238000010411 cooking Methods 0.000 description 4
- 229920001778 nylon Polymers 0.000 description 4
- 239000000956 alloy Substances 0.000 description 3
- 229910045601 alloy Inorganic materials 0.000 description 3
- 229910002092 carbon dioxide Inorganic materials 0.000 description 3
- UBAZGMLMVVQSCD-UHFFFAOYSA-N carbon dioxide;molecular oxygen Chemical compound O=O.O=C=O UBAZGMLMVVQSCD-UHFFFAOYSA-N 0.000 description 3
- 230000001143 conditioned effect Effects 0.000 description 3
- 239000003205 fragrance Substances 0.000 description 3
- 239000000463 material Substances 0.000 description 3
- 238000000034 method Methods 0.000 description 3
- 239000005022 packaging material Substances 0.000 description 3
- 239000002341 toxic gas Substances 0.000 description 3
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- 229920002292 Nylon 6 Polymers 0.000 description 2
- 229920006020 amorphous polyamide Polymers 0.000 description 2
- 235000019568 aromas Nutrition 0.000 description 2
- IISBACLAFKSPIT-UHFFFAOYSA-N bisphenol A Chemical compound C=1C=C(O)C=CC=1C(C)(C)C1=CC=C(O)C=C1 IISBACLAFKSPIT-UHFFFAOYSA-N 0.000 description 2
- 239000003795 chemical substances by application Substances 0.000 description 2
- 230000000694 effects Effects 0.000 description 2
- 230000007613 environmental effect Effects 0.000 description 2
- 239000011521 glass Substances 0.000 description 2
- 229930195733 hydrocarbon Natural products 0.000 description 2
- 150000002430 hydrocarbons Chemical class 0.000 description 2
- 231100000252 nontoxic Toxicity 0.000 description 2
- 230000003000 nontoxic effect Effects 0.000 description 2
- 230000035699 permeability Effects 0.000 description 2
- 239000000825 pharmaceutical preparation Substances 0.000 description 2
- 229940127557 pharmaceutical product Drugs 0.000 description 2
- XNGIFLGASWRNHJ-UHFFFAOYSA-N phthalic acid Chemical compound OC(=O)C1=CC=CC=C1C(O)=O XNGIFLGASWRNHJ-UHFFFAOYSA-N 0.000 description 2
- 229920003023 plastic Polymers 0.000 description 2
- 239000004033 plastic Substances 0.000 description 2
- 230000008569 process Effects 0.000 description 2
- 231100000331 toxic Toxicity 0.000 description 2
- 230000002588 toxic effect Effects 0.000 description 2
- 239000002699 waste material Substances 0.000 description 2
- 125000004178 (C1-C4) alkyl group Chemical group 0.000 description 1
- FQLAJSQGBDYBAL-UHFFFAOYSA-N 3-(azepane-1-carbonyl)benzamide Chemical compound NC(=O)C1=CC=CC(C(=O)N2CCCCCC2)=C1 FQLAJSQGBDYBAL-UHFFFAOYSA-N 0.000 description 1
- NCXLAQKHYPYRPO-UHFFFAOYSA-N 3-(azepane-1-carbonyl)benzamide;benzene-1,4-dicarboxamide Chemical compound NC(=O)C1=CC=C(C(N)=O)C=C1.NC(=O)C1=CC=CC(C(=O)N2CCCCCC2)=C1 NCXLAQKHYPYRPO-UHFFFAOYSA-N 0.000 description 1
- PGGROMGHWHXWJL-UHFFFAOYSA-N 4-(azepane-1-carbonyl)benzamide Chemical compound C1=CC(C(=O)N)=CC=C1C(=O)N1CCCCCC1 PGGROMGHWHXWJL-UHFFFAOYSA-N 0.000 description 1
- 239000004215 Carbon black (E152) Substances 0.000 description 1
- 229920000298 Cellophane Polymers 0.000 description 1
- IMROMDMJAWUWLK-UHFFFAOYSA-N Ethenol Chemical compound OC=C IMROMDMJAWUWLK-UHFFFAOYSA-N 0.000 description 1
- 229920000219 Ethylene vinyl alcohol Polymers 0.000 description 1
- KRHYYFGTRYWZRS-UHFFFAOYSA-M Fluoride anion Chemical compound [F-] KRHYYFGTRYWZRS-UHFFFAOYSA-M 0.000 description 1
- 229920004142 LEXAN™ Polymers 0.000 description 1
- 239000004418 Lexan Substances 0.000 description 1
- 239000004687 Nylon copolymer Substances 0.000 description 1
- 239000005062 Polybutadiene Substances 0.000 description 1
- OXIKYYJDTWKERT-UHFFFAOYSA-N [4-(aminomethyl)cyclohexyl]methanamine Chemical compound NCC1CCC(CN)CC1 OXIKYYJDTWKERT-UHFFFAOYSA-N 0.000 description 1
- ISKQADXMHQSTHK-UHFFFAOYSA-N [4-(aminomethyl)phenyl]methanamine Chemical compound NCC1=CC=C(CN)C=C1 ISKQADXMHQSTHK-UHFFFAOYSA-N 0.000 description 1
- 125000003277 amino group Chemical group 0.000 description 1
- 230000008901 benefit Effects 0.000 description 1
- 230000002146 bilateral effect Effects 0.000 description 1
- 239000001569 carbon dioxide Substances 0.000 description 1
- 235000014171 carbonated beverage Nutrition 0.000 description 1
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 1
- 238000006243 chemical reaction Methods 0.000 description 1
- 150000001875 compounds Chemical class 0.000 description 1
- 229920001577 copolymer Polymers 0.000 description 1
- 230000006735 deficit Effects 0.000 description 1
- 150000001991 dicarboxylic acids Chemical class 0.000 description 1
- 238000010101 extrusion blow moulding Methods 0.000 description 1
- 235000015203 fruit juice Nutrition 0.000 description 1
- 238000003958 fumigation Methods 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 230000002209 hydrophobic effect Effects 0.000 description 1
- 229920001600 hydrophobic polymer Polymers 0.000 description 1
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 1
- 229920000554 ionomer Polymers 0.000 description 1
- 239000000155 melt Substances 0.000 description 1
- 238000002844 melting Methods 0.000 description 1
- 230000008018 melting Effects 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- 229910052757 nitrogen Inorganic materials 0.000 description 1
- 229920006112 polar polymer Polymers 0.000 description 1
- 229920000058 polyacrylate Polymers 0.000 description 1
- 229920002857 polybutadiene Polymers 0.000 description 1
- 238000006068 polycondensation reaction Methods 0.000 description 1
- 229920000728 polyester Polymers 0.000 description 1
- 229920000098 polyolefin Polymers 0.000 description 1
- 229920002620 polyvinyl fluoride Polymers 0.000 description 1
- 238000003860 storage Methods 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
Classifications
-
- B—PERFORMING OPERATIONS; TRANSPORTING
- B32—LAYERED PRODUCTS
- B32B—LAYERED PRODUCTS, i.e. PRODUCTS BUILT-UP OF STRATA OF FLAT OR NON-FLAT, e.g. CELLULAR OR HONEYCOMB, FORM
- B32B27/00—Layered products comprising a layer of synthetic resin
- B32B27/34—Layered products comprising a layer of synthetic resin comprising polyamides
-
- Y—GENERAL TAGGING OF NEW TECHNOLOGICAL DEVELOPMENTS; GENERAL TAGGING OF CROSS-SECTIONAL TECHNOLOGIES SPANNING OVER SEVERAL SECTIONS OF THE IPC; TECHNICAL SUBJECTS COVERED BY FORMER USPC CROSS-REFERENCE ART COLLECTIONS [XRACs] AND DIGESTS
- Y10—TECHNICAL SUBJECTS COVERED BY FORMER USPC
- Y10T—TECHNICAL SUBJECTS COVERED BY FORMER US CLASSIFICATION
- Y10T428/00—Stock material or miscellaneous articles
- Y10T428/31504—Composite [nonstructural laminate]
- Y10T428/31725—Of polyamide
-
- Y—GENERAL TAGGING OF NEW TECHNOLOGICAL DEVELOPMENTS; GENERAL TAGGING OF CROSS-SECTIONAL TECHNOLOGIES SPANNING OVER SEVERAL SECTIONS OF THE IPC; TECHNICAL SUBJECTS COVERED BY FORMER USPC CROSS-REFERENCE ART COLLECTIONS [XRACs] AND DIGESTS
- Y10—TECHNICAL SUBJECTS COVERED BY FORMER USPC
- Y10T—TECHNICAL SUBJECTS COVERED BY FORMER US CLASSIFICATION
- Y10T428/00—Stock material or miscellaneous articles
- Y10T428/31504—Composite [nonstructural laminate]
- Y10T428/31725—Of polyamide
- Y10T428/31739—Nylon type
Landscapes
- Laminated Bodies (AREA)
- Polyamides (AREA)
- Sealing Material Composition (AREA)
- Compositions Of Macromolecular Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| CH3172/91A CH684747A5 (de) | 1991-10-31 | 1991-10-31 | Mehrschicht-Verbund. |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE4142978C1 true DE4142978C1 (enExample) | 1992-12-03 |
Family
ID=4250181
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE4142978A Expired - Fee Related DE4142978C1 (enExample) | 1991-10-31 | 1991-12-24 |
Country Status (5)
| Country | Link |
|---|---|
| US (1) | US5418068A (enExample) |
| EP (1) | EP0539894A1 (enExample) |
| JP (1) | JPH06220424A (enExample) |
| CH (1) | CH684747A5 (enExample) |
| DE (1) | DE4142978C1 (enExample) |
Cited By (10)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| EP0580360A1 (en) * | 1992-07-20 | 1994-01-26 | General Electric Company | Multilayer container |
| EP0581495A1 (en) * | 1992-07-20 | 1994-02-02 | General Electric Company | Multilayer containers |
| US5439718A (en) * | 1993-07-21 | 1995-08-08 | General Electric Company | Multilayer container of polycarbonate and amorphous polyamide of improved barrier and stress crack resistant properties |
| WO1997029910A1 (en) * | 1996-02-20 | 1997-08-21 | E.I. Du Pont De Nemours And Company | See-through food packaging structures having a polyamide food contact-layer to remove compounds causing food discoloration |
| DE19530952C2 (de) * | 1995-08-23 | 2000-06-29 | Wolff Walsrode Ag | Sterilisationsfeste, tiefziehbare, siegelbare Semi-rigid-Folie |
| WO2014198759A1 (de) | 2013-06-12 | 2014-12-18 | Basf Se | Verfahren zur kontinuierlichen herstellung eines aliphatischen oder teilaromatischen polyamids |
| WO2014198755A1 (de) | 2013-06-12 | 2014-12-18 | Basf Se | Verfahren zur kontinuierlichen herstellung eines aliphatischen oder teilaromatischen polyamid-oligomers |
| WO2014198764A1 (de) | 2013-06-12 | 2014-12-18 | Basf Se | Verfahren zur herstellung teilaromatischer copolyamide mit hohem diaminüberschuss |
| WO2014198757A1 (de) | 2013-06-12 | 2014-12-18 | Basf Se | Verfahren zur kontinuierlichen herstellung von polyamid-oligomeren und zur herstellung von teilkristallinen oder amorphen, thermoplastisch verarbeitbaren polyamiden |
| WO2014198770A1 (de) | 2013-06-12 | 2014-12-18 | Basf Se | Verfahren zur herstellung aliphatischer oder teilaromatischer polyamide umfassend eine festphasenpolymerisation |
Families Citing this family (21)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US7008890B1 (en) * | 1995-04-19 | 2006-03-07 | Fraunhofer-Gesellschaft Zur Forderung Der Angewandten Forschung E.V. | Vapor barrier for use in the thermal insulation of buildings |
| US5763095A (en) * | 1995-11-29 | 1998-06-09 | W. R. Grace & Co.-Conn. | Breathable film for cheese packaging |
| US5849380A (en) * | 1995-12-27 | 1998-12-15 | Mitsubishi Gas Chemical Company, Inc. | Deoxidizing multi-layer material and packaging container using same |
| CA2262799C (en) * | 1996-08-16 | 2006-01-10 | Cryovac, Inc. | Article comprising film having polyamide sealant, polyamide core layer, and o2-barrier layer, and packaged product using same |
| AUPP654598A0 (en) | 1998-10-16 | 1998-11-05 | Silverbrook Research Pty Ltd | Micromechanical device and method (ij46h) |
| AUPP653998A0 (en) | 1998-10-16 | 1998-11-05 | Silverbrook Research Pty Ltd | Micromechanical device and method (ij46B) |
| DE19757606C2 (de) * | 1997-12-23 | 2001-05-10 | Inventa Ag | Thermoplastische Mehrschichtverbunde |
| US7388048B2 (en) * | 2003-08-05 | 2008-06-17 | Arkema France | Flexible semiaromatic polyamides with a low moisture uptake |
| JP4710219B2 (ja) * | 2003-09-17 | 2011-06-29 | 宇部興産株式会社 | ポリアミド多層フィルム |
| US20070015424A1 (en) * | 2005-07-15 | 2007-01-18 | Certainteed Corporation | Building material having adaptive vapor retarder |
| WO2007087896A1 (de) * | 2006-01-31 | 2007-08-09 | Ems-Chemie Ag | Polyamidformmasse und deren verwendung zur herstellung von transparenten,heissdampfsterilisierbaren formteilen und extrudaten |
| AU2007222453A1 (en) * | 2006-03-08 | 2007-09-13 | Basf Se | Partially aromatic copolyamides with a high crystallinity |
| FI20060701L (fi) * | 2006-07-27 | 2008-01-28 | Stora Enso Oyj | Polymeeripinnoitteinen kuumasaumautuva pakkausmateriaali sekä siitä muodostettu suljettu tuotepakkaus |
| US20080236078A1 (en) * | 2007-03-30 | 2008-10-02 | Certainteed Corporation | Attic Insulation with Desiccant |
| US8820028B2 (en) | 2007-03-30 | 2014-09-02 | Certainteed Corporation | Attic and wall insulation with desiccant |
| FR2954773B1 (fr) * | 2009-12-24 | 2013-01-04 | Arkema France | Polyamide semi-aromatique, son procede de preparation, composition comprenant un tel polyamide et leurs utilisations |
| JP5867391B2 (ja) * | 2010-06-29 | 2016-02-24 | 三菱瓦斯化学株式会社 | ポリアミド化合物 |
| US9115498B2 (en) | 2012-03-30 | 2015-08-25 | Certainteed Corporation | Roofing composite including dessicant and method of thermal energy management of a roof by reversible sorption and desorption of moisture |
| CN110536919B (zh) | 2017-04-25 | 2022-05-24 | 艾德凡斯化学公司 | 基于己内酰胺的半芳族共聚酰胺 |
| CN109265678B (zh) * | 2018-09-19 | 2021-07-06 | 中仑塑业(福建)有限公司 | 一种聚酰胺树脂及其制备方法和成型品 |
| GB202000444D0 (en) | 2020-01-13 | 2020-02-26 | Gbuk Group Ltd | Tamper evident cap |
Citations (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4696865A (en) * | 1984-04-20 | 1987-09-29 | Monsanto Company | Hollow copolyamide article |
| EP0358038A1 (en) * | 1988-08-23 | 1990-03-14 | Viskase Corporation | Amorphous nylon copolymer and copolyamide films and blends |
| US4937130A (en) * | 1989-01-18 | 1990-06-26 | General Electric Company | Polycarbonate container having internal layers of amorphous polyamide |
Family Cites Families (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2509791A1 (de) * | 1975-03-06 | 1976-09-16 | Basf Ag | Copolyamide und deren verwendung als schmelzkleber |
| DE2626931C3 (de) * | 1976-06-16 | 1979-04-05 | Basf Ag, 6700 Ludwigshafen | Copolyamide und ihre Verwendung zum Appretieren von Leder oder Lederaustauschmaterial |
| DE2753577A1 (de) * | 1977-12-01 | 1979-06-07 | Bayer Ag | Polyamide |
| US4908272A (en) * | 1987-04-27 | 1990-03-13 | Mitsubishi Gas Chemical Company, Inc. | Gas-barrier multilayered structure |
| US4826955A (en) * | 1988-01-21 | 1989-05-02 | Allied-Signal Inc. | Amorphous copolyamide article of manufacture with moisture-insensitive oxygen barrier properties |
| US4983719A (en) * | 1989-07-21 | 1991-01-08 | General Electric Company | Amorphous polyamide having excellent oxygen barrier properties from para-xylylene diamine, isophthalic acid and adipic acid |
-
1991
- 1991-10-31 CH CH3172/91A patent/CH684747A5/de not_active IP Right Cessation
- 1991-12-24 DE DE4142978A patent/DE4142978C1/de not_active Expired - Fee Related
-
1992
- 1992-10-24 EP EP92118248A patent/EP0539894A1/de not_active Withdrawn
- 1992-10-26 US US07/966,299 patent/US5418068A/en not_active Expired - Fee Related
- 1992-10-27 JP JP4288588A patent/JPH06220424A/ja active Pending
Patent Citations (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4696865A (en) * | 1984-04-20 | 1987-09-29 | Monsanto Company | Hollow copolyamide article |
| EP0358038A1 (en) * | 1988-08-23 | 1990-03-14 | Viskase Corporation | Amorphous nylon copolymer and copolyamide films and blends |
| US4937130A (en) * | 1989-01-18 | 1990-06-26 | General Electric Company | Polycarbonate container having internal layers of amorphous polyamide |
Cited By (15)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| EP0580360A1 (en) * | 1992-07-20 | 1994-01-26 | General Electric Company | Multilayer container |
| EP0581495A1 (en) * | 1992-07-20 | 1994-02-02 | General Electric Company | Multilayer containers |
| US5439718A (en) * | 1993-07-21 | 1995-08-08 | General Electric Company | Multilayer container of polycarbonate and amorphous polyamide of improved barrier and stress crack resistant properties |
| DE19530952C2 (de) * | 1995-08-23 | 2000-06-29 | Wolff Walsrode Ag | Sterilisationsfeste, tiefziehbare, siegelbare Semi-rigid-Folie |
| WO1997029910A1 (en) * | 1996-02-20 | 1997-08-21 | E.I. Du Pont De Nemours And Company | See-through food packaging structures having a polyamide food contact-layer to remove compounds causing food discoloration |
| US5897901A (en) * | 1996-02-20 | 1999-04-27 | E. I. Du Pont De Nemours And Company | Method for removing compounds causing discoloration in fruit/vegetables stored in see-through packaging structures |
| WO2014198759A1 (de) | 2013-06-12 | 2014-12-18 | Basf Se | Verfahren zur kontinuierlichen herstellung eines aliphatischen oder teilaromatischen polyamids |
| WO2014198755A1 (de) | 2013-06-12 | 2014-12-18 | Basf Se | Verfahren zur kontinuierlichen herstellung eines aliphatischen oder teilaromatischen polyamid-oligomers |
| WO2014198764A1 (de) | 2013-06-12 | 2014-12-18 | Basf Se | Verfahren zur herstellung teilaromatischer copolyamide mit hohem diaminüberschuss |
| WO2014198757A1 (de) | 2013-06-12 | 2014-12-18 | Basf Se | Verfahren zur kontinuierlichen herstellung von polyamid-oligomeren und zur herstellung von teilkristallinen oder amorphen, thermoplastisch verarbeitbaren polyamiden |
| WO2014198770A1 (de) | 2013-06-12 | 2014-12-18 | Basf Se | Verfahren zur herstellung aliphatischer oder teilaromatischer polyamide umfassend eine festphasenpolymerisation |
| US9708449B2 (en) | 2013-06-12 | 2017-07-18 | Basf Se | Method for the continuous production of an aliphatic or semi-aromatic polyamide oligomer |
| US9994678B2 (en) | 2013-06-12 | 2018-06-12 | Basf Se | Process for the continuous preparation of an aliphatic or partially aromatic polyamide |
| US10351671B2 (en) | 2013-06-12 | 2019-07-16 | Basf Se | Method for producing semi-aromatic copolyamides with a high diamine excess |
| US10676569B2 (en) | 2013-06-12 | 2020-06-09 | Basf Se | Method for continuously producing polyamide oligomers and producing semicrystalline or amorphous polyamides that can be thermoplastically processed |
Also Published As
| Publication number | Publication date |
|---|---|
| CH684747A5 (de) | 1994-12-15 |
| EP0539894A1 (de) | 1993-05-05 |
| JPH06220424A (ja) | 1994-08-09 |
| US5418068A (en) | 1995-05-23 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE4142978C1 (enExample) | ||
| DE3853578T2 (de) | Mehrschichtige Verpackungsmaterialien mit guten Gassperreigenschaften. | |
| EP0488779B1 (en) | Polyvinyl alcohol product and multi-layer product containing the same | |
| DE3884042T2 (de) | Mehrschichtige Gassperrstruktur. | |
| DE60123471T2 (de) | Mehrschichtverpackung mit barriereeigenschaften | |
| DE60314074T2 (de) | Gasundurchlässige Mehrschichtstruktur | |
| EP0879560B1 (de) | Mehrschichtige, biaxial verstreckte Nahrungsmittelhülle mit zwei Sauerstoff-Barriereschichten | |
| EP0682476B1 (de) | Fünfschichtige, biaxial verstreckte schlauchfolie zur verpackung und umhüllung von pastösen lebensmitteln | |
| DE69414265T2 (de) | Sterilisierbare polymerfilme | |
| DE69025000T2 (de) | Mehrschichtige Struktur | |
| DE60317282T2 (de) | Polyesterharzzusammensetzung | |
| DE69114640T3 (de) | Biaxial orientierte Verbundfolie. | |
| DE602005000305T2 (de) | Coextrudierte Verpackungsfilme enthaltend Polyamid- und Polyesterschichten | |
| EP1084962B1 (de) | Mehrschichtiger biaxial gereckter Hochbarriere-Kunststoffdarm | |
| EP0530539A1 (de) | Coextrudierte biaxial gereckte Schlauchfolie | |
| DE3050007A1 (en) | Multi-layered vessel and process for producing same | |
| EP1084620B1 (de) | Mehrschichtig coextrudierte biaxial gereckte Hochbarriere-Kunststoffhülle mit verminderter Haftung zum Füllgut sowie deren Verwendung als Nahrungsmittelhülle | |
| DE69419276T2 (de) | Biaxial-gestreckte Folie für Nahrungsverpackung | |
| DE69900824T2 (de) | Polyamid beschichtete Folie | |
| EP1299000B1 (de) | Polyamid-kunststoffdarm mit nanodispersen additiven sowie dessen verwendung als nahrungsmittelhülle | |
| DE4434899C2 (de) | Copolyamide und deren Verwendung | |
| DE69924672T2 (de) | Biaxial gestreckte Mehrschichtfolie | |
| DE68923309T2 (de) | Harzmischung und daraus hergestellte Formkörper. | |
| EP0658310B1 (de) | Mindestens 4-schichtig coextrudierte, biaxial verstreckte, transparente, schlauchförmige Wursthülle mit hoher Barrierewirkung gegenüber Wasserdampf-Sauerstoffpermeation und Lichtdurchlässigkeit | |
| DE4140350C2 (de) | Sperrschicht aus Copolyamid sowie deren Verwendung |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| D1 | Grant (no unexamined application published) patent law 81 | ||
| 8364 | No opposition during term of opposition | ||
| 8328 | Change in the person/name/address of the agent |
Free format text: BECKER, E., DR.RER.NAT., PAT.-ANW., 81479 MUENCHEN |
|
| 8339 | Ceased/non-payment of the annual fee |