DE3873260T2 - Verfahren zur herstellung von substituierten isothiazolonen. - Google Patents
Verfahren zur herstellung von substituierten isothiazolonen.Info
- Publication number
- DE3873260T2 DE3873260T2 DE8888310054T DE3873260T DE3873260T2 DE 3873260 T2 DE3873260 T2 DE 3873260T2 DE 8888310054 T DE8888310054 T DE 8888310054T DE 3873260 T DE3873260 T DE 3873260T DE 3873260 T2 DE3873260 T2 DE 3873260T2
- Authority
- DE
- Germany
- Prior art keywords
- halogen
- process according
- reaction
- carbon atoms
- sulfur
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired - Fee Related
Links
- 238000004519 manufacturing process Methods 0.000 title claims 2
- 150000001408 amides Chemical class 0.000 claims abstract description 6
- -1 carbalkoxy Chemical group 0.000 claims description 30
- 238000006243 chemical reaction Methods 0.000 claims description 28
- PXJJSXABGXMUSU-UHFFFAOYSA-N disulfur dichloride Chemical compound ClSSCl PXJJSXABGXMUSU-UHFFFAOYSA-N 0.000 claims description 17
- 229910052736 halogen Chemical group 0.000 claims description 15
- 150000002367 halogens Chemical group 0.000 claims description 15
- 238000000034 method Methods 0.000 claims description 13
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 claims description 12
- FWMUJAIKEJWSSY-UHFFFAOYSA-N sulfur dichloride Chemical compound ClSCl FWMUJAIKEJWSSY-UHFFFAOYSA-N 0.000 claims description 11
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical group C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 claims description 10
- 125000004432 carbon atom Chemical group C* 0.000 claims description 9
- 125000000217 alkyl group Chemical group 0.000 claims description 8
- 125000003118 aryl group Chemical group 0.000 claims description 6
- 239000001257 hydrogen Substances 0.000 claims description 6
- 229910052739 hydrogen Inorganic materials 0.000 claims description 6
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 6
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims description 6
- 125000003545 alkoxy group Chemical group 0.000 claims description 5
- 125000003710 aryl alkyl group Chemical group 0.000 claims description 5
- 125000004093 cyano group Chemical group *C#N 0.000 claims description 5
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 claims description 5
- 125000005843 halogen group Chemical group 0.000 claims description 4
- 150000007530 organic bases Chemical class 0.000 claims description 4
- 230000035484 reaction time Effects 0.000 claims description 4
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 3
- 125000003342 alkenyl group Chemical group 0.000 claims description 3
- 125000003282 alkyl amino group Chemical group 0.000 claims description 3
- 125000000304 alkynyl group Chemical group 0.000 claims description 3
- HRPVXLWXLXDGHG-UHFFFAOYSA-N Acrylamide Chemical compound NC(=O)C=C HRPVXLWXLXDGHG-UHFFFAOYSA-N 0.000 claims description 2
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical group [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 2
- 125000004414 alkyl thio group Chemical group 0.000 claims description 2
- 125000004397 aminosulfonyl group Chemical group NS(=O)(=O)* 0.000 claims description 2
- 125000005110 aryl thio group Chemical group 0.000 claims description 2
- 125000004104 aryloxy group Chemical group 0.000 claims description 2
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 claims description 2
- 239000000460 chlorine Chemical group 0.000 claims description 2
- 229910052801 chlorine Chemical group 0.000 claims description 2
- 125000000753 cycloalkyl group Chemical group 0.000 claims description 2
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 claims description 2
- 125000004663 dialkyl amino group Chemical group 0.000 claims description 2
- 125000004438 haloalkoxy group Chemical group 0.000 claims description 2
- 125000004178 (C1-C4) alkyl group Chemical group 0.000 claims 2
- 125000000229 (C1-C4)alkoxy group Chemical group 0.000 claims 2
- 125000004209 (C1-C8) alkyl group Chemical group 0.000 claims 1
- 229910018105 SCl2 Inorganic materials 0.000 claims 1
- 101001135436 Urodacus yaschenkoi Antimicrobial peptide scorpine-like-2 Proteins 0.000 claims 1
- 125000004356 hydroxy functional group Chemical group O* 0.000 claims 1
- 125000002112 pyrrolidino group Chemical group [*]N1C([H])([H])C([H])([H])C([H])([H])C1([H])[H] 0.000 claims 1
- JLHMJWHSBYZWJJ-UHFFFAOYSA-N 1,2-thiazole 1-oxide Chemical class O=S1C=CC=N1 JLHMJWHSBYZWJJ-UHFFFAOYSA-N 0.000 abstract description 8
- 239000003139 biocide Substances 0.000 abstract description 2
- 230000015572 biosynthetic process Effects 0.000 abstract description 2
- 125000001475 halogen functional group Chemical group 0.000 abstract description 2
- 238000003786 synthesis reaction Methods 0.000 abstract description 2
- MVPPADPHJFYWMZ-UHFFFAOYSA-N chlorobenzene Chemical compound ClC1=CC=CC=C1 MVPPADPHJFYWMZ-UHFFFAOYSA-N 0.000 description 20
- 239000002904 solvent Substances 0.000 description 8
- 238000002360 preparation method Methods 0.000 description 7
- 229910052717 sulfur Inorganic materials 0.000 description 6
- 239000011593 sulfur Substances 0.000 description 6
- MECLWNBJBBIOPX-UHFFFAOYSA-N 4,5-dichloro-2-cyclohexyl-3h-1,2-thiazole 1-oxide Chemical compound C1C(Cl)=C(Cl)S(=O)N1C1CCCCC1 MECLWNBJBBIOPX-UHFFFAOYSA-N 0.000 description 5
- 238000002474 experimental method Methods 0.000 description 4
- LFULEKSKNZEWOE-UHFFFAOYSA-N propanil Chemical compound CCC(=O)NC1=CC=C(Cl)C(Cl)=C1 LFULEKSKNZEWOE-UHFFFAOYSA-N 0.000 description 4
- 125000001424 substituent group Chemical group 0.000 description 4
- AGAGGPXEBMVPEP-UHFFFAOYSA-N 2,3-dichloro-n-cyclohexylpropanamide Chemical compound ClCC(Cl)C(=O)NC1CCCCC1 AGAGGPXEBMVPEP-UHFFFAOYSA-N 0.000 description 3
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 3
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 3
- 150000003926 acrylamides Chemical class 0.000 description 3
- 239000003153 chemical reaction reagent Substances 0.000 description 3
- 150000001875 compounds Chemical class 0.000 description 3
- 239000000203 mixture Substances 0.000 description 3
- WDEHXKIYVJZXHY-UHFFFAOYSA-N 2-chloro-n-cyclohexylprop-2-enamide Chemical compound ClC(=C)C(=O)NC1CCCCC1 WDEHXKIYVJZXHY-UHFFFAOYSA-N 0.000 description 2
- WBRWSCUAIAHLIN-UHFFFAOYSA-N 4-chloro-2-cyclohexyl-3h-1,2-thiazole 1-oxide Chemical compound C1C(Cl)=CS(=O)N1C1CCCCC1 WBRWSCUAIAHLIN-UHFFFAOYSA-N 0.000 description 2
- NLHHRLWOUZZQLW-UHFFFAOYSA-N Acrylonitrile Chemical compound C=CC#N NLHHRLWOUZZQLW-UHFFFAOYSA-N 0.000 description 2
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 2
- 150000001412 amines Chemical class 0.000 description 2
- 238000004817 gas chromatography Methods 0.000 description 2
- 238000010438 heat treatment Methods 0.000 description 2
- 238000004128 high performance liquid chromatography Methods 0.000 description 2
- AWGZKFQMWZYCHF-UHFFFAOYSA-N n-octylprop-2-enamide Chemical compound CCCCCCCCNC(=O)C=C AWGZKFQMWZYCHF-UHFFFAOYSA-N 0.000 description 2
- 229910052757 nitrogen Inorganic materials 0.000 description 2
- 239000012044 organic layer Substances 0.000 description 2
- 239000000126 substance Substances 0.000 description 2
- 125000000547 substituted alkyl group Chemical group 0.000 description 2
- YBBRCQOCSYXUOC-UHFFFAOYSA-N sulfuryl dichloride Chemical compound ClS(Cl)(=O)=O YBBRCQOCSYXUOC-UHFFFAOYSA-N 0.000 description 2
- 239000000725 suspension Substances 0.000 description 2
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 2
- WSLDOOZREJYCGB-UHFFFAOYSA-N 1,2-Dichloroethane Chemical compound ClCCCl WSLDOOZREJYCGB-UHFFFAOYSA-N 0.000 description 1
- YBXYCBGDIALKAK-UHFFFAOYSA-N 2-chloroprop-2-enamide Chemical compound NC(=O)C(Cl)=C YBXYCBGDIALKAK-UHFFFAOYSA-N 0.000 description 1
- 125000001731 2-cyanoethyl group Chemical group [H]C([H])(*)C([H])([H])C#N 0.000 description 1
- XUOKWZRAWBZOQM-UHFFFAOYSA-N 2-cyclohexylprop-2-enamide Chemical compound NC(=O)C(=C)C1CCCCC1 XUOKWZRAWBZOQM-UHFFFAOYSA-N 0.000 description 1
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 description 1
- 125000006512 3,4-dichlorobenzyl group Chemical group [H]C1=C(Cl)C(Cl)=C([H])C(=C1[H])C([H])([H])* 0.000 description 1
- 125000004189 3,4-dichlorophenyl group Chemical group [H]C1=C([H])C(Cl)=C(Cl)C([H])=C1* 0.000 description 1
- JLSJEUQOXVVCPN-UHFFFAOYSA-N 3-sulfanylpropanamide Chemical compound NC(=O)CCS JLSJEUQOXVVCPN-UHFFFAOYSA-N 0.000 description 1
- LJOJEVWXVSSAMG-UHFFFAOYSA-N 4,5-dichloro-2-octyl-3h-1,2-thiazole 1-oxide Chemical compound CCCCCCCCN1CC(Cl)=C(Cl)S1=O LJOJEVWXVSSAMG-UHFFFAOYSA-N 0.000 description 1
- 125000006283 4-chlorobenzyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1Cl)C([H])([H])* 0.000 description 1
- 125000004217 4-methoxybenzyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1OC([H])([H])[H])C([H])([H])* 0.000 description 1
- 125000004172 4-methoxyphenyl group Chemical group [H]C1=C([H])C(OC([H])([H])[H])=C([H])C([H])=C1* 0.000 description 1
- 101000883882 Cherax destructor Crustacean hyperglycemic hormone A Proteins 0.000 description 1
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 1
- MZVQCMJNVPIDEA-UHFFFAOYSA-N [CH2]CN(CC)CC Chemical group [CH2]CN(CC)CC MZVQCMJNVPIDEA-UHFFFAOYSA-N 0.000 description 1
- 239000002253 acid Substances 0.000 description 1
- HFBMWMNUJJDEQZ-UHFFFAOYSA-N acryloyl chloride Chemical compound ClC(=O)C=C HFBMWMNUJJDEQZ-UHFFFAOYSA-N 0.000 description 1
- 125000002015 acyclic group Chemical group 0.000 description 1
- 150000001335 aliphatic alkanes Chemical class 0.000 description 1
- 150000001336 alkenes Chemical class 0.000 description 1
- 125000004183 alkoxy alkyl group Chemical group 0.000 description 1
- 125000000278 alkyl amino alkyl group Chemical group 0.000 description 1
- 125000006350 alkyl thio alkyl group Chemical group 0.000 description 1
- 238000004458 analytical method Methods 0.000 description 1
- 125000005128 aryl amino alkyl group Chemical group 0.000 description 1
- 125000001769 aryl amino group Chemical group 0.000 description 1
- 125000005160 aryl oxy alkyl group Chemical group 0.000 description 1
- 125000005164 aryl thioalkyl group Chemical group 0.000 description 1
- 125000004429 atom Chemical group 0.000 description 1
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000004181 carboxyalkyl group Chemical group 0.000 description 1
- 239000012159 carrier gas Substances 0.000 description 1
- 125000004218 chloromethyl group Chemical group [H]C([H])(Cl)* 0.000 description 1
- NKKMVIVFRUYPLQ-NSCUHMNNSA-N crotononitrile Chemical compound C\C=C\C#N NKKMVIVFRUYPLQ-NSCUHMNNSA-N 0.000 description 1
- 125000004966 cyanoalkyl group Chemical group 0.000 description 1
- 125000000640 cyclooctyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C([H])([H])C1([H])[H] 0.000 description 1
- 125000001559 cyclopropyl group Chemical group [H]C1([H])C([H])([H])C1([H])* 0.000 description 1
- 125000002704 decyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000004985 dialkyl amino alkyl group Chemical group 0.000 description 1
- 238000007865 diluting Methods 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 125000005448 ethoxyethyl group Chemical group [H]C([H])([H])C([H])([H])OC([H])([H])C([H])([H])* 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 239000007789 gas Substances 0.000 description 1
- 238000002290 gas chromatography-mass spectrometry Methods 0.000 description 1
- 125000004994 halo alkoxy alkyl group Chemical group 0.000 description 1
- 125000000262 haloalkenyl group Chemical group 0.000 description 1
- 125000001188 haloalkyl group Chemical group 0.000 description 1
- 125000000232 haloalkynyl group Chemical group 0.000 description 1
- 230000002140 halogenating effect Effects 0.000 description 1
- 239000001307 helium Substances 0.000 description 1
- 229910052734 helium Inorganic materials 0.000 description 1
- SWQJXJOGLNCZEY-UHFFFAOYSA-N helium atom Chemical compound [He] SWQJXJOGLNCZEY-UHFFFAOYSA-N 0.000 description 1
- 125000004051 hexyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 1
- 125000002768 hydroxyalkyl group Chemical group 0.000 description 1
- 125000004029 hydroxymethyl group Chemical group [H]OC([H])([H])* 0.000 description 1
- 238000011065 in-situ storage Methods 0.000 description 1
- 239000000543 intermediate Substances 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 1
- PMJFVKWBSWWAKT-UHFFFAOYSA-N n-cyclohexylprop-2-enamide Chemical compound C=CC(=O)NC1CCCCC1 PMJFVKWBSWWAKT-UHFFFAOYSA-N 0.000 description 1
- 125000001624 naphthyl group Chemical group 0.000 description 1
- 125000002347 octyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- JRZJOMJEPLMPRA-UHFFFAOYSA-N olefin Natural products CCCCCCCC=C JRZJOMJEPLMPRA-UHFFFAOYSA-N 0.000 description 1
- 230000001590 oxidative effect Effects 0.000 description 1
- 125000002958 pentadecyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000002568 propynyl group Chemical group [*]C#CC([H])([H])[H] 0.000 description 1
- 125000004076 pyridyl group Chemical group 0.000 description 1
- 238000010791 quenching Methods 0.000 description 1
- 230000000171 quenching effect Effects 0.000 description 1
- 239000000376 reactant Substances 0.000 description 1
- 239000013558 reference substance Substances 0.000 description 1
- 238000010992 reflux Methods 0.000 description 1
- 238000007363 ring formation reaction Methods 0.000 description 1
- 125000004079 stearyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 description 1
- 229920002554 vinyl polymer Polymers 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D275/00—Heterocyclic compounds containing 1,2-thiazole or hydrogenated 1,2-thiazole rings
- C07D275/02—Heterocyclic compounds containing 1,2-thiazole or hydrogenated 1,2-thiazole rings not condensed with other rings
- C07D275/03—Heterocyclic compounds containing 1,2-thiazole or hydrogenated 1,2-thiazole rings not condensed with other rings with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Thiazole And Isothizaole Compounds (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
- Plural Heterocyclic Compounds (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Nitrogen Condensed Heterocyclic Rings (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Steroid Compounds (AREA)
- Low-Molecular Organic Synthesis Reactions Using Catalysts (AREA)
- Indole Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US07/112,786 US4861896A (en) | 1987-10-26 | 1987-10-26 | Preparation of halo substituted isothiazolones |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DE3873260D1 DE3873260D1 (de) | 1992-09-03 |
| DE3873260T2 true DE3873260T2 (de) | 1993-03-11 |
Family
ID=22345843
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE8888310054T Expired - Fee Related DE3873260T2 (de) | 1987-10-26 | 1988-10-26 | Verfahren zur herstellung von substituierten isothiazolonen. |
Country Status (13)
| Country | Link |
|---|---|
| US (1) | US4861896A (enExample) |
| EP (1) | EP0314450B1 (enExample) |
| JP (1) | JPH0688986B2 (enExample) |
| KR (1) | KR960011380B1 (enExample) |
| AT (1) | ATE78817T1 (enExample) |
| BR (1) | BR8805500A (enExample) |
| CA (1) | CA1331461C (enExample) |
| DE (1) | DE3873260T2 (enExample) |
| ES (1) | ES2043844T3 (enExample) |
| GR (1) | GR3005317T3 (enExample) |
| HU (1) | HU201536B (enExample) |
| IL (1) | IL88177A (enExample) |
| MX (1) | MX164008B (enExample) |
Families Citing this family (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4939266A (en) * | 1982-06-01 | 1990-07-03 | Rohm And Haas Company | Nitrosamine-free 3-isothiazolone |
| US5068338A (en) * | 1982-06-01 | 1991-11-26 | Rohm And Haas Company | Process for nitrosamine-free sabilized isothiazolones |
| GB2274283B (en) * | 1991-05-10 | 1996-01-31 | Sunkyong Ind Ltd | A process for preparing 4-isothiazolin-3-one |
| CA2151074C (en) * | 1994-07-05 | 2005-08-02 | Hirokazu Kagano | Method for producing 1,2-benzisothiazol-3-ones |
Family Cites Families (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3523121A (en) * | 1967-03-09 | 1970-08-04 | Rohm & Haas | Certain 2-carbamoyl-3-isothiazolenes |
| US3914301A (en) * | 1971-05-06 | 1975-10-21 | Rohm & Haas | Acrylamide derivatives of 3-isothiazolones |
| CA1189514A (en) * | 1982-06-01 | 1985-06-25 | Horst O. Bayer | Nitrosamine-free 3-isothiazolones and process |
-
1987
- 1987-10-26 US US07/112,786 patent/US4861896A/en not_active Expired - Fee Related
-
1988
- 1988-10-12 CA CA000579879A patent/CA1331461C/en not_active Expired - Fee Related
- 1988-10-19 MX MX13470A patent/MX164008B/es unknown
- 1988-10-24 JP JP63267996A patent/JPH0688986B2/ja not_active Expired - Lifetime
- 1988-10-25 BR BR8805500A patent/BR8805500A/pt unknown
- 1988-10-25 KR KR1019880013906A patent/KR960011380B1/ko not_active Expired - Fee Related
- 1988-10-26 HU HU885596A patent/HU201536B/hu not_active IP Right Cessation
- 1988-10-26 AT AT88310054T patent/ATE78817T1/de not_active IP Right Cessation
- 1988-10-26 ES ES88310054T patent/ES2043844T3/es not_active Expired - Lifetime
- 1988-10-26 DE DE8888310054T patent/DE3873260T2/de not_active Expired - Fee Related
- 1988-10-26 EP EP88310054A patent/EP0314450B1/en not_active Expired - Lifetime
- 1988-10-26 IL IL88177A patent/IL88177A/xx not_active IP Right Cessation
-
1992
- 1992-07-30 GR GR920401550T patent/GR3005317T3/el unknown
Also Published As
| Publication number | Publication date |
|---|---|
| CA1331461C (en) | 1994-08-16 |
| KR960011380B1 (ko) | 1996-08-22 |
| GR3005317T3 (enExample) | 1993-05-24 |
| US4861896A (en) | 1989-08-29 |
| ES2043844T3 (es) | 1994-01-01 |
| EP0314450B1 (en) | 1992-07-29 |
| BR8805500A (pt) | 1989-07-04 |
| JPH01146874A (ja) | 1989-06-08 |
| MX164008B (es) | 1992-07-09 |
| EP0314450A1 (en) | 1989-05-03 |
| IL88177A (en) | 1993-02-21 |
| HUT49335A (en) | 1989-09-28 |
| JPH0688986B2 (ja) | 1994-11-09 |
| HU201536B (en) | 1990-11-28 |
| IL88177A0 (en) | 1989-06-30 |
| ATE78817T1 (de) | 1992-08-15 |
| DE3873260D1 (de) | 1992-09-03 |
| KR890006605A (ko) | 1989-06-14 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE68928783T2 (de) | Zwischenverbindungen zur Herstellung von Fungiziden | |
| DE3634975C2 (de) | Verfahren zur Herstellung von substituierten und disubstituierten Pyridin-2,3-dicarboxylatestern | |
| DE69534190T2 (de) | Verfahren zur Herstellung von 1,2-Benzisothiazol-3-onen | |
| DE2736408A1 (de) | Verfahren zur herstellung von sulfobetainen | |
| DE3873260T2 (de) | Verfahren zur herstellung von substituierten isothiazolonen. | |
| DE69500409T2 (de) | Herstellung von 3-Isothiazolen | |
| DE69809290T2 (de) | Verfahren zur herstellung von isoharnstoffen | |
| DE69901130T2 (de) | Verfahren zur Herstellung von Pyridindicarboxylatderivaten | |
| DD142543A5 (de) | Verfahren zur herstellung von thiocarbamaten | |
| DE69605873T2 (de) | Verfahren zur Herstellung von Isothiocyanat-Derivaten | |
| DE69003338T2 (de) | Verbindung, Verfahren und Verwendung. | |
| DE1795651B2 (de) | Verfahren zur Herstellung von 6-substituierten 23,5,6-Tetrahydroimidazo [2,1-bJ thiazolen | |
| DE60010092T2 (de) | Verfahren zur herstellung von acylierten 1,3-dicarbonylverbindungen | |
| DE1518711A1 (de) | Verfahren zur Herstellung des Aminoaethylesters von Methacrylsaeure | |
| DE69012451T2 (de) | Cyanoguanidin-Derivate. | |
| DE10026645A1 (de) | Verfahren zur Formylierung organischer Verbindungen | |
| DE3131096A1 (de) | Verfahren zur herstellung von n-substituierten methacryl- und acrylamiden | |
| DD158643A5 (de) | Kontinuierliches verfahren zur herstellung von dichloracetamiden | |
| DE60105733T2 (de) | Acrylate mit mehreren quatenären Amino-Gruppen im Alkohol-Teil, Verfahren zu deren Herstellung, und (Co)Polymere hergestellt aus diesen Monomeren | |
| DE69522175T2 (de) | Verfahren zur Herstellung von Alkylensulfiden | |
| DE2349313A1 (de) | Verfahren zur herstellung von tetraalkylthiuramidsulfiden | |
| DE2802442B2 (de) | Verfahren zur Gewinnung und Reinigung von Carboranverbindungen | |
| DE1933523C (de) | 3-Benzal-thiochroman-4-on-l-oxide | |
| DE1670680C (de) | Verfahren zur Herstellung von 3,1-Benzothiazinen | |
| WO2008074653A1 (de) | Verfahren zur herstellung von menthylderivaten |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| 8364 | No opposition during term of opposition | ||
| 8339 | Ceased/non-payment of the annual fee |