DE3688472T2 - Programmierbare logische Schaltung. - Google Patents
Programmierbare logische Schaltung.Info
- Publication number
- DE3688472T2 DE3688472T2 DE86301336T DE3688472T DE3688472T2 DE 3688472 T2 DE3688472 T2 DE 3688472T2 DE 86301336 T DE86301336 T DE 86301336T DE 3688472 T DE3688472 T DE 3688472T DE 3688472 T2 DE3688472 T2 DE 3688472T2
- Authority
- DE
- Germany
- Prior art keywords
- logic
- signal
- output
- input
- product term
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired - Fee Related
Links
- 238000012360 testing method Methods 0.000 claims description 23
- 230000015654 memory Effects 0.000 claims description 17
- 238000000034 method Methods 0.000 claims description 17
- 230000006870 function Effects 0.000 claims description 16
- 239000011159 matrix material Substances 0.000 claims description 14
- 230000008569 process Effects 0.000 claims description 5
- 230000005689 Fowler Nordheim tunneling Effects 0.000 claims description 3
- 230000000694 effects Effects 0.000 claims description 3
- 238000012795 verification Methods 0.000 description 26
- 238000010586 diagram Methods 0.000 description 12
- 238000003491 array Methods 0.000 description 7
- 238000005516 engineering process Methods 0.000 description 6
- PWPJGUXAGUPAHP-UHFFFAOYSA-N lufenuron Chemical group C1=C(Cl)C(OC(F)(F)C(C(F)(F)F)F)=CC(Cl)=C1NC(=O)NC(=O)C1=C(F)C=CC=C1F PWPJGUXAGUPAHP-UHFFFAOYSA-N 0.000 description 6
- 238000013461 design Methods 0.000 description 3
- 229910021420 polycrystalline silicon Inorganic materials 0.000 description 3
- 229920005591 polysilicon Polymers 0.000 description 3
- 230000005641 tunneling Effects 0.000 description 3
- 230000002457 bidirectional effect Effects 0.000 description 2
- 230000015556 catabolic process Effects 0.000 description 2
- 230000000295 complement effect Effects 0.000 description 2
- 238000013500 data storage Methods 0.000 description 2
- 238000013524 data verification Methods 0.000 description 2
- 230000007547 defect Effects 0.000 description 2
- 230000001066 destructive effect Effects 0.000 description 2
- 230000005284 excitation Effects 0.000 description 2
- 230000005669 field effect Effects 0.000 description 2
- 238000004519 manufacturing process Methods 0.000 description 2
- 230000004044 response Effects 0.000 description 2
- 230000001360 synchronised effect Effects 0.000 description 2
- 101100232300 Kluyveromyces lactis (strain ATCC 8585 / CBS 2359 / DSM 70799 / NBRC 1267 / NRRL Y-1140 / WM37) RAG5 gene Proteins 0.000 description 1
- 108010076504 Protein Sorting Signals Proteins 0.000 description 1
- 230000009471 action Effects 0.000 description 1
- 230000003213 activating effect Effects 0.000 description 1
- 230000004913 activation Effects 0.000 description 1
- 238000013459 approach Methods 0.000 description 1
- 238000011161 development Methods 0.000 description 1
- 230000018109 developmental process Effects 0.000 description 1
- 239000002019 doping agent Substances 0.000 description 1
- 230000010354 integration Effects 0.000 description 1
- 229910044991 metal oxide Inorganic materials 0.000 description 1
- 150000004706 metal oxides Chemical class 0.000 description 1
- 238000004377 microelectronic Methods 0.000 description 1
- 238000004806 packaging method and process Methods 0.000 description 1
- 230000021715 photosynthesis, light harvesting Effects 0.000 description 1
- 239000010453 quartz Substances 0.000 description 1
- 230000008672 reprogramming Effects 0.000 description 1
- 239000004065 semiconductor Substances 0.000 description 1
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N silicon dioxide Inorganic materials O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- H—ELECTRICITY
- H03—ELECTRONIC CIRCUITRY
- H03K—PULSE TECHNIQUE
- H03K19/00—Logic circuits, i.e. having at least two inputs acting on one output; Inverting circuits
- H03K19/02—Logic circuits, i.e. having at least two inputs acting on one output; Inverting circuits using specified components
- H03K19/173—Logic circuits, i.e. having at least two inputs acting on one output; Inverting circuits using specified components using elementary logic circuits as components
- H03K19/1733—Controllable logic circuits
- H03K19/1735—Controllable logic circuits by wiring, e.g. uncommitted logic arrays
- H03K19/1736—Controllable logic circuits by wiring, e.g. uncommitted logic arrays in which the wiring can be modified
-
- G—PHYSICS
- G01—MEASURING; TESTING
- G01R—MEASURING ELECTRIC VARIABLES; MEASURING MAGNETIC VARIABLES
- G01R31/00—Arrangements for testing electric properties; Arrangements for locating electric faults; Arrangements for electrical testing characterised by what is being tested not provided for elsewhere
- G01R31/28—Testing of electronic circuits, e.g. by signal tracer
- G01R31/317—Testing of digital circuits
- G01R31/3181—Functional testing
- G01R31/3185—Reconfiguring for testing, e.g. LSSD, partitioning
- G01R31/318516—Test of programmable logic devices [PLDs]
-
- H—ELECTRICITY
- H03—ELECTRONIC CIRCUITRY
- H03K—PULSE TECHNIQUE
- H03K19/00—Logic circuits, i.e. having at least two inputs acting on one output; Inverting circuits
- H03K19/02—Logic circuits, i.e. having at least two inputs acting on one output; Inverting circuits using specified components
- H03K19/173—Logic circuits, i.e. having at least two inputs acting on one output; Inverting circuits using specified components using elementary logic circuits as components
- H03K19/177—Logic circuits, i.e. having at least two inputs acting on one output; Inverting circuits using specified components using elementary logic circuits as components arranged in matrix form
- H03K19/17704—Logic circuits, i.e. having at least two inputs acting on one output; Inverting circuits using specified components using elementary logic circuits as components arranged in matrix form the logic functions being realised by the interconnection of rows and columns
-
- H—ELECTRICITY
- H03—ELECTRONIC CIRCUITRY
- H03K—PULSE TECHNIQUE
- H03K19/00—Logic circuits, i.e. having at least two inputs acting on one output; Inverting circuits
- H03K19/02—Logic circuits, i.e. having at least two inputs acting on one output; Inverting circuits using specified components
- H03K19/173—Logic circuits, i.e. having at least two inputs acting on one output; Inverting circuits using specified components using elementary logic circuits as components
- H03K19/177—Logic circuits, i.e. having at least two inputs acting on one output; Inverting circuits using specified components using elementary logic circuits as components arranged in matrix form
- H03K19/17748—Structural details of configuration resources
- H03K19/17758—Structural details of configuration resources for speeding up configuration or reconfiguration
-
- H—ELECTRICITY
- H03—ELECTRONIC CIRCUITRY
- H03K—PULSE TECHNIQUE
- H03K19/00—Logic circuits, i.e. having at least two inputs acting on one output; Inverting circuits
- H03K19/02—Logic circuits, i.e. having at least two inputs acting on one output; Inverting circuits using specified components
- H03K19/173—Logic circuits, i.e. having at least two inputs acting on one output; Inverting circuits using specified components using elementary logic circuits as components
- H03K19/177—Logic circuits, i.e. having at least two inputs acting on one output; Inverting circuits using specified components using elementary logic circuits as components arranged in matrix form
- H03K19/17748—Structural details of configuration resources
- H03K19/1776—Structural details of configuration resources for memories
-
- H—ELECTRICITY
- H03—ELECTRONIC CIRCUITRY
- H03K—PULSE TECHNIQUE
- H03K19/00—Logic circuits, i.e. having at least two inputs acting on one output; Inverting circuits
- H03K19/02—Logic circuits, i.e. having at least two inputs acting on one output; Inverting circuits using specified components
- H03K19/173—Logic circuits, i.e. having at least two inputs acting on one output; Inverting circuits using specified components using elementary logic circuits as components
- H03K19/177—Logic circuits, i.e. having at least two inputs acting on one output; Inverting circuits using specified components using elementary logic circuits as components arranged in matrix form
- H03K19/17748—Structural details of configuration resources
- H03K19/17764—Structural details of configuration resources for reliability
-
- H—ELECTRICITY
- H03—ELECTRONIC CIRCUITRY
- H03K—PULSE TECHNIQUE
- H03K19/00—Logic circuits, i.e. having at least two inputs acting on one output; Inverting circuits
- H03K19/02—Logic circuits, i.e. having at least two inputs acting on one output; Inverting circuits using specified components
- H03K19/173—Logic circuits, i.e. having at least two inputs acting on one output; Inverting circuits using specified components using elementary logic circuits as components
- H03K19/177—Logic circuits, i.e. having at least two inputs acting on one output; Inverting circuits using specified components using elementary logic circuits as components arranged in matrix form
- H03K19/1778—Structural details for adapting physical parameters
Landscapes
- Physics & Mathematics (AREA)
- Mathematical Physics (AREA)
- Engineering & Computer Science (AREA)
- General Engineering & Computer Science (AREA)
- Computer Hardware Design (AREA)
- Computing Systems (AREA)
- General Physics & Mathematics (AREA)
- Logic Circuits (AREA)
- Read Only Memory (AREA)
- Non-Volatile Memory (AREA)
- Semiconductor Memories (AREA)
- Design And Manufacture Of Integrated Circuits (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US06/707,662 US4761768A (en) | 1985-03-04 | 1985-03-04 | Programmable logic device |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DE3688472D1 DE3688472D1 (de) | 1993-07-01 |
| DE3688472T2 true DE3688472T2 (de) | 1994-01-05 |
Family
ID=24842619
Family Applications (2)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE86301336T Expired - Fee Related DE3688472T2 (de) | 1985-03-04 | 1986-02-25 | Programmierbare logische Schaltung. |
| DE3650598T Expired - Fee Related DE3650598T2 (de) | 1985-03-04 | 1986-02-25 | Programmierbare logische Schaltung |
Family Applications After (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE3650598T Expired - Fee Related DE3650598T2 (de) | 1985-03-04 | 1986-02-25 | Programmierbare logische Schaltung |
Country Status (4)
| Country | Link |
|---|---|
| US (1) | US4761768A (enExample) |
| EP (2) | EP0196771B1 (enExample) |
| JP (2) | JP2607470B2 (enExample) |
| DE (2) | DE3688472T2 (enExample) |
Families Citing this family (119)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4879688A (en) * | 1985-03-04 | 1989-11-07 | Lattice Semiconductor Corporation | In-system programmable logic device |
| US4896296A (en) * | 1985-03-04 | 1990-01-23 | Lattice Semiconductor Corporation | Programmable logic device configurable input/output cell |
| US4855954A (en) * | 1985-03-04 | 1989-08-08 | Lattice Semiconductor Corporation | In-system programmable logic device with four dedicated terminals |
| US4761768A (en) * | 1985-03-04 | 1988-08-02 | Lattice Semiconductor Corporation | Programmable logic device |
| US5367208A (en) | 1986-09-19 | 1994-11-22 | Actel Corporation | Reconfigurable programmable interconnect architecture |
| JPH071493B2 (ja) * | 1987-06-11 | 1995-01-11 | 三菱電機株式会社 | テスト補助回路 |
| EP0310377B1 (en) * | 1987-10-02 | 1992-06-10 | Kawasaki Steel Corporation | Programmable input/output circuit |
| US4903223A (en) * | 1988-05-05 | 1990-02-20 | Altera Corporation | Programmable logic device with programmable word line connections |
| US4930107A (en) * | 1988-08-08 | 1990-05-29 | Altera Corporation | Method and apparatus for programming and verifying programmable elements in programmable devices |
| JP3156966B2 (ja) * | 1988-09-30 | 2001-04-16 | 株式会社東芝 | 不揮発性半導体メモリ装置 |
| US5329470A (en) * | 1988-12-02 | 1994-07-12 | Quickturn Systems, Inc. | Reconfigurable hardware emulation system |
| US5109353A (en) * | 1988-12-02 | 1992-04-28 | Quickturn Systems, Incorporated | Apparatus for emulation of electronic hardware system |
| US4930098A (en) * | 1988-12-30 | 1990-05-29 | Intel Corporation | Shift register programming for a programmable logic device |
| US4940909A (en) * | 1989-05-12 | 1990-07-10 | Plus Logic, Inc. | Configuration control circuit for programmable logic devices |
| US5369593A (en) * | 1989-05-31 | 1994-11-29 | Synopsys Inc. | System for and method of connecting a hardware modeling element to a hardware modeling system |
| US5353243A (en) * | 1989-05-31 | 1994-10-04 | Synopsys Inc. | Hardware modeling system and method of use |
| US5027011A (en) * | 1989-10-31 | 1991-06-25 | Sgs-Thomson Microelectronics, Inc. | Input row drivers for programmable logic devices |
| US5198705A (en) * | 1990-05-11 | 1993-03-30 | Actel Corporation | Logic module with configurable combinational and sequential blocks |
| US5412260A (en) * | 1991-05-03 | 1995-05-02 | Lattice Semiconductor Corporation | Multiplexed control pins for in-system programming and boundary scan state machines in a high density programmable logic device |
| US5369645A (en) * | 1991-07-02 | 1994-11-29 | Hewlett-Packard Company | Testing integrated circuit pad input and output structures |
| US5231312A (en) * | 1992-03-12 | 1993-07-27 | Atmel Corporation | Integrated logic circuit with functionally flexible input/output macrocells |
| US5307475A (en) * | 1992-06-29 | 1994-04-26 | The United States Of America As Represented By The Secretary Of The Navy | Slave controller utilizing eight least/most significant bits for accessing sixteen bit data words |
| US5319767A (en) * | 1992-06-29 | 1994-06-07 | The United States Of America As Represented By The Secretary Of The Navy | Slave controller for effecting a block transfer of sixteen bit words between a memory and a data transfer bus |
| US5425036A (en) * | 1992-09-18 | 1995-06-13 | Quickturn Design Systems, Inc. | Method and apparatus for debugging reconfigurable emulation systems |
| IL109921A (en) * | 1993-06-24 | 1997-09-30 | Quickturn Design Systems | Method and apparatus for configuring memory circuits |
| US5680583A (en) * | 1994-02-16 | 1997-10-21 | Arkos Design, Inc. | Method and apparatus for a trace buffer in an emulation system |
| US5689195A (en) * | 1995-05-17 | 1997-11-18 | Altera Corporation | Programmable logic array integrated circuit devices |
| US5544107A (en) * | 1994-08-22 | 1996-08-06 | Adaptec, Inc. | Diagnostic data port for a LSI or VLSI integrated circuit |
| US5712790A (en) * | 1995-04-11 | 1998-01-27 | International Business Machines Corporation | Method of power reduction in pla's |
| US5719505A (en) * | 1995-04-11 | 1998-02-17 | International Business Machines Corporation | Reduced power PLA |
| US5732246A (en) * | 1995-06-07 | 1998-03-24 | International Business Machines Corporation | Programmable array interconnect latch |
| US5734868A (en) * | 1995-08-09 | 1998-03-31 | Curd; Derek R. | Efficient in-system programming structure and method for non-volatile programmable logic devices |
| US5555214A (en) * | 1995-11-08 | 1996-09-10 | Altera Corporation | Apparatus for serial reading and writing of random access memory arrays |
| US5651013A (en) * | 1995-11-14 | 1997-07-22 | International Business Machines Corporation | Programmable circuits for test and operation of programmable gate arrays |
| EP0782144B1 (en) * | 1995-12-29 | 2001-05-23 | STMicroelectronics S.r.l. | Programmable device with basic modules electrically connected by flash memory cells |
| US5742531A (en) * | 1996-05-03 | 1998-04-21 | Xilinx Inc | Configurable parallel and bit serial load apparatus |
| US5961576A (en) * | 1996-05-03 | 1999-10-05 | Xilinx, Inc. | Configurable parallel and bit serial load apparatus |
| US5841967A (en) * | 1996-10-17 | 1998-11-24 | Quickturn Design Systems, Inc. | Method and apparatus for design verification using emulation and simulation |
| US5936426A (en) * | 1997-02-03 | 1999-08-10 | Actel Corporation | Logic function module for field programmable array |
| US5960191A (en) * | 1997-05-30 | 1999-09-28 | Quickturn Design Systems, Inc. | Emulation system with time-multiplexed interconnect |
| US5970240A (en) * | 1997-06-25 | 1999-10-19 | Quickturn Design Systems, Inc. | Method and apparatus for configurable memory emulation |
| US6072209A (en) | 1997-07-08 | 2000-06-06 | Micro Technology, Inc. | Four F2 folded bit line DRAM cell structure having buried bit and word lines |
| US5973356A (en) * | 1997-07-08 | 1999-10-26 | Micron Technology, Inc. | Ultra high density flash memory |
| US5909618A (en) | 1997-07-08 | 1999-06-01 | Micron Technology, Inc. | Method of making memory cell with vertical transistor and buried word and body lines |
| US5936274A (en) * | 1997-07-08 | 1999-08-10 | Micron Technology, Inc. | High density flash memory |
| US6150687A (en) * | 1997-07-08 | 2000-11-21 | Micron Technology, Inc. | Memory cell having a vertical transistor with buried source/drain and dual gates |
| US6191470B1 (en) | 1997-07-08 | 2001-02-20 | Micron Technology, Inc. | Semiconductor-on-insulator memory cell with buried word and body lines |
| US5914511A (en) * | 1997-10-06 | 1999-06-22 | Micron Technology, Inc. | Circuit and method for a folded bit line memory using trench plate capacitor cells with body bias contacts |
| US6528837B2 (en) * | 1997-10-06 | 2003-03-04 | Micron Technology, Inc. | Circuit and method for an open bit line memory cell with a vertical transistor and trench plate trench capacitor |
| US5907170A (en) | 1997-10-06 | 1999-05-25 | Micron Technology, Inc. | Circuit and method for an open bit line memory cell with a vertical transistor and trench plate trench capacitor |
| US6066869A (en) * | 1997-10-06 | 2000-05-23 | Micron Technology, Inc. | Circuit and method for a folded bit line memory cell with vertical transistor and trench capacitor |
| US5995988A (en) * | 1997-12-04 | 1999-11-30 | Xilinx, Inc. | Configurable parallel and bit serial load apparatus |
| US6025225A (en) | 1998-01-22 | 2000-02-15 | Micron Technology, Inc. | Circuits with a trench capacitor having micro-roughened semiconductor surfaces and methods for forming the same |
| US6242775B1 (en) | 1998-02-24 | 2001-06-05 | Micron Technology, Inc. | Circuits and methods using vertical complementary transistors |
| US6246083B1 (en) | 1998-02-24 | 2001-06-12 | Micron Technology, Inc. | Vertical gain cell and array for a dynamic random access memory |
| US5963469A (en) * | 1998-02-24 | 1999-10-05 | Micron Technology, Inc. | Vertical bipolar read access for low voltage memory cell |
| US6304483B1 (en) | 1998-02-24 | 2001-10-16 | Micron Technology, Inc. | Circuits and methods for a static random access memory using vertical transistors |
| US5991225A (en) | 1998-02-27 | 1999-11-23 | Micron Technology, Inc. | Programmable memory address decode array with vertical transistors |
| US6124729A (en) | 1998-02-27 | 2000-09-26 | Micron Technology, Inc. | Field programmable logic arrays with vertical transistors |
| US6043527A (en) | 1998-04-14 | 2000-03-28 | Micron Technology, Inc. | Circuits and methods for a memory cell with a trench plate trench capacitor and a vertical bipolar read device |
| US6208164B1 (en) | 1998-08-04 | 2001-03-27 | Micron Technology, Inc. | Programmable logic array with vertical transistors |
| US6134175A (en) * | 1998-08-04 | 2000-10-17 | Micron Technology, Inc. | Memory address decode array with vertical transistors |
| US6093623A (en) * | 1998-08-04 | 2000-07-25 | Micron Technology, Inc. | Methods for making silicon-on-insulator structures |
| US6423613B1 (en) | 1998-11-10 | 2002-07-23 | Micron Technology, Inc. | Low temperature silicon wafer bond process with bulk material bond strength |
| US6380581B1 (en) | 1999-02-26 | 2002-04-30 | Micron Technology, Inc. | DRAM technology compatible non volatile memory cells with capacitors connected to the gates of the transistors |
| US6297989B1 (en) | 1999-02-26 | 2001-10-02 | Micron Technology, Inc. | Applications for non-volatile memory cells |
| US6256225B1 (en) | 1999-02-26 | 2001-07-03 | Micron Technology, Inc. | Construction and application for non-volatile reprogrammable switches |
| US6452856B1 (en) * | 1999-02-26 | 2002-09-17 | Micron Technology, Inc. | DRAM technology compatible processor/memory chips |
| JP4206203B2 (ja) * | 1999-03-04 | 2009-01-07 | アルテラ コーポレイション | プログラマブルロジック集積回路デバイスの相互接続ならびに入力/出力リソース |
| US6407576B1 (en) * | 1999-03-04 | 2002-06-18 | Altera Corporation | Interconnection and input/output resources for programmable logic integrated circuit devices |
| US6521958B1 (en) * | 1999-08-26 | 2003-02-18 | Micron Technology, Inc. | MOSFET technology for programmable address decode and correction |
| US6769109B2 (en) | 2000-02-25 | 2004-07-27 | Lightspeed Semiconductor Corporation | Programmable logic array embedded in mask-programmed ASIC |
| US7055125B2 (en) * | 2000-09-08 | 2006-05-30 | Lightspeed Semiconductor Corp. | Depopulated programmable logic array |
| ITRM20010298A1 (it) * | 2001-05-31 | 2002-12-02 | Micron Technology Inc | Interfaccia di comando di utilizzatore con decodificatore programmabile. |
| US6674667B2 (en) * | 2001-02-13 | 2004-01-06 | Micron Technology, Inc. | Programmable fuse and antifuse and method therefor |
| US6852167B2 (en) | 2001-03-01 | 2005-02-08 | Micron Technology, Inc. | Methods, systems, and apparatus for uniform chemical-vapor depositions |
| DE10148157B4 (de) * | 2001-09-28 | 2006-05-18 | Infineon Technologies Ag | Programmgesteuerte Einheit |
| US6772381B1 (en) * | 2002-01-17 | 2004-08-03 | Advanced Micro Devices, Inc. | Programmable logic device verification system and method |
| US7589029B2 (en) | 2002-05-02 | 2009-09-15 | Micron Technology, Inc. | Atomic layer deposition and conversion |
| US7160577B2 (en) | 2002-05-02 | 2007-01-09 | Micron Technology, Inc. | Methods for atomic-layer deposition of aluminum oxides in integrated circuits |
| US6856542B2 (en) * | 2002-06-04 | 2005-02-15 | Stmicroelectronics, Inc. | Programmable logic device circuit and method of fabricating same |
| US7312109B2 (en) * | 2002-07-08 | 2007-12-25 | Viciciv, Inc. | Methods for fabricating fuse programmable three dimensional integrated circuits |
| US20040004251A1 (en) * | 2002-07-08 | 2004-01-08 | Madurawe Raminda U. | Insulated-gate field-effect thin film transistors |
| US6992503B2 (en) * | 2002-07-08 | 2006-01-31 | Viciciv Technology | Programmable devices with convertibility to customizable devices |
| US7129744B2 (en) * | 2003-10-23 | 2006-10-31 | Viciciv Technology | Programmable interconnect structures |
| US7112994B2 (en) | 2002-07-08 | 2006-09-26 | Viciciv Technology | Three dimensional integrated circuits |
| US7673273B2 (en) * | 2002-07-08 | 2010-03-02 | Tier Logic, Inc. | MPGA products based on a prototype FPGA |
| US7812458B2 (en) * | 2007-11-19 | 2010-10-12 | Tier Logic, Inc. | Pad invariant FPGA and ASIC devices |
| US8643162B2 (en) | 2007-11-19 | 2014-02-04 | Raminda Udaya Madurawe | Pads and pin-outs in three dimensional integrated circuits |
| US7042756B2 (en) * | 2002-10-18 | 2006-05-09 | Viciciv Technology | Configurable storage device |
| US7084666B2 (en) * | 2002-10-21 | 2006-08-01 | Viciciv Technology | Programmable interconnect structures |
| US6897543B1 (en) | 2003-08-22 | 2005-05-24 | Altera Corporation | Electrically-programmable integrated circuit antifuses |
| US7030651B2 (en) | 2003-12-04 | 2006-04-18 | Viciciv Technology | Programmable structured arrays |
| US7176713B2 (en) * | 2004-01-05 | 2007-02-13 | Viciciv Technology | Integrated circuits with RAM and ROM fabrication options |
| KR100564611B1 (ko) * | 2004-02-14 | 2006-03-29 | 삼성전자주식회사 | 하드 디스크 드라이브의 완충 구조체 |
| US7157782B1 (en) | 2004-02-17 | 2007-01-02 | Altera Corporation | Electrically-programmable transistor antifuses |
| US7489164B2 (en) * | 2004-05-17 | 2009-02-10 | Raminda Udaya Madurawe | Multi-port memory devices |
| US7075331B2 (en) | 2004-06-03 | 2006-07-11 | Tekelec | Methods and systems for providing hardware assisted programming of a programmable logic device in an embedded system |
| US7180813B2 (en) * | 2004-12-15 | 2007-02-20 | Stmicroelectronics, Inc. | Programmable system device having a shared power supply voltage generator for FLASH and PLD modules |
| US7927948B2 (en) | 2005-07-20 | 2011-04-19 | Micron Technology, Inc. | Devices with nanocrystals and methods of formation |
| US7486111B2 (en) * | 2006-03-08 | 2009-02-03 | Tier Logic, Inc. | Programmable logic devices comprising time multiplexed programmable interconnect |
| US20080024165A1 (en) * | 2006-07-28 | 2008-01-31 | Raminda Udaya Madurawe | Configurable embedded multi-port memory |
| DE102007004311A1 (de) * | 2007-01-29 | 2008-08-07 | Qimonda Ag | Halbleiter-Bauelement, insbesondere DRAM, mit mehreren verschiedenartigen einmal-programmierbaren Elementen |
| US20090128189A1 (en) * | 2007-11-19 | 2009-05-21 | Raminda Udaya Madurawe | Three dimensional programmable devices |
| US7635988B2 (en) * | 2007-11-19 | 2009-12-22 | Tier Logic, Inc. | Multi-port thin-film memory devices |
| US7602213B2 (en) * | 2007-12-26 | 2009-10-13 | Tier Logic, Inc. | Using programmable latch to implement logic |
| US7795913B2 (en) * | 2007-12-26 | 2010-09-14 | Tier Logic | Programmable latch based multiplier |
| US7573294B2 (en) * | 2007-12-26 | 2009-08-11 | Tier Logic, Inc. | Programmable logic based latches and shift registers |
| US7573293B2 (en) * | 2007-12-26 | 2009-08-11 | Tier Logic, Inc. | Programmable logic based latches and shift registers |
| US8072811B2 (en) * | 2008-05-07 | 2011-12-06 | Aplus Flash Technology, Inc, | NAND based NMOS NOR flash memory cell, a NAND based NMOS NOR flash memory array, and a method of forming a NAND based NMOS NOR flash memory array |
| US8120959B2 (en) * | 2008-05-30 | 2012-02-21 | Aplus Flash Technology, Inc. | NAND string based NAND/NOR flash memory cell, array, and memory device having parallel bit lines and source lines, having a programmable select gating transistor, and circuits and methods for operating same |
| US8230375B2 (en) | 2008-09-14 | 2012-07-24 | Raminda Udaya Madurawe | Automated metal pattern generation for integrated circuits |
| US8120966B2 (en) * | 2009-02-05 | 2012-02-21 | Aplus Flash Technology, Inc. | Method and apparatus for management of over-erasure in NAND-based NOR-type flash memory |
| US8159265B1 (en) | 2010-11-16 | 2012-04-17 | Raminda Udaya Madurawe | Memory for metal configurable integrated circuits |
| US8159268B1 (en) | 2010-11-16 | 2012-04-17 | Raminda Udaya Madurawe | Interconnect structures for metal configurable integrated circuits |
| US8159266B1 (en) | 2010-11-16 | 2012-04-17 | Raminda Udaya Madurawe | Metal configurable integrated circuits |
| KR102771901B1 (ko) | 2020-06-19 | 2025-02-25 | 삼성전자주식회사 | 일 함수 층들을 갖는 반도체 소자들 |
| KR102820462B1 (ko) | 2020-06-24 | 2025-06-16 | 삼성전자주식회사 | 게이트 라인을 포함하는 집적회로 소자 |
| KR102788873B1 (ko) | 2020-06-24 | 2025-03-31 | 삼성전자주식회사 | 캡핑층을 포함하는 반도체 소자 |
Family Cites Families (46)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3191151A (en) * | 1962-11-26 | 1965-06-22 | Fairchild Camera Instr Co | Programmable circuit |
| US3566153A (en) * | 1969-04-30 | 1971-02-23 | Texas Instruments Inc | Programmable sequential logic |
| US3774171A (en) * | 1971-11-08 | 1973-11-20 | Honeywell Inf Systems | Read only memory organization |
| US3818252A (en) * | 1971-12-20 | 1974-06-18 | Hitachi Ltd | Universal logical integrated circuit |
| US3818452A (en) * | 1972-04-28 | 1974-06-18 | Gen Electric | Electrically programmable logic circuits |
| US3816725A (en) * | 1972-04-28 | 1974-06-11 | Gen Electric | Multiple level associative logic circuits |
| GB1444084A (en) * | 1972-06-21 | 1976-07-28 | Honeywell Inf Systems | Generalized logic device |
| US3803587A (en) * | 1972-09-11 | 1974-04-09 | C Mead | Logic system |
| US3849638A (en) * | 1973-07-18 | 1974-11-19 | Gen Electric | Segmented associative logic circuits |
| US3949370A (en) * | 1974-06-06 | 1976-04-06 | National Semiconductor Corporation | Programmable logic array control section for data processing system |
| US3912947A (en) * | 1974-07-05 | 1975-10-14 | Motorola Inc | Mos data bus control circuitry |
| US3924243A (en) * | 1974-08-06 | 1975-12-02 | Ibm | Cross-field-partitioning in array logic modules |
| US3906255A (en) * | 1974-09-06 | 1975-09-16 | Motorola Inc | MOS current limiting output circuit |
| IT1042852B (it) * | 1974-09-30 | 1980-01-30 | Siemens Ag | Disposizione di circuiti logici integrata e programmabile |
| DE2455178C2 (de) * | 1974-11-21 | 1982-12-23 | Siemens AG, 1000 Berlin und 8000 München | Integrierte, programmierbare Logikanordnung |
| US3936812A (en) * | 1974-12-30 | 1976-02-03 | Ibm Corporation | Segmented parallel rail paths for input/output signals |
| IT1063025B (it) * | 1975-04-29 | 1985-02-11 | Siemens Ag | Disposizione circuitale logica integrata e programmabile |
| DE2606958A1 (de) * | 1976-02-20 | 1977-08-25 | Siemens Ag | Bausteinschaltung mit speichertransistoren |
| US4084152A (en) * | 1976-06-30 | 1978-04-11 | International Business Machines Corporation | Time shared programmable logic array |
| US4233526A (en) * | 1977-04-08 | 1980-11-11 | Nippon Electric Co., Ltd. | Semiconductor memory device having multi-gate transistors |
| US4124899A (en) * | 1977-05-23 | 1978-11-07 | Monolithic Memories, Inc. | Programmable array logic circuit |
| JPS5467346A (en) * | 1977-11-08 | 1979-05-30 | Nec Corp | Pla logic circuit |
| JPS54137933A (en) * | 1978-04-18 | 1979-10-26 | Sharp Corp | Programmable nonvolatile rom |
| US4177452A (en) * | 1978-06-05 | 1979-12-04 | International Business Machines Corporation | Electrically programmable logic array |
| JPS5847796B2 (ja) * | 1979-05-26 | 1983-10-25 | 富士通株式会社 | 半導体メモリ装置 |
| US4414665A (en) * | 1979-11-21 | 1983-11-08 | Nippon Telegraph & Telephone Public Corp. | Semiconductor memory device test apparatus |
| US4321695A (en) * | 1979-11-23 | 1982-03-23 | Texas Instruments Incorporated | High speed serial access semiconductor memory with fault tolerant feature |
| GB2070779B (en) * | 1980-02-28 | 1984-02-15 | Solartron Electronic Group | Apparatus for testing digital electronic circuits |
| US4543646A (en) * | 1980-06-05 | 1985-09-24 | Western Digital Corporation | Chip topography for MOS Data Encryption Standard circuit |
| JPS5723346A (en) * | 1980-07-16 | 1982-02-06 | Matsushita Electric Ind Co Ltd | Code approving circuit |
| DE3135368A1 (de) * | 1981-09-07 | 1983-03-31 | Siemens AG, 1000 Berlin und 8000 München | Verfahren und anordnung zur funktionspruefung einer programmierbare logikanordnung |
| US4434478A (en) * | 1981-11-27 | 1984-02-28 | International Business Machines Corporation | Programming floating gate devices |
| US4488267A (en) * | 1982-05-24 | 1984-12-11 | At&T Bell Laboratories | Integrated circuit chips with removable drivers and/or buffers |
| US4521852A (en) * | 1982-06-30 | 1985-06-04 | Texas Instruments Incorporated | Data processing device formed on a single semiconductor substrate having secure memory |
| US4521853A (en) * | 1982-06-30 | 1985-06-04 | Texas Instruments Incorporated | Secure microprocessor/microcomputer with secured memory |
| US4590552A (en) * | 1982-06-30 | 1986-05-20 | Texas Instruments Incorporated | Security bit for designating the security status of information stored in a nonvolatile memory |
| US4476560A (en) * | 1982-09-21 | 1984-10-09 | Advanced Micro Devices, Inc. | Diagnostic circuit for digital systems |
| US4490812A (en) * | 1982-09-30 | 1984-12-25 | Mostek Corporation | User reprogrammable programmed logic array |
| US4503387A (en) * | 1982-12-30 | 1985-03-05 | Harris Corporation | A.C. Testing of logic arrays |
| JPS59188234A (ja) * | 1983-04-11 | 1984-10-25 | Hitachi Ltd | 半導体集積回路装置及びその製法 |
| US4583196A (en) * | 1983-10-28 | 1986-04-15 | Honeywell Inc. | Secure read only memory |
| US4617479B1 (en) * | 1984-05-03 | 1993-09-21 | Altera Semiconductor Corp. | Programmable logic array device using eprom technology |
| US4609986A (en) * | 1984-06-14 | 1986-09-02 | Altera Corporation | Programmable logic array device using EPROM technology |
| US4625311A (en) * | 1984-06-18 | 1986-11-25 | Monolithic Memories, Inc. | Programmable array logic circuit with testing and verification circuitry |
| US4638189A (en) * | 1984-06-29 | 1987-01-20 | Monolithic Memories, Incorporated | Fast and gate with programmable output polarity |
| US4761768A (en) * | 1985-03-04 | 1988-08-02 | Lattice Semiconductor Corporation | Programmable logic device |
-
1985
- 1985-03-04 US US06/707,662 patent/US4761768A/en not_active Expired - Lifetime
-
1986
- 1986-02-25 EP EP86301336A patent/EP0196771B1/en not_active Expired - Lifetime
- 1986-02-25 DE DE86301336T patent/DE3688472T2/de not_active Expired - Fee Related
- 1986-02-25 EP EP92202930A patent/EP0523817B1/en not_active Expired - Lifetime
- 1986-02-25 DE DE3650598T patent/DE3650598T2/de not_active Expired - Fee Related
- 1986-03-04 JP JP4817986A patent/JP2607470B2/ja not_active Expired - Lifetime
-
1994
- 1994-03-28 JP JP8092094A patent/JP2934149B2/ja not_active Expired - Lifetime
Also Published As
| Publication number | Publication date |
|---|---|
| DE3650598T2 (de) | 1997-09-11 |
| JP2934149B2 (ja) | 1999-08-16 |
| JPS61216520A (ja) | 1986-09-26 |
| EP0196771B1 (en) | 1993-05-26 |
| EP0523817A2 (en) | 1993-01-20 |
| EP0196771A2 (en) | 1986-10-08 |
| JPH0774621A (ja) | 1995-03-17 |
| DE3688472D1 (de) | 1993-07-01 |
| US4761768A (en) | 1988-08-02 |
| EP0523817A3 (enExample) | 1994-03-16 |
| JP2607470B2 (ja) | 1997-05-07 |
| EP0523817B1 (en) | 1997-01-29 |
| DE3650598D1 (de) | 1997-03-13 |
| EP0196771A3 (en) | 1987-12-16 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE3688472T2 (de) | Programmierbare logische Schaltung. | |
| DE3751084T2 (de) | Im system programmierbare logische vorrichtung. | |
| DE3900798C2 (de) | Verfahren zum Programmieren eines elektrisch löschbaren und programmierbaren Nur-Lese-Speichers | |
| DE69525210T2 (de) | Programmierbare logikvorrichtung mit regionaler und universeller signalweglenkung | |
| DE69222589T2 (de) | Nichtlöschbarer Halbleiterspeicher mit Reihendecoder | |
| DE69028386T2 (de) | Auf statischem RAM basierende Zelle für ein programmierbares logisches Feld | |
| DE19880311B3 (de) | Nichtflüchtige Speicherstruktur | |
| DE3740361C2 (enExample) | ||
| DE4330778C2 (de) | Speicherzellenschaltung | |
| DE3850482T2 (de) | Elektrisch löschbarer und programmierbarer Festwertspeicher mit Stapelgatterzellen. | |
| DE69706873T2 (de) | Löschverfahren für mehrere-bits-pro-zelle flash -eeprom mit seitenmodus | |
| DE69625494T2 (de) | Integrierte schaltung zur speicherung und wiederauffindung von mehreren digitalen bits pro nichtflüchtiger speicherzelle | |
| DE60308202T2 (de) | Hochkompakter nichtflüchtiger speicher mit platz sparenden datenregistern und dessen betriebsverfahren | |
| DE69702195T2 (de) | Schieberegister-flashseitenpuffer mit mehreren bits pro zelle | |
| DE69630958T2 (de) | Programmierbarer nichtflüchtiger zweiwegschalter für programmierbare logik | |
| DE3839114A1 (de) | Nichtfluechtige dynamische halbleiterspeicheranordnung mit nand-zellenstruktur | |
| DE4213731A1 (de) | Nichtfluechtiges halbleiterspeicherbauelement und programmierverfahren hierfuer | |
| DE69422794T2 (de) | Programmierbare logische Feldstruktur für nichtflüchtige Halbleiterspeicher, insbesondere Flash-EPROMS | |
| DE69908340T2 (de) | Seitenmoduslöschverfahren in flash-speichermatrize | |
| DE4040492C2 (enExample) | ||
| DE3686933T2 (de) | Programmierbares halbleiterspeichergeraet. | |
| DE3884062T2 (de) | Programmierbare logische Einrichtung. | |
| DE3686070T2 (de) | Programmierbare logische schaltung mit begrenzten leserstroemen. | |
| DE69321245T2 (de) | Integrierte Programmierschaltung für eine elektrisch programmierbare Halbleiterspeicheranordnung mit Redundanz | |
| DE3900979C2 (de) | Elektrisch lösch- und programmierbares Nur-Lese-Speicherbauelement |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| 8364 | No opposition during term of opposition | ||
| 8339 | Ceased/non-payment of the annual fee |