DE3618573C2 - - Google Patents
Info
- Publication number
- DE3618573C2 DE3618573C2 DE19863618573 DE3618573A DE3618573C2 DE 3618573 C2 DE3618573 C2 DE 3618573C2 DE 19863618573 DE19863618573 DE 19863618573 DE 3618573 A DE3618573 A DE 3618573A DE 3618573 C2 DE3618573 C2 DE 3618573C2
- Authority
- DE
- Germany
- Prior art keywords
- discharge vessel
- discharge
- closure elements
- current
- anode
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired - Fee Related
Links
- 239000007789 gas Substances 0.000 claims description 19
- TWNQGVIAIRXVLR-UHFFFAOYSA-N oxo(oxoalumanyloxy)alumane Chemical compound O=[Al]O[Al]=O TWNQGVIAIRXVLR-UHFFFAOYSA-N 0.000 claims description 12
- 229910052756 noble gas Inorganic materials 0.000 claims description 11
- 239000011261 inert gas Substances 0.000 claims description 9
- 239000000919 ceramic Substances 0.000 claims description 8
- 239000000463 material Substances 0.000 claims description 6
- QSHDDOUJBYECFT-UHFFFAOYSA-N mercury Chemical compound [Hg] QSHDDOUJBYECFT-UHFFFAOYSA-N 0.000 claims description 6
- 229910052753 mercury Inorganic materials 0.000 claims description 6
- 229910052758 niobium Inorganic materials 0.000 claims description 4
- 239000010955 niobium Substances 0.000 claims description 4
- GUCVJGMIXFAOAE-UHFFFAOYSA-N niobium atom Chemical compound [Nb] GUCVJGMIXFAOAE-UHFFFAOYSA-N 0.000 claims description 4
- 239000000126 substance Substances 0.000 claims description 2
- 229910052715 tantalum Inorganic materials 0.000 claims description 2
- GUVRBAGPIYLISA-UHFFFAOYSA-N tantalum atom Chemical compound [Ta] GUVRBAGPIYLISA-UHFFFAOYSA-N 0.000 claims description 2
- 229910001257 Nb alloy Inorganic materials 0.000 claims 1
- 229910001362 Ta alloys Inorganic materials 0.000 claims 1
- 210000003298 dental enamel Anatomy 0.000 description 7
- XKRFYHLGVUSROY-UHFFFAOYSA-N Argon Chemical compound [Ar] XKRFYHLGVUSROY-UHFFFAOYSA-N 0.000 description 6
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 6
- 229910052708 sodium Inorganic materials 0.000 description 6
- 239000011734 sodium Substances 0.000 description 6
- 229910052724 xenon Inorganic materials 0.000 description 6
- FHNFHKCVQCLJFQ-UHFFFAOYSA-N xenon atom Chemical compound [Xe] FHNFHKCVQCLJFQ-UHFFFAOYSA-N 0.000 description 6
- 239000011230 binding agent Substances 0.000 description 5
- 238000013461 design Methods 0.000 description 5
- 230000005855 radiation Effects 0.000 description 5
- 229910045601 alloy Inorganic materials 0.000 description 4
- 239000000956 alloy Substances 0.000 description 4
- 238000005516 engineering process Methods 0.000 description 4
- 239000011521 glass Substances 0.000 description 4
- 238000002844 melting Methods 0.000 description 4
- 230000008018 melting Effects 0.000 description 4
- 239000000203 mixture Substances 0.000 description 4
- PNEYBMLMFCGWSK-UHFFFAOYSA-N aluminium oxide Inorganic materials [O-2].[O-2].[O-2].[Al+3].[Al+3] PNEYBMLMFCGWSK-UHFFFAOYSA-N 0.000 description 3
- 229910052786 argon Inorganic materials 0.000 description 3
- 230000000694 effects Effects 0.000 description 3
- 229910052734 helium Inorganic materials 0.000 description 3
- 239000001307 helium Substances 0.000 description 3
- SWQJXJOGLNCZEY-UHFFFAOYSA-N helium atom Chemical compound [He] SWQJXJOGLNCZEY-UHFFFAOYSA-N 0.000 description 3
- 229910052743 krypton Inorganic materials 0.000 description 3
- DNNSSWSSYDEUBZ-UHFFFAOYSA-N krypton atom Chemical compound [Kr] DNNSSWSSYDEUBZ-UHFFFAOYSA-N 0.000 description 3
- 238000004519 manufacturing process Methods 0.000 description 3
- 229910052754 neon Inorganic materials 0.000 description 3
- GKAOGPIIYCISHV-UHFFFAOYSA-N neon atom Chemical compound [Ne] GKAOGPIIYCISHV-UHFFFAOYSA-N 0.000 description 3
- 229910052574 oxide ceramic Inorganic materials 0.000 description 3
- 239000011224 oxide ceramic Substances 0.000 description 3
- 230000035939 shock Effects 0.000 description 3
- 238000005476 soldering Methods 0.000 description 3
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 description 2
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 2
- 239000000654 additive Substances 0.000 description 2
- 229910010293 ceramic material Inorganic materials 0.000 description 2
- 238000010276 construction Methods 0.000 description 2
- 239000004744 fabric Substances 0.000 description 2
- 229910052751 metal Inorganic materials 0.000 description 2
- 239000002184 metal Substances 0.000 description 2
- 238000000034 method Methods 0.000 description 2
- 230000001681 protective effect Effects 0.000 description 2
- WFKWXMTUELFFGS-UHFFFAOYSA-N tungsten Chemical compound [W] WFKWXMTUELFFGS-UHFFFAOYSA-N 0.000 description 2
- QCWXUUIWCKQGHC-UHFFFAOYSA-N Zirconium Chemical compound [Zr] QCWXUUIWCKQGHC-UHFFFAOYSA-N 0.000 description 1
- 230000000996 additive effect Effects 0.000 description 1
- 229910000287 alkaline earth metal oxide Inorganic materials 0.000 description 1
- 230000009286 beneficial effect Effects 0.000 description 1
- 239000005388 borosilicate glass Substances 0.000 description 1
- 239000003990 capacitor Substances 0.000 description 1
- 230000001419 dependent effect Effects 0.000 description 1
- 238000011161 development Methods 0.000 description 1
- 230000018109 developmental process Effects 0.000 description 1
- 230000005611 electricity Effects 0.000 description 1
- 230000003628 erosive effect Effects 0.000 description 1
- 230000005284 excitation Effects 0.000 description 1
- 230000002349 favourable effect Effects 0.000 description 1
- 239000002241 glass-ceramic Substances 0.000 description 1
- 238000011835 investigation Methods 0.000 description 1
- 229910052742 iron Inorganic materials 0.000 description 1
- 150000002739 metals Chemical class 0.000 description 1
- 150000002835 noble gases Chemical class 0.000 description 1
- 239000010453 quartz Substances 0.000 description 1
- 238000001953 recrystallisation Methods 0.000 description 1
- 229920006395 saturated elastomer Polymers 0.000 description 1
- 229910000679 solder Inorganic materials 0.000 description 1
- 238000012549 training Methods 0.000 description 1
- 150000003657 tungsten Chemical class 0.000 description 1
- 229910052721 tungsten Inorganic materials 0.000 description 1
- 239000010937 tungsten Substances 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 1
- 229910052726 zirconium Inorganic materials 0.000 description 1
Classifications
-
- H—ELECTRICITY
- H01—ELECTRIC ELEMENTS
- H01J—ELECTRIC DISCHARGE TUBES OR DISCHARGE LAMPS
- H01J61/00—Gas-discharge or vapour-discharge lamps
- H01J61/70—Lamps with low-pressure unconstricted discharge having a cold pressure < 400 Torr
- H01J61/80—Lamps suitable only for intermittent operation, e.g. flash lamp
-
- H—ELECTRICITY
- H01—ELECTRIC ELEMENTS
- H01J—ELECTRIC DISCHARGE TUBES OR DISCHARGE LAMPS
- H01J61/00—Gas-discharge or vapour-discharge lamps
- H01J61/02—Details
- H01J61/30—Vessels; Containers
- H01J61/302—Vessels; Containers characterised by the material of the vessel
Landscapes
- Vessels And Coating Films For Discharge Lamps (AREA)
- Discharge Lamp (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| HU256985A HU202013B (en) | 1985-07-02 | 1985-07-02 | Impulsed inert gas discharge lamp |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DE3618573A1 DE3618573A1 (de) | 1987-01-08 |
| DE3618573C2 true DE3618573C2 (enExample) | 1992-10-15 |
Family
ID=10960039
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19863618573 Granted DE3618573A1 (de) | 1985-07-02 | 1986-06-03 | Entladungslampe mit edelgasfuellung, insbesondere zum impulsartigen betrieb |
Country Status (6)
| Country | Link |
|---|---|
| JP (1) | JPS6231938A (enExample) |
| BE (1) | BE904993A (enExample) |
| DE (1) | DE3618573A1 (enExample) |
| GB (1) | GB2178230A (enExample) |
| HU (1) | HU202013B (enExample) |
| NL (1) | NL8601430A (enExample) |
Families Citing this family (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US5043634A (en) * | 1988-06-27 | 1991-08-27 | Gte Products Corporation | Pulsed light source |
| CA2316333A1 (en) * | 1997-12-29 | 1999-07-22 | Povl Kass | A lamp device and a lamp tube as well as a method of regulating the lamp device |
| DE19915920A1 (de) * | 1999-04-09 | 2000-10-19 | Heraeus Gmbh W C | Metallisches Bauteil und Entladungslampe |
| DE19933154B4 (de) * | 1999-07-20 | 2006-03-23 | W.C. Heraeus Gmbh | Entladungslampe |
| DE102005048907A1 (de) * | 2005-10-10 | 2007-04-26 | Siemens Ag | Unterflur-Blitzfeuer |
Family Cites Families (15)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| NL255240A (enExample) * | 1959-08-26 | |||
| US3502929A (en) * | 1967-07-14 | 1970-03-24 | Varian Associates | High intensity arc lamp |
| US3636395A (en) * | 1970-02-19 | 1972-01-18 | Sperry Rand Corp | Light source |
| US3705325A (en) * | 1971-01-21 | 1972-12-05 | Bell Telephone Labor Inc | Short arc discharge lamp |
| BE795680A (fr) * | 1972-02-21 | 1973-08-20 | Philips Nv | Lampe a decharge a haute pression, munie d'un conducteur de traversee metallique |
| GB1381648A (en) * | 1972-10-11 | 1975-01-22 | Sysun V V Basov J G | Gas discharge devices |
| JPS51102380A (ja) * | 1975-03-07 | 1976-09-09 | Hitachi Ltd | Hodento |
| DE2848891C2 (de) * | 1978-11-10 | 1982-12-30 | Heimann Gmbh, 6200 Wiesbaden | Blitzlichtlampe |
| NL7903285A (nl) * | 1979-04-26 | 1980-10-28 | Philips Nv | Ontladingslamp. |
| NL7903286A (nl) * | 1979-04-26 | 1980-10-28 | Philips Nv | Ontladingsbuis. |
| US4315187A (en) * | 1979-11-13 | 1982-02-09 | Nam Kwong Electric Co. Ltd. | Stroboscopic dishcharge tube for photography |
| JPS56134466A (en) * | 1980-03-24 | 1981-10-21 | Univ Osaka | Flush lamp |
| JPS581510A (ja) * | 1981-06-29 | 1983-01-06 | 井上 秋忠 | い草泥落機 |
| DE3227280A1 (de) * | 1982-07-21 | 1984-01-26 | Heimann Gmbh, 6200 Wiesbaden | Gasentladungslampe, insbesondere blitzroehre |
| JPS59148256A (ja) * | 1983-02-10 | 1984-08-24 | Oak Kk | 閃光放電管 |
-
1985
- 1985-07-02 HU HU256985A patent/HU202013B/hu not_active IP Right Cessation
-
1986
- 1986-06-03 DE DE19863618573 patent/DE3618573A1/de active Granted
- 1986-06-03 NL NL8601430A patent/NL8601430A/nl not_active Application Discontinuation
- 1986-06-25 BE BE0/216833A patent/BE904993A/fr not_active IP Right Cessation
- 1986-06-30 GB GB08615913A patent/GB2178230A/en not_active Withdrawn
- 1986-07-01 JP JP15282586A patent/JPS6231938A/ja active Pending
Also Published As
| Publication number | Publication date |
|---|---|
| HUT52894A (en) | 1990-08-28 |
| NL8601430A (nl) | 1987-02-02 |
| HU202013B (en) | 1991-01-28 |
| GB8615913D0 (en) | 1986-08-06 |
| DE3618573A1 (de) | 1987-01-08 |
| JPS6231938A (ja) | 1987-02-10 |
| BE904993A (fr) | 1986-10-16 |
| GB2178230A (en) | 1987-02-04 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE3133642C2 (enExample) | ||
| DE3716485C1 (de) | Xenon-Kurzbogen-Entladungslampe | |
| DE1217496B (de) | Quecksilberdampf-Hochdruckentladungslampe mit Metallhalogen-Zusatz | |
| DE19801485A1 (de) | Halogen-Metalldampflampe | |
| DE69604362T2 (de) | Elektrodenlose niederdruckentladungslampe | |
| DE3008518C2 (de) | Elektrode für eine Entladungslampe | |
| DE2346132A1 (de) | Keramik-entladungslampe | |
| DE3618573C2 (enExample) | ||
| DE2142338A1 (de) | Optischer Sender oder Verstarker mit gasförmigem Medium | |
| DE2625554C2 (de) | Wandstabilisierte Blitzröhre | |
| DE4031117A1 (de) | Hochdruckentladungslampe und verfahren zur herstellung der lampe | |
| DE3123604C2 (de) | Metalldampf-Hochdruckentladungslampe | |
| DE2131887C3 (de) | Blitzentladungslampe | |
| EP0456907B1 (de) | Hochdruckentladungslampe | |
| DE1065092B (de) | Blitzlichtentladungslampe | |
| DE2328128C3 (de) | Blitzentladungsröhre | |
| DE3110818A1 (de) | Bogenentladungslampe | |
| DE1126991B (de) | Wandstabilisierte elektrische Edelgas-Hochdruck-Entladungslampe und Verfahren zu ihrer Herstellung | |
| DE10336088A1 (de) | UV-Strahler mit rohrförmigem Entladungsgefäß | |
| DE2722694C2 (de) | Quecksilberdampf-Niederdruckentladungslampe | |
| DE3742991C2 (enExample) | ||
| DE69205228T2 (de) | Hochdrucknatriumlampe. | |
| DE102010034661B4 (de) | Kurzbogen-Entladungslampe mit Längsöffnung in der Anode, an deren Innenfläche Mikrorisse gebildet sind | |
| DE3307197C2 (enExample) | ||
| DE3200698A1 (de) | Hochdruck-natriumdampflampe |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| 8110 | Request for examination paragraph 44 | ||
| D2 | Grant after examination | ||
| 8364 | No opposition during term of opposition | ||
| 8339 | Ceased/non-payment of the annual fee |