DE3540627C2 - - Google Patents
Info
- Publication number
- DE3540627C2 DE3540627C2 DE3540627A DE3540627A DE3540627C2 DE 3540627 C2 DE3540627 C2 DE 3540627C2 DE 3540627 A DE3540627 A DE 3540627A DE 3540627 A DE3540627 A DE 3540627A DE 3540627 C2 DE3540627 C2 DE 3540627C2
- Authority
- DE
- Germany
- Prior art keywords
- heat
- color
- bis
- layer
- sensitive
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 230000015572 biosynthetic process Effects 0.000 claims description 110
- 239000000463 material Substances 0.000 claims description 47
- -1 aromatic diamide derivative Chemical class 0.000 claims description 31
- 125000000217 alkyl group Chemical group 0.000 claims description 14
- 239000003795 chemical substances by application Substances 0.000 claims description 13
- 150000004885 piperazines Chemical class 0.000 claims description 9
- 125000003118 aryl group Chemical group 0.000 claims description 8
- 125000003710 aryl alkyl group Chemical group 0.000 claims description 6
- 238000011161 development Methods 0.000 claims description 6
- 230000002378 acidificating effect Effects 0.000 claims description 5
- 125000002947 alkylene group Chemical group 0.000 claims description 5
- 125000004442 acylamino group Chemical group 0.000 claims description 4
- 125000000753 cycloalkyl group Chemical group 0.000 claims description 4
- 229910052739 hydrogen Inorganic materials 0.000 claims description 4
- 239000001257 hydrogen Substances 0.000 claims description 4
- 125000004435 hydrogen atom Chemical class [H]* 0.000 claims description 4
- 239000003086 colorant Substances 0.000 claims description 2
- 125000000547 substituted alkyl group Chemical group 0.000 claims description 2
- 125000003107 substituted aryl group Chemical group 0.000 claims description 2
- 125000005346 substituted cycloalkyl group Chemical group 0.000 claims description 2
- OAKJQQAXSVQMHS-UHFFFAOYSA-N Hydrazine Chemical compound NN OAKJQQAXSVQMHS-UHFFFAOYSA-N 0.000 claims 1
- 239000010410 layer Substances 0.000 description 133
- 229910052757 nitrogen Inorganic materials 0.000 description 100
- 239000006185 dispersion Substances 0.000 description 56
- 239000007788 liquid Substances 0.000 description 40
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 30
- 239000011248 coating agent Substances 0.000 description 27
- 238000000576 coating method Methods 0.000 description 27
- 238000004042 decolorization Methods 0.000 description 19
- 239000000975 dye Substances 0.000 description 18
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 15
- VTYYLEPIZMXCLO-UHFFFAOYSA-L Calcium carbonate Chemical compound [Ca+2].[O-]C([O-])=O VTYYLEPIZMXCLO-UHFFFAOYSA-L 0.000 description 14
- 239000004372 Polyvinyl alcohol Substances 0.000 description 14
- 229920002451 polyvinyl alcohol Polymers 0.000 description 14
- VZSRBBMJRBPUNF-UHFFFAOYSA-N 2-(2,3-dihydro-1H-inden-2-ylamino)-N-[3-oxo-3-(2,4,6,7-tetrahydrotriazolo[4,5-c]pyridin-5-yl)propyl]pyrimidine-5-carboxamide Chemical compound C1C(CC2=CC=CC=C12)NC1=NC=C(C=N1)C(=O)NCCC(N1CC2=C(CC1)NN=N2)=O VZSRBBMJRBPUNF-UHFFFAOYSA-N 0.000 description 13
- GLUUGHFHXGJENI-UHFFFAOYSA-N Piperazine Chemical compound C1CNCCN1 GLUUGHFHXGJENI-UHFFFAOYSA-N 0.000 description 13
- 239000002245 particle Substances 0.000 description 11
- 239000004576 sand Substances 0.000 description 11
- 238000004040 coloring Methods 0.000 description 9
- 230000000052 comparative effect Effects 0.000 description 9
- 229920000663 Hydroxyethyl cellulose Polymers 0.000 description 8
- 239000004354 Hydroxyethyl cellulose Substances 0.000 description 8
- 239000007864 aqueous solution Substances 0.000 description 8
- 235000019447 hydroxyethyl cellulose Nutrition 0.000 description 8
- 238000000926 separation method Methods 0.000 description 8
- 229910000019 calcium carbonate Inorganic materials 0.000 description 7
- 238000003490 calendering Methods 0.000 description 7
- 125000004432 carbon atom Chemical group C* 0.000 description 7
- 150000003839 salts Chemical class 0.000 description 7
- 239000000243 solution Substances 0.000 description 7
- LYRFLYHAGKPMFH-UHFFFAOYSA-N octadecanamide Chemical class CCCCCCCCCCCCCCCCCC(N)=O LYRFLYHAGKPMFH-UHFFFAOYSA-N 0.000 description 6
- 238000002360 preparation method Methods 0.000 description 6
- 229920001577 copolymer Polymers 0.000 description 5
- 235000014113 dietary fatty acids Nutrition 0.000 description 5
- 239000000194 fatty acid Substances 0.000 description 5
- 229930195729 fatty acid Natural products 0.000 description 5
- 229910000040 hydrogen fluoride Inorganic materials 0.000 description 5
- FRVCGRDGKAINSV-UHFFFAOYSA-L iron(2+);octadecanoate Chemical compound [Fe+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O FRVCGRDGKAINSV-UHFFFAOYSA-L 0.000 description 5
- VKLRYNRORSWXRK-UHFFFAOYSA-N n-[3-[4-(3-benzamidopropyl)piperazin-1-yl]propyl]benzamide Chemical compound C=1C=CC=CC=1C(=O)NCCCN(CC1)CCN1CCCNC(=O)C1=CC=CC=C1 VKLRYNRORSWXRK-UHFFFAOYSA-N 0.000 description 5
- 229940066771 systemic antihistamines piperazine derivative Drugs 0.000 description 5
- QIGBRXMKCJKVMJ-UHFFFAOYSA-N Hydroquinone Chemical compound OC1=CC=C(O)C=C1 QIGBRXMKCJKVMJ-UHFFFAOYSA-N 0.000 description 4
- 238000001035 drying Methods 0.000 description 4
- 238000004519 manufacturing process Methods 0.000 description 4
- 238000000034 method Methods 0.000 description 4
- 239000000203 mixture Substances 0.000 description 4
- GHMLBKRAJCXXBS-UHFFFAOYSA-N resorcinol Chemical compound OC1=CC=CC(O)=C1 GHMLBKRAJCXXBS-UHFFFAOYSA-N 0.000 description 4
- HXZRLUTUNSQNCG-UHFFFAOYSA-N 1-[3-(2-oxoazepane-1-carbonyl)benzoyl]azepan-2-one Chemical compound C=1C=CC(C(=O)N2C(CCCCC2)=O)=CC=1C(=O)N1CCCCCC1=O HXZRLUTUNSQNCG-UHFFFAOYSA-N 0.000 description 3
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 3
- 239000002253 acid Substances 0.000 description 3
- 239000011230 binding agent Substances 0.000 description 3
- 238000002845 discoloration Methods 0.000 description 3
- 150000004665 fatty acids Chemical class 0.000 description 3
- 229910001385 heavy metal Inorganic materials 0.000 description 3
- 229910052751 metal Inorganic materials 0.000 description 3
- 239000002184 metal Substances 0.000 description 3
- 229940037312 stearamide Drugs 0.000 description 3
- 239000000758 substrate Substances 0.000 description 3
- 238000012360 testing method Methods 0.000 description 3
- KJCVRFUGPWSIIH-UHFFFAOYSA-N 1-naphthol Chemical compound C1=CC=C2C(O)=CC=CC2=C1 KJCVRFUGPWSIIH-UHFFFAOYSA-N 0.000 description 2
- GSCLSACFHWKTQU-UHFFFAOYSA-N 2'-chloro-6'-(diethylamino)spiro[2-benzofuran-3,9'-xanthene]-1-one Chemical compound O1C(=O)C2=CC=CC=C2C21C1=CC(Cl)=CC=C1OC1=CC(N(CC)CC)=CC=C21 GSCLSACFHWKTQU-UHFFFAOYSA-N 0.000 description 2
- JWAZRIHNYRIHIV-UHFFFAOYSA-N 2-naphthol Chemical compound C1=CC=CC2=CC(O)=CC=C21 JWAZRIHNYRIHIV-UHFFFAOYSA-N 0.000 description 2
- 125000000094 2-phenylethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])C([H])([H])* 0.000 description 2
- TUAMRELNJMMDMT-UHFFFAOYSA-N 3,5-xylenol Chemical compound CC1=CC(C)=CC(O)=C1 TUAMRELNJMMDMT-UHFFFAOYSA-N 0.000 description 2
- TXFPEBPIARQUIG-UHFFFAOYSA-N 4'-hydroxyacetophenone Chemical compound CC(=O)C1=CC=C(O)C=C1 TXFPEBPIARQUIG-UHFFFAOYSA-N 0.000 description 2
- DLFVBJFMPXGRIB-UHFFFAOYSA-N Acetamide Chemical class CC(N)=O DLFVBJFMPXGRIB-UHFFFAOYSA-N 0.000 description 2
- HRPVXLWXLXDGHG-UHFFFAOYSA-N Acrylamide Chemical compound NC(=O)C=C HRPVXLWXLXDGHG-UHFFFAOYSA-N 0.000 description 2
- MOZDKDIOPSPTBH-UHFFFAOYSA-N Benzyl parahydroxybenzoate Chemical compound C1=CC(O)=CC=C1C(=O)OCC1=CC=CC=C1 MOZDKDIOPSPTBH-UHFFFAOYSA-N 0.000 description 2
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 2
- PEDCQBHIVMGVHV-UHFFFAOYSA-N Glycerine Chemical compound OCC(O)CO PEDCQBHIVMGVHV-UHFFFAOYSA-N 0.000 description 2
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 description 2
- NIPNSKYNPDTRPC-UHFFFAOYSA-N N-[2-oxo-2-(2,4,6,7-tetrahydrotriazolo[4,5-c]pyridin-5-yl)ethyl]-2-[[3-(trifluoromethoxy)phenyl]methylamino]pyrimidine-5-carboxamide Chemical compound O=C(CNC(=O)C=1C=NC(=NC=1)NCC1=CC(=CC=C1)OC(F)(F)F)N1CC2=C(CC1)NN=N2 NIPNSKYNPDTRPC-UHFFFAOYSA-N 0.000 description 2
- AFCARXCZXQIEQB-UHFFFAOYSA-N N-[3-oxo-3-(2,4,6,7-tetrahydrotriazolo[4,5-c]pyridin-5-yl)propyl]-2-[[3-(trifluoromethoxy)phenyl]methylamino]pyrimidine-5-carboxamide Chemical compound O=C(CCNC(=O)C=1C=NC(=NC=1)NCC1=CC(=CC=C1)OC(F)(F)F)N1CC2=C(CC1)NN=N2 AFCARXCZXQIEQB-UHFFFAOYSA-N 0.000 description 2
- PXHVJJICTQNCMI-UHFFFAOYSA-N Nickel Chemical compound [Ni] PXHVJJICTQNCMI-UHFFFAOYSA-N 0.000 description 2
- 229920002125 Sokalan® Polymers 0.000 description 2
- PPBRXRYQALVLMV-UHFFFAOYSA-N Styrene Chemical compound C=CC1=CC=CC=C1 PPBRXRYQALVLMV-UHFFFAOYSA-N 0.000 description 2
- XLOMVQKBTHCTTD-UHFFFAOYSA-N Zinc monoxide Chemical compound [Zn]=O XLOMVQKBTHCTTD-UHFFFAOYSA-N 0.000 description 2
- 125000000738 acetamido group Chemical group [H]C([H])([H])C(=O)N([H])[*] 0.000 description 2
- 150000001412 amines Chemical class 0.000 description 2
- TZCXTZWJZNENPQ-UHFFFAOYSA-L barium sulfate Chemical compound [Ba+2].[O-]S([O-])(=O)=O TZCXTZWJZNENPQ-UHFFFAOYSA-L 0.000 description 2
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 2
- YXVFYQXJAXKLAK-UHFFFAOYSA-N biphenyl-4-ol Chemical compound C1=CC(O)=CC=C1C1=CC=CC=C1 YXVFYQXJAXKLAK-UHFFFAOYSA-N 0.000 description 2
- IISBACLAFKSPIT-UHFFFAOYSA-N bisphenol A Chemical compound C=1C=C(O)C=CC=1C(C)(C)C1=CC=C(O)C=C1 IISBACLAFKSPIT-UHFFFAOYSA-N 0.000 description 2
- YCIMNLLNPGFGHC-UHFFFAOYSA-N catechol Chemical compound OC1=CC=CC=C1O YCIMNLLNPGFGHC-UHFFFAOYSA-N 0.000 description 2
- 229920002678 cellulose Polymers 0.000 description 2
- 239000001913 cellulose Substances 0.000 description 2
- 235000010980 cellulose Nutrition 0.000 description 2
- 150000001875 compounds Chemical class 0.000 description 2
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 2
- 150000002148 esters Chemical class 0.000 description 2
- 239000000945 filler Substances 0.000 description 2
- FWQHNLCNFPYBCA-UHFFFAOYSA-N fluoran Chemical compound C12=CC=CC=C2OC2=CC=CC=C2C11OC(=O)C2=CC=CC=C21 FWQHNLCNFPYBCA-UHFFFAOYSA-N 0.000 description 2
- LNTHITQWFMADLM-UHFFFAOYSA-N gallic acid Chemical compound OC(=O)C1=CC(O)=C(O)C(O)=C1 LNTHITQWFMADLM-UHFFFAOYSA-N 0.000 description 2
- 150000002334 glycols Chemical class 0.000 description 2
- 238000009499 grossing Methods 0.000 description 2
- 229910052736 halogen Inorganic materials 0.000 description 2
- 150000002367 halogens Chemical class 0.000 description 2
- IPCSVZSSVZVIGE-UHFFFAOYSA-N hexadecanoic acid Chemical compound CCCCCCCCCCCCCCCC(O)=O IPCSVZSSVZVIGE-UHFFFAOYSA-N 0.000 description 2
- 230000001939 inductive effect Effects 0.000 description 2
- 150000003951 lactams Chemical class 0.000 description 2
- QSHDDOUJBYECFT-UHFFFAOYSA-N mercury Chemical compound [Hg] QSHDDOUJBYECFT-UHFFFAOYSA-N 0.000 description 2
- 229910052753 mercury Inorganic materials 0.000 description 2
- ZKCFCLVNNPLCAH-UHFFFAOYSA-N methyl 4-[3-[4-[3-[(4-methoxycarbonylbenzoyl)amino]propyl]piperazin-1-yl]propylcarbamoyl]benzoate Chemical compound C1=CC(C(=O)OC)=CC=C1C(=O)NCCCN1CCN(CCCNC(=O)C=2C=CC(=CC=2)C(=O)OC)CC1 ZKCFCLVNNPLCAH-UHFFFAOYSA-N 0.000 description 2
- LXCFILQKKLGQFO-UHFFFAOYSA-N methylparaben Chemical compound COC(=O)C1=CC=C(O)C=C1 LXCFILQKKLGQFO-UHFFFAOYSA-N 0.000 description 2
- RKISUIUJZGSLEV-UHFFFAOYSA-N n-[2-(octadecanoylamino)ethyl]octadecanamide Chemical compound CCCCCCCCCCCCCCCCCC(=O)NCCNC(=O)CCCCCCCCCCCCCCCCC RKISUIUJZGSLEV-UHFFFAOYSA-N 0.000 description 2
- JGJRIHAFHRXKBN-UHFFFAOYSA-N n-[6-[4-(6-benzamidohexyl)piperazin-1-yl]hexyl]benzamide Chemical compound C=1C=CC=CC=1C(=O)NCCCCCCN(CC1)CCN1CCCCCCNC(=O)C1=CC=CC=C1 JGJRIHAFHRXKBN-UHFFFAOYSA-N 0.000 description 2
- HKUFIYBZNQSHQS-UHFFFAOYSA-N n-octadecyloctadecan-1-amine Chemical compound CCCCCCCCCCCCCCCCCCNCCCCCCCCCCCCCCCCCC HKUFIYBZNQSHQS-UHFFFAOYSA-N 0.000 description 2
- 150000007524 organic acids Chemical class 0.000 description 2
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 2
- 239000004584 polyacrylic acid Substances 0.000 description 2
- 239000000843 powder Substances 0.000 description 2
- WQGWDDDVZFFDIG-UHFFFAOYSA-N pyrogallol Chemical compound OC1=CC=CC(O)=C1O WQGWDDDVZFFDIG-UHFFFAOYSA-N 0.000 description 2
- 239000000377 silicon dioxide Substances 0.000 description 2
- 235000012239 silicon dioxide Nutrition 0.000 description 2
- 159000000000 sodium salts Chemical class 0.000 description 2
- UMGDCJDMYOKAJW-UHFFFAOYSA-N thiourea Chemical compound NC(N)=S UMGDCJDMYOKAJW-UHFFFAOYSA-N 0.000 description 2
- MGSRCZKZVOBKFT-UHFFFAOYSA-N thymol Chemical compound CC(C)C1=CC=C(C)C=C1O MGSRCZKZVOBKFT-UHFFFAOYSA-N 0.000 description 2
- 125000003944 tolyl group Chemical group 0.000 description 2
- 125000005023 xylyl group Chemical group 0.000 description 2
- ZDAAPEPLJTXHQY-UHFFFAOYSA-N (2-chlorophenyl)methyl 4-hydroxybenzoate Chemical compound C1=CC(O)=CC=C1C(=O)OCC1=CC=CC=C1Cl ZDAAPEPLJTXHQY-UHFFFAOYSA-N 0.000 description 1
- LIZLYZVAYZQVPG-UHFFFAOYSA-N (3-bromo-2-fluorophenyl)methanol Chemical compound OCC1=CC=CC(Br)=C1F LIZLYZVAYZQVPG-UHFFFAOYSA-N 0.000 description 1
- WAOCEEXLEFNWKA-UHFFFAOYSA-N (4-chlorophenyl)methyl 4-hydroxybenzoate Chemical compound C1=CC(O)=CC=C1C(=O)OCC1=CC=C(Cl)C=C1 WAOCEEXLEFNWKA-UHFFFAOYSA-N 0.000 description 1
- BYFJLAHGKYACPI-UHFFFAOYSA-N (4-methylphenyl)methyl 4-hydroxybenzoate Chemical compound C1=CC(C)=CC=C1COC(=O)C1=CC=C(O)C=C1 BYFJLAHGKYACPI-UHFFFAOYSA-N 0.000 description 1
- DDMUCNBBNKTNCX-UHFFFAOYSA-N 1,3-bis(3-chlorophenyl)thiourea Chemical compound ClC1=CC=CC(NC(=S)NC=2C=C(Cl)C=CC=2)=C1 DDMUCNBBNKTNCX-UHFFFAOYSA-N 0.000 description 1
- ZFMWVFOQAAUFDD-UHFFFAOYSA-N 1,3-bis(3-methylphenyl)thiourea Chemical compound CC1=CC=CC(NC(=S)NC=2C=C(C)C=CC=2)=C1 ZFMWVFOQAAUFDD-UHFFFAOYSA-N 0.000 description 1
- SYJZYFOTCABQES-UHFFFAOYSA-N 1,3-bis(4-chlorophenyl)thiourea Chemical compound C1=CC(Cl)=CC=C1NC(=S)NC1=CC=C(Cl)C=C1 SYJZYFOTCABQES-UHFFFAOYSA-N 0.000 description 1
- OLCTWHDDTLNSNS-UHFFFAOYSA-N 1,3-bis[3-(trifluoromethyl)phenyl]thiourea Chemical compound FC(F)(F)C1=CC=CC(NC(=S)NC=2C=C(C=CC=2)C(F)(F)F)=C1 OLCTWHDDTLNSNS-UHFFFAOYSA-N 0.000 description 1
- QKKYRIWROSZLQT-UHFFFAOYSA-N 1-[2-(2-oxoazepane-1-carbonyl)benzoyl]azepan-2-one Chemical compound C=1C=CC=C(C(=O)N2C(CCCCC2)=O)C=1C(=O)N1CCCCCC1=O QKKYRIWROSZLQT-UHFFFAOYSA-N 0.000 description 1
- ABRBNODEXHWBDK-UHFFFAOYSA-N 1-[2-(2-oxopiperidine-1-carbonyl)benzoyl]piperidin-2-one Chemical compound C=1C=CC=C(C(=O)N2C(CCCC2)=O)C=1C(=O)N1CCCCC1=O ABRBNODEXHWBDK-UHFFFAOYSA-N 0.000 description 1
- HLOJGPJXNVGELK-UHFFFAOYSA-N 1-[3-(2-oxopiperidine-1-carbonyl)benzoyl]piperidin-2-one Chemical compound C=1C=CC(C(=O)N2C(CCCC2)=O)=CC=1C(=O)N1CCCCC1=O HLOJGPJXNVGELK-UHFFFAOYSA-N 0.000 description 1
- IOGGBUVFUGPCLQ-UHFFFAOYSA-N 1-[4-(2-oxoazepane-1-carbonyl)benzoyl]azepan-2-one Chemical compound C=1C=C(C(=O)N2C(CCCCC2)=O)C=CC=1C(=O)N1CCCCCC1=O IOGGBUVFUGPCLQ-UHFFFAOYSA-N 0.000 description 1
- INSKBXQYJSMEJF-UHFFFAOYSA-N 1-[4-(2-oxopiperidine-1-carbonyl)benzoyl]piperidin-2-one Chemical compound C=1C=C(C(=O)N2C(CCCC2)=O)C=CC=1C(=O)N1CCCCC1=O INSKBXQYJSMEJF-UHFFFAOYSA-N 0.000 description 1
- ZFWAHZCOKGWUIT-UHFFFAOYSA-N 1-anilino-3-phenyliminourea Chemical compound C=1C=CC=CC=1N=NC(=O)NNC1=CC=CC=C1 ZFWAHZCOKGWUIT-UHFFFAOYSA-N 0.000 description 1
- SJJCQDRGABAVBB-UHFFFAOYSA-N 1-hydroxy-2-naphthoic acid Chemical compound C1=CC=CC2=C(O)C(C(=O)O)=CC=C21 SJJCQDRGABAVBB-UHFFFAOYSA-N 0.000 description 1
- IXPNQXFRVYWDDI-UHFFFAOYSA-N 1-methyl-2,4-dioxo-1,3-diazinane-5-carboximidamide Chemical compound CN1CC(C(N)=N)C(=O)NC1=O IXPNQXFRVYWDDI-UHFFFAOYSA-N 0.000 description 1
- WJFKNYWRSNBZNX-UHFFFAOYSA-N 10H-phenothiazine Chemical compound C1=CC=C2NC3=CC=CC=C3SC2=C1 WJFKNYWRSNBZNX-UHFFFAOYSA-N 0.000 description 1
- JFNWGAYGVJGNBG-UHFFFAOYSA-N 2'-anilino-3'-methyl-6'-pyrrolidin-1-ylspiro[2-benzofuran-3,9'-xanthene]-1-one Chemical compound CC1=CC=2OC3=CC(N4CCCC4)=CC=C3C3(C4=CC=CC=C4C(=O)O3)C=2C=C1NC1=CC=CC=C1 JFNWGAYGVJGNBG-UHFFFAOYSA-N 0.000 description 1
- KGRVJHAUYBGFFP-UHFFFAOYSA-N 2,2'-Methylenebis(4-methyl-6-tert-butylphenol) Chemical compound CC(C)(C)C1=CC(C)=CC(CC=2C(=C(C=C(C)C=2)C(C)(C)C)O)=C1O KGRVJHAUYBGFFP-UHFFFAOYSA-N 0.000 description 1
- BURBNIPKSRJAIQ-UHFFFAOYSA-N 2-azaniumyl-3-[3-(trifluoromethyl)phenyl]propanoate Chemical compound OC(=O)C(N)CC1=CC=CC(C(F)(F)F)=C1 BURBNIPKSRJAIQ-UHFFFAOYSA-N 0.000 description 1
- XBQRPFBBTWXIFI-UHFFFAOYSA-N 2-chloro-4-[2-(3-chloro-4-hydroxyphenyl)propan-2-yl]phenol Chemical compound C=1C=C(O)C(Cl)=CC=1C(C)(C)C1=CC=C(O)C(Cl)=C1 XBQRPFBBTWXIFI-UHFFFAOYSA-N 0.000 description 1
- CQQQDRUVGKBKCP-UHFFFAOYSA-N 2-chloro-n-[3-[4-[3-[(2-chlorobenzoyl)amino]propyl]piperazin-1-yl]propyl]benzamide Chemical compound ClC1=CC=CC=C1C(=O)NCCCN1CCN(CCCNC(=O)C=2C(=CC=CC=2)Cl)CC1 CQQQDRUVGKBKCP-UHFFFAOYSA-N 0.000 description 1
- MWATYUAXYBPMRX-UHFFFAOYSA-N 2-chloro-n-[6-[4-[6-[(2-chlorobenzoyl)amino]hexyl]piperazin-1-yl]hexyl]benzamide Chemical compound ClC1=CC=CC=C1C(=O)NCCCCCCN1CCN(CCCCCCNC(=O)C=2C(=CC=CC=2)Cl)CC1 MWATYUAXYBPMRX-UHFFFAOYSA-N 0.000 description 1
- IRXLHWQRMFTTHW-UHFFFAOYSA-N 2-phenyl-n-[3-[4-[3-[(2-phenylacetyl)amino]propyl]piperazin-1-yl]propyl]acetamide Chemical compound C1CN(CCCNC(=O)CC=2C=CC=CC=2)CCN1CCCNC(=O)CC1=CC=CC=C1 IRXLHWQRMFTTHW-UHFFFAOYSA-N 0.000 description 1
- ZDRSNHRWLQQICP-UHFFFAOYSA-N 2-tert-butyl-4-[2-(3-tert-butyl-4-hydroxyphenyl)propan-2-yl]phenol Chemical compound C1=C(O)C(C(C)(C)C)=CC(C(C)(C)C=2C=C(C(O)=CC=2)C(C)(C)C)=C1 ZDRSNHRWLQQICP-UHFFFAOYSA-N 0.000 description 1
- BCHZICNRHXRCHY-UHFFFAOYSA-N 2h-oxazine Chemical compound N1OC=CC=C1 BCHZICNRHXRCHY-UHFFFAOYSA-N 0.000 description 1
- VEORPZCZECFIRK-UHFFFAOYSA-N 3,3',5,5'-tetrabromobisphenol A Chemical compound C=1C(Br)=C(O)C(Br)=CC=1C(C)(C)C1=CC(Br)=C(O)C(Br)=C1 VEORPZCZECFIRK-UHFFFAOYSA-N 0.000 description 1
- YMTYZTXUZLQUSF-UHFFFAOYSA-N 3,3'-Dimethylbisphenol A Chemical compound C1=C(O)C(C)=CC(C(C)(C)C=2C=C(C)C(O)=CC=2)=C1 YMTYZTXUZLQUSF-UHFFFAOYSA-N 0.000 description 1
- ABJAMKKUHBSXDS-UHFFFAOYSA-N 3,3-bis(6-amino-1,4-dimethylcyclohexa-2,4-dien-1-yl)-2-benzofuran-1-one Chemical compound C1=CC(C)=CC(N)C1(C)C1(C2(C)C(C=C(C)C=C2)N)C2=CC=CC=C2C(=O)O1 ABJAMKKUHBSXDS-UHFFFAOYSA-N 0.000 description 1
- DJRJYWNDMBCUSJ-UHFFFAOYSA-N 3,3-bis[4-(dibutylamino)phenyl]-2-benzofuran-1-one Chemical compound C1=CC(N(CCCC)CCCC)=CC=C1C1(C=2C=CC(=CC=2)N(CCCC)CCCC)C2=CC=CC=C2C(=O)O1 DJRJYWNDMBCUSJ-UHFFFAOYSA-N 0.000 description 1
- YLZOPXRUQYQQID-UHFFFAOYSA-N 3-(2,4,6,7-tetrahydrotriazolo[4,5-c]pyridin-5-yl)-1-[4-[2-[[3-(trifluoromethoxy)phenyl]methylamino]pyrimidin-5-yl]piperazin-1-yl]propan-1-one Chemical compound N1N=NC=2CN(CCC=21)CCC(=O)N1CCN(CC1)C=1C=NC(=NC=1)NCC1=CC(=CC=C1)OC(F)(F)F YLZOPXRUQYQQID-UHFFFAOYSA-N 0.000 description 1
- PGAAZCXJMPDCHO-UHFFFAOYSA-N 3-(4-chloro-2-hydroxy-5-methylphenyl)-3-[4-(dimethylamino)-2-methoxyphenyl]-2-benzofuran-1-one Chemical compound COC1=CC(N(C)C)=CC=C1C1(C=2C(=CC(Cl)=C(C)C=2)O)C2=CC=CC=C2C(=O)O1 PGAAZCXJMPDCHO-UHFFFAOYSA-N 0.000 description 1
- RHWGUGLTKRIMRC-UHFFFAOYSA-N 3-(5-chloro-2-methoxyphenyl)-3-[4-(dimethylamino)-2-hydroxyphenyl]-2-benzofuran-1-one Chemical compound COC1=CC=C(Cl)C=C1C1(C=2C(=CC(=CC=2)N(C)C)O)C2=CC=CC=C2C(=O)O1 RHWGUGLTKRIMRC-UHFFFAOYSA-N 0.000 description 1
- HGISGXNMSVYLSZ-UHFFFAOYSA-N 3-[4-(dimethylamino)-2-hydroxyphenyl]-3-(2-methoxy-5-methylphenyl)-2-benzofuran-1-one Chemical compound COC1=CC=C(C)C=C1C1(C=2C(=CC(=CC=2)N(C)C)O)C2=CC=CC=C2C(=O)O1 HGISGXNMSVYLSZ-UHFFFAOYSA-N 0.000 description 1
- LSYHVTSZEQZQNJ-UHFFFAOYSA-N 3-[4-(dimethylamino)-2-hydroxyphenyl]-3-(2-methoxy-5-nitrophenyl)-2-benzofuran-1-one Chemical compound COC1=CC=C([N+]([O-])=O)C=C1C1(C=2C(=CC(=CC=2)N(C)C)O)C2=CC=CC=C2C(=O)O1 LSYHVTSZEQZQNJ-UHFFFAOYSA-N 0.000 description 1
- BBJHWPAIBCAPKZ-UHFFFAOYSA-N 3-methyl-n-[3-[4-[3-[(3-methylbenzoyl)amino]propyl]piperazin-1-yl]propyl]benzamide Chemical compound CC1=CC=CC(C(=O)NCCCN2CCN(CCCNC(=O)C=3C=C(C)C=CC=3)CC2)=C1 BBJHWPAIBCAPKZ-UHFFFAOYSA-N 0.000 description 1
- VWGKEVWFBOUAND-UHFFFAOYSA-N 4,4'-thiodiphenol Chemical compound C1=CC(O)=CC=C1SC1=CC=C(O)C=C1 VWGKEVWFBOUAND-UHFFFAOYSA-N 0.000 description 1
- BOTKTAZUSYVSFF-UHFFFAOYSA-N 4-(2,4,4-trimethylpentan-2-yl)benzene-1,2-diol Chemical compound CC(C)(C)CC(C)(C)C1=CC=C(O)C(O)=C1 BOTKTAZUSYVSFF-UHFFFAOYSA-N 0.000 description 1
- JSUKRBMPOXGCPR-UHFFFAOYSA-N 4-(benzenesulfonyl)phenol Chemical compound C1=CC(O)=CC=C1S(=O)(=O)C1=CC=CC=C1 JSUKRBMPOXGCPR-UHFFFAOYSA-N 0.000 description 1
- SVOBELCYOCEECO-UHFFFAOYSA-N 4-[1-(4-hydroxy-3-methylphenyl)cyclohexyl]-2-methylphenol Chemical compound C1=C(O)C(C)=CC(C2(CCCCC2)C=2C=C(C)C(O)=CC=2)=C1 SVOBELCYOCEECO-UHFFFAOYSA-N 0.000 description 1
- AXPUUWUULFGYOR-UHFFFAOYSA-N 4-chloro-n-[2-[4-[2-[(4-chlorobenzoyl)amino]ethyl]piperazin-1-yl]ethyl]benzamide Chemical compound C1=CC(Cl)=CC=C1C(=O)NCCN1CCN(CCNC(=O)C=2C=CC(Cl)=CC=2)CC1 AXPUUWUULFGYOR-UHFFFAOYSA-N 0.000 description 1
- HDEDUHNBJRONKQ-UHFFFAOYSA-N 4-chloro-n-[3-[4-[3-[(4-chlorobenzoyl)amino]propyl]piperazin-1-yl]propyl]benzamide Chemical compound C1=CC(Cl)=CC=C1C(=O)NCCCN1CCN(CCCNC(=O)C=2C=CC(Cl)=CC=2)CC1 HDEDUHNBJRONKQ-UHFFFAOYSA-N 0.000 description 1
- KUPYTHQTOOFWHE-UHFFFAOYSA-N 4-chloro-n-[6-[4-[6-[(4-chlorobenzoyl)amino]hexyl]piperazin-1-yl]hexyl]benzamide Chemical compound C1=CC(Cl)=CC=C1C(=O)NCCCCCCN1CCN(CCCCCCNC(=O)C=2C=CC(Cl)=CC=2)CC1 KUPYTHQTOOFWHE-UHFFFAOYSA-N 0.000 description 1
- 229940073735 4-hydroxy acetophenone Drugs 0.000 description 1
- FQKNVWBVUHMMGW-UHFFFAOYSA-N 4-hydroxybenzoic acid;2-octylbenzoic acid Chemical compound OC(=O)C1=CC=C(O)C=C1.CCCCCCCCC1=CC=CC=C1C(O)=O FQKNVWBVUHMMGW-UHFFFAOYSA-N 0.000 description 1
- SXNZHSBKPVDJJN-UHFFFAOYSA-N 4-methoxy-n-[3-[4-[3-[(4-methoxybenzoyl)amino]propyl]piperazin-1-yl]propyl]benzamide Chemical compound C1=CC(OC)=CC=C1C(=O)NCCCN1CCN(CCCNC(=O)C=2C=CC(OC)=CC=2)CC1 SXNZHSBKPVDJJN-UHFFFAOYSA-N 0.000 description 1
- SMZZALTWBJHHHP-UHFFFAOYSA-N 4-methyl-n-[3-[4-[3-[(4-methylbenzoyl)amino]propyl]piperazin-1-yl]propyl]benzamide Chemical compound C1=CC(C)=CC=C1C(=O)NCCCN1CCN(CCCNC(=O)C=2C=CC(C)=CC=2)CC1 SMZZALTWBJHHHP-UHFFFAOYSA-N 0.000 description 1
- MZANEMRIGKQCPM-UHFFFAOYSA-N 4-methyl-n-[6-[4-[6-[(4-methylbenzoyl)amino]hexyl]piperazin-1-yl]hexyl]benzamide Chemical compound C1=CC(C)=CC=C1C(=O)NCCCCCCN1CCN(CCCCCCNC(=O)C=2C=CC(C)=CC=2)CC1 MZANEMRIGKQCPM-UHFFFAOYSA-N 0.000 description 1
- GVZFKHPHBATYJJ-UHFFFAOYSA-N 4-propan-2-yl-n-[3-[4-[3-[(4-propan-2-ylbenzoyl)amino]propyl]piperazin-1-yl]propyl]benzamide Chemical compound C1=CC(C(C)C)=CC=C1C(=O)NCCCN1CCN(CCCNC(=O)C=2C=CC(=CC=2)C(C)C)CC1 GVZFKHPHBATYJJ-UHFFFAOYSA-N 0.000 description 1
- QHPQWRBYOIRBIT-UHFFFAOYSA-N 4-tert-butylphenol Chemical compound CC(C)(C)C1=CC=C(O)C=C1 QHPQWRBYOIRBIT-UHFFFAOYSA-N 0.000 description 1
- LYCCNHVQBSOODL-UHFFFAOYSA-N 6-(diethylamino)-3,3-bis[4-(dimethylamino)phenyl]-2-benzofuran-1-one Chemical compound C=1C(N(CC)CC)=CC=C2C=1C(=O)OC2(C=1C=CC(=CC=1)N(C)C)C1=CC=C(N(C)C)C=C1 LYCCNHVQBSOODL-UHFFFAOYSA-N 0.000 description 1
- KAUQJMHLAFIZDU-UHFFFAOYSA-N 6-Hydroxy-2-naphthoic acid Chemical compound C1=C(O)C=CC2=CC(C(=O)O)=CC=C21 KAUQJMHLAFIZDU-UHFFFAOYSA-N 0.000 description 1
- DEXFNLNNUZKHNO-UHFFFAOYSA-N 6-[3-[4-[2-(2,3-dihydro-1H-inden-2-ylamino)pyrimidin-5-yl]piperidin-1-yl]-3-oxopropyl]-3H-1,3-benzoxazol-2-one Chemical compound C1C(CC2=CC=CC=C12)NC1=NC=C(C=N1)C1CCN(CC1)C(CCC1=CC2=C(NC(O2)=O)C=C1)=O DEXFNLNNUZKHNO-UHFFFAOYSA-N 0.000 description 1
- KCBLOCLSUSTAMW-UHFFFAOYSA-N 6-chloro-3,3-bis[4-(dimethylamino)phenyl]-2-benzofuran-1-one Chemical compound C1=CC(N(C)C)=CC=C1C1(C=2C=CC(=CC=2)N(C)C)C2=CC=C(Cl)C=C2C(=O)O1 KCBLOCLSUSTAMW-UHFFFAOYSA-N 0.000 description 1
- JXSRRBVHLUJJFC-UHFFFAOYSA-N 7-amino-2-methylsulfanyl-[1,2,4]triazolo[1,5-a]pyrimidine-6-carbonitrile Chemical compound N1=CC(C#N)=C(N)N2N=C(SC)N=C21 JXSRRBVHLUJJFC-UHFFFAOYSA-N 0.000 description 1
- 229930185605 Bisphenol Natural products 0.000 description 1
- HTVITOHKHWFJKO-UHFFFAOYSA-N Bisphenol B Chemical compound C=1C=C(O)C=CC=1C(C)(CC)C1=CC=C(O)C=C1 HTVITOHKHWFJKO-UHFFFAOYSA-N 0.000 description 1
- QFOHBWFCKVYLES-UHFFFAOYSA-N Butylparaben Chemical compound CCCCOC(=O)C1=CC=C(O)C=C1 QFOHBWFCKVYLES-UHFFFAOYSA-N 0.000 description 1
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 1
- 229920002134 Carboxymethyl cellulose Polymers 0.000 description 1
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 description 1
- IPAJDLMMTVZVPP-UHFFFAOYSA-N Crystal violet lactone Chemical compound C1=CC(N(C)C)=CC=C1C1(C=2C=CC(=CC=2)N(C)C)C2=CC=C(N(C)C)C=C2C(=O)O1 IPAJDLMMTVZVPP-UHFFFAOYSA-N 0.000 description 1
- MDNWOSOZYLHTCG-UHFFFAOYSA-N Dichlorophen Chemical compound OC1=CC=C(Cl)C=C1CC1=CC(Cl)=CC=C1O MDNWOSOZYLHTCG-UHFFFAOYSA-N 0.000 description 1
- KSPIHGBHKVISFI-UHFFFAOYSA-N Diphenylcarbazide Chemical compound C=1C=CC=CC=1NNC(=O)NNC1=CC=CC=C1 KSPIHGBHKVISFI-UHFFFAOYSA-N 0.000 description 1
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 1
- VGGSQFUCUMXWEO-UHFFFAOYSA-N Ethene Chemical compound C=C VGGSQFUCUMXWEO-UHFFFAOYSA-N 0.000 description 1
- 239000001856 Ethyl cellulose Substances 0.000 description 1
- ZZSNKZQZMQGXPY-UHFFFAOYSA-N Ethyl cellulose Chemical compound CCOCC1OC(OC)C(OCC)C(OCC)C1OC1C(O)C(O)C(OC)C(CO)O1 ZZSNKZQZMQGXPY-UHFFFAOYSA-N 0.000 description 1
- 239000005977 Ethylene Substances 0.000 description 1
- PDQAZBWRQCGBEV-UHFFFAOYSA-N Ethylenethiourea Chemical compound S=C1NCCN1 PDQAZBWRQCGBEV-UHFFFAOYSA-N 0.000 description 1
- KRHYYFGTRYWZRS-UHFFFAOYSA-N Fluorane Chemical compound F KRHYYFGTRYWZRS-UHFFFAOYSA-N 0.000 description 1
- 108010010803 Gelatin Proteins 0.000 description 1
- VQTUBCCKSQIDNK-UHFFFAOYSA-N Isobutene Chemical group CC(C)=C VQTUBCCKSQIDNK-UHFFFAOYSA-N 0.000 description 1
- CERQOIWHTDAKMF-UHFFFAOYSA-N Methacrylic acid Chemical compound CC(=C)C(O)=O CERQOIWHTDAKMF-UHFFFAOYSA-N 0.000 description 1
- 229920000881 Modified starch Polymers 0.000 description 1
- FCSHMCFRCYZTRQ-UHFFFAOYSA-N N,N'-diphenylthiourea Chemical compound C=1C=CC=CC=1NC(=S)NC1=CC=CC=C1 FCSHMCFRCYZTRQ-UHFFFAOYSA-N 0.000 description 1
- MKYBYDHXWVHEJW-UHFFFAOYSA-N N-[1-oxo-1-(2,4,6,7-tetrahydrotriazolo[4,5-c]pyridin-5-yl)propan-2-yl]-2-[[3-(trifluoromethoxy)phenyl]methylamino]pyrimidine-5-carboxamide Chemical compound O=C(C(C)NC(=O)C=1C=NC(=NC=1)NCC1=CC(=CC=C1)OC(F)(F)F)N1CC2=C(CC1)NN=N2 MKYBYDHXWVHEJW-UHFFFAOYSA-N 0.000 description 1
- 235000021314 Palmitic acid Nutrition 0.000 description 1
- 239000002202 Polyethylene glycol Chemical class 0.000 description 1
- 239000004721 Polyphenylene oxide Chemical class 0.000 description 1
- 239000004793 Polystyrene Substances 0.000 description 1
- BQCADISMDOOEFD-UHFFFAOYSA-N Silver Chemical compound [Ag] BQCADISMDOOEFD-UHFFFAOYSA-N 0.000 description 1
- 235000021355 Stearic acid Nutrition 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 1
- KYPYTERUKNKOLP-UHFFFAOYSA-N Tetrachlorobisphenol A Chemical compound C=1C(Cl)=C(O)C(Cl)=CC=1C(C)(C)C1=CC(Cl)=C(O)C(Cl)=C1 KYPYTERUKNKOLP-UHFFFAOYSA-N 0.000 description 1
- 239000005844 Thymol Substances 0.000 description 1
- GWEVSGVZZGPLCZ-UHFFFAOYSA-N Titan oxide Chemical compound O=[Ti]=O GWEVSGVZZGPLCZ-UHFFFAOYSA-N 0.000 description 1
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Natural products NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 description 1
- 229920001807 Urea-formaldehyde Polymers 0.000 description 1
- BZHJMEDXRYGGRV-UHFFFAOYSA-N Vinyl chloride Chemical compound ClC=C BZHJMEDXRYGGRV-UHFFFAOYSA-N 0.000 description 1
- ALUQMBZPJUOGAM-UHFFFAOYSA-N [2-(morpholine-4-carbonyl)phenyl]-morpholin-4-ylmethanone Chemical compound C=1C=CC=C(C(=O)N2CCOCC2)C=1C(=O)N1CCOCC1 ALUQMBZPJUOGAM-UHFFFAOYSA-N 0.000 description 1
- HLIMXHKUWKACDD-UHFFFAOYSA-N [2-(pyrrolidine-1-carbonyl)phenyl]-pyrrolidin-1-ylmethanone Chemical compound C=1C=CC=C(C(=O)N2CCCC2)C=1C(=O)N1CCCC1 HLIMXHKUWKACDD-UHFFFAOYSA-N 0.000 description 1
- ZKURGBYDCVNWKH-UHFFFAOYSA-N [3,7-bis(dimethylamino)phenothiazin-10-yl]-phenylmethanone Chemical compound C12=CC=C(N(C)C)C=C2SC2=CC(N(C)C)=CC=C2N1C(=O)C1=CC=CC=C1 ZKURGBYDCVNWKH-UHFFFAOYSA-N 0.000 description 1
- VCUWUQJORXXEDA-UHFFFAOYSA-N [3-(morpholine-4-carbonyl)phenyl]-morpholin-4-ylmethanone Chemical compound C=1C=CC(C(=O)N2CCOCC2)=CC=1C(=O)N1CCOCC1 VCUWUQJORXXEDA-UHFFFAOYSA-N 0.000 description 1
- UQLUYLUUTPKJAZ-UHFFFAOYSA-N [3-(pyrrolidine-1-carbonyl)phenyl]-pyrrolidin-1-ylmethanone Chemical compound C=1C=CC(C(=O)N2CCCC2)=CC=1C(=O)N1CCCC1 UQLUYLUUTPKJAZ-UHFFFAOYSA-N 0.000 description 1
- TVHPBNWALWHAHP-UHFFFAOYSA-N [4-(3-oxo-1H-2-benzofuran-1-yl)phenyl] acetate Chemical compound C1=CC(OC(=O)C)=CC=C1C1C2=CC=CC=C2C(=O)O1 TVHPBNWALWHAHP-UHFFFAOYSA-N 0.000 description 1
- WSLSHSXFPNQGRU-UHFFFAOYSA-N [4-(morpholine-4-carbonyl)phenyl]-morpholin-4-ylmethanone Chemical compound C=1C=C(C(=O)N2CCOCC2)C=CC=1C(=O)N1CCOCC1 WSLSHSXFPNQGRU-UHFFFAOYSA-N 0.000 description 1
- HQVHKTBIKQZOGM-UHFFFAOYSA-N [4-(pyrrolidine-1-carbonyl)phenyl]-pyrrolidin-1-ylmethanone Chemical compound C=1C=C(C(=O)N2CCCC2)C=CC=1C(=O)N1CCCC1 HQVHKTBIKQZOGM-UHFFFAOYSA-N 0.000 description 1
- ZWEDAALVTOJJMR-UHFFFAOYSA-N [4-[1-(4-acetyloxy-3,5-dibromophenyl)-3-oxo-2-benzofuran-1-yl]-2,6-dibromophenyl] acetate Chemical compound C1=C(Br)C(OC(=O)C)=C(Br)C=C1C1(C=2C=C(Br)C(OC(C)=O)=C(Br)C=2)C2=CC=CC=C2C(=O)O1 ZWEDAALVTOJJMR-UHFFFAOYSA-N 0.000 description 1
- SEINERABHKEIER-UHFFFAOYSA-N [4-[1-(4-acetyloxy-3-methylphenyl)-3-oxo-2-benzofuran-1-yl]-2-methylphenyl] acetate Chemical compound C1=C(C)C(OC(=O)C)=CC=C1C1(C=2C=C(C)C(OC(C)=O)=CC=2)C2=CC=CC=C2C(=O)O1 SEINERABHKEIER-UHFFFAOYSA-N 0.000 description 1
- PMLAHVIUSJHZPI-UHFFFAOYSA-N [4-[1-(4-acetyloxy-3-propan-2-ylphenyl)-3-oxo-2-benzofuran-1-yl]-2-propan-2-ylphenyl] acetate Chemical compound C1=C(OC(C)=O)C(C(C)C)=CC(C2(C3=CC=CC=C3C(=O)O2)C=2C=C(C(OC(C)=O)=CC=2)C(C)C)=C1 PMLAHVIUSJHZPI-UHFFFAOYSA-N 0.000 description 1
- 235000011054 acetic acid Nutrition 0.000 description 1
- 125000005396 acrylic acid ester group Chemical group 0.000 description 1
- 229920006243 acrylic copolymer Polymers 0.000 description 1
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 1
- 125000003545 alkoxy group Chemical group 0.000 description 1
- 125000004453 alkoxycarbonyl group Chemical group 0.000 description 1
- WNROFYMDJYEPJX-UHFFFAOYSA-K aluminium hydroxide Chemical compound [OH-].[OH-].[OH-].[Al+3] WNROFYMDJYEPJX-UHFFFAOYSA-K 0.000 description 1
- 150000001408 amides Chemical class 0.000 description 1
- 229940063284 ammonium salicylate Drugs 0.000 description 1
- 125000004104 aryloxy group Chemical group 0.000 description 1
- JPIYZTWMUGTEHX-UHFFFAOYSA-N auramine O free base Chemical compound C1=CC(N(C)C)=CC=C1C(=N)C1=CC=C(N(C)C)C=C1 JPIYZTWMUGTEHX-UHFFFAOYSA-N 0.000 description 1
- 239000000987 azo dye Substances 0.000 description 1
- UKMSUNONTOPOIO-UHFFFAOYSA-M behenate Chemical compound CCCCCCCCCCCCCCCCCCCCCC([O-])=O UKMSUNONTOPOIO-UHFFFAOYSA-M 0.000 description 1
- 229940116224 behenate Drugs 0.000 description 1
- 230000009286 beneficial effect Effects 0.000 description 1
- 125000000043 benzamido group Chemical group [H]N([*])C(=O)C1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 description 1
- 125000000440 benzylamino group Chemical group [H]N(*)C([H])([H])C1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 description 1
- IMHDGJOMLMDPJN-UHFFFAOYSA-N biphenyl-2,2'-diol Chemical group OC1=CC=CC=C1C1=CC=CC=C1O IMHDGJOMLMDPJN-UHFFFAOYSA-N 0.000 description 1
- JFIOVJDNOJYLKP-UHFFFAOYSA-N bithionol Chemical compound OC1=C(Cl)C=C(Cl)C=C1SC1=CC(Cl)=CC(Cl)=C1O JFIOVJDNOJYLKP-UHFFFAOYSA-N 0.000 description 1
- MTAZNLWOLGHBHU-UHFFFAOYSA-N butadiene-styrene rubber Chemical compound C=CC=C.C=CC1=CC=CC=C1 MTAZNLWOLGHBHU-UHFFFAOYSA-N 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 229910052791 calcium Inorganic materials 0.000 description 1
- 239000011575 calcium Substances 0.000 description 1
- 239000001768 carboxy methyl cellulose Substances 0.000 description 1
- 235000010948 carboxy methyl cellulose Nutrition 0.000 description 1
- 239000008112 carboxymethyl-cellulose Substances 0.000 description 1
- 239000005018 casein Substances 0.000 description 1
- BECPQYXYKAMYBN-UHFFFAOYSA-N casein, tech. Chemical compound NCCCCC(C(O)=O)N=C(O)C(CC(O)=O)N=C(O)C(CCC(O)=N)N=C(O)C(CC(C)C)N=C(O)C(CCC(O)=O)N=C(O)C(CC(O)=O)N=C(O)C(CCC(O)=O)N=C(O)C(C(C)O)N=C(O)C(CCC(O)=N)N=C(O)C(CCC(O)=N)N=C(O)C(CCC(O)=N)N=C(O)C(CCC(O)=O)N=C(O)C(CCC(O)=O)N=C(O)C(COP(O)(O)=O)N=C(O)C(CCC(O)=N)N=C(O)C(N)CC1=CC=CC=C1 BECPQYXYKAMYBN-UHFFFAOYSA-N 0.000 description 1
- 235000021240 caseins Nutrition 0.000 description 1
- 239000002738 chelating agent Substances 0.000 description 1
- 239000003638 chemical reducing agent Substances 0.000 description 1
- 239000004927 clay Substances 0.000 description 1
- 229910052570 clay Inorganic materials 0.000 description 1
- 229910017052 cobalt Inorganic materials 0.000 description 1
- 239000010941 cobalt Substances 0.000 description 1
- GUTLYIVDDKVIGB-UHFFFAOYSA-N cobalt atom Chemical compound [Co] GUTLYIVDDKVIGB-UHFFFAOYSA-N 0.000 description 1
- 229910052802 copper Inorganic materials 0.000 description 1
- 239000010949 copper Substances 0.000 description 1
- 239000003712 decolorant Substances 0.000 description 1
- VEQVWMIWJMNBTL-UHFFFAOYSA-L dodecanoate;iron(2+) Chemical compound [Fe+2].CCCCCCCCCCCC([O-])=O.CCCCCCCCCCCC([O-])=O VEQVWMIWJMNBTL-UHFFFAOYSA-L 0.000 description 1
- PSYDSRLQABJJAD-UHFFFAOYSA-N dodecylthiourea Chemical compound CCCCCCCCCCCCNC(N)=S PSYDSRLQABJJAD-UHFFFAOYSA-N 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- MFGZXPGKKJMZIY-UHFFFAOYSA-N ethyl 5-amino-1-(4-sulfamoylphenyl)pyrazole-4-carboxylate Chemical compound NC1=C(C(=O)OCC)C=NN1C1=CC=C(S(N)(=O)=O)C=C1 MFGZXPGKKJMZIY-UHFFFAOYSA-N 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 235000010944 ethyl methyl cellulose Nutrition 0.000 description 1
- 235000010228 ethyl p-hydroxybenzoate Nutrition 0.000 description 1
- 239000004403 ethyl p-hydroxybenzoate Substances 0.000 description 1
- 229940043351 ethyl-p-hydroxybenzoate Drugs 0.000 description 1
- NUVBSKCKDOMJSU-UHFFFAOYSA-N ethylparaben Chemical compound CCOC(=O)C1=CC=C(O)C=C1 NUVBSKCKDOMJSU-UHFFFAOYSA-N 0.000 description 1
- WOLATMHLPFJRGC-UHFFFAOYSA-N furan-2,5-dione;styrene Chemical compound O=C1OC(=O)C=C1.C=CC1=CC=CC=C1 WOLATMHLPFJRGC-UHFFFAOYSA-N 0.000 description 1
- 229940074391 gallic acid Drugs 0.000 description 1
- 235000004515 gallic acid Nutrition 0.000 description 1
- 229920000159 gelatin Polymers 0.000 description 1
- 239000008273 gelatin Substances 0.000 description 1
- 235000019322 gelatine Nutrition 0.000 description 1
- 235000011852 gelatine desserts Nutrition 0.000 description 1
- 235000011187 glycerol Nutrition 0.000 description 1
- 150000002357 guanidines Chemical class 0.000 description 1
- 229940083094 guanine derivative acting on arteriolar smooth muscle Drugs 0.000 description 1
- FUZZWVXGSFPDMH-UHFFFAOYSA-M hexanoate Chemical compound CCCCCC([O-])=O FUZZWVXGSFPDMH-UHFFFAOYSA-M 0.000 description 1
- 125000004051 hexyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 229960004337 hydroquinone Drugs 0.000 description 1
- WGCNASOHLSPBMP-UHFFFAOYSA-N hydroxyacetaldehyde Natural products OCC=O WGCNASOHLSPBMP-UHFFFAOYSA-N 0.000 description 1
- 238000003384 imaging method Methods 0.000 description 1
- 150000002505 iron Chemical class 0.000 description 1
- 229910052742 iron Inorganic materials 0.000 description 1
- UTCGLBIPYDLKNF-UHFFFAOYSA-L iron(2+);nonanoate Chemical compound [Fe+2].CCCCCCCCC([O-])=O.CCCCCCCCC([O-])=O UTCGLBIPYDLKNF-UHFFFAOYSA-L 0.000 description 1
- XLDSINOWIMZXDD-UHFFFAOYSA-L iron(2+);tetradecanoate Chemical compound [Fe+2].CCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCC([O-])=O XLDSINOWIMZXDD-UHFFFAOYSA-L 0.000 description 1
- 150000002576 ketones Chemical class 0.000 description 1
- 150000002596 lactones Chemical class 0.000 description 1
- 229920000126 latex Polymers 0.000 description 1
- 239000011133 lead Substances 0.000 description 1
- PIJPYDMVFNTHIP-UHFFFAOYSA-L lead sulfate Chemical compound [PbH4+2].[O-]S([O-])(=O)=O PIJPYDMVFNTHIP-UHFFFAOYSA-L 0.000 description 1
- 150000004668 long chain fatty acids Chemical class 0.000 description 1
- 238000002844 melting Methods 0.000 description 1
- 230000008018 melting Effects 0.000 description 1
- BXDUJMLIUYJHNH-UHFFFAOYSA-L mercury(2+);oxalate Chemical compound [Hg+2].[O-]C(=O)C([O-])=O BXDUJMLIUYJHNH-UHFFFAOYSA-L 0.000 description 1
- 229920003145 methacrylic acid copolymer Polymers 0.000 description 1
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 description 1
- 229920000609 methyl cellulose Polymers 0.000 description 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 1
- 235000010270 methyl p-hydroxybenzoate Nutrition 0.000 description 1
- 239000001923 methylcellulose Substances 0.000 description 1
- 235000010981 methylcellulose Nutrition 0.000 description 1
- 229920003087 methylethyl cellulose Polymers 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- 235000019426 modified starch Nutrition 0.000 description 1
- MXHTZQSKTCCMFG-UHFFFAOYSA-N n,n-dibenzyl-1-phenylmethanamine Chemical compound C=1C=CC=CC=1CN(CC=1C=CC=CC=1)CC1=CC=CC=C1 MXHTZQSKTCCMFG-UHFFFAOYSA-N 0.000 description 1
- WQEPLUUGTLDZJY-UHFFFAOYSA-N n-Pentadecanoic acid Natural products CCCCCCCCCCCCCCC(O)=O WQEPLUUGTLDZJY-UHFFFAOYSA-N 0.000 description 1
- GRDRZEFQNFCRKJ-UHFFFAOYSA-N n-[12-[4-(12-benzamidododecyl)piperazin-1-yl]dodecyl]benzamide Chemical compound C=1C=CC=CC=1C(=O)NCCCCCCCCCCCCN(CC1)CCN1CCCCCCCCCCCCNC(=O)C1=CC=CC=C1 GRDRZEFQNFCRKJ-UHFFFAOYSA-N 0.000 description 1
- FYUCZUMKEGEVJZ-UHFFFAOYSA-N n-[18-[4-(18-benzamidooctadecyl)piperazin-1-yl]octadecyl]benzamide Chemical compound C=1C=CC=CC=1C(=O)NCCCCCCCCCCCCCCCCCCN(CC1)CCN1CCCCCCCCCCCCCCCCCCNC(=O)C1=CC=CC=C1 FYUCZUMKEGEVJZ-UHFFFAOYSA-N 0.000 description 1
- REBHYEHRCCIEAQ-UHFFFAOYSA-N n-[2-[4-(2-benzamidoethyl)piperazin-1-yl]ethyl]benzamide Chemical compound C=1C=CC=CC=1C(=O)NCCN(CC1)CCN1CCNC(=O)C1=CC=CC=C1 REBHYEHRCCIEAQ-UHFFFAOYSA-N 0.000 description 1
- IUGOBJZYBODIRT-UHFFFAOYSA-N n-[3-[4-[3-(2,2-dimethylpropanoylamino)propyl]piperazin-1-yl]propyl]-2,2-dimethylpropanamide Chemical compound CC(C)(C)C(=O)NCCCN1CCN(CCCNC(=O)C(C)(C)C)CC1 IUGOBJZYBODIRT-UHFFFAOYSA-N 0.000 description 1
- CIQMZNGQHIEVMD-UHFFFAOYSA-N n-[3-[4-[3-(cyclohexylamino)propyl]piperazin-1-yl]propyl]cyclohexanamine Chemical compound C1CN(CCCNC2CCCCC2)CCN1CCCNC1CCCCC1 CIQMZNGQHIEVMD-UHFFFAOYSA-N 0.000 description 1
- XYCQDKJVOVKQRP-UHFFFAOYSA-N n-[3-[4-[3-(octadecanoylamino)propyl]piperazin-1-yl]propyl]octadecanamide Chemical compound CCCCCCCCCCCCCCCCCC(=O)NCCCN1CCN(CCCNC(=O)CCCCCCCCCCCCCCCCC)CC1 XYCQDKJVOVKQRP-UHFFFAOYSA-N 0.000 description 1
- JBMRATQOVAPOGF-UHFFFAOYSA-N n-[4-[4-(4-benzamidobutyl)piperazin-1-yl]butyl]benzamide Chemical compound C=1C=CC=CC=1C(=O)NCCCCN(CC1)CCN1CCCCNC(=O)C1=CC=CC=C1 JBMRATQOVAPOGF-UHFFFAOYSA-N 0.000 description 1
- WOGRZIFYJRHANG-UHFFFAOYSA-N n-[5-[4-(5-benzamidopentyl)piperazin-1-yl]pentyl]benzamide Chemical compound C=1C=CC=CC=1C(=O)NCCCCCN(CC1)CCN1CCCCCNC(=O)C1=CC=CC=C1 WOGRZIFYJRHANG-UHFFFAOYSA-N 0.000 description 1
- BBRACFWKKWMMGF-UHFFFAOYSA-N n-[8-[4-(8-benzamidooctyl)piperazin-1-yl]octyl]benzamide Chemical compound C=1C=CC=CC=1C(=O)NCCCCCCCCN(CC1)CCN1CCCCCCCCNC(=O)C1=CC=CC=C1 BBRACFWKKWMMGF-UHFFFAOYSA-N 0.000 description 1
- GRHRIJYRDMAPNG-UHFFFAOYSA-N n-fluoromethanamine Chemical compound CNF GRHRIJYRDMAPNG-UHFFFAOYSA-N 0.000 description 1
- 229910052759 nickel Inorganic materials 0.000 description 1
- QJGQUHMNIGDVPM-UHFFFAOYSA-N nitrogen group Chemical group [N] QJGQUHMNIGDVPM-UHFFFAOYSA-N 0.000 description 1
- 150000002832 nitroso derivatives Chemical class 0.000 description 1
- FBUKVWPVBMHYJY-UHFFFAOYSA-M nonanoate Chemical compound CCCCCCCCC([O-])=O FBUKVWPVBMHYJY-UHFFFAOYSA-M 0.000 description 1
- 229920003986 novolac Polymers 0.000 description 1
- QIQXTHQIDYTFRH-UHFFFAOYSA-N octadecanoic acid Chemical compound CCCCCCCCCCCCCCCCCC(O)=O QIQXTHQIDYTFRH-UHFFFAOYSA-N 0.000 description 1
- OQCDKBAXFALNLD-UHFFFAOYSA-N octadecanoic acid Natural products CCCCCCCC(C)CCCCCCCCC(O)=O OQCDKBAXFALNLD-UHFFFAOYSA-N 0.000 description 1
- 150000002894 organic compounds Chemical class 0.000 description 1
- 239000011368 organic material Substances 0.000 description 1
- 239000003973 paint Substances 0.000 description 1
- 229920001568 phenolic resin Polymers 0.000 description 1
- 239000005011 phenolic resin Substances 0.000 description 1
- 150000002989 phenols Chemical class 0.000 description 1
- 229950000688 phenothiazine Drugs 0.000 description 1
- FCJSHPDYVMKCHI-UHFFFAOYSA-N phenyl benzoate Chemical compound C=1C=CC=CC=1C(=O)OC1=CC=CC=C1 FCJSHPDYVMKCHI-UHFFFAOYSA-N 0.000 description 1
- QCDYQQDYXPDABM-UHFFFAOYSA-N phloroglucinol Chemical compound OC1=CC(O)=CC(O)=C1 QCDYQQDYXPDABM-UHFFFAOYSA-N 0.000 description 1
- 229960001553 phloroglucinol Drugs 0.000 description 1
- XQZYPMVTSDWCCE-UHFFFAOYSA-N phthalonitrile Chemical class N#CC1=CC=CC=C1C#N XQZYPMVTSDWCCE-UHFFFAOYSA-N 0.000 description 1
- 229920006391 phthalonitrile polymer Chemical class 0.000 description 1
- 229920001490 poly(butyl methacrylate) polymer Polymers 0.000 description 1
- 229920001495 poly(sodium acrylate) polymer Polymers 0.000 description 1
- 229920002401 polyacrylamide Polymers 0.000 description 1
- 229920000570 polyether Chemical class 0.000 description 1
- 229920001223 polyethylene glycol Chemical class 0.000 description 1
- 229920002223 polystyrene Polymers 0.000 description 1
- 229920002635 polyurethane Polymers 0.000 description 1
- 239000004814 polyurethane Substances 0.000 description 1
- 229920002689 polyvinyl acetate Polymers 0.000 description 1
- 239000011118 polyvinyl acetate Substances 0.000 description 1
- 229920000036 polyvinylpyrrolidone Polymers 0.000 description 1
- 239000001267 polyvinylpyrrolidone Substances 0.000 description 1
- 235000013855 polyvinylpyrrolidone Nutrition 0.000 description 1
- DPLVEEXVKBWGHE-UHFFFAOYSA-N potassium sulfide Chemical compound [S-2].[K+].[K+] DPLVEEXVKBWGHE-UHFFFAOYSA-N 0.000 description 1
- 239000010970 precious metal Substances 0.000 description 1
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 1
- 238000007639 printing Methods 0.000 description 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 239000004405 propyl p-hydroxybenzoate Substances 0.000 description 1
- 235000010232 propyl p-hydroxybenzoate Nutrition 0.000 description 1
- QELSKZZBTMNZEB-UHFFFAOYSA-N propylparaben Chemical compound CCCOC(=O)C1=CC=C(O)C=C1 QELSKZZBTMNZEB-UHFFFAOYSA-N 0.000 description 1
- 239000011241 protective layer Substances 0.000 description 1
- 229940079877 pyrogallol Drugs 0.000 description 1
- 229960001755 resorcinol Drugs 0.000 description 1
- 229910052709 silver Inorganic materials 0.000 description 1
- 239000004332 silver Substances 0.000 description 1
- AQRYNYUOKMNDDV-UHFFFAOYSA-M silver behenate Chemical compound [Ag+].CCCCCCCCCCCCCCCCCCCCCC([O-])=O AQRYNYUOKMNDDV-UHFFFAOYSA-M 0.000 description 1
- XNGYKPINNDWGGF-UHFFFAOYSA-L silver oxalate Chemical compound [Ag+].[Ag+].[O-]C(=O)C([O-])=O XNGYKPINNDWGGF-UHFFFAOYSA-L 0.000 description 1
- ORYURPRSXLUCSS-UHFFFAOYSA-M silver;octadecanoate Chemical compound [Ag+].CCCCCCCCCCCCCCCCCC([O-])=O ORYURPRSXLUCSS-UHFFFAOYSA-M 0.000 description 1
- 235000010413 sodium alginate Nutrition 0.000 description 1
- 239000000661 sodium alginate Substances 0.000 description 1
- 229940005550 sodium alginate Drugs 0.000 description 1
- NNMHYFLPFNGQFZ-UHFFFAOYSA-M sodium polyacrylate Chemical compound [Na+].[O-]C(=O)C=C NNMHYFLPFNGQFZ-UHFFFAOYSA-M 0.000 description 1
- HAEPBEMBOAIUPN-UHFFFAOYSA-L sodium tetrathionate Chemical compound O.O.[Na+].[Na+].[O-]S(=O)(=O)SSS([O-])(=O)=O HAEPBEMBOAIUPN-UHFFFAOYSA-L 0.000 description 1
- AKHNMLFCWUSKQB-UHFFFAOYSA-L sodium thiosulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=S AKHNMLFCWUSKQB-UHFFFAOYSA-L 0.000 description 1
- 235000019345 sodium thiosulphate Nutrition 0.000 description 1
- GGCZERPQGJTIQP-UHFFFAOYSA-N sodium;9,10-dioxoanthracene-2-sulfonic acid Chemical compound [Na+].C1=CC=C2C(=O)C3=CC(S(=O)(=O)O)=CC=C3C(=O)C2=C1 GGCZERPQGJTIQP-UHFFFAOYSA-N 0.000 description 1
- 239000008117 stearic acid Substances 0.000 description 1
- 229910052712 strontium Inorganic materials 0.000 description 1
- CIOAGBVUUVVLOB-UHFFFAOYSA-N strontium atom Chemical compound [Sr] CIOAGBVUUVVLOB-UHFFFAOYSA-N 0.000 description 1
- 229920003048 styrene butadiene rubber Polymers 0.000 description 1
- 125000001424 substituent group Chemical group 0.000 description 1
- 150000003464 sulfur compounds Chemical class 0.000 description 1
- 239000004094 surface-active agent Substances 0.000 description 1
- 239000000454 talc Substances 0.000 description 1
- 229910052623 talc Inorganic materials 0.000 description 1
- 229920001897 terpolymer Polymers 0.000 description 1
- 238000007651 thermal printing Methods 0.000 description 1
- 238000001931 thermography Methods 0.000 description 1
- 150000003585 thioureas Chemical class 0.000 description 1
- RUJLHPZAKCVICY-UHFFFAOYSA-J thorium(4+);disulfate Chemical compound [Th+4].[O-]S([O-])(=O)=O.[O-]S([O-])(=O)=O RUJLHPZAKCVICY-UHFFFAOYSA-J 0.000 description 1
- 229960000790 thymol Drugs 0.000 description 1
- OGIDPMRJRNCKJF-UHFFFAOYSA-N titanium oxide Inorganic materials [Ti]=O OGIDPMRJRNCKJF-UHFFFAOYSA-N 0.000 description 1
- 238000012546 transfer Methods 0.000 description 1
- AAAQKTZKLRYKHR-UHFFFAOYSA-N triphenylmethane Chemical compound C1=CC=CC=C1C(C=1C=CC=CC=1)C1=CC=CC=C1 AAAQKTZKLRYKHR-UHFFFAOYSA-N 0.000 description 1
- 239000001993 wax Substances 0.000 description 1
- 238000004383 yellowing Methods 0.000 description 1
- UGZADUVQMDAIAO-UHFFFAOYSA-L zinc hydroxide Chemical compound [OH-].[OH-].[Zn+2] UGZADUVQMDAIAO-UHFFFAOYSA-L 0.000 description 1
- 229940007718 zinc hydroxide Drugs 0.000 description 1
- 229910021511 zinc hydroxide Inorganic materials 0.000 description 1
- 239000011787 zinc oxide Substances 0.000 description 1
- LGBXRSIJICXMDL-UHFFFAOYSA-L zinc;6-carboxynaphthalen-2-olate Chemical compound [Zn+2].C1=C([O-])C=CC2=CC(C(=O)O)=CC=C21.C1=C([O-])C=CC2=CC(C(=O)O)=CC=C21 LGBXRSIJICXMDL-UHFFFAOYSA-L 0.000 description 1
Classifications
-
- B—PERFORMING OPERATIONS; TRANSPORTING
- B41—PRINTING; LINING MACHINES; TYPEWRITERS; STAMPS
- B41M—PRINTING, DUPLICATING, MARKING, OR COPYING PROCESSES; COLOUR PRINTING
- B41M5/00—Duplicating or marking methods; Sheet materials for use therein
- B41M5/26—Thermography ; Marking by high energetic means, e.g. laser otherwise than by burning, and characterised by the material used
- B41M5/34—Multicolour thermography
Landscapes
- Physics & Mathematics (AREA)
- Optics & Photonics (AREA)
- Heat Sensitive Colour Forming Recording (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| JP59241333A JPH0630955B2 (ja) | 1984-11-15 | 1984-11-15 | 2色感熱記録材料 |
| JP59273816A JPH0630956B2 (ja) | 1984-12-27 | 1984-12-27 | 2色感熱記録材料 |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DE3540627A1 DE3540627A1 (de) | 1986-05-22 |
| DE3540627C2 true DE3540627C2 (OSRAM) | 1988-10-06 |
Family
ID=26535206
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19853540627 Granted DE3540627A1 (de) | 1984-11-15 | 1985-11-15 | Waermeempfindliches zweifarben-aufzeichnungsmaterial |
Country Status (3)
| Country | Link |
|---|---|
| US (1) | US4613878A (OSRAM) |
| DE (1) | DE3540627A1 (OSRAM) |
| GB (1) | GB2167201B (OSRAM) |
Families Citing this family (18)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| EP0198202B1 (en) * | 1985-03-09 | 1991-07-17 | Mitsubishi Corporation | Novel n-cyclohexyl-polycarboxamide compound and derivatives thereof, processes for preparing them, and use of them in preparation of host-guest complexes |
| JPH0710620B2 (ja) * | 1985-03-28 | 1995-02-08 | 株式会社リコー | 2色感熱記録型ラベル |
| JPS6259078A (ja) * | 1985-09-09 | 1987-03-14 | Fuji Photo Film Co Ltd | 減感剤組成物 |
| JPS6315786A (ja) * | 1986-05-31 | 1988-01-22 | Kanzaki Paper Mfg Co Ltd | 2色感熱記録体 |
| US4965166A (en) * | 1988-03-02 | 1990-10-23 | Fuji Photo Film Co., Ltd. | Multicolor recording material |
| US5366952A (en) * | 1992-06-22 | 1994-11-22 | Kanzaki Specialty Papers | Double-surface heat-sensitive record material |
| DE69410587T2 (de) * | 1994-01-14 | 1999-01-07 | Agfa-Gevaert N.V., Mortsel | Aufzeichnungsmaterial für ein Direktbildverfahren durch Wärme |
| DE19536045A1 (de) * | 1995-09-28 | 1997-04-03 | Agfa Gevaert Ag | Wärmeempfindliches Aufzeichnungsmaterial |
| US5922203A (en) * | 1997-10-07 | 1999-07-13 | Hydranautics | Amine monomers and their use in preparing interfacially synthesized membranes for reverse osmosis and nanofiltration |
| US6464873B1 (en) | 1999-06-15 | 2002-10-15 | Hydranautics | Interfacially polymerized, bipiperidine-polyamide membranes for reverse osmosis and/or nanofiltration and process for making the same |
| US6482651B1 (en) * | 1999-06-30 | 2002-11-19 | United Color Manufacturing, Inc. | Aromatic esters for marking or tagging petroleum products |
| AU2012201141B2 (en) * | 1999-06-30 | 2015-09-17 | United Color Manufacturing, Inc. | Aromatic esters for marking or tagging petroleum products |
| US6998214B2 (en) * | 2001-07-13 | 2006-02-14 | The Trustees Of Boston College | Methods for three-dimensional optical data storage and retrieval |
| US9795928B2 (en) | 2014-06-24 | 2017-10-24 | Nano And Advanced Materials Institute Limited | Stepwise interfacial polymerization technique with different reagent solution designs to prepare hollow fiber nanofiltration membrane composites |
| JP7022516B2 (ja) * | 2017-04-17 | 2022-02-18 | 株式会社日立産機システム | 温度検知材料、それを用いた温度検知インク、温度インジケータ、および物品管理システム |
| CN114250648A (zh) * | 2021-12-30 | 2022-03-29 | 北京鼎一致远科技发展有限公司 | 一种双色无墨打印纸及其制作方法 |
| CN114277610B (zh) * | 2021-12-30 | 2023-05-23 | 湖南鼎一致远科技发展有限公司 | 一种双色无墨打印纸隔离保护层涂料及其制备方法和双色无墨打印纸 |
| CN114277605B (zh) * | 2021-12-30 | 2023-04-18 | 湖南鼎一致远科技发展有限公司 | 一种双色无墨打印纸及其制备方法 |
Citations (12)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS4886543A (OSRAM) * | 1972-02-17 | 1973-11-15 | ||
| JPS4969A (OSRAM) * | 1972-04-13 | 1974-01-05 | ||
| JPS494342A (OSRAM) * | 1972-05-01 | 1974-01-16 | ||
| JPS4927708A (OSRAM) * | 1972-07-10 | 1974-03-12 | ||
| JPS4965239A (OSRAM) * | 1972-10-21 | 1974-06-25 | ||
| JPS5017865A (OSRAM) * | 1973-06-16 | 1975-02-25 | ||
| JPS5017866A (OSRAM) * | 1973-06-15 | 1975-02-25 | ||
| JPS5018048A (OSRAM) * | 1973-06-20 | 1975-02-26 | ||
| JPS5129024A (OSRAM) * | 1974-09-05 | 1976-03-11 | Gen Corp | |
| JPS5187542A (ja) * | 1975-01-31 | 1976-07-31 | Unitika Ltd | Horibiniruarukoorukeihotsutomerutogatasetsuchakuzaino seizohoho |
| JPS5347843A (en) * | 1977-10-18 | 1978-04-28 | Mitsubishi Paper Mills Ltd | Multicolor developing heat sensitive paper |
| EP0012587B1 (en) * | 1978-12-14 | 1983-05-25 | Ricoh Company, Ltd | Thermo-sensitive multi-color recording material and process for preparation thereof |
Family Cites Families (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS5525306A (en) * | 1978-08-10 | 1980-02-23 | Ricoh Co Ltd | Multi-color heat-sensitive recording material |
| JPS5825987A (ja) * | 1981-08-07 | 1983-02-16 | Ricoh Co Ltd | 感熱記録材料 |
-
1985
- 1985-11-15 US US06/798,420 patent/US4613878A/en not_active Expired - Lifetime
- 1985-11-15 GB GB08528253A patent/GB2167201B/en not_active Expired
- 1985-11-15 DE DE19853540627 patent/DE3540627A1/de active Granted
Patent Citations (12)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS4886543A (OSRAM) * | 1972-02-17 | 1973-11-15 | ||
| JPS4969A (OSRAM) * | 1972-04-13 | 1974-01-05 | ||
| JPS494342A (OSRAM) * | 1972-05-01 | 1974-01-16 | ||
| JPS4927708A (OSRAM) * | 1972-07-10 | 1974-03-12 | ||
| JPS4965239A (OSRAM) * | 1972-10-21 | 1974-06-25 | ||
| JPS5017866A (OSRAM) * | 1973-06-15 | 1975-02-25 | ||
| JPS5017865A (OSRAM) * | 1973-06-16 | 1975-02-25 | ||
| JPS5018048A (OSRAM) * | 1973-06-20 | 1975-02-26 | ||
| JPS5129024A (OSRAM) * | 1974-09-05 | 1976-03-11 | Gen Corp | |
| JPS5187542A (ja) * | 1975-01-31 | 1976-07-31 | Unitika Ltd | Horibiniruarukoorukeihotsutomerutogatasetsuchakuzaino seizohoho |
| JPS5347843A (en) * | 1977-10-18 | 1978-04-28 | Mitsubishi Paper Mills Ltd | Multicolor developing heat sensitive paper |
| EP0012587B1 (en) * | 1978-12-14 | 1983-05-25 | Ricoh Company, Ltd | Thermo-sensitive multi-color recording material and process for preparation thereof |
Also Published As
| Publication number | Publication date |
|---|---|
| GB2167201B (en) | 1988-08-10 |
| GB8528253D0 (en) | 1985-12-18 |
| US4613878A (en) | 1986-09-23 |
| DE3540627A1 (de) | 1986-05-22 |
| GB2167201A (en) | 1986-05-21 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE3610588C2 (OSRAM) | ||
| DE3540627C2 (OSRAM) | ||
| DE3526890C2 (OSRAM) | ||
| DE3602986A1 (de) | Waermeempfindliches aufzeichnungsmaterial | |
| DE3801837C2 (de) | Wärmeempfindliches Aufzeichnungsmaterial | |
| DE3408707C2 (de) | Wärmeempfindliches Aufzeichnungsmaterial | |
| DE2820462C3 (de) | Selbstaufzeichnendes druckempfindliches Papier | |
| DE3444396C2 (OSRAM) | ||
| JPS6184282A (ja) | 二色感熱記録材料 | |
| DE3688449T3 (de) | Aufzeichnungsmaterial. | |
| AT395695B (de) | Hitze-empfindliches aufzeichnungsmaterial | |
| DE3441657C2 (OSRAM) | ||
| DE3329070C2 (OSRAM) | ||
| DE3044727A1 (de) | Waermeempfindliches aufzeichnungsmaterial | |
| DE3881990T2 (de) | Wärmeempfindliches Aufzeichnungsmaterial. | |
| DE4026866A1 (de) | Hitzeempfindliches aufzeichnungsmedium | |
| DE3880060T2 (de) | Mehrfarbiges wärmeempfindliches Aufzeichnungsmaterial. | |
| DE69217796T2 (de) | Wärmeempfindliches Aufzeichnungsmaterial | |
| DE69209135T2 (de) | Wärmeempfindliches Aufzeichnungsmaterial | |
| DE69601893T2 (de) | Wärmeempfindliches Aufzeichnungsblatt | |
| DE4004563A1 (de) | Waermeempfindliches aufzeichnungsmaterial | |
| DE69204212T2 (de) | Wärmeempfindliches Aufzeichnungsmaterial. | |
| EP0122468B1 (de) | Wärmeempfindliches Aufzeichnungsblatt | |
| DE3414297A1 (de) | Waermeempfindliches aufzeichnungsmaterial | |
| DE68915670T2 (de) | Wärmeempfindliches Aufzeichnungsmaterial. |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| OP8 | Request for examination as to paragraph 44 patent law | ||
| D2 | Grant after examination | ||
| 8364 | No opposition during term of opposition | ||
| 8328 | Change in the person/name/address of the agent |
Free format text: BARZ, P., DIPL.-CHEM. DR.RER.NAT., PAT.-ANW., 80803 MUENCHEN |
|
| 8339 | Ceased/non-payment of the annual fee |