DE3523175A1 - Kuenstlerpinsel - Google Patents
KuenstlerpinselInfo
- Publication number
- DE3523175A1 DE3523175A1 DE19853523175 DE3523175A DE3523175A1 DE 3523175 A1 DE3523175 A1 DE 3523175A1 DE 19853523175 DE19853523175 DE 19853523175 DE 3523175 A DE3523175 A DE 3523175A DE 3523175 A1 DE3523175 A1 DE 3523175A1
- Authority
- DE
- Germany
- Prior art keywords
- brush
- artist
- handle
- different
- brushes
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Granted
Links
- 238000009966 trimming Methods 0.000 claims description 12
- 230000003247 decreasing effect Effects 0.000 abstract 1
- 230000008719 thickening Effects 0.000 description 3
- 238000010428 oil painting Methods 0.000 description 2
- 239000003973 paint Substances 0.000 description 2
- 238000010429 water colour painting Methods 0.000 description 2
- 230000001680 brushing effect Effects 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- NQLVQOSNDJXLKG-UHFFFAOYSA-N prosulfocarb Chemical compound CCCN(CCC)C(=O)SCC1=CC=CC=C1 NQLVQOSNDJXLKG-UHFFFAOYSA-N 0.000 description 1
- 238000005096 rolling process Methods 0.000 description 1
- 238000010186 staining Methods 0.000 description 1
Classifications
-
- A—HUMAN NECESSITIES
- A46—BRUSHWARE
- A46B—BRUSHES
- A46B5/00—Brush bodies; Handles integral with brushware
-
- A—HUMAN NECESSITIES
- A46—BRUSHWARE
- A46B—BRUSHES
- A46B7/00—Bristle carriers arranged in the brush body
- A46B7/04—Bristle carriers arranged in the brush body interchangeably removable bristle carriers
-
- A—HUMAN NECESSITIES
- A46—BRUSHWARE
- A46B—BRUSHES
- A46B2200/00—Brushes characterized by their functions, uses or applications
- A46B2200/20—Brushes for applying products to surfaces in general
- A46B2200/202—Applicator paint brush
- A46B2200/205—Artist paint brush, e.g. paint brushes that as a rule come to a point for fine work
Landscapes
- Brushes (AREA)
- Coating Apparatus (AREA)
Priority Applications (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19853523175 DE3523175A1 (de) | 1985-06-28 | 1985-06-28 | Kuenstlerpinsel |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19853523175 DE3523175A1 (de) | 1985-06-28 | 1985-06-28 | Kuenstlerpinsel |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DE3523175A1 true DE3523175A1 (de) | 1987-01-08 |
| DE3523175C2 DE3523175C2 (enExample) | 1988-01-21 |
Family
ID=6274451
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19853523175 Granted DE3523175A1 (de) | 1985-06-28 | 1985-06-28 | Kuenstlerpinsel |
Country Status (1)
| Country | Link |
|---|---|
| DE (1) | DE3523175A1 (enExample) |
Cited By (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| EP0433839A1 (de) * | 1989-12-20 | 1991-06-26 | Defet Kg Künstlerpinselfabrik | Künstlerpinsel |
| FR2697417A1 (fr) * | 1992-10-29 | 1994-05-06 | Flament Sa Ets | Pinceau destiné à appliquer des produits liquides ou pâteux. |
| EP0679351A1 (fr) * | 1994-04-27 | 1995-11-02 | Etablissements Flament S.A. | Pinceau destiné à appliquer des produits liquides ou pâteux |
| GB2329328A (en) * | 1997-09-17 | 1999-03-24 | Universal International Plc | Paint brush |
Families Citing this family (8)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE4115943C2 (de) * | 1991-05-16 | 1998-10-01 | Noerthemann Karl Heinz | Zahnfleischmassagebürste |
| DE10240183B3 (de) * | 2002-08-28 | 2004-03-18 | Norbert Franz | Pinselkopf und Pinselkopf-System |
| USD557020S1 (en) | 2005-01-06 | 2007-12-11 | Royal Brush Manufacturing, Inc. | Brush handle |
| USD558981S1 (en) | 2005-01-06 | 2008-01-08 | Royal Brush Manufacturing, Inc. | Paint brush head |
| USD558982S1 (en) | 2005-01-06 | 2008-01-08 | Royal Brush Manufacturing, Inc. | Paint brush head |
| USD559548S1 (en) | 2005-01-06 | 2008-01-15 | Royal Brush Manufacturing, Inc. | Paint brush head |
| USD559547S1 (en) | 2005-01-06 | 2008-01-15 | Royal Brush Manufacturing, Inc. | Paint brush head |
| USD533224S1 (en) | 2005-01-06 | 2006-12-05 | Royal Brush Manufacturing, Inc. | Stylus handle |
Citations (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CH97028A (de) * | 1921-06-02 | 1922-12-01 | Friedlin Hans | Neuerung an Pinseln, Besen und dergleichen. |
| DE815036C (de) * | 1949-10-04 | 1951-09-27 | Willi Lange | Verlaengerungsgriff fuer Deckenbuersten und aehnliche Arbeitsgeraete |
| DE1919526A1 (de) * | 1969-04-17 | 1970-11-05 | Nolte Dr Med Wolf Juergen | Vorrichtung zur physiologischen Beeinflussung der Muskulatur des Verdauungskanals |
| DE7113078U (de) * | 1971-09-30 | Gebr Schabert Kg | Pinsel mit auswechselbarem Pinselkopf | |
| DE8000269U1 (de) * | 1980-01-08 | 1980-05-08 | Elco-Pinsel Gmbh, 8802 Bechhofen | Pinsel mit besatz |
| DE3129044A1 (de) * | 1980-11-20 | 1982-07-15 | VEB Metall Miesterhorst, 3571 Miesterhorst | Wechselstielsystem |
| US4471507A (en) * | 1983-05-27 | 1984-09-18 | Marvin Schwartz | Paint brushes with detachable handles |
-
1985
- 1985-06-28 DE DE19853523175 patent/DE3523175A1/de active Granted
Patent Citations (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE7113078U (de) * | 1971-09-30 | Gebr Schabert Kg | Pinsel mit auswechselbarem Pinselkopf | |
| CH97028A (de) * | 1921-06-02 | 1922-12-01 | Friedlin Hans | Neuerung an Pinseln, Besen und dergleichen. |
| DE815036C (de) * | 1949-10-04 | 1951-09-27 | Willi Lange | Verlaengerungsgriff fuer Deckenbuersten und aehnliche Arbeitsgeraete |
| DE1919526A1 (de) * | 1969-04-17 | 1970-11-05 | Nolte Dr Med Wolf Juergen | Vorrichtung zur physiologischen Beeinflussung der Muskulatur des Verdauungskanals |
| DE8000269U1 (de) * | 1980-01-08 | 1980-05-08 | Elco-Pinsel Gmbh, 8802 Bechhofen | Pinsel mit besatz |
| DE3129044A1 (de) * | 1980-11-20 | 1982-07-15 | VEB Metall Miesterhorst, 3571 Miesterhorst | Wechselstielsystem |
| US4471507A (en) * | 1983-05-27 | 1984-09-18 | Marvin Schwartz | Paint brushes with detachable handles |
Cited By (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| EP0433839A1 (de) * | 1989-12-20 | 1991-06-26 | Defet Kg Künstlerpinselfabrik | Künstlerpinsel |
| FR2697417A1 (fr) * | 1992-10-29 | 1994-05-06 | Flament Sa Ets | Pinceau destiné à appliquer des produits liquides ou pâteux. |
| EP0680706A1 (fr) * | 1992-10-29 | 1995-11-08 | Etablissements Flament S.A. | Pinceau destiné à appliquer des produits liquides ou pâteux |
| EP0679351A1 (fr) * | 1994-04-27 | 1995-11-02 | Etablissements Flament S.A. | Pinceau destiné à appliquer des produits liquides ou pâteux |
| FR2719203A1 (fr) * | 1994-04-27 | 1995-11-03 | Flament Sa Ets | Pinceau destiné à appliquer des produits liquides ou pâteux. |
| GB2329328A (en) * | 1997-09-17 | 1999-03-24 | Universal International Plc | Paint brush |
Also Published As
| Publication number | Publication date |
|---|---|
| DE3523175C2 (enExample) | 1988-01-21 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE8807268U1 (de) | Stielbürste zum Reinigen von Hohlkörpern | |
| DE3523175A1 (de) | Kuenstlerpinsel | |
| EP0583761B1 (de) | Schirm | |
| EP0099069A2 (de) | Lackstift | |
| DE2114533C2 (de) | Härteverstellbare Massagebürste | |
| DE2550256A1 (de) | Abstreifer fuer einen kosmetischen stift mit applikator | |
| DE19509830A1 (de) | Farbschlüssel | |
| DE3620846A1 (de) | Zahnbuerste | |
| DE19734282C2 (de) | Fingerzahnbürste | |
| CH365188A (de) | Aus Kehrichtschaufel und Handwischer bestehende Reinigungsgarnitur | |
| EP0433839A1 (de) | Künstlerpinsel | |
| DE102018133028A1 (de) | Reinigungsgerät | |
| DE3424340C2 (de) | Mehrzweckmesser | |
| DE7704174U1 (de) | Handwerkzeug, insbesondere maler- oder tapezierwerkzeug | |
| DE4336186C2 (de) | Vorrichtung zur Erzeugung von Strähnen im Haar | |
| DE2547236C3 (de) | Zeichenpinsel und Verfahren zu dessen Herstellung | |
| DE488240C (de) | Zerlegbarer Gewehrputzstock | |
| AT398527B (de) | Reinigungsgerät bestehend aus einer bürste od.dgl. | |
| DE102018102626B4 (de) | Taillierter kosmetikpinsel | |
| DE863932C (de) | Zerlegbar ausgebildeter Toilettengegenstand | |
| DE2610741C3 (de) | Zirkeleinsatz | |
| DE2009716A1 (de) | Mehrzweck-Tischständer | |
| EP0586927A1 (de) | Schirm oder Spazierstock | |
| DE202021106256U1 (de) | Spültuchhalter | |
| DE7011306U (de) | Buerste zum auftragen von farbe, lack usw. |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| OP8 | Request for examination as to paragraph 44 patent law | ||
| D2 | Grant after examination | ||
| 8364 | No opposition during term of opposition | ||
| 8339 | Ceased/non-payment of the annual fee |