DE3401672A1 - Verfahren zur herstellung von mono- oder biscarbonylverbindungen - Google Patents
Verfahren zur herstellung von mono- oder biscarbonylverbindungenInfo
- Publication number
- DE3401672A1 DE3401672A1 DE19843401672 DE3401672A DE3401672A1 DE 3401672 A1 DE3401672 A1 DE 3401672A1 DE 19843401672 DE19843401672 DE 19843401672 DE 3401672 A DE3401672 A DE 3401672A DE 3401672 A1 DE3401672 A1 DE 3401672A1
- Authority
- DE
- Germany
- Prior art keywords
- hydrogenation
- formula
- radical
- ozone
- ozonization
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Withdrawn
Links
- 150000001875 compounds Chemical class 0.000 title claims abstract description 26
- 238000004519 manufacturing process Methods 0.000 title claims description 10
- 238000005984 hydrogenation reaction Methods 0.000 claims abstract description 79
- 238000000034 method Methods 0.000 claims abstract description 55
- 238000006385 ozonation reaction Methods 0.000 claims abstract description 52
- 239000003054 catalyst Substances 0.000 claims abstract description 47
- CBENFWSGALASAD-UHFFFAOYSA-N Ozone Chemical compound [O-][O+]=O CBENFWSGALASAD-UHFFFAOYSA-N 0.000 claims abstract description 40
- 150000002978 peroxides Chemical class 0.000 claims abstract description 31
- 150000001728 carbonyl compounds Chemical class 0.000 claims abstract description 12
- 239000000725 suspension Substances 0.000 claims abstract description 8
- 150000001722 carbon compounds Chemical class 0.000 claims abstract description 6
- DNIAPMSPPWPWGF-GSVOUGTGSA-N (R)-(-)-Propylene glycol Chemical compound C[C@@H](O)CO DNIAPMSPPWPWGF-GSVOUGTGSA-N 0.000 claims abstract description 4
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 claims description 93
- 239000001257 hydrogen Substances 0.000 claims description 45
- 229910052739 hydrogen Inorganic materials 0.000 claims description 45
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 33
- 125000004432 carbon atom Chemical group C* 0.000 claims description 15
- 238000006894 reductive elimination reaction Methods 0.000 claims description 14
- BASFCYQUMIYNBI-UHFFFAOYSA-N platinum Chemical compound [Pt] BASFCYQUMIYNBI-UHFFFAOYSA-N 0.000 claims description 13
- 125000001931 aliphatic group Chemical group 0.000 claims description 12
- 239000002904 solvent Substances 0.000 claims description 11
- 150000002431 hydrogen Chemical group 0.000 claims description 10
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 claims description 9
- 230000002829 reductive effect Effects 0.000 claims description 9
- VVQNEPGJFQJSBK-UHFFFAOYSA-N Methyl methacrylate Chemical compound COC(=O)C(C)=C VVQNEPGJFQJSBK-UHFFFAOYSA-N 0.000 claims description 8
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims description 6
- 229910052760 oxygen Inorganic materials 0.000 claims description 6
- 239000001301 oxygen Substances 0.000 claims description 6
- 229910052697 platinum Inorganic materials 0.000 claims description 6
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 claims description 5
- 238000009903 catalytic hydrogenation reaction Methods 0.000 claims description 5
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 5
- 229910052717 sulfur Inorganic materials 0.000 claims description 5
- 239000011593 sulfur Substances 0.000 claims description 5
- 125000003118 aryl group Chemical group 0.000 claims description 4
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims description 4
- LEQAOMBKQFMDFZ-UHFFFAOYSA-N glyoxal Chemical compound O=CC=O LEQAOMBKQFMDFZ-UHFFFAOYSA-N 0.000 claims description 4
- 125000005842 heteroatom Chemical group 0.000 claims description 3
- 125000004070 6 membered heterocyclic group Chemical class 0.000 claims description 2
- 229940015043 glyoxal Drugs 0.000 claims description 2
- 125000001072 heteroaryl group Chemical group 0.000 claims description 2
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 2
- 239000000463 material Substances 0.000 claims description 2
- CIUQDSCDWFSTQR-UHFFFAOYSA-N [C]1=CC=CC=C1 Chemical class [C]1=CC=CC=C1 CIUQDSCDWFSTQR-UHFFFAOYSA-N 0.000 claims 1
- 125000000636 p-nitrophenyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1*)[N+]([O-])=O 0.000 claims 1
- 125000001037 p-tolyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1*)C([H])([H])[H] 0.000 claims 1
- 238000002360 preparation method Methods 0.000 abstract description 3
- 239000000243 solution Substances 0.000 description 63
- 239000000047 product Substances 0.000 description 26
- 238000006243 chemical reaction Methods 0.000 description 16
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 15
- -1 heteroaromatic aldehydes Chemical class 0.000 description 15
- ARGCQEVBJHPOGB-UHFFFAOYSA-N 2,5-dihydrofuran Chemical compound C1OCC=C1 ARGCQEVBJHPOGB-UHFFFAOYSA-N 0.000 description 12
- UFWIBTONFRDIAS-UHFFFAOYSA-N Naphthalene Chemical compound C1=CC=CC2=CC=CC=C21 UFWIBTONFRDIAS-UHFFFAOYSA-N 0.000 description 12
- HGCIXCUEYOPUTN-UHFFFAOYSA-N cyclohexene Chemical compound C1CCC=CC1 HGCIXCUEYOPUTN-UHFFFAOYSA-N 0.000 description 12
- 238000010626 work up procedure Methods 0.000 description 11
- 150000003254 radicals Chemical class 0.000 description 10
- 238000004448 titration Methods 0.000 description 10
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 9
- 230000002378 acidificating effect Effects 0.000 description 9
- 239000011541 reaction mixture Substances 0.000 description 9
- 239000007858 starting material Substances 0.000 description 9
- 125000003172 aldehyde group Chemical group 0.000 description 8
- 150000002500 ions Chemical class 0.000 description 7
- 150000002923 oximes Chemical class 0.000 description 7
- 238000005949 ozonolysis reaction Methods 0.000 description 7
- WSFSSNUMVMOOMR-UHFFFAOYSA-N Formaldehyde Chemical compound O=C WSFSSNUMVMOOMR-UHFFFAOYSA-N 0.000 description 6
- 238000009835 boiling Methods 0.000 description 6
- 239000007795 chemical reaction product Substances 0.000 description 6
- 230000000694 effects Effects 0.000 description 6
- 229910000510 noble metal Inorganic materials 0.000 description 6
- 238000003756 stirring Methods 0.000 description 6
- 239000000126 substance Substances 0.000 description 6
- 239000000203 mixture Substances 0.000 description 5
- 230000008929 regeneration Effects 0.000 description 5
- 238000011069 regeneration method Methods 0.000 description 5
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 5
- RRKODOZNUZCUBN-CCAGOZQPSA-N (1z,3z)-cycloocta-1,3-diene Chemical compound C1CC\C=C/C=C\C1 RRKODOZNUZCUBN-CCAGOZQPSA-N 0.000 description 4
- YBYIRNPNPLQARY-UHFFFAOYSA-N 1H-indene Chemical compound C1=CC=C2CC=CC2=C1 YBYIRNPNPLQARY-UHFFFAOYSA-N 0.000 description 4
- 239000006227 byproduct Substances 0.000 description 4
- KDLHZDBZIXYQEI-UHFFFAOYSA-N palladium Substances [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 4
- 238000000926 separation method Methods 0.000 description 4
- YFTNGXPZDGKIMY-UHFFFAOYSA-N 4,4-dimethoxybut-1-ene Chemical compound COC(OC)CC=C YFTNGXPZDGKIMY-UHFFFAOYSA-N 0.000 description 3
- JLBJTVDPSNHSKJ-UHFFFAOYSA-N 4-Methylstyrene Chemical compound CC1=CC=C(C=C)C=C1 JLBJTVDPSNHSKJ-UHFFFAOYSA-N 0.000 description 3
- KFDVPJUYSDEJTH-UHFFFAOYSA-N 4-ethenylpyridine Chemical compound C=CC1=CC=NC=C1 KFDVPJUYSDEJTH-UHFFFAOYSA-N 0.000 description 3
- UMHJEEQLYBKSAN-UHFFFAOYSA-N Adipaldehyde Chemical compound O=CCCCCC=O UMHJEEQLYBKSAN-UHFFFAOYSA-N 0.000 description 3
- 150000001241 acetals Chemical class 0.000 description 3
- URYYVOIYTNXXBN-UPHRSURJSA-N cyclooctene Chemical compound C1CCC\C=C/CC1 URYYVOIYTNXXBN-UPHRSURJSA-N 0.000 description 3
- 239000004913 cyclooctene Substances 0.000 description 3
- 239000007789 gas Substances 0.000 description 3
- 238000002844 melting Methods 0.000 description 3
- 230000008018 melting Effects 0.000 description 3
- 229940054441 o-phthalaldehyde Drugs 0.000 description 3
- OADYBSJSJUFUBR-UHFFFAOYSA-N octanedial Chemical compound O=CCCCCCCC=O OADYBSJSJUFUBR-UHFFFAOYSA-N 0.000 description 3
- ZWLUXSQADUDCSB-UHFFFAOYSA-N phthalaldehyde Chemical compound O=CC1=CC=CC=C1C=O ZWLUXSQADUDCSB-UHFFFAOYSA-N 0.000 description 3
- MBDNRNMVTZADMQ-UHFFFAOYSA-N sulfolene Chemical compound O=S1(=O)CC=CC1 MBDNRNMVTZADMQ-UHFFFAOYSA-N 0.000 description 3
- TXGHOSDIGLWWFE-UHFFFAOYSA-N 1,1,8,8-tetramethoxyoctane Chemical compound COC(OC)CCCCCCC(OC)OC TXGHOSDIGLWWFE-UHFFFAOYSA-N 0.000 description 2
- SPEUIVXLLWOEMJ-UHFFFAOYSA-N 1,1-dimethoxyethane Chemical compound COC(C)OC SPEUIVXLLWOEMJ-UHFFFAOYSA-N 0.000 description 2
- RWGPAMBILZOZBK-UHFFFAOYSA-N 2-(2-oxoethoxy)acetaldehyde Chemical compound O=CCOCC=O RWGPAMBILZOZBK-UHFFFAOYSA-N 0.000 description 2
- LKGNPIZAOBMSOD-UHFFFAOYSA-N 2-(2-oxoethyl)benzaldehyde Chemical compound O=CCC1=CC=CC=C1C=O LKGNPIZAOBMSOD-UHFFFAOYSA-N 0.000 description 2
- WAQXSSXMCPGQBD-UHFFFAOYSA-N 2-(2-oxoethylsulfonyl)acetaldehyde Chemical compound O=CCS(=O)(=O)CC=O WAQXSSXMCPGQBD-UHFFFAOYSA-N 0.000 description 2
- CSDSSGBPEUDDEE-UHFFFAOYSA-N 2-formylpyridine Chemical compound O=CC1=CC=CC=N1 CSDSSGBPEUDDEE-UHFFFAOYSA-N 0.000 description 2
- KGIGUEBEKRSTEW-UHFFFAOYSA-N 2-vinylpyridine Chemical compound C=CC1=CC=CC=N1 KGIGUEBEKRSTEW-UHFFFAOYSA-N 0.000 description 2
- LGZOGIOIEBOBCZ-UHFFFAOYSA-N 3,3-dibutoxypropanal Chemical compound CCCCOC(CC=O)OCCCC LGZOGIOIEBOBCZ-UHFFFAOYSA-N 0.000 description 2
- KXVQJIFNPZJOTG-UHFFFAOYSA-N 3,3-dimethoxypropanal Chemical compound COC(OC)CC=O KXVQJIFNPZJOTG-UHFFFAOYSA-N 0.000 description 2
- SUNKIXPXTMANBG-UHFFFAOYSA-N 4,4-dibutoxybut-1-ene Chemical compound CCCCOC(CC=C)OCCCC SUNKIXPXTMANBG-UHFFFAOYSA-N 0.000 description 2
- BXRFQSNOROATLV-UHFFFAOYSA-N 4-nitrobenzaldehyde Chemical compound [O-][N+](=O)C1=CC=C(C=O)C=C1 BXRFQSNOROATLV-UHFFFAOYSA-N 0.000 description 2
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 2
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 2
- PCSMJKASWLYICJ-UHFFFAOYSA-N Succinic aldehyde Chemical compound O=CCCC=O PCSMJKASWLYICJ-UHFFFAOYSA-N 0.000 description 2
- DHKHKXVYLBGOIT-UHFFFAOYSA-N acetaldehyde Diethyl Acetal Natural products CCOC(C)OCC DHKHKXVYLBGOIT-UHFFFAOYSA-N 0.000 description 2
- 150000001299 aldehydes Chemical class 0.000 description 2
- 125000000217 alkyl group Chemical group 0.000 description 2
- 125000002947 alkylene group Chemical group 0.000 description 2
- 230000015572 biosynthetic process Effects 0.000 description 2
- 239000012876 carrier material Substances 0.000 description 2
- 238000012512 characterization method Methods 0.000 description 2
- 238000001816 cooling Methods 0.000 description 2
- BQHDXNZNSPVVKB-UHFFFAOYSA-N diethyl 2-methylidenepropanedioate Chemical compound CCOC(=O)C(=C)C(=O)OCC BQHDXNZNSPVVKB-UHFFFAOYSA-N 0.000 description 2
- IBZFNIMEOXVZMC-UHFFFAOYSA-N dimethyl cyclohex-3-ene-1,2-dicarboxylate Chemical compound COC(=O)C1CCC=CC1C(=O)OC IBZFNIMEOXVZMC-UHFFFAOYSA-N 0.000 description 2
- 238000004821 distillation Methods 0.000 description 2
- 238000011065 in-situ storage Methods 0.000 description 2
- CWKLZLBVOJRSOM-UHFFFAOYSA-N methyl pyruvate Chemical compound COC(=O)C(C)=O CWKLZLBVOJRSOM-UHFFFAOYSA-N 0.000 description 2
- FXLOVSHXALFLKQ-UHFFFAOYSA-N p-tolualdehyde Chemical compound CC1=CC=C(C=O)C=C1 FXLOVSHXALFLKQ-UHFFFAOYSA-N 0.000 description 2
- 229910052763 palladium Inorganic materials 0.000 description 2
- 239000003208 petroleum Substances 0.000 description 2
- 239000012071 phase Substances 0.000 description 2
- 239000000843 powder Substances 0.000 description 2
- 230000002035 prolonged effect Effects 0.000 description 2
- BGUWFUQJCDRPTL-UHFFFAOYSA-N pyridine-4-carbaldehyde Chemical compound O=CC1=CC=NC=C1 BGUWFUQJCDRPTL-UHFFFAOYSA-N 0.000 description 2
- 238000011946 reduction process Methods 0.000 description 2
- BJRGNROMZGSJDC-UHFFFAOYSA-N 1,1,4,4-tetramethoxybutane Chemical compound COC(OC)CCC(OC)OC BJRGNROMZGSJDC-UHFFFAOYSA-N 0.000 description 1
- RLIGZIPVXNQITD-UHFFFAOYSA-N 1,1,6,6-tetramethoxyhexane Chemical compound COC(OC)CCCCC(OC)OC RLIGZIPVXNQITD-UHFFFAOYSA-N 0.000 description 1
- 125000002030 1,2-phenylene group Chemical group [H]C1=C([H])C([*:1])=C([*:2])C([H])=C1[H] 0.000 description 1
- YFZHODLXYNDBSM-UHFFFAOYSA-N 1-ethenyl-4-nitrobenzene Chemical compound [O-][N+](=O)C1=CC=C(C=C)C=C1 YFZHODLXYNDBSM-UHFFFAOYSA-N 0.000 description 1
- GFISDBXSWQMOND-UHFFFAOYSA-N 2,5-dimethoxyoxolane Chemical compound COC1CCC(OC)O1 GFISDBXSWQMOND-UHFFFAOYSA-N 0.000 description 1
- NIXOWILDQLNWCW-UHFFFAOYSA-N 2-Propenoic acid Natural products OC(=O)C=C NIXOWILDQLNWCW-UHFFFAOYSA-N 0.000 description 1
- BSKHPKMHTQYZBB-UHFFFAOYSA-N 2-methylpyridine Chemical class CC1=CC=CC=N1 BSKHPKMHTQYZBB-UHFFFAOYSA-N 0.000 description 1
- WSSSPWUEQFSQQG-UHFFFAOYSA-N 4-methyl-1-pentene Chemical compound CC(C)CC=C WSSSPWUEQFSQQG-UHFFFAOYSA-N 0.000 description 1
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 1
- JIGUQPWFLRLWPJ-UHFFFAOYSA-N Ethyl acrylate Chemical compound CCOC(=O)C=C JIGUQPWFLRLWPJ-UHFFFAOYSA-N 0.000 description 1
- IYXGSMUGOJNHAZ-UHFFFAOYSA-N Ethyl malonate Chemical compound CCOC(=O)CC(=O)OCC IYXGSMUGOJNHAZ-UHFFFAOYSA-N 0.000 description 1
- 238000006000 Knoevenagel condensation reaction Methods 0.000 description 1
- 239000002253 acid Substances 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 230000001476 alcoholic effect Effects 0.000 description 1
- 125000003545 alkoxy group Chemical group 0.000 description 1
- 125000004453 alkoxycarbonyl group Chemical group 0.000 description 1
- 229910052782 aluminium Inorganic materials 0.000 description 1
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 description 1
- 239000008346 aqueous phase Substances 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 230000009286 beneficial effect Effects 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 125000002843 carboxylic acid group Chemical group 0.000 description 1
- 230000003197 catalytic effect Effects 0.000 description 1
- 238000006555 catalytic reaction Methods 0.000 description 1
- 150000001768 cations Chemical class 0.000 description 1
- 239000003638 chemical reducing agent Substances 0.000 description 1
- 238000000354 decomposition reaction Methods 0.000 description 1
- 230000007423 decrease Effects 0.000 description 1
- DBKKFIIYQGGHJO-UHFFFAOYSA-N diethyl 2-oxopropanedioate Chemical compound CCOC(=O)C(=O)C(=O)OCC DBKKFIIYQGGHJO-UHFFFAOYSA-N 0.000 description 1
- 230000000447 dimerizing effect Effects 0.000 description 1
- APGUUZNLMFETAH-UHFFFAOYSA-N dimethyl cyclohexene-1,2-dicarboxylate Chemical compound COC(=O)C1=C(C(=O)OC)CCCC1 APGUUZNLMFETAH-UHFFFAOYSA-N 0.000 description 1
- 229940082150 encore Drugs 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- FJAKCEHATXBFJT-UHFFFAOYSA-N ethyl 2-oxobutanoate Chemical compound CCOC(=O)C(=O)CC FJAKCEHATXBFJT-UHFFFAOYSA-N 0.000 description 1
- 230000002349 favourable effect Effects 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 238000005194 fractionation Methods 0.000 description 1
- 239000011261 inert gas Substances 0.000 description 1
- 229910052500 inorganic mineral Inorganic materials 0.000 description 1
- 239000000543 intermediate Substances 0.000 description 1
- 235000021190 leftovers Nutrition 0.000 description 1
- WSFSSNUMVMOOMR-NJFSPNSNSA-N methanone Chemical compound O=[14CH2] WSFSSNUMVMOOMR-NJFSPNSNSA-N 0.000 description 1
- OJURWUUOVGOHJZ-UHFFFAOYSA-N methyl 2-[(2-acetyloxyphenyl)methyl-[2-[(2-acetyloxyphenyl)methyl-(2-methoxy-2-oxoethyl)amino]ethyl]amino]acetate Chemical compound C=1C=CC=C(OC(C)=O)C=1CN(CC(=O)OC)CCN(CC(=O)OC)CC1=CC=CC=C1OC(C)=O OJURWUUOVGOHJZ-UHFFFAOYSA-N 0.000 description 1
- 239000011707 mineral Substances 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 description 1
- ZHCAAFJSYLFLPX-UHFFFAOYSA-N nitrocyclohexatriene Chemical group [O-][N+](=O)C1=CC=C=C[CH]1 ZHCAAFJSYLFLPX-UHFFFAOYSA-N 0.000 description 1
- 229910052757 nitrogen Inorganic materials 0.000 description 1
- 150000002894 organic compounds Chemical class 0.000 description 1
- 150000001451 organic peroxides Chemical class 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- 230000035515 penetration Effects 0.000 description 1
- PNJWIWWMYCMZRO-UHFFFAOYSA-N pent‐4‐en‐2‐one Natural products CC(=O)CC=C PNJWIWWMYCMZRO-UHFFFAOYSA-N 0.000 description 1
- 230000000144 pharmacologic effect Effects 0.000 description 1
- AQSJGOWTSHOLKH-UHFFFAOYSA-N phosphite(3-) Chemical class [O-]P([O-])[O-] AQSJGOWTSHOLKH-UHFFFAOYSA-N 0.000 description 1
- 150000003014 phosphoric acid esters Chemical class 0.000 description 1
- OJMIONKXNSYLSR-UHFFFAOYSA-N phosphorous acid Chemical compound OP(O)O OJMIONKXNSYLSR-UHFFFAOYSA-N 0.000 description 1
- 231100000572 poisoning Toxicity 0.000 description 1
- 230000000607 poisoning effect Effects 0.000 description 1
- 230000035484 reaction time Effects 0.000 description 1
- 230000008707 rearrangement Effects 0.000 description 1
- 239000000741 silica gel Substances 0.000 description 1
- 229910002027 silica gel Inorganic materials 0.000 description 1
- 229910001415 sodium ion Inorganic materials 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 230000002269 spontaneous effect Effects 0.000 description 1
- 238000003860 storage Methods 0.000 description 1
- 239000000758 substrate Substances 0.000 description 1
- 229960000468 sulfalene Drugs 0.000 description 1
- KXRZBTAEDBELFD-UHFFFAOYSA-N sulfamethopyrazine Chemical compound COC1=NC=CN=C1NS(=O)(=O)C1=CC=C(N)C=C1 KXRZBTAEDBELFD-UHFFFAOYSA-N 0.000 description 1
- 150000003462 sulfoxides Chemical class 0.000 description 1
- LMBFAGIMSUYTBN-MPZNNTNKSA-N teixobactin Chemical class C([C@H](C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H](CCC(N)=O)C(=O)N[C@H]([C@@H](C)CC)C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H]1C(N[C@@H](C)C(=O)N[C@@H](C[C@@H]2NC(=N)NC2)C(=O)N[C@H](C(=O)O[C@H]1C)[C@@H](C)CC)=O)NC)C1=CC=CC=C1 LMBFAGIMSUYTBN-MPZNNTNKSA-N 0.000 description 1
- 239000010409 thin film Substances 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
- 229910052727 yttrium Inorganic materials 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C45/00—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds
- C07C45/40—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by oxidation with ozone; by ozonolysis
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C201/00—Preparation of esters of nitric or nitrous acid or of compounds containing nitro or nitroso groups bound to a carbon skeleton
- C07C201/06—Preparation of nitro compounds
- C07C201/12—Preparation of nitro compounds by reactions not involving the formation of nitro groups
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C315/00—Preparation of sulfones; Preparation of sulfoxides
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C45/00—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds
- C07C45/56—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds from heterocyclic compounds
- C07C45/57—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds from heterocyclic compounds with oxygen as the only heteroatom
- C07C45/59—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds from heterocyclic compounds with oxygen as the only heteroatom in five-membered rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C47/00—Compounds having —CHO groups
- C07C47/02—Saturated compounds having —CHO groups bound to acyclic carbon atoms or to hydrogen
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C47/00—Compounds having —CHO groups
- C07C47/02—Saturated compounds having —CHO groups bound to acyclic carbon atoms or to hydrogen
- C07C47/12—Saturated compounds having —CHO groups bound to acyclic carbon atoms or to hydrogen containing more than one —CHO group
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C47/00—Compounds having —CHO groups
- C07C47/02—Saturated compounds having —CHO groups bound to acyclic carbon atoms or to hydrogen
- C07C47/198—Saturated compounds having —CHO groups bound to acyclic carbon atoms or to hydrogen containing ether groups, groups, groups, or groups
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C47/00—Compounds having —CHO groups
- C07C47/52—Compounds having —CHO groups bound to carbon atoms of six—membered aromatic rings
- C07C47/542—Alkylated benzaldehydes
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C47/00—Compounds having —CHO groups
- C07C47/52—Compounds having —CHO groups bound to carbon atoms of six—membered aromatic rings
- C07C47/544—Diformyl benzenes; Alkylated derivatives thereof
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C49/00—Ketones; Ketenes; Dimeric ketenes; Ketonic chelates
- C07C49/04—Saturated compounds containing keto groups bound to acyclic carbon atoms
- C07C49/12—Ketones containing more than one keto group
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C67/00—Preparation of carboxylic acid esters
- C07C67/30—Preparation of carboxylic acid esters by modifying the acid moiety of the ester, such modification not being an introduction of an ester group
- C07C67/313—Preparation of carboxylic acid esters by modifying the acid moiety of the ester, such modification not being an introduction of an ester group by introduction of doubly bound oxygen containing functional groups, e.g. carboxyl groups
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D213/00—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members
- C07D213/02—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members
- C07D213/04—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D213/24—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom with substituted hydrocarbon radicals attached to ring carbon atoms
- C07D213/44—Radicals substituted by doubly-bound oxygen, sulfur, or nitrogen atoms, or by two such atoms singly-bound to the same carbon atom
- C07D213/46—Oxygen atoms
- C07D213/48—Aldehydo radicals
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| AT0450083A AT380008B (de) | 1983-12-23 | 1983-12-23 | Verfahren zur herstellung von mono- oder biscarbonylverbindungen |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE3401672A1 true DE3401672A1 (de) | 1985-09-26 |
Family
ID=3564834
Family Applications (2)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19843401672 Withdrawn DE3401672A1 (de) | 1983-12-23 | 1984-01-19 | Verfahren zur herstellung von mono- oder biscarbonylverbindungen |
| DE8484113702T Expired - Lifetime DE3481414D1 (de) | 1983-12-23 | 1984-11-14 | Verfahren zur herstellung von mono- oder biscarbonylverbindungen. |
Family Applications After (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE8484113702T Expired - Lifetime DE3481414D1 (de) | 1983-12-23 | 1984-11-14 | Verfahren zur herstellung von mono- oder biscarbonylverbindungen. |
Country Status (15)
| Country | Link |
|---|---|
| US (1) | US4769464A (enExample) |
| EP (1) | EP0147593B1 (enExample) |
| JP (1) | JPS60156635A (enExample) |
| KR (1) | KR920000444B1 (enExample) |
| AT (2) | AT380008B (enExample) |
| AU (1) | AU572246B2 (enExample) |
| CA (1) | CA1253867A (enExample) |
| DE (2) | DE3401672A1 (enExample) |
| ES (1) | ES8606234A1 (enExample) |
| GR (1) | GR81086B (enExample) |
| HU (1) | HU198437B (enExample) |
| IE (1) | IE57650B1 (enExample) |
| IL (1) | IL73933A (enExample) |
| NZ (1) | NZ210517A (enExample) |
| ZA (1) | ZA849894B (enExample) |
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE19811517A1 (de) * | 1998-03-17 | 1999-09-23 | Studiengesellschaft Kohle Mbh | Verfahren zur Oxidation von Cyclohexan mit Ozon |
Families Citing this family (44)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE3346266A1 (de) * | 1983-12-21 | 1985-07-11 | Lentia Gmbh | Verfahren zur herstelung von glyoxal, alkylglyoxalen und von deren acetalen |
| DE3544046A1 (de) * | 1985-12-13 | 1987-06-19 | Degussa | Verfahren zur herstellung von 2,5-dimethoxy- und 2,5-diethoxytetrahydrofuran |
| ATE127775T1 (de) * | 1989-12-14 | 1995-09-15 | Chemie Linz Gmbh | Verfahren zur herstellung von alpha-omega- alkandicarbonsäuren. |
| AT398759B (de) * | 1993-03-12 | 1995-01-25 | Chemie Linz Gmbh | Hydrogenolytische reduktion peroxidischer ozonolyseprodukte und vorrichtung zu ihrer durchführung |
| TW299317B (enExample) * | 1993-03-12 | 1997-03-01 | Chemie Linz Gmbh | |
| AT402293B (de) * | 1994-09-06 | 1997-03-25 | Chemie Linz Gmbh | Verfahren zur herstellung von mono- oder dicarbonsäuren aus aldehyden, deren vollacetalen oder halbacetalen, sowie aus gemischen davon |
| AT404938B (de) * | 1996-10-30 | 1999-03-25 | Chemie Linz Gmbh | Verfahren zur reinigung von o-phthaldialdehyd |
| AT408099B (de) * | 1999-11-26 | 2001-08-27 | Dsm Fine Chem Austria Gmbh | Verfahren zur herstellung von hydroxymethylpyridinen |
| WO2001062696A1 (en) * | 2000-02-25 | 2001-08-30 | Akzo Nobel N.V. | Process for the preparation of glyceraldehyde and derivatives thereof |
| WO2001098439A2 (en) * | 2000-06-22 | 2001-12-27 | The Lubrizol Corporation | Acylating agents and dispersants for lubricating oil and fuels |
| AT500421A1 (de) * | 2000-12-14 | 2005-12-15 | Dsm Fine Chem Austria Gmbh | Verbessertes verfahren zur reinigung von ketonen, erhalten aus den korrespondierenden terpenen durch ozonolyse und reduktion |
| AT500489A1 (de) * | 2001-03-09 | 2006-01-15 | Dsm Fine Chem Austria Gmbh | Verfahren zur herstellung von mono- oder biscarbonyl- oder hydroxylverbindungen |
| AT413537B (de) * | 2001-05-15 | 2006-03-15 | Dsm Fine Chem Austria Gmbh | Verbessertes verfahren zur reinigung und formulierung von o-phthalaldehyd |
| AT412087B (de) * | 2002-12-13 | 2004-09-27 | Dsm Fine Chem Austria Gmbh | In-situ zersetzung von peroxiden während der ozonolyse von alkenen |
| HU227638B1 (en) * | 2005-12-23 | 2011-10-28 | Thales Rt | Flowing laboratorial ozonizating apparatus and method for ozonization reaction |
| US8106242B2 (en) | 2006-05-23 | 2012-01-31 | Dsm Ip Assets B.V. | Process for the production of compounds via hazardous intermediates in a series of microreactors |
| US20080177101A1 (en) * | 2006-07-11 | 2008-07-24 | Spectra Gases, Inc. | Synthesis of isotopically labeled alpha-keto acids and esters |
| WO2008077769A1 (en) * | 2006-12-20 | 2008-07-03 | Dsm Fine Chemicals Austria Nfg Gmbh & Co Kg | Process for the safe ozonolysis of organic compounds in flammable solvents |
| US10414839B2 (en) | 2010-10-20 | 2019-09-17 | Sirrus, Inc. | Polymers including a methylene beta-ketoester and products formed therefrom |
| US9828324B2 (en) | 2010-10-20 | 2017-11-28 | Sirrus, Inc. | Methylene beta-diketone monomers, methods for making methylene beta-diketone monomers, polymerizable compositions and products formed therefrom |
| US9249265B1 (en) | 2014-09-08 | 2016-02-02 | Sirrus, Inc. | Emulsion polymers including one or more 1,1-disubstituted alkene compounds, emulsion methods, and polymer compositions |
| WO2012054633A2 (en) * | 2010-10-20 | 2012-04-26 | Bioformix, Llc | Synthesis of methylene malonates using rapid recovery in the presence of a heat transfer agent |
| US9279022B1 (en) | 2014-09-08 | 2016-03-08 | Sirrus, Inc. | Solution polymers including one or more 1,1-disubstituted alkene compounds, solution polymerization methods, and polymer compositions |
| JP2014532625A (ja) | 2011-10-19 | 2014-12-08 | シラス・インコーポレイテッド | メチレンβ−ジケトンモノマー、メチレンβ−ジケトンモノマーを製造するための方法、これらから作られる重合可能な組成物および製品 |
| EP3626784A1 (en) | 2012-03-30 | 2020-03-25 | Sirrus, Inc. | Ink and coating formulations and polymerizable systems for producing the same |
| EP2831125B1 (en) | 2012-03-30 | 2016-10-05 | Sirrus, Inc. | Methods for activating polymerizable compositions, polymerizable systems, and products formed thereby |
| WO2013149168A1 (en) | 2012-03-30 | 2013-10-03 | Bioformix, Inc. | Composite and laminate articles and polymerizable systems for producing the same |
| US10047192B2 (en) | 2012-06-01 | 2018-08-14 | Sirrus, Inc. | Optical material and articles formed therefrom |
| EP2920231B1 (en) | 2012-11-16 | 2020-05-06 | Sirrus, Inc. | Plastics bonding systems and methods |
| EP3712928A1 (en) | 2012-11-30 | 2020-09-23 | Sirrus, Inc. | Composite compositions for electronics applications |
| CN105008321A (zh) | 2013-01-11 | 2015-10-28 | 瑟拉斯公司 | 经过双(羟甲基)丙二酸酯的途径获得亚甲基丙二酸酯的方法 |
| US9315597B2 (en) | 2014-09-08 | 2016-04-19 | Sirrus, Inc. | Compositions containing 1,1-disubstituted alkene compounds for preparing polymers having enhanced glass transition temperatures |
| US9416091B1 (en) | 2015-02-04 | 2016-08-16 | Sirrus, Inc. | Catalytic transesterification of ester compounds with groups reactive under transesterification conditions |
| US10501400B2 (en) | 2015-02-04 | 2019-12-10 | Sirrus, Inc. | Heterogeneous catalytic transesterification of ester compounds with groups reactive under transesterification conditions |
| US9334430B1 (en) | 2015-05-29 | 2016-05-10 | Sirrus, Inc. | Encapsulated polymerization initiators, polymerization systems and methods using the same |
| US9217098B1 (en) | 2015-06-01 | 2015-12-22 | Sirrus, Inc. | Electroinitiated polymerization of compositions having a 1,1-disubstituted alkene compound |
| US9518001B1 (en) | 2016-05-13 | 2016-12-13 | Sirrus, Inc. | High purity 1,1-dicarbonyl substituted-1-alkenes and methods for their preparation |
| US9567475B1 (en) | 2016-06-03 | 2017-02-14 | Sirrus, Inc. | Coatings containing polyester macromers containing 1,1-dicarbonyl-substituted 1 alkenes |
| US9617377B1 (en) | 2016-06-03 | 2017-04-11 | Sirrus, Inc. | Polyester macromers containing 1,1-dicarbonyl-substituted 1 alkenes |
| US10196481B2 (en) | 2016-06-03 | 2019-02-05 | Sirrus, Inc. | Polymer and other compounds functionalized with terminal 1,1-disubstituted alkene monomer(s) and methods thereof |
| US10428177B2 (en) | 2016-06-03 | 2019-10-01 | Sirrus, Inc. | Water absorbing or water soluble polymers, intermediate compounds, and methods thereof |
| CN111056955B (zh) * | 2019-12-16 | 2021-05-25 | 中国科学院大连化学物理研究所 | 一种环己烯制备己二胺的方法 |
| CN111138255B (zh) * | 2019-12-16 | 2021-06-22 | 中国科学院大连化学物理研究所 | 一种环己烯制备己二醛的工艺 |
| CN117776828A (zh) * | 2023-11-30 | 2024-03-29 | 上海巽田科技股份有限公司 | 一种采用非均相催化剂连续式制备羰基化合物的方法及其使用的催化剂 |
Citations (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3145232A (en) * | 1959-11-03 | 1964-08-18 | Monsanto Co | Ozonization and reduction of unsaturated organic compounds |
| US3637721A (en) * | 1970-06-25 | 1972-01-25 | Inmont Corp | Process for producing aldehydes by ozonizing and reducing certain aromatic and heterocyclic compounds containing carbon-to-carbon unsaturation |
Family Cites Families (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2733270A (en) * | 1956-01-31 | Preparation of aldehydes | ||
| GB709450A (en) * | 1950-10-09 | 1954-05-26 | Du Pont | Preparation of adipaldehyde |
| US3705922A (en) * | 1970-08-11 | 1972-12-12 | United States Steel Corp | Process for the preparation of glyoxylic acid methyl hemiacetal |
| NL171808C (nl) * | 1971-02-19 | 1983-05-16 | Snia Viscosa | Werkwijze voor het ozoniseren van alkenen. |
| DE2514001A1 (de) * | 1975-03-29 | 1976-10-07 | Basf Ag | Verfahren zur herstellung von glyoxalmonoacetalen |
| SU590314A1 (ru) * | 1975-12-11 | 1978-01-30 | Институт Химии Башкирского Филиала Ан Ссср | Способ получени олигомерных (цис-1,4-полидиен-1,3)-гликолей |
| DE3346266A1 (de) * | 1983-12-21 | 1985-07-11 | Lentia Gmbh | Verfahren zur herstelung von glyoxal, alkylglyoxalen und von deren acetalen |
-
1983
- 1983-12-23 AT AT0450083A patent/AT380008B/de not_active IP Right Cessation
-
1984
- 1984-01-19 DE DE19843401672 patent/DE3401672A1/de not_active Withdrawn
- 1984-11-14 DE DE8484113702T patent/DE3481414D1/de not_active Expired - Lifetime
- 1984-11-14 EP EP84113702A patent/EP0147593B1/de not_active Expired - Lifetime
- 1984-11-14 AT AT84113702T patent/ATE50555T1/de not_active IP Right Cessation
- 1984-11-28 GR GR81086A patent/GR81086B/el unknown
- 1984-12-10 IE IE3164/84A patent/IE57650B1/en not_active IP Right Cessation
- 1984-12-11 NZ NZ210517A patent/NZ210517A/en unknown
- 1984-12-12 CA CA000469941A patent/CA1253867A/en not_active Expired
- 1984-12-17 US US06/681,904 patent/US4769464A/en not_active Expired - Lifetime
- 1984-12-19 ZA ZA849894A patent/ZA849894B/xx unknown
- 1984-12-21 HU HU844810A patent/HU198437B/hu unknown
- 1984-12-21 ES ES538965A patent/ES8606234A1/es not_active Expired
- 1984-12-21 JP JP59268745A patent/JPS60156635A/ja active Granted
- 1984-12-21 AU AU37036/84A patent/AU572246B2/en not_active Ceased
- 1984-12-22 KR KR1019840008271A patent/KR920000444B1/ko not_active Expired
- 1984-12-25 IL IL73933A patent/IL73933A/xx not_active IP Right Cessation
Patent Citations (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3145232A (en) * | 1959-11-03 | 1964-08-18 | Monsanto Co | Ozonization and reduction of unsaturated organic compounds |
| US3637721A (en) * | 1970-06-25 | 1972-01-25 | Inmont Corp | Process for producing aldehydes by ozonizing and reducing certain aromatic and heterocyclic compounds containing carbon-to-carbon unsaturation |
Non-Patent Citations (3)
| Title |
|---|
| DE-Buch: Honben-Weyl: Eugen Müller: Georg Thieme Verlag: Methoden der organischen Chemie, Bd.VII, Teil 1, Stuttgart 1954, S.333-337 * |
| US-Z: Chemical Abstracts, 64, 1966, 9881 b * |
| US-Z: J. Chem. Soc., Perkin Trans. 1, 1972, S.1335-42 * |
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE19811517A1 (de) * | 1998-03-17 | 1999-09-23 | Studiengesellschaft Kohle Mbh | Verfahren zur Oxidation von Cyclohexan mit Ozon |
Also Published As
| Publication number | Publication date |
|---|---|
| IE843164L (en) | 1985-06-23 |
| JPS60156635A (ja) | 1985-08-16 |
| KR850004564A (ko) | 1985-07-25 |
| ATA450083A (de) | 1985-08-15 |
| IL73933A (en) | 1989-02-28 |
| ATE50555T1 (de) | 1990-03-15 |
| CA1253867A (en) | 1989-05-09 |
| IE57650B1 (en) | 1993-02-10 |
| EP0147593A2 (de) | 1985-07-10 |
| EP0147593B1 (de) | 1990-02-28 |
| GR81086B (en) | 1985-01-09 |
| US4769464A (en) | 1988-09-06 |
| IL73933A0 (en) | 1985-03-31 |
| EP0147593A3 (en) | 1986-06-04 |
| KR920000444B1 (ko) | 1992-01-14 |
| DE3481414D1 (de) | 1990-04-05 |
| HU198437B (en) | 1989-10-30 |
| AT380008B (de) | 1986-03-25 |
| HUT36444A (en) | 1985-09-30 |
| ZA849894B (en) | 1985-08-28 |
| ES538965A0 (es) | 1986-04-16 |
| AU572246B2 (en) | 1988-05-05 |
| JPS6361296B2 (enExample) | 1988-11-28 |
| AU3703684A (en) | 1985-07-04 |
| ES8606234A1 (es) | 1986-04-16 |
| NZ210517A (en) | 1988-01-08 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| EP0147593B1 (de) | Verfahren zur Herstellung von Mono- oder Biscarbonylverbindungen | |
| EP1858903B1 (de) | Diarylphenoxy-aluminium-verbindungen | |
| EP0099981B1 (de) | Verfahren zur Herstellung von Glyoxylsäure und Glyoxylsäurederivaten | |
| EP0146784B1 (de) | Verfahren zur Herstellung von Glyoxal, Alkylglyoxalen und von deren Acetalen | |
| DE69823844T2 (de) | Verfahren zur herstellung von als protease inhibitoren wervollen 4-hydroxy-2-oxo-pyran-derivaten | |
| DE3122995C2 (enExample) | ||
| DE1938219A1 (de) | Verfahren zur Herstellung von 14-Hydroxy-normorphinonderivaten | |
| DE2717502C2 (enExample) | ||
| EP0385287A2 (de) | Verfahren zur Herstellung von D-Mannosaminderivaten | |
| EP0468320A1 (de) | Verfahren zur Herstellung von Glykolen aus Formaldehyd | |
| EP0058326A1 (de) | Verfahren zur Herstellung von araliphatischen Aldehyden und/oder Aminen | |
| EP0128279B1 (de) | Verfahren zur Herstellung von 6-Methylnicotinsäureester | |
| DE3020298C2 (de) | Verfahren zur Herstellung von 2,2,4,5,5-Pentamethyl-3-formyl-3-pyrrolin | |
| DE1443594A1 (de) | Verfahren zur Herstellung von Estern der Vitamin-A-Saeure | |
| DE60204473T2 (de) | VERFAHREN ZUR HERSTELLUNG VON 4-(HYDROXY)-ç1,4-!BIPIPERIDINYL-L-CARBONSÄURE-TERT.-BUTYLESTER | |
| DE2538307C3 (de) | Verfahren zur Herstellung von Dimethylaminobenzolsulfonaten | |
| DE1271713B (de) | Verfahren zur Herstellung von organischen Carbonylverbindungen | |
| DE1795023C2 (de) | Verfahren zur Herstellung von 2-Benzyloxy-2-isopropylmalonsäurediäthylester und dessen Verwendung zur Herstellung von Heterocyclen für die Totalsynthese von Reptidalkaloiden des Mutterkorns | |
| DE1468624B2 (de) | Verfahren zur herstellung von beta-cyanketonen | |
| DE2166997B2 (de) | Verfahren zur Herstellung von 4,4-Diphenyl-piperidinen | |
| DE1793661C (de) | Verfahren zur Herstellung von 2,5-Dimethyl-4,5-dihydrofuranol-(3)-on-(4). Ausscheidung aus: 1768649 | |
| DE1445184C (de) | Verfahren zur Herstellung von alpha-Pyrrolidino-n-valerophenonen und ihren Salzen | |
| DE4137271A1 (de) | Verfahren zur herstellung von n-(2-chlor-pyridin-5-yl-methyl)-ethylendiamin | |
| DD232494A5 (de) | Neue 2,6-dioxa-bicyclo-(2,2,2)-octan-6-yl-acetaldehyde | |
| DE1110633B (de) | Verfahren zur Herstellung von Vitamin-A-saeurenitril bzw. -estern |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| OM8 | Search report available as to paragraph 43 lit. 1 sentence 1 patent law | ||
| 8127 | New person/name/address of the applicant |
Owner name: CHEMIE LINZ (DEUTSCHLAND) GMBH, 6200 WIESBADEN, DE |
|
| 8141 | Disposal/no request for examination |