DE3321871C2 - - Google Patents
Info
- Publication number
- DE3321871C2 DE3321871C2 DE3321871A DE3321871A DE3321871C2 DE 3321871 C2 DE3321871 C2 DE 3321871C2 DE 3321871 A DE3321871 A DE 3321871A DE 3321871 A DE3321871 A DE 3321871A DE 3321871 C2 DE3321871 C2 DE 3321871C2
- Authority
- DE
- Germany
- Prior art keywords
- group
- recording material
- bisazo
- weight
- bisazo compound
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 239000000463 material Substances 0.000 claims description 154
- -1 Bisazo compound Chemical class 0.000 claims description 115
- 125000001424 substituent group Chemical group 0.000 claims description 20
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 12
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 10
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims description 10
- 229910052736 halogen Inorganic materials 0.000 claims description 9
- 150000002367 halogens Chemical class 0.000 claims description 9
- UJOBWOGCFQCDNV-UHFFFAOYSA-N 9H-carbazole Chemical compound C1=CC=C2C3=CC=CC=C3NC2=C1 UJOBWOGCFQCDNV-UHFFFAOYSA-N 0.000 claims description 8
- 125000003545 alkoxy group Chemical group 0.000 claims description 8
- 125000000217 alkyl group Chemical group 0.000 claims description 8
- 229910052799 carbon Inorganic materials 0.000 claims description 8
- 125000005843 halogen group Chemical group 0.000 claims description 8
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 claims description 7
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 claims description 6
- 125000001624 naphthyl group Chemical group 0.000 claims description 6
- 125000004178 (C1-C4) alkyl group Chemical group 0.000 claims description 5
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 5
- SIKJAQJRHWYJAI-UHFFFAOYSA-N Indole Chemical compound C1=CC=C2NC=CC2=C1 SIKJAQJRHWYJAI-UHFFFAOYSA-N 0.000 claims description 4
- UFWIBTONFRDIAS-UHFFFAOYSA-N Naphthalene Chemical compound C1=CC=CC2=CC=CC=C21 UFWIBTONFRDIAS-UHFFFAOYSA-N 0.000 claims description 4
- 125000000609 carbazolyl group Chemical group C1(=CC=CC=2C3=CC=CC=C3NC12)* 0.000 claims description 4
- 229910052739 hydrogen Inorganic materials 0.000 claims description 4
- 239000001257 hydrogen Substances 0.000 claims description 4
- 125000001041 indolyl group Chemical group 0.000 claims description 4
- IANQTJSKSUMEQM-UHFFFAOYSA-N 1-benzofuran Chemical group C1=CC=C2OC=CC2=C1 IANQTJSKSUMEQM-UHFFFAOYSA-N 0.000 claims description 3
- 125000000499 benzofuranyl group Chemical group O1C(=CC2=C1C=CC=C2)* 0.000 claims description 3
- 125000003983 fluorenyl group Chemical group C1(=CC=CC=2C3=CC=CC=C3CC12)* 0.000 claims description 3
- 125000002541 furyl group Chemical group 0.000 claims description 3
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 claims description 3
- 125000004076 pyridyl group Chemical group 0.000 claims description 3
- 150000003254 radicals Chemical class 0.000 claims description 3
- 125000001544 thienyl group Chemical group 0.000 claims description 3
- ICBZSKCTKKUQSY-YUWZRIFDSA-N 4-[(1r,2s)-1-hydroxy-2-(methylamino)propyl]phenol;hydrochloride Chemical compound Cl.CN[C@@H](C)[C@H](O)C1=CC=C(O)C=C1 ICBZSKCTKKUQSY-YUWZRIFDSA-N 0.000 claims description 2
- 125000005428 anthryl group Chemical group [H]C1=C([H])C([H])=C2C([H])=C3C(*)=C([H])C([H])=C([H])C3=C([H])C2=C1[H] 0.000 claims description 2
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 claims description 2
- 125000002147 dimethylamino group Chemical group [H]C([H])([H])N(*)C([H])([H])[H] 0.000 claims description 2
- PZOUSPYUWWUPPK-UHFFFAOYSA-N indole Natural products CC1=CC=CC2=C1C=CN2 PZOUSPYUWWUPPK-UHFFFAOYSA-N 0.000 claims description 2
- RKJUIXBNRJVNHR-UHFFFAOYSA-N indolenine Natural products C1=CC=C2CC=NC2=C1 RKJUIXBNRJVNHR-UHFFFAOYSA-N 0.000 claims description 2
- 125000004432 carbon atom Chemical group C* 0.000 claims 1
- 239000010410 layer Substances 0.000 description 86
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 44
- 125000000664 diazo group Chemical group [N-]=[N+]=[*] 0.000 description 42
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 36
- 239000006185 dispersion Substances 0.000 description 33
- 229920006267 polyester film Polymers 0.000 description 28
- 150000003839 salts Chemical class 0.000 description 28
- 239000000203 mixture Substances 0.000 description 27
- 229910052782 aluminium Inorganic materials 0.000 description 26
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 description 26
- 239000011541 reaction mixture Substances 0.000 description 23
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 22
- 238000005859 coupling reaction Methods 0.000 description 18
- 238000002329 infrared spectrum Methods 0.000 description 16
- 230000008878 coupling Effects 0.000 description 15
- 238000010168 coupling process Methods 0.000 description 15
- 229920001225 polyester resin Polymers 0.000 description 13
- 239000004645 polyester resin Substances 0.000 description 13
- VMHLLURERBWHNL-UHFFFAOYSA-M Sodium acetate Chemical compound [Na+].CC([O-])=O VMHLLURERBWHNL-UHFFFAOYSA-M 0.000 description 12
- 239000001632 sodium acetate Substances 0.000 description 12
- 235000017281 sodium acetate Nutrition 0.000 description 12
- LPXPTNMVRIOKMN-UHFFFAOYSA-M sodium nitrite Chemical compound [Na+].[O-]N=O LPXPTNMVRIOKMN-UHFFFAOYSA-M 0.000 description 12
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 12
- 239000002800 charge carrier Substances 0.000 description 11
- 239000000243 solution Substances 0.000 description 11
- VZSRBBMJRBPUNF-UHFFFAOYSA-N 2-(2,3-dihydro-1H-inden-2-ylamino)-N-[3-oxo-3-(2,4,6,7-tetrahydrotriazolo[4,5-c]pyridin-5-yl)propyl]pyrimidine-5-carboxamide Chemical compound C1C(CC2=CC=CC=C12)NC1=NC=C(C=N1)C(=O)NCCC(N1CC2=C(CC1)NN=N2)=O VZSRBBMJRBPUNF-UHFFFAOYSA-N 0.000 description 10
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 10
- 239000007864 aqueous solution Substances 0.000 description 10
- 239000011230 binding agent Substances 0.000 description 10
- 229920005989 resin Polymers 0.000 description 8
- 239000011347 resin Substances 0.000 description 8
- 239000000758 substrate Substances 0.000 description 8
- HTOVOINXQALKOW-UHFFFAOYSA-N 4-[4-(4-aminophenyl)buta-1,3-dienyl]aniline Chemical compound C1=CC(N)=CC=C1C=CC=CC1=CC=C(N)C=C1 HTOVOINXQALKOW-UHFFFAOYSA-N 0.000 description 7
- 238000010521 absorption reaction Methods 0.000 description 7
- 239000002609 medium Substances 0.000 description 7
- 238000002360 preparation method Methods 0.000 description 7
- IZOOKGZEMKOBQA-UHFFFAOYSA-N 4-[6-(4-aminophenyl)hexa-1,3,5-trienyl]aniline Chemical compound C1=CC(N)=CC=C1C=CC=CC=CC1=CC=C(N)C=C1 IZOOKGZEMKOBQA-UHFFFAOYSA-N 0.000 description 6
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 6
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 6
- 235000010288 sodium nitrite Nutrition 0.000 description 6
- 239000004793 Polystyrene Substances 0.000 description 5
- 239000002245 particle Substances 0.000 description 5
- 229920003227 poly(N-vinyl carbazole) Polymers 0.000 description 5
- 239000000047 product Substances 0.000 description 5
- 239000006163 transport media Substances 0.000 description 5
- RILZRCJGXSFXNE-UHFFFAOYSA-N 2-[4-(trifluoromethoxy)phenyl]ethanol Chemical compound OCCC1=CC=C(OC(F)(F)F)C=C1 RILZRCJGXSFXNE-UHFFFAOYSA-N 0.000 description 4
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 4
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 description 4
- 239000004419 Panlite Substances 0.000 description 4
- CIUQDSCDWFSTQR-UHFFFAOYSA-N [C]1=CC=CC=C1 Chemical compound [C]1=CC=CC=C1 CIUQDSCDWFSTQR-UHFFFAOYSA-N 0.000 description 4
- 239000000853 adhesive Substances 0.000 description 4
- 230000001070 adhesive effect Effects 0.000 description 4
- 239000013078 crystal Substances 0.000 description 4
- 150000001989 diazonium salts Chemical class 0.000 description 4
- 125000000623 heterocyclic group Chemical group 0.000 description 4
- 238000000034 method Methods 0.000 description 4
- 239000003960 organic solvent Substances 0.000 description 4
- 239000004431 polycarbonate resin Substances 0.000 description 4
- 229920005668 polycarbonate resin Polymers 0.000 description 4
- 229920000728 polyester Polymers 0.000 description 4
- WFKWXMTUELFFGS-UHFFFAOYSA-N tungsten Chemical compound [W] WFKWXMTUELFFGS-UHFFFAOYSA-N 0.000 description 4
- 229910052721 tungsten Inorganic materials 0.000 description 4
- 239000010937 tungsten Substances 0.000 description 4
- WPWHSFAFEBZWBB-UHFFFAOYSA-N 1-butyl radical Chemical compound [CH2]CCC WPWHSFAFEBZWBB-UHFFFAOYSA-N 0.000 description 3
- GBCBWIWWOJUPBF-ZPUQHVIOSA-N 1-nitro-4-[(1e,3e)-4-(4-nitrophenyl)buta-1,3-dienyl]benzene Chemical compound C1=CC([N+](=O)[O-])=CC=C1\C=C\C=C\C1=CC=C([N+]([O-])=O)C=C1 GBCBWIWWOJUPBF-ZPUQHVIOSA-N 0.000 description 3
- OYPMHQIMQGZDHK-CRQXNEITSA-N 1-nitro-4-[(1e,3e,5e)-6-(4-nitrophenyl)hexa-1,3,5-trienyl]benzene Chemical compound C1=CC([N+](=O)[O-])=CC=C1\C=C\C=C\C=C\C1=CC=C([N+]([O-])=O)C=C1 OYPMHQIMQGZDHK-CRQXNEITSA-N 0.000 description 3
- BZKRKPGZABEOSM-XMHGGMMESA-N 4-[(e)-2-[3-[4-(diethylamino)phenyl]-2-phenyl-3,4-dihydropyrazol-5-yl]ethenyl]-n,n-diethylaniline Chemical compound C1=CC(N(CC)CC)=CC=C1\C=C\C1=NN(C=2C=CC=CC=2)C(C=2C=CC(=CC=2)N(CC)CC)C1 BZKRKPGZABEOSM-XMHGGMMESA-N 0.000 description 3
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 3
- BUGBHKTXTAQXES-UHFFFAOYSA-N Selenium Chemical compound [Se] BUGBHKTXTAQXES-UHFFFAOYSA-N 0.000 description 3
- 230000004888 barrier function Effects 0.000 description 3
- 238000006243 chemical reaction Methods 0.000 description 3
- 229910052801 chlorine Inorganic materials 0.000 description 3
- 239000000460 chlorine Substances 0.000 description 3
- 150000001875 compounds Chemical class 0.000 description 3
- 238000010438 heat treatment Methods 0.000 description 3
- 238000004519 manufacturing process Methods 0.000 description 3
- 229910052751 metal Inorganic materials 0.000 description 3
- 239000002184 metal Substances 0.000 description 3
- 239000004014 plasticizer Substances 0.000 description 3
- 229920002223 polystyrene Polymers 0.000 description 3
- 239000002244 precipitate Substances 0.000 description 3
- 229910052711 selenium Inorganic materials 0.000 description 3
- 239000011669 selenium Substances 0.000 description 3
- 238000003756 stirring Methods 0.000 description 3
- 229920002554 vinyl polymer Polymers 0.000 description 3
- QNLZIZAQLLYXTC-UHFFFAOYSA-N 1,2-dimethylnaphthalene Chemical compound C1=CC=CC2=C(C)C(C)=CC=C21 QNLZIZAQLLYXTC-UHFFFAOYSA-N 0.000 description 2
- KBSPJIWZDWBDGM-UHFFFAOYSA-N 1-Methylpyrene Chemical compound C1=C2C(C)=CC=C(C=C3)C2=C2C3=CC=CC2=C1 KBSPJIWZDWBDGM-UHFFFAOYSA-N 0.000 description 2
- VHQGURIJMFPBKS-UHFFFAOYSA-N 2,4,7-trinitrofluoren-9-one Chemical compound [O-][N+](=O)C1=CC([N+]([O-])=O)=C2C3=CC=C([N+](=O)[O-])C=C3C(=O)C2=C1 VHQGURIJMFPBKS-UHFFFAOYSA-N 0.000 description 2
- TURIHPLQSRVWHU-UHFFFAOYSA-N 2-phenylnaphthalene Chemical compound C1=CC=CC=C1C1=CC=C(C=CC=C2)C2=C1 TURIHPLQSRVWHU-UHFFFAOYSA-N 0.000 description 2
- JFGQHAHJWJBOPD-UHFFFAOYSA-N 3-hydroxy-n-phenylnaphthalene-2-carboxamide Chemical compound OC1=CC2=CC=CC=C2C=C1C(=O)NC1=CC=CC=C1 JFGQHAHJWJBOPD-UHFFFAOYSA-N 0.000 description 2
- UZGVMZRBRRYLIP-UHFFFAOYSA-N 4-[5-[4-(diethylamino)phenyl]-1,3,4-oxadiazol-2-yl]-n,n-diethylaniline Chemical compound C1=CC(N(CC)CC)=CC=C1C1=NN=C(C=2C=CC(=CC=2)N(CC)CC)O1 UZGVMZRBRRYLIP-UHFFFAOYSA-N 0.000 description 2
- MEWVMBOXBMKYDO-UHFFFAOYSA-N CC1C(C=2N(C3=CC=CC=C3C2CC1=C)CC)=NNC1=CC=CC=C1 Chemical compound CC1C(C=2N(C3=CC=CC=C3C2CC1=C)CC)=NNC1=CC=CC=C1 MEWVMBOXBMKYDO-UHFFFAOYSA-N 0.000 description 2
- 238000006546 Horner-Wadsworth-Emmons reaction Methods 0.000 description 2
- 206010034972 Photosensitivity reaction Diseases 0.000 description 2
- 239000004952 Polyamide Substances 0.000 description 2
- ATUOYWHBWRKTHZ-UHFFFAOYSA-N Propane Chemical compound CCC ATUOYWHBWRKTHZ-UHFFFAOYSA-N 0.000 description 2
- XLOMVQKBTHCTTD-UHFFFAOYSA-N Zinc monoxide Chemical compound [Zn]=O XLOMVQKBTHCTTD-UHFFFAOYSA-N 0.000 description 2
- OCBFFGCSTGGPSQ-UHFFFAOYSA-N [CH2]CC Chemical compound [CH2]CC OCBFFGCSTGGPSQ-UHFFFAOYSA-N 0.000 description 2
- 239000012790 adhesive layer Substances 0.000 description 2
- MWPLVEDNUUSJAV-UHFFFAOYSA-N anthracene Chemical compound C1=CC=CC2=CC3=CC=CC=C3C=C21 MWPLVEDNUUSJAV-UHFFFAOYSA-N 0.000 description 2
- 125000001246 bromo group Chemical group Br* 0.000 description 2
- 150000001721 carbon Chemical group 0.000 description 2
- 239000003638 chemical reducing agent Substances 0.000 description 2
- 238000009833 condensation Methods 0.000 description 2
- 230000005494 condensation Effects 0.000 description 2
- 238000000354 decomposition reaction Methods 0.000 description 2
- 239000012954 diazonium Substances 0.000 description 2
- 238000006193 diazotization reaction Methods 0.000 description 2
- DOIRQSBPFJWKBE-UHFFFAOYSA-N dibutyl phthalate Chemical compound CCCCOC(=O)C1=CC=CC=C1C(=O)OCCCC DOIRQSBPFJWKBE-UHFFFAOYSA-N 0.000 description 2
- OKVJWADVFPXWQD-UHFFFAOYSA-N difluoroborinic acid Chemical compound OB(F)F OKVJWADVFPXWQD-UHFFFAOYSA-N 0.000 description 2
- USIUVYZYUHIAEV-UHFFFAOYSA-N diphenyl ether Chemical compound C=1C=CC=CC=1OC1=CC=CC=C1 USIUVYZYUHIAEV-UHFFFAOYSA-N 0.000 description 2
- QUPDWYMUPZLYJZ-UHFFFAOYSA-N ethyl Chemical compound C[CH2] QUPDWYMUPZLYJZ-UHFFFAOYSA-N 0.000 description 2
- 239000004744 fabric Substances 0.000 description 2
- 239000000706 filtrate Substances 0.000 description 2
- 238000001914 filtration Methods 0.000 description 2
- 239000011888 foil Substances 0.000 description 2
- WSFSSNUMVMOOMR-UHFFFAOYSA-N formaldehyde Natural products O=C WSFSSNUMVMOOMR-UHFFFAOYSA-N 0.000 description 2
- 150000002430 hydrocarbons Chemical group 0.000 description 2
- 229910052742 iron Inorganic materials 0.000 description 2
- WCYWZMWISLQXQU-UHFFFAOYSA-N methyl Chemical compound [CH3] WCYWZMWISLQXQU-UHFFFAOYSA-N 0.000 description 2
- 150000007522 mineralic acids Chemical class 0.000 description 2
- 238000002156 mixing Methods 0.000 description 2
- 239000000178 monomer Substances 0.000 description 2
- GACNTLAEHODJKY-UHFFFAOYSA-N n,n-dibenzyl-4-[1-[4-(dibenzylamino)phenyl]propyl]aniline Chemical compound C=1C=C(N(CC=2C=CC=CC=2)CC=2C=CC=CC=2)C=CC=1C(CC)C(C=C1)=CC=C1N(CC=1C=CC=CC=1)CC1=CC=CC=C1 GACNTLAEHODJKY-UHFFFAOYSA-N 0.000 description 2
- 230000036211 photosensitivity Effects 0.000 description 2
- 229920002647 polyamide Polymers 0.000 description 2
- 229920000642 polymer Polymers 0.000 description 2
- 238000001556 precipitation Methods 0.000 description 2
- 238000006722 reduction reaction Methods 0.000 description 2
- 150000003334 secondary amides Chemical class 0.000 description 2
- 239000000126 substance Substances 0.000 description 2
- VOLGAXAGEUPBDM-UHFFFAOYSA-N $l^{1}-oxidanylethane Chemical compound CC[O] VOLGAXAGEUPBDM-UHFFFAOYSA-N 0.000 description 1
- BKLWQDSDJBFRDF-ZPUQHVIOSA-N (2e,4e)-5-(4-nitrophenyl)penta-2,4-dienal Chemical compound [O-][N+](=O)C1=CC=C(\C=C\C=C\C=O)C=C1 BKLWQDSDJBFRDF-ZPUQHVIOSA-N 0.000 description 1
- OVYSYUWZCLZIKE-UHFFFAOYSA-N (9-ethyl-4-methyl-3-methylidene-2-phenyl-4H-carbazol-1-ylidene)hydrazine Chemical compound CC1C(C(C(C=2N(C3=CC=CC=C3C12)CC)=NN)C1=CC=CC=C1)=C OVYSYUWZCLZIKE-UHFFFAOYSA-N 0.000 description 1
- ALGQVMMYDWQDEC-OWOJBTEDSA-N (e)-3-(4-nitrophenyl)prop-2-enal Chemical compound [O-][N+](=O)C1=CC=C(\C=C\C=O)C=C1 ALGQVMMYDWQDEC-OWOJBTEDSA-N 0.000 description 1
- PVOFXOOKGFNHFA-UHFFFAOYSA-N 1,3,7,9-tetranitro-6-oxidobenzo[c]cinnolin-6-ium Chemical compound C1=C([N+]([O-])=O)C=C2C3=C([N+]([O-])=O)C=C([N+](=O)[O-])C=C3N=[N+]([O-])C2=C1[N+]([O-])=O PVOFXOOKGFNHFA-UHFFFAOYSA-N 0.000 description 1
- PMBBBTMBKMPOQF-UHFFFAOYSA-N 1,3,7-trinitrodibenzothiophene 5,5-dioxide Chemical compound O=S1(=O)C2=CC([N+](=O)[O-])=CC=C2C2=C1C=C([N+]([O-])=O)C=C2[N+]([O-])=O PMBBBTMBKMPOQF-UHFFFAOYSA-N 0.000 description 1
- WQGWMEKAPOBYFV-UHFFFAOYSA-N 1,5,7-trinitrothioxanthen-9-one Chemical compound C1=CC([N+]([O-])=O)=C2C(=O)C3=CC([N+](=O)[O-])=CC([N+]([O-])=O)=C3SC2=C1 WQGWMEKAPOBYFV-UHFFFAOYSA-N 0.000 description 1
- JAVBBFXUGDCHLZ-UHFFFAOYSA-N 1-$l^{1}-oxidanylpropane Chemical compound CCC[O] JAVBBFXUGDCHLZ-UHFFFAOYSA-N 0.000 description 1
- MNCMBBIFTVWHIP-UHFFFAOYSA-N 1-anthracen-9-yl-2,2,2-trifluoroethanone Chemical group C1=CC=C2C(C(=O)C(F)(F)F)=C(C=CC=C3)C3=CC2=C1 MNCMBBIFTVWHIP-UHFFFAOYSA-N 0.000 description 1
- HYGLETVERPVXOS-UHFFFAOYSA-N 1-bromopyrene Chemical compound C1=C2C(Br)=CC=C(C=C3)C2=C2C3=CC=CC2=C1 HYGLETVERPVXOS-UHFFFAOYSA-N 0.000 description 1
- AWAKGNAIMIGBNG-UHFFFAOYSA-N 1-diethoxyphosphoryl-4-nitrobenzene Chemical compound CCOP(=O)(OCC)C1=CC=C([N+]([O-])=O)C=C1 AWAKGNAIMIGBNG-UHFFFAOYSA-N 0.000 description 1
- HOQAPVYOGBLGOC-UHFFFAOYSA-N 1-ethyl-9h-carbazole Chemical group C12=CC=CC=C2NC2=C1C=CC=C2CC HOQAPVYOGBLGOC-UHFFFAOYSA-N 0.000 description 1
- ZWAMZDRREBOHIO-UHFFFAOYSA-N 1-ethylpyrene Chemical compound C1=C2C(CC)=CC=C(C=C3)C2=C2C3=CC=CC2=C1 ZWAMZDRREBOHIO-UHFFFAOYSA-N 0.000 description 1
- JKWHNOYTFIQUAE-UHFFFAOYSA-N 1-n,1-n,3-n,3-n-tetrabenzyl-9-ethylcarbazole-1,3-diamine Chemical compound C=12N(CC)C3=CC=CC=C3C2=CC(N(CC=2C=CC=CC=2)CC=2C=CC=CC=2)=CC=1N(CC=1C=CC=CC=1)CC1=CC=CC=C1 JKWHNOYTFIQUAE-UHFFFAOYSA-N 0.000 description 1
- TYUPTZLMOSZOAV-UHFFFAOYSA-N 2,4,10-trinitro-6-oxidobenzo[c]cinnolin-6-ium Chemical compound C1=CC([N+]([O-])=O)=C2C3=CC([N+](=O)[O-])=CC([N+]([O-])=O)=C3N=[N+]([O-])C2=C1 TYUPTZLMOSZOAV-UHFFFAOYSA-N 0.000 description 1
- JOERSAVCLPYNIZ-UHFFFAOYSA-N 2,4,5,7-tetranitrofluoren-9-one Chemical compound O=C1C2=CC([N+]([O-])=O)=CC([N+]([O-])=O)=C2C2=C1C=C([N+](=O)[O-])C=C2[N+]([O-])=O JOERSAVCLPYNIZ-UHFFFAOYSA-N 0.000 description 1
- RBFUXCYPJKXNMP-UHFFFAOYSA-N 2,4,7-trinitrophenanthrene-9,10-dione Chemical compound [O-][N+](=O)C1=CC([N+]([O-])=O)=C2C3=CC=C([N+](=O)[O-])C=C3C(=O)C(=O)C2=C1 RBFUXCYPJKXNMP-UHFFFAOYSA-N 0.000 description 1
- HJCNIHXYINVVFF-UHFFFAOYSA-N 2,6,8-trinitroindeno[1,2-b]thiophen-4-one Chemical compound O=C1C2=CC([N+]([O-])=O)=CC([N+]([O-])=O)=C2C2=C1C=C([N+](=O)[O-])S2 HJCNIHXYINVVFF-UHFFFAOYSA-N 0.000 description 1
- HDVGAFBXTXDYIB-UHFFFAOYSA-N 2,7-dinitrofluoren-9-one Chemical compound C1=C([N+]([O-])=O)C=C2C(=O)C3=CC([N+](=O)[O-])=CC=C3C2=C1 HDVGAFBXTXDYIB-UHFFFAOYSA-N 0.000 description 1
- VMQHOWOVMXIROE-UHFFFAOYSA-N 2,8-dinitrodibenzothiophene Chemical compound C1=C([N+]([O-])=O)C=C2C3=CC([N+](=O)[O-])=CC=C3SC2=C1 VMQHOWOVMXIROE-UHFFFAOYSA-N 0.000 description 1
- MFAWABLKXSRSOR-UHFFFAOYSA-N 2-(6,8-dinitroindeno[1,2-b]thiophen-4-ylidene)propanedinitrile Chemical compound [O-][N+](=O)C1=CC([N+](=O)[O-])=CC2=C1C(SC=C1)=C1C2=C(C#N)C#N MFAWABLKXSRSOR-UHFFFAOYSA-N 0.000 description 1
- FSMZNCMGDPVHDF-UHFFFAOYSA-N 2-bromo-6,8-dinitro-4h-indeno[1,2-b]thiophene Chemical compound [O-][N+](=O)C1=CC([N+](=O)[O-])=CC2=C1C(SC(Br)=C1)=C1C2 FSMZNCMGDPVHDF-UHFFFAOYSA-N 0.000 description 1
- ZHOQMEKSJLKZRY-UHFFFAOYSA-N 2-bromopyrene-1-carbaldehyde Chemical compound C1=CC=C2C=CC3=C(C=O)C(Br)=CC4=CC=C1C2=C43 ZHOQMEKSJLKZRY-UHFFFAOYSA-N 0.000 description 1
- IIKVAWLYHHZRGV-UHFFFAOYSA-N 2-carbazol-9-ylethanol Chemical compound C1=CC=C2N(CCO)C3=CC=CC=C3C2=C1 IIKVAWLYHHZRGV-UHFFFAOYSA-N 0.000 description 1
- YPOXSLZIYJHIQI-UHFFFAOYSA-N 2-hydroxy-n-phenyl-11h-benzo[a]carbazole-3-carboxamide Chemical compound OC1=CC2=C3NC4=CC=CC=C4C3=CC=C2C=C1C(=O)NC1=CC=CC=C1 YPOXSLZIYJHIQI-UHFFFAOYSA-N 0.000 description 1
- XMPQJGTYEXSTIY-UHFFFAOYSA-N 2-indeno[1,2-b]thiophen-4-ylidenepropanedinitrile Chemical compound C12=CC=CC=C2C(=C(C#N)C#N)C2=C1SC=C2 XMPQJGTYEXSTIY-UHFFFAOYSA-N 0.000 description 1
- GXLYVLHWXVRVKI-UHFFFAOYSA-N 2-nitrodibenzothiophene Chemical compound C1=CC=C2C3=CC([N+](=O)[O-])=CC=C3SC2=C1 GXLYVLHWXVRVKI-UHFFFAOYSA-N 0.000 description 1
- AJEAHBZZHSLIQP-UHFFFAOYSA-N 2-nitrofluoren-9-one Chemical compound C1=CC=C2C(=O)C3=CC([N+](=O)[O-])=CC=C3C2=C1 AJEAHBZZHSLIQP-UHFFFAOYSA-N 0.000 description 1
- YOCSZWYTDFWNMT-UHFFFAOYSA-N 2-nitroindeno[1,2-b]thiophen-4-one Chemical compound O=C1C2=CC=CC=C2C2=C1C=C([N+](=O)[O-])S2 YOCSZWYTDFWNMT-UHFFFAOYSA-N 0.000 description 1
- KEHIOHQUZQSPCO-UHFFFAOYSA-N 2-nitroindeno[2,1-b]thiophen-4-one Chemical compound C12=CC=CC=C2C(=O)C2=C1C=C([N+](=O)[O-])S2 KEHIOHQUZQSPCO-UHFFFAOYSA-N 0.000 description 1
- KLLLJCACIRKBDT-UHFFFAOYSA-N 2-phenyl-1H-indole Chemical compound N1C2=CC=CC=C2C=C1C1=CC=CC=C1 KLLLJCACIRKBDT-UHFFFAOYSA-N 0.000 description 1
- NOXSEPQGTKXPOK-UHFFFAOYSA-N 3,7,9-trinitro-5-oxidobenzo[c]cinnolin-5-ium Chemical compound C1=C([N+]([O-])=O)C=C2C3=CC=C([N+](=O)[O-])C=C3[N+]([O-])=NC2=C1[N+]([O-])=O NOXSEPQGTKXPOK-UHFFFAOYSA-N 0.000 description 1
- YRXRGRLSHSSUNF-UHFFFAOYSA-N 3,7-dinitrodibenzothiophene 5,5-dioxide Chemical compound C1=C([N+]([O-])=O)C=C2S(=O)(=O)C3=CC([N+](=O)[O-])=CC=C3C2=C1 YRXRGRLSHSSUNF-UHFFFAOYSA-N 0.000 description 1
- AEFDIOODLJMOML-UHFFFAOYSA-N 3,7-dinitrodibenzothiophene 5-oxide Chemical compound C1=C([N+]([O-])=O)C=C2S(=O)C3=CC([N+](=O)[O-])=CC=C3C2=C1 AEFDIOODLJMOML-UHFFFAOYSA-N 0.000 description 1
- WUPHOULIZUERAE-UHFFFAOYSA-N 3-(oxolan-2-yl)propanoic acid Chemical compound OC(=O)CCC1CCCO1 WUPHOULIZUERAE-UHFFFAOYSA-N 0.000 description 1
- YPRJLDUOGDQQAK-UHFFFAOYSA-N 3-nitrodibenzothiophene 5,5-dioxide Chemical compound C1=CC=C2S(=O)(=O)C3=CC([N+](=O)[O-])=CC=C3C2=C1 YPRJLDUOGDQQAK-UHFFFAOYSA-N 0.000 description 1
- BBSNLPXHXFJCJE-UHFFFAOYSA-N 3-nitrodibenzothiophene 5-oxide Chemical compound C1=CC=C2S(=O)C3=CC([N+](=O)[O-])=CC=C3C2=C1 BBSNLPXHXFJCJE-UHFFFAOYSA-N 0.000 description 1
- MLEBCZSWVARRML-UHFFFAOYSA-N 4-(2,5-diphenyl-1,3-oxazol-4-yl)-n,n-diethylaniline Chemical compound C1=CC(N(CC)CC)=CC=C1C1=C(C=2C=CC=CC=2)OC(C=2C=CC=CC=2)=N1 MLEBCZSWVARRML-UHFFFAOYSA-N 0.000 description 1
- CLQYLLIGYDFCGY-UHFFFAOYSA-N 4-(2-anthracen-9-ylethenyl)-n,n-diethylaniline Chemical compound C1=CC(N(CC)CC)=CC=C1C=CC1=C(C=CC=C2)C2=CC2=CC=CC=C12 CLQYLLIGYDFCGY-UHFFFAOYSA-N 0.000 description 1
- YATJOUUMQREMEW-UHFFFAOYSA-N 4-(2-anthracen-9-ylethenyl)-n,n-dimethylaniline Chemical compound C1=CC(N(C)C)=CC=C1C=CC1=C(C=CC=C2)C2=CC2=CC=CC=C12 YATJOUUMQREMEW-UHFFFAOYSA-N 0.000 description 1
- LXQJOJHWKDPNPD-UHFFFAOYSA-N 4-[2-[6-[2-[4-(diethylamino)phenyl]ethenyl]pyridin-2-yl]ethenyl]-n,n-diethylaniline Chemical compound C1=CC(N(CC)CC)=CC=C1C=CC1=CC=CC(C=CC=2C=CC(=CC=2)N(CC)CC)=N1 LXQJOJHWKDPNPD-UHFFFAOYSA-N 0.000 description 1
- YCHDSDSNBXYNHE-UHFFFAOYSA-N 4-[3-[4-(diethylamino)phenyl]-1h-1,2,4-triazol-5-yl]-n,n-diethylaniline Chemical compound C1=CC(N(CC)CC)=CC=C1C1=NN=C(C=2C=CC(=CC=2)N(CC)CC)N1 YCHDSDSNBXYNHE-UHFFFAOYSA-N 0.000 description 1
- SBMCZDLOXDWNIN-UHFFFAOYSA-N 4-[bis[4-(diethylamino)phenyl]methyl]-n,n-diethylaniline Chemical compound C1=CC(N(CC)CC)=CC=C1C(C=1C=CC(=CC=1)N(CC)CC)C1=CC=C(N(CC)CC)C=C1 SBMCZDLOXDWNIN-UHFFFAOYSA-N 0.000 description 1
- 125000004172 4-methoxyphenyl group Chemical group [H]C1=C([H])C(OC([H])([H])[H])=C([H])C([H])=C1* 0.000 description 1
- IXAFAYIIDHDJHN-UHFFFAOYSA-N 4-methylpyrene Natural products C1=CC=C2C(C)=CC3=CC=CC4=CC=C1C2=C34 IXAFAYIIDHDJHN-UHFFFAOYSA-N 0.000 description 1
- VLEBJFVCVYDLSG-UHFFFAOYSA-N 6,8-dinitro-4h-indeno[1,2-b]thiophene Chemical compound [O-][N+](=O)C1=CC([N+](=O)[O-])=CC2=C1C(SC=C1)=C1C2 VLEBJFVCVYDLSG-UHFFFAOYSA-N 0.000 description 1
- XLEYZLMRDKTFOI-UHFFFAOYSA-N 9-[[4-(dimethylamino)phenyl]methylidene]-2h-fluoren-1-one Chemical compound C1=CC(N(C)C)=CC=C1C=C1C2=CC=CC=C2C2=C1C(=O)CC=C2 XLEYZLMRDKTFOI-UHFFFAOYSA-N 0.000 description 1
- PLAZXGNBGZYJSA-UHFFFAOYSA-N 9-ethylcarbazole Chemical compound C1=CC=C2N(CC)C3=CC=CC=C3C2=C1 PLAZXGNBGZYJSA-UHFFFAOYSA-N 0.000 description 1
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 1
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- VGGSQFUCUMXWEO-UHFFFAOYSA-N Ethene Chemical compound C=C VGGSQFUCUMXWEO-UHFFFAOYSA-N 0.000 description 1
- 239000005977 Ethylene Substances 0.000 description 1
- 239000000020 Nitrocellulose Substances 0.000 description 1
- 206010034960 Photophobia Diseases 0.000 description 1
- JOSCNYCOYXTLTN-GFCCVEGCSA-N [3-[4-(aminomethyl)-6-(trifluoromethyl)pyridin-2-yl]oxyphenyl]-[(3R)-3-(hydroxymethyl)pyrrolidin-1-yl]methanone Chemical group NCC1=CC(=NC(=C1)C(F)(F)F)OC=1C=C(C=CC=1)C(=O)N1C[C@@H](CC1)CO JOSCNYCOYXTLTN-GFCCVEGCSA-N 0.000 description 1
- 239000004840 adhesive resin Substances 0.000 description 1
- 229920006223 adhesive resin Polymers 0.000 description 1
- 239000012670 alkaline solution Substances 0.000 description 1
- 125000000129 anionic group Chemical group 0.000 description 1
- BBEAQIROQSPTKN-UHFFFAOYSA-N antipyrene Natural products C1=CC=C2C=CC3=CC=CC4=CC=C1C2=C43 BBEAQIROQSPTKN-UHFFFAOYSA-N 0.000 description 1
- 150000005840 aryl radicals Chemical class 0.000 description 1
- 238000005452 bending Methods 0.000 description 1
- HFACYLZERDEVSX-UHFFFAOYSA-N benzidine Chemical compound C1=CC(N)=CC=C1C1=CC=C(N)C=C1 HFACYLZERDEVSX-UHFFFAOYSA-N 0.000 description 1
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 1
- 229910052794 bromium Inorganic materials 0.000 description 1
- 125000004106 butoxy group Chemical group [*]OC([H])([H])C([H])([H])C(C([H])([H])[H])([H])[H] 0.000 description 1
- 229910052980 cadmium sulfide Inorganic materials 0.000 description 1
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 1
- 239000003086 colorant Substances 0.000 description 1
- 238000004040 coloring Methods 0.000 description 1
- 238000007796 conventional method Methods 0.000 description 1
- 125000004093 cyano group Chemical group *C#N 0.000 description 1
- 125000000753 cycloalkyl group Chemical group 0.000 description 1
- 125000001664 diethylamino group Chemical group [H]C([H])([H])C([H])([H])N(*)C([H])([H])C([H])([H])[H] 0.000 description 1
- 238000000921 elemental analysis Methods 0.000 description 1
- 239000003822 epoxy resin Substances 0.000 description 1
- 125000001301 ethoxy group Chemical group [H]C([H])([H])C([H])([H])O* 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 230000005496 eutectics Effects 0.000 description 1
- GVEPBJHOBDJJJI-UHFFFAOYSA-N fluoranthrene Natural products C1=CC(C2=CC=CC=C22)=C3C2=CC=CC3=C1 GVEPBJHOBDJJJI-UHFFFAOYSA-N 0.000 description 1
- YLQWCDOCJODRMT-UHFFFAOYSA-N fluoren-9-one Chemical compound C1=CC=C2C(=O)C3=CC=CC=C3C2=C1 YLQWCDOCJODRMT-UHFFFAOYSA-N 0.000 description 1
- 235000019256 formaldehyde Nutrition 0.000 description 1
- 229960004279 formaldehyde Drugs 0.000 description 1
- WSOJIQBCVMSHLB-UHFFFAOYSA-N indeno[1,2-b]thiophen-4-one Chemical compound C12=CC=CC=C2C(=O)C2=C1SC=C2 WSOJIQBCVMSHLB-UHFFFAOYSA-N 0.000 description 1
- FFQQXIVOSCLQKP-UHFFFAOYSA-N indeno[2,1-b]thiophen-4-one Chemical compound O=C1C2=CC=CC=C2C2=C1SC=C2 FFQQXIVOSCLQKP-UHFFFAOYSA-N 0.000 description 1
- 208000013469 light sensitivity Diseases 0.000 description 1
- 239000002075 main ingredient Substances 0.000 description 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 1
- GRVDJDISBSALJP-UHFFFAOYSA-N methyloxidanyl Chemical compound [O]C GRVDJDISBSALJP-UHFFFAOYSA-N 0.000 description 1
- 238000003801 milling Methods 0.000 description 1
- URKZLZPFQKCNJV-UHFFFAOYSA-N n,n-dibenzyl-1,1-diphenylmethanamine Chemical compound C=1C=CC=CC=1CN(C(C=1C=CC=CC=1)C=1C=CC=CC=1)CC1=CC=CC=C1 URKZLZPFQKCNJV-UHFFFAOYSA-N 0.000 description 1
- ZOOOVTVHHIPVET-UHFFFAOYSA-N n,n-diethyl-4-[2-(5-methyl-1,3-benzoxazol-2-yl)ethenyl]aniline Chemical compound C1=CC(N(CC)CC)=CC=C1C=CC1=NC2=CC(C)=CC=C2O1 ZOOOVTVHHIPVET-UHFFFAOYSA-N 0.000 description 1
- RCHKEJKUUXXBSM-UHFFFAOYSA-N n-benzyl-2-(3-formylindol-1-yl)acetamide Chemical compound C12=CC=CC=C2C(C=O)=CN1CC(=O)NCC1=CC=CC=C1 RCHKEJKUUXXBSM-UHFFFAOYSA-N 0.000 description 1
- KKFHAJHLJHVUDM-UHFFFAOYSA-N n-vinylcarbazole Chemical compound C1=CC=C2N(C=C)C3=CC=CC=C3C2=C1 KKFHAJHLJHVUDM-UHFFFAOYSA-N 0.000 description 1
- 229920001220 nitrocellulos Polymers 0.000 description 1
- 229910052757 nitrogen Inorganic materials 0.000 description 1
- 239000012860 organic pigment Substances 0.000 description 1
- TWNQGVIAIRXVLR-UHFFFAOYSA-N oxo(oxoalumanyloxy)alumane Chemical compound O=[Al]O[Al]=O TWNQGVIAIRXVLR-UHFFFAOYSA-N 0.000 description 1
- 239000012188 paraffin wax Substances 0.000 description 1
- 239000000049 pigment Substances 0.000 description 1
- 229920002401 polyacrylamide Polymers 0.000 description 1
- 239000004417 polycarbonate Substances 0.000 description 1
- 229920000515 polycarbonate Polymers 0.000 description 1
- 229920000647 polyepoxide Polymers 0.000 description 1
- 229920001470 polyketone Polymers 0.000 description 1
- 229920002635 polyurethane Polymers 0.000 description 1
- 239000004814 polyurethane Substances 0.000 description 1
- 229920006215 polyvinyl ketone Polymers 0.000 description 1
- 230000008569 process Effects 0.000 description 1
- 239000001294 propane Substances 0.000 description 1
- 125000002572 propoxy group Chemical group [*]OC([H])([H])C(C([H])([H])[H])([H])[H] 0.000 description 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- RCYFOPUXRMOLQM-UHFFFAOYSA-N pyrene-1-carbaldehyde Chemical compound C1=C2C(C=O)=CC=C(C=C3)C2=C2C3=CC=CC2=C1 RCYFOPUXRMOLQM-UHFFFAOYSA-N 0.000 description 1
- 125000001725 pyrenyl group Chemical group 0.000 description 1
- WVIICGIFSIBFOG-UHFFFAOYSA-N pyrylium Chemical class C1=CC=[O+]C=C1 WVIICGIFSIBFOG-UHFFFAOYSA-N 0.000 description 1
- 238000011084 recovery Methods 0.000 description 1
- 230000009467 reduction Effects 0.000 description 1
- 230000004044 response Effects 0.000 description 1
- 230000035945 sensitivity Effects 0.000 description 1
- 239000002904 solvent Substances 0.000 description 1
- PJANXHGTPQOBST-UHFFFAOYSA-N stilbene Chemical group C=1C=CC=CC=1C=CC1=CC=CC=C1 PJANXHGTPQOBST-UHFFFAOYSA-N 0.000 description 1
- AUHHYELHRWCWEZ-UHFFFAOYSA-N tetrachlorophthalic anhydride Chemical compound ClC1=C(Cl)C(Cl)=C2C(=O)OC(=O)C2=C1Cl AUHHYELHRWCWEZ-UHFFFAOYSA-N 0.000 description 1
- ODHXBMXNKOYIBV-UHFFFAOYSA-N triphenylamine Chemical compound C1=CC=CC=C1N(C=1C=CC=CC=1)C1=CC=CC=C1 ODHXBMXNKOYIBV-UHFFFAOYSA-N 0.000 description 1
- 239000011787 zinc oxide Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C09—DYES; PAINTS; POLISHES; NATURAL RESINS; ADHESIVES; COMPOSITIONS NOT OTHERWISE PROVIDED FOR; APPLICATIONS OF MATERIALS NOT OTHERWISE PROVIDED FOR
- C09B—ORGANIC DYES OR CLOSELY-RELATED COMPOUNDS FOR PRODUCING DYES, e.g. PIGMENTS; MORDANTS; LAKES
- C09B35/00—Disazo and polyazo dyes of the type A<-D->B prepared by diazotising and coupling
- C09B35/02—Disazo dyes
- C09B35/039—Disazo dyes characterised by the tetrazo component
- C09B35/205—Disazo dyes characterised by the tetrazo component the tetrazo component being a derivative of a diaryl- or triaryl- alkane or-alkene
- C09B35/215—Disazo dyes characterised by the tetrazo component the tetrazo component being a derivative of a diaryl- or triaryl- alkane or-alkene of diarylethane or diarylethene
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Photoreceptors In Electrophotography (AREA)
- Heterocyclic Carbon Compounds Containing A Hetero Ring Having Nitrogen And Oxygen As The Only Ring Hetero Atoms (AREA)
Applications Claiming Priority (4)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| JP10399682A JPS58222152A (ja) | 1982-06-18 | 1982-06-18 | 新規なジスアゾ化合物及びその製造法 |
| JP10399782A JPS58222153A (ja) | 1982-06-18 | 1982-06-18 | 新規なジスアゾ化合物及びその製造法 |
| JP552483A JPS59129857A (ja) | 1983-01-17 | 1983-01-17 | 電子写真用感光体 |
| JP1114883A JPS59136351A (ja) | 1983-01-26 | 1983-01-26 | 電子写真用感光体 |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DE3321871A1 DE3321871A1 (de) | 1983-12-22 |
| DE3321871C2 true DE3321871C2 (env) | 1989-01-05 |
Family
ID=27454310
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE3321871A Granted DE3321871A1 (de) | 1982-06-18 | 1983-06-16 | Bisazo-verbindung und diese bisazo-verbindung enthaltende elektrophotographische aufzeichnungsmaterialien |
Country Status (3)
| Country | Link |
|---|---|
| US (1) | US4486519A (env) |
| DE (1) | DE3321871A1 (env) |
| GB (1) | GB2123020B (env) |
Families Citing this family (8)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE3515177A1 (de) * | 1984-04-27 | 1985-11-07 | Ricoh Co., Ltd., Tokio/Tokyo | Elektrophotographische originaldruckform und verfahren zur herstellung von druckplatten |
| US4713307A (en) * | 1986-04-11 | 1987-12-15 | Xerox Corporation | Organic azo photoconductor imaging members |
| US5081233A (en) * | 1986-05-15 | 1992-01-14 | Ricoh Company, Ltd. | Bisazo compounds and electrophotographic photoconductors comprising the bisazo compounds |
| US4797337A (en) * | 1987-07-27 | 1989-01-10 | Xerox Corporation | Disazo photoconductive imaging members |
| US5344735A (en) * | 1988-04-20 | 1994-09-06 | Ricoh Company, Ltd. | Bisazo electrophotographic photoconductor |
| US4833052A (en) * | 1988-08-02 | 1989-05-23 | Xerox Corporation | Bisazo photoconductive imaging members |
| US5097022A (en) * | 1988-11-14 | 1992-03-17 | Ricoh Company, Ltd. | Bisazo pigments for use in electrophotographic photoconductors |
| US6174637B1 (en) | 2000-01-19 | 2001-01-16 | Xerox Corporation | Electrophotographic imaging member and process of making |
Family Cites Families (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2913450A (en) * | 1954-09-07 | 1959-11-17 | American Cyanamid Co | Azo dyes from bis (p-aminophenyl) butadienes |
| NL184708C (nl) * | 1975-07-04 | 1989-10-02 | Oce Van Der Grinten Nv | Elektrofotografisch kopieerprocede en produkt daarmee verkregen. |
| JPS6027017B2 (ja) * | 1977-07-08 | 1985-06-26 | 株式会社リコー | 電子写真用感光体 |
| US4314015A (en) * | 1977-07-18 | 1982-02-02 | Ricoh Co., Ltd. | Electrophotographic sensitive materials containing disazo compounds |
| GB2055882B (en) * | 1979-06-20 | 1983-04-13 | Ricoh Kk | Bis-azo compounds and the preparation thereof |
| US4349616A (en) * | 1979-12-28 | 1982-09-14 | Ricoh Co., Ltd. | Disazo pigment containing electrophotographic element |
| JPS57148750A (en) * | 1981-03-11 | 1982-09-14 | Konishiroku Photo Ind Co Ltd | Electrophotographic receptor |
-
1983
- 1983-06-01 US US06/500,051 patent/US4486519A/en not_active Expired - Lifetime
- 1983-06-16 GB GB08316362A patent/GB2123020B/en not_active Expired
- 1983-06-16 DE DE3321871A patent/DE3321871A1/de active Granted
Also Published As
| Publication number | Publication date |
|---|---|
| GB8316362D0 (en) | 1983-07-20 |
| GB2123020A (en) | 1984-01-25 |
| GB2123020B (en) | 1986-02-26 |
| US4486519A (en) | 1984-12-04 |
| DE3321871A1 (de) | 1983-12-22 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2829543C2 (de) | Elektrophotographisches Aufzeichnungsmaterial | |
| DE2935536C2 (env) | ||
| DE3347905C2 (env) | ||
| DE2829606A1 (de) | Diazoverbindungen, verfahren zu ihrer herstellung und diese enthaltende elektrophotographische aufzeichnungsmaterialien | |
| DE3447685C2 (env) | ||
| DE3617948A1 (de) | Elektrofotografisches aufzeichnungmaterial | |
| DE3414141A1 (de) | Stilben-derivate, distyryl-derivate und elektrophotographische photoleiter, welche zumindest eines der derivate enthalten | |
| US4314015A (en) | Electrophotographic sensitive materials containing disazo compounds | |
| DE4000463A1 (de) | Elektrophotographischer photorezeptor | |
| DE3321871C2 (env) | ||
| DE3602987A1 (de) | Lichtempfindliches material enthaltend eine disazo-verbindung zur verwendung in der elektrophotographie | |
| DE2947760C2 (env) | ||
| DE69117233T2 (de) | Elektrophotographischer Photorezeptor | |
| DE3853521T2 (de) | Elektrophotographisches lichtempfindliches Element. | |
| DE3810522A1 (de) | Aromatische diolefinische verbindungen, aromatische diethylverbindungen und elektrophotographische photoleiter, die eine aromatische diethylverbindung enthalten | |
| DE3448011C2 (env) | ||
| DE68912884T2 (de) | Elektrophotographischer Photorezeptor. | |
| DE3301453C2 (env) | ||
| DE3336595C2 (env) | ||
| DE3220208C2 (de) | Elektrophotographisches Aufzeichnungsmaterial | |
| DE3049303A1 (de) | Elektrophotographisches element | |
| DE3521652A1 (de) | Disazoverbindungen, verfahren zu deren herstellung und diese enthaltende lichtempfindliche materialien | |
| DE2722332A1 (de) | 1,3,4-oxadiazolderivate sowie diese enthaltende elektrophotographische aufzeichnungsmaterialien | |
| DE3522896C2 (env) | ||
| DE69214715T2 (de) | Elektrophotographischer Photorezeptor |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| OP8 | Request for examination as to paragraph 44 patent law | ||
| 8128 | New person/name/address of the agent |
Representative=s name: SCHWABE, H., DIPL.-ING. SANDMAIR, K., DIPL.-CHEM. |
|
| D2 | Grant after examination | ||
| 8364 | No opposition during term of opposition | ||
| 8339 | Ceased/non-payment of the annual fee |