DE3314837A1 - Druckbegrenzungsventil - Google Patents
DruckbegrenzungsventilInfo
- Publication number
- DE3314837A1 DE3314837A1 DE19833314837 DE3314837A DE3314837A1 DE 3314837 A1 DE3314837 A1 DE 3314837A1 DE 19833314837 DE19833314837 DE 19833314837 DE 3314837 A DE3314837 A DE 3314837A DE 3314837 A1 DE3314837 A1 DE 3314837A1
- Authority
- DE
- Germany
- Prior art keywords
- pressure relief
- valve
- relief valve
- spring
- ring
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Granted
Links
- 239000012530 fluid Substances 0.000 claims description 27
- 239000010408 film Substances 0.000 description 8
- 239000007789 gas Substances 0.000 description 8
- 238000005065 mining Methods 0.000 description 3
- 238000007789 sealing Methods 0.000 description 3
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- 206010016275 Fear Diseases 0.000 description 2
- 229910000831 Steel Inorganic materials 0.000 description 2
- 239000003245 coal Substances 0.000 description 2
- 230000006378 damage Effects 0.000 description 2
- 239000007788 liquid Substances 0.000 description 2
- 239000010959 steel Substances 0.000 description 2
- 230000006835 compression Effects 0.000 description 1
- 238000007906 compression Methods 0.000 description 1
- 238000010276 construction Methods 0.000 description 1
- 230000007423 decrease Effects 0.000 description 1
- 238000006073 displacement reaction Methods 0.000 description 1
- JKMBMIMLVFMXRW-LYYFRFARSA-N epicocconone Chemical compound C1=C2C[C@@H](CO)OC=C2C(=O)[C@]2(C)C1=C(C(/O)=C/C(=O)/C=C/C=C/C=C/C)C(=O)O2 JKMBMIMLVFMXRW-LYYFRFARSA-N 0.000 description 1
- 230000007774 longterm Effects 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 229910052757 nitrogen Inorganic materials 0.000 description 1
- 230000035515 penetration Effects 0.000 description 1
- 230000036316 preload Effects 0.000 description 1
- 230000002028 premature Effects 0.000 description 1
- 230000035484 reaction time Effects 0.000 description 1
- 239000010409 thin film Substances 0.000 description 1
Classifications
-
- F—MECHANICAL ENGINEERING; LIGHTING; HEATING; WEAPONS; BLASTING
- F16—ENGINEERING ELEMENTS AND UNITS; GENERAL MEASURES FOR PRODUCING AND MAINTAINING EFFECTIVE FUNCTIONING OF MACHINES OR INSTALLATIONS; THERMAL INSULATION IN GENERAL
- F16K—VALVES; TAPS; COCKS; ACTUATING-FLOATS; DEVICES FOR VENTING OR AERATING
- F16K17/00—Safety valves; Equalising valves, e.g. pressure relief valves
- F16K17/02—Safety valves; Equalising valves, e.g. pressure relief valves opening on surplus pressure on one side; closing on insufficient pressure on one side
- F16K17/04—Safety valves; Equalising valves, e.g. pressure relief valves opening on surplus pressure on one side; closing on insufficient pressure on one side spring-loaded
- F16K17/0446—Safety valves; Equalising valves, e.g. pressure relief valves opening on surplus pressure on one side; closing on insufficient pressure on one side spring-loaded with an obturating member having at least a component of their opening and closing motion not perpendicular to the closing faces
- F16K17/046—Safety valves; Equalising valves, e.g. pressure relief valves opening on surplus pressure on one side; closing on insufficient pressure on one side spring-loaded with an obturating member having at least a component of their opening and closing motion not perpendicular to the closing faces the valve being of the gate valve type or the sliding valve type
Landscapes
- Engineering & Computer Science (AREA)
- General Engineering & Computer Science (AREA)
- Mechanical Engineering (AREA)
- Safety Valves (AREA)
Priority Applications (3)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19833314837 DE3314837A1 (de) | 1982-06-03 | 1983-04-23 | Druckbegrenzungsventil |
| EP19830105216 EP0096303B1 (de) | 1982-06-03 | 1983-05-26 | Druckbegrenzungsventil |
| ES522903A ES8403591A1 (es) | 1982-06-03 | 1983-06-01 | Dispositivo valvular limitador de presion. |
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE3220846 | 1982-06-03 | ||
| DE19833314837 DE3314837A1 (de) | 1982-06-03 | 1983-04-23 | Druckbegrenzungsventil |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DE3314837A1 true DE3314837A1 (de) | 1983-12-08 |
| DE3314837C2 DE3314837C2 (cg-RX-API-DMAC10.html) | 1990-01-25 |
Family
ID=25802196
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19833314837 Granted DE3314837A1 (de) | 1982-06-03 | 1983-04-23 | Druckbegrenzungsventil |
Country Status (3)
| Country | Link |
|---|---|
| EP (1) | EP0096303B1 (cg-RX-API-DMAC10.html) |
| DE (1) | DE3314837A1 (cg-RX-API-DMAC10.html) |
| ES (1) | ES8403591A1 (cg-RX-API-DMAC10.html) |
Cited By (15)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE3508986A1 (de) * | 1984-03-16 | 1985-09-19 | GAT Grubenausbau GmbH, 5840 Schwerte | Druckbegrenzungsventil |
| DE3426018A1 (de) * | 1984-07-14 | 1986-01-23 | GAT Grubenausbau GmbH, 5840 Schwerte | Einstellvorrichtung fuer druckbegrenzungsventile |
| DE3715548A1 (de) * | 1987-05-09 | 1988-11-17 | Voith Gmbh J M | Walzenpresse mit einer vorrichtung zur entlastung der druckwalze |
| DE3830075A1 (de) * | 1987-11-23 | 1989-06-01 | Voss Richard Grubenausbau | Druckbegrenzungsventil fuer geschlossene kreislaeufe |
| DE3546557C2 (en) * | 1984-03-16 | 1989-06-15 | Gat Grubenausbau Gmbh, 5840 Schwerte, De | Pressure relief valve |
| DE3909461A1 (de) * | 1989-03-22 | 1990-09-27 | Voss Richard Grubenausbau | Gebirgsschlagsicherheitsventil |
| DE3916260A1 (de) * | 1989-05-19 | 1990-11-22 | Voss Richard Grubenausbau | Kleinbauendes druckbegrenzungsventil mit grosser durchflussmenge |
| DE4021622A1 (de) * | 1989-09-01 | 1991-08-08 | Voss Richard Grubenausbau | Druckbegrenzungsventil mit teflondichtung |
| WO1991013280A1 (de) * | 1990-02-22 | 1991-09-05 | Heinrich Quante Berg- Und Ingenieurtechnik Gmbh & Co. Kg | Druckbegrenzungsventil mit stabiler federauflage |
| EP0471145A1 (de) * | 1990-08-16 | 1992-02-19 | DAMS GmbH | Teleskopförmig längenverstellbarer hydraulischer Grubenstempel |
| EP0608491A1 (de) * | 1993-01-27 | 1994-08-03 | Richard Voss Grubenausbau Gmbh | Grossvolumiges Druckbegrenzungsventil |
| DE4311862C1 (de) * | 1993-04-10 | 1994-10-27 | Vos Richard Grubenausbau Gmbh | Druckbegrenzungsventil mit auswechselbarem Steuerventil |
| US5462076A (en) * | 1993-06-17 | 1995-10-31 | Richard Voss Grubenausbau Gmbh | Pressure-compensated pressure limiting valve |
| US5611646A (en) * | 1993-07-14 | 1997-03-18 | Richard Voss Grubenausbau Gmbh | Support prop with integrated pressure limiting valve and nailed pipes |
| CN105782525A (zh) * | 2016-05-12 | 2016-07-20 | 宁波市加力特机械有限公司 | 平台车泄压阀体 |
Families Citing this family (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE3637888A1 (de) * | 1986-11-06 | 1988-05-19 | Gewerk Eisenhuette Westfalia | Druckbegrenzungsventil, insbesondere fuer hydraulische ausbausysteme |
| DE9114696U1 (de) * | 1991-11-26 | 1992-02-13 | Maschinenfabrik Jörn Dams GmbH, 4320 Hattingen | Hochdruckhydraulikventil |
| EP0817930A4 (en) * | 1995-12-29 | 1998-05-13 | Innovent Inc | QUICK REPLY VALVE |
| US5924444A (en) * | 1996-12-27 | 1999-07-20 | Innovent Inc. | Rapid response valve |
| DE19732933A1 (de) * | 1997-07-31 | 1999-02-04 | Rexroth Mannesmann Gmbh | Proportional verstellbares Druckbegrenzungsventil |
| DE102004005747A1 (de) * | 2004-02-05 | 2005-08-25 | Voß, Christina | Druckbegrenzungsventil mit hydraulisch dichtendem Dichtring |
| FR3091741B1 (fr) * | 2019-01-14 | 2021-04-02 | Air Liquide Medical Systems | Prise de distribution de fluide médical améliorée |
Citations (9)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| FR1149979A (fr) * | 1956-04-20 | 1958-01-03 | Perfectionnements apportés aux soupapes de sûreté pour circuits de fluide sous pression | |
| FR1493612A (fr) * | 1966-06-29 | 1967-09-01 | Perfectionnements apportés aux dispositifs limiteurs de pression | |
| US3482594A (en) * | 1966-01-20 | 1969-12-09 | Gewerk Eisenhuette Westfalia | Pressure relief valve |
| US3548867A (en) * | 1968-06-10 | 1970-12-22 | Gewerk Eisenhuette Westfalia | Pressure relief devices |
| DE2408106A1 (de) * | 1974-02-20 | 1975-08-28 | Gewerk Eisenhuette Westfalia | Ueberdruckventilpatrone, insbesondere fuer hydraulische grubenstempel |
| DE7811107U1 (de) * | 1978-04-14 | 1979-05-17 | Hermann Hemscheidt Maschinenfabrik Gmbh & Co, 5600 Wuppertal | Druckbegrenzungsventil |
| DE2815919A1 (de) * | 1978-04-13 | 1979-10-18 | Thyssen Industrie | Ueberdruckventil fuer hydraulische ausbauelemente des untertaegigen grubenbetriebs, vornehmlich fuer den steinkohlebergbau |
| DE2832964A1 (de) * | 1978-07-27 | 1980-02-14 | Thyssen Industrie | Ueberdruckventil, vornhemlich fuer hydraulische ausbauelemente des untertaegigen grubenbetriebs |
| DE8216072U1 (de) * | 1982-06-03 | 1982-10-07 | Dams, Jörn, 4320 Hattingen | Druckbegrenzungsventil |
Family Cites Families (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1303157C2 (de) * | 1973-02-01 | Ueberdruckventilpatrone zum absichern hydraulischer grubenstempel | ||
| AT226177B (de) * | 1961-05-17 | 1963-03-11 | Oesterr Alpine Montan | Unter der Belastung einer Feder, vorzugsweise einer Tellerfeder, stehendes Überdruckventil für hydraulische Grubenstempel |
-
1983
- 1983-04-23 DE DE19833314837 patent/DE3314837A1/de active Granted
- 1983-05-26 EP EP19830105216 patent/EP0096303B1/de not_active Expired
- 1983-06-01 ES ES522903A patent/ES8403591A1/es not_active Expired
Patent Citations (10)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| FR1149979A (fr) * | 1956-04-20 | 1958-01-03 | Perfectionnements apportés aux soupapes de sûreté pour circuits de fluide sous pression | |
| US3482594A (en) * | 1966-01-20 | 1969-12-09 | Gewerk Eisenhuette Westfalia | Pressure relief valve |
| FR1493612A (fr) * | 1966-06-29 | 1967-09-01 | Perfectionnements apportés aux dispositifs limiteurs de pression | |
| US3548867A (en) * | 1968-06-10 | 1970-12-22 | Gewerk Eisenhuette Westfalia | Pressure relief devices |
| DE1750834A1 (de) * | 1968-06-10 | 1971-04-29 | Gewerk Eisenhuette Westfalia | UEberdruckventilpatrone mit Kolben-O-Ring-Dichtung |
| DE2408106A1 (de) * | 1974-02-20 | 1975-08-28 | Gewerk Eisenhuette Westfalia | Ueberdruckventilpatrone, insbesondere fuer hydraulische grubenstempel |
| DE2815919A1 (de) * | 1978-04-13 | 1979-10-18 | Thyssen Industrie | Ueberdruckventil fuer hydraulische ausbauelemente des untertaegigen grubenbetriebs, vornehmlich fuer den steinkohlebergbau |
| DE7811107U1 (de) * | 1978-04-14 | 1979-05-17 | Hermann Hemscheidt Maschinenfabrik Gmbh & Co, 5600 Wuppertal | Druckbegrenzungsventil |
| DE2832964A1 (de) * | 1978-07-27 | 1980-02-14 | Thyssen Industrie | Ueberdruckventil, vornhemlich fuer hydraulische ausbauelemente des untertaegigen grubenbetriebs |
| DE8216072U1 (de) * | 1982-06-03 | 1982-10-07 | Dams, Jörn, 4320 Hattingen | Druckbegrenzungsventil |
Non-Patent Citations (4)
| Title |
|---|
| "Dichtelemente für Hydraulik und Pneumatik, Formenliste und Konstruktionsanleitung", Asbest- und Gummiwerke Martin Merkel KG, Hamburg, 1970 * |
| Betriebsempfehlungen für den Steinkohlenbergbau, Nr. 16, Anforderungen an hydraulische Steuerungen für Schreitausbau, Hrsg. Steinkohlebergbauverein * |
| Deutsche DIN-Norm: DIN 7163 u. DIN 7164 (Ausgabe August 1966) St. Acèl, "Statisches und dynamisches Verhalten von ölhydraulischen Steuerungs- u. Regelungselementen", in: Sonderdruck aus TR (Techn. Rundschau, Bern, CH) Nrn 39/1961, H. 6, 5L/1962, H. 2 u.22, 28/1963 * |
| Sonderdruck aus DE-Z.: "elhydraulik und Pnauma- tik, 3.Jhrg., H.7, (Oktober 1959) * |
Cited By (24)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE3508986A1 (de) * | 1984-03-16 | 1985-09-19 | GAT Grubenausbau GmbH, 5840 Schwerte | Druckbegrenzungsventil |
| DE3546557C2 (en) * | 1984-03-16 | 1989-06-15 | Gat Grubenausbau Gmbh, 5840 Schwerte, De | Pressure relief valve |
| DE3426018A1 (de) * | 1984-07-14 | 1986-01-23 | GAT Grubenausbau GmbH, 5840 Schwerte | Einstellvorrichtung fuer druckbegrenzungsventile |
| DE3715548A1 (de) * | 1987-05-09 | 1988-11-17 | Voith Gmbh J M | Walzenpresse mit einer vorrichtung zur entlastung der druckwalze |
| US4838156A (en) * | 1987-05-09 | 1989-06-13 | J. M. Voith Gmbh | Roller press with a device for the relief of the pressure roll |
| AT391496B (de) * | 1987-05-09 | 1990-10-10 | Voith Gmbh J M | Walzenpresse fuer die behandlung bahnfoermigen gutes, wie z.b. papierbahnen |
| DE3830075A1 (de) * | 1987-11-23 | 1989-06-01 | Voss Richard Grubenausbau | Druckbegrenzungsventil fuer geschlossene kreislaeufe |
| DE3909461A1 (de) * | 1989-03-22 | 1990-09-27 | Voss Richard Grubenausbau | Gebirgsschlagsicherheitsventil |
| DE3916260A1 (de) * | 1989-05-19 | 1990-11-22 | Voss Richard Grubenausbau | Kleinbauendes druckbegrenzungsventil mit grosser durchflussmenge |
| DE4021622A1 (de) * | 1989-09-01 | 1991-08-08 | Voss Richard Grubenausbau | Druckbegrenzungsventil mit teflondichtung |
| DE4021622C2 (de) * | 1989-09-01 | 2000-08-10 | Vos Richard Grubenausbau Gmbh | Druckbegrenzungsventil mit Teflondichtung |
| TR26010A (tr) * | 1990-02-22 | 1993-11-01 | Quante Heinrich Berg Ing | SABIT YAY SOMUNLU BASINC KUMANDA SüBABI |
| US5285813A (en) * | 1990-02-22 | 1994-02-15 | Ingenieurtechnik Gmbh & Co. Kg | Pressure limiting valve with stable spring pad |
| WO1991013280A1 (de) * | 1990-02-22 | 1991-09-05 | Heinrich Quante Berg- Und Ingenieurtechnik Gmbh & Co. Kg | Druckbegrenzungsventil mit stabiler federauflage |
| EP0471145A1 (de) * | 1990-08-16 | 1992-02-19 | DAMS GmbH | Teleskopförmig längenverstellbarer hydraulischer Grubenstempel |
| EP0608491A1 (de) * | 1993-01-27 | 1994-08-03 | Richard Voss Grubenausbau Gmbh | Grossvolumiges Druckbegrenzungsventil |
| DE4302080C1 (de) * | 1993-01-27 | 1994-08-18 | Vos Richard Grubenausbau Gmbh | Kleinbauendes Druckbegrenzungsventil mit hoher Durchflußleistung |
| US5400817A (en) * | 1993-01-27 | 1995-03-28 | Richard Voss Grubenausbau Gmbh | High-capacity pressure limiting valve |
| TR27632A (tr) * | 1993-01-27 | 1995-06-14 | Richard Vob Grubenausbau Gmbh | Yüksek debiler icin basinc kontrol valfi (subabi). |
| DE4311862C1 (de) * | 1993-04-10 | 1994-10-27 | Vos Richard Grubenausbau Gmbh | Druckbegrenzungsventil mit auswechselbarem Steuerventil |
| US5396924A (en) * | 1993-04-10 | 1995-03-14 | Richard Voss Grubenausbau Gmbh | Pressure limiting valve with replacement control valve |
| US5462076A (en) * | 1993-06-17 | 1995-10-31 | Richard Voss Grubenausbau Gmbh | Pressure-compensated pressure limiting valve |
| US5611646A (en) * | 1993-07-14 | 1997-03-18 | Richard Voss Grubenausbau Gmbh | Support prop with integrated pressure limiting valve and nailed pipes |
| CN105782525A (zh) * | 2016-05-12 | 2016-07-20 | 宁波市加力特机械有限公司 | 平台车泄压阀体 |
Also Published As
| Publication number | Publication date |
|---|---|
| DE3314837C2 (cg-RX-API-DMAC10.html) | 1990-01-25 |
| EP0096303B1 (de) | 1985-11-27 |
| ES522903A0 (es) | 1984-03-16 |
| EP0096303A1 (de) | 1983-12-21 |
| ES8403591A1 (es) | 1984-03-16 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE3314837A1 (de) | Druckbegrenzungsventil | |
| DE69219507T2 (de) | Druck entlastende Abstreifdichtungsanordnung | |
| DE2803283C2 (de) | Überdruckventil für hydraulische Grubenstempel | |
| DE69112617T2 (de) | Ringförmige Dichtung. | |
| EP1045978B1 (de) | Kraftstoffeinspritzventil für brennkraftmaschinen | |
| DE2832964A1 (de) | Ueberdruckventil, vornhemlich fuer hydraulische ausbauelemente des untertaegigen grubenbetriebs | |
| EP4086491B1 (de) | Ventilanordnung | |
| EP1606541A1 (de) | Druckbegrenzungsventil | |
| DE1628152B2 (de) | Dichtung für Hochdruckkompressoren und -pumpen | |
| EP2962022B1 (de) | Überströmventil | |
| DE102010006223A1 (de) | Druckbegrenzungsventil mit einer Sitzventildichtung | |
| DE69915946T2 (de) | Dichtung | |
| DE3042818A1 (de) | Kugelventil | |
| EP1110017A1 (de) | REIBUNGSARME DICHTUNG und hydraulikzylinder | |
| DE2544507C3 (de) | Überlastschutzeinrichtung für Pressen o.dgl | |
| EP0573539B1 (de) | Dichtungsanordnung | |
| DE2404174B2 (de) | Hubventil | |
| DE102004024215A1 (de) | Steuerventil | |
| DE3929094A1 (de) | Gebirgsschlagventil mit doppelkolben | |
| DE3303877C2 (de) | Einzelstempelventil | |
| DE8312106U1 (de) | Druckbegrenzungsventil | |
| EP1714062B1 (de) | Druckbegrenzungsventil mit hydraulisch dichtendem dichtring | |
| DE8216072U1 (de) | Druckbegrenzungsventil | |
| DE3003879C2 (de) | Ventilanordnung, insbesondere für Hochdruckkolbenpumpen | |
| EP0640783A1 (de) | Hochdruck Absperrventil |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| OP8 | Request for examination as to paragraph 44 patent law | ||
| D2 | Grant after examination | ||
| 8363 | Opposition against the patent | ||
| 8365 | Fully valid after opposition proceedings | ||
| 8327 | Change in the person/name/address of the patent owner |
Owner name: DAMS GMBH, 45527 HATTINGEN, DE |
|
| 8381 | Inventor (new situation) |
Free format text: DAMS, JOERN, 45527 HATTINGEN, DE |
|
| 8339 | Ceased/non-payment of the annual fee |