DE3310388C2 - - Google Patents
Info
- Publication number
- DE3310388C2 DE3310388C2 DE3310388A DE3310388A DE3310388C2 DE 3310388 C2 DE3310388 C2 DE 3310388C2 DE 3310388 A DE3310388 A DE 3310388A DE 3310388 A DE3310388 A DE 3310388A DE 3310388 C2 DE3310388 C2 DE 3310388C2
- Authority
- DE
- Germany
- Prior art keywords
- photochromic
- article according
- composition
- hydrogen
- photochromic article
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired - Lifetime
Links
- PXHVJJICTQNCMI-UHFFFAOYSA-N nickel Substances [Ni] PXHVJJICTQNCMI-UHFFFAOYSA-N 0.000 claims description 22
- 239000000203 mixture Substances 0.000 claims description 19
- 229920006217 cellulose acetate butyrate Polymers 0.000 claims description 18
- 150000001875 compounds Chemical class 0.000 claims description 13
- 229910052739 hydrogen Inorganic materials 0.000 claims description 11
- 239000001257 hydrogen Substances 0.000 claims description 11
- -1 1,1,3,3-tetramethylbutyl Chemical group 0.000 claims description 7
- 150000002431 hydrogen Chemical group 0.000 claims description 7
- MYMOFIZGZYHOMD-UHFFFAOYSA-N Dioxygen Chemical compound O=O MYMOFIZGZYHOMD-UHFFFAOYSA-N 0.000 claims description 6
- 125000000217 alkyl group Chemical group 0.000 claims description 6
- 229910052736 halogen Inorganic materials 0.000 claims description 6
- 150000002367 halogens Chemical group 0.000 claims description 6
- JHQVCQDWGSXTFE-UHFFFAOYSA-N 2-(2-prop-2-enoxycarbonyloxyethoxy)ethyl prop-2-enyl carbonate Chemical group C=CCOC(=O)OCCOCCOC(=O)OCC=C JHQVCQDWGSXTFE-UHFFFAOYSA-N 0.000 claims description 5
- 125000003545 alkoxy group Chemical group 0.000 claims description 5
- 230000005281 excited state Effects 0.000 claims description 4
- 150000002500 ions Chemical class 0.000 claims description 4
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 4
- 239000013110 organic ligand Substances 0.000 claims description 4
- 150000002978 peroxides Chemical class 0.000 claims description 4
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 3
- 229910052759 nickel Inorganic materials 0.000 claims description 3
- 229920003023 plastic Polymers 0.000 claims description 3
- 239000004033 plastic Substances 0.000 claims description 2
- 229920003229 poly(methyl methacrylate) Polymers 0.000 claims description 2
- 239000004926 polymethyl methacrylate Substances 0.000 claims description 2
- BOXSVZNGTQTENJ-UHFFFAOYSA-L zinc dibutyldithiocarbamate Chemical compound [Zn+2].CCCCN(C([S-])=S)CCCC.CCCCN(C([S-])=S)CCCC BOXSVZNGTQTENJ-UHFFFAOYSA-L 0.000 claims description 2
- 239000000326 ultraviolet stabilizing agent Substances 0.000 claims 4
- SIKJAQJRHWYJAI-UHFFFAOYSA-N Indole Chemical compound C1=CC=C2NC=CC2=C1 SIKJAQJRHWYJAI-UHFFFAOYSA-N 0.000 claims 2
- HQABUPZFAYXKJW-UHFFFAOYSA-N butan-1-amine Chemical compound CCCCN HQABUPZFAYXKJW-UHFFFAOYSA-N 0.000 claims 2
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 claims 2
- RUCUTVYCDLCNQO-UHFFFAOYSA-N 5'-methoxy-1',3',3'-trimethylspiro[benzo[f][1,4]benzoxazine-3,2'-indole] Chemical compound C1=CC=CC2=C(N=CC3(O4)N(C)C5=CC=C(C=C5C3(C)C)OC)C4=CC=C21 RUCUTVYCDLCNQO-UHFFFAOYSA-N 0.000 claims 1
- YAIPWTSJXYEUSF-UHFFFAOYSA-N 8-bromo-1',3',3',4',5'-pentamethylspiro[benzo[f][1,4]benzoxazine-3,2'-indole] Chemical compound CN1C2(C(C3=C(C(=CC=C13)C)C)(C)C)C=NC1=C(O2)C=CC2=CC(=CC=C21)Br YAIPWTSJXYEUSF-UHFFFAOYSA-N 0.000 claims 1
- IMCLJZBMDMESBW-UHFFFAOYSA-N 8-bromo-1',3',3',5',6'-pentamethylspiro[benzo[f][1,4]benzoxazine-3,2'-indole] Chemical compound C1=C(Br)C=CC2=C(N=CC3(C(C)(C)C4=CC(C)=C(C)C=C4N3C)O3)C3=CC=C21 IMCLJZBMDMESBW-UHFFFAOYSA-N 0.000 claims 1
- 125000001246 bromo group Chemical group Br* 0.000 claims 1
- 229920005668 polycarbonate resin Polymers 0.000 claims 1
- 239000004431 polycarbonate resin Substances 0.000 claims 1
- 239000000975 dye Substances 0.000 description 28
- 239000012963 UV stabilizer Substances 0.000 description 17
- 239000003963 antioxidant agent Substances 0.000 description 7
- 235000006708 antioxidants Nutrition 0.000 description 7
- IAHPADQGUAKOQZ-UHFFFAOYSA-N spiro[1,3-dihydroindole-2,3'-benzo[f][1,4]benzoxazine] Chemical compound C1=CC=CC2=C(N=CC3(NC4=CC=CC=C4C3)O3)C3=CC=C21 IAHPADQGUAKOQZ-UHFFFAOYSA-N 0.000 description 6
- 230000005855 radiation Effects 0.000 description 5
- JLZIIHMTTRXXIN-UHFFFAOYSA-N 2-(2-hydroxy-4-methoxybenzoyl)benzoic acid Chemical compound OC1=CC(OC)=CC=C1C(=O)C1=CC=CC=C1C(O)=O JLZIIHMTTRXXIN-UHFFFAOYSA-N 0.000 description 4
- 230000000694 effects Effects 0.000 description 4
- 238000006303 photolysis reaction Methods 0.000 description 4
- 239000000243 solution Substances 0.000 description 4
- 229940124543 ultraviolet light absorber Drugs 0.000 description 4
- XZMCDFZZKTWFGF-UHFFFAOYSA-N Cyanamide Chemical compound NC#N XZMCDFZZKTWFGF-UHFFFAOYSA-N 0.000 description 3
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 3
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 3
- 239000006096 absorbing agent Substances 0.000 description 3
- 230000003078 antioxidant effect Effects 0.000 description 3
- 238000000576 coating method Methods 0.000 description 3
- 239000013068 control sample Substances 0.000 description 3
- 230000006872 improvement Effects 0.000 description 3
- HPOWMHUJHHIQGP-UHFFFAOYSA-L n,n-dibutylcarbamodithioate;nickel(2+) Chemical compound [Ni+2].CCCCN(C([S-])=S)CCCC.CCCCN(C([S-])=S)CCCC HPOWMHUJHHIQGP-UHFFFAOYSA-L 0.000 description 3
- 229920000642 polymer Polymers 0.000 description 3
- WPRMJBJYCFNTKE-UHFFFAOYSA-L (3,5-ditert-butyl-4-hydroxyphenyl)methyl-ethoxyphosphinate;nickel(2+) Chemical compound [Ni+2].CCOP([O-])(=O)CC1=CC(C(C)(C)C)=C(O)C(C(C)(C)C)=C1.CCOP([O-])(=O)CC1=CC(C(C)(C)C)=C(O)C(C(C)(C)C)=C1 WPRMJBJYCFNTKE-UHFFFAOYSA-L 0.000 description 2
- MEZZCSHVIGVWFI-UHFFFAOYSA-N 2,2'-Dihydroxy-4-methoxybenzophenone Chemical compound OC1=CC(OC)=CC=C1C(=O)C1=CC=CC=C1O MEZZCSHVIGVWFI-UHFFFAOYSA-N 0.000 description 2
- 229920004142 LEXAN™ Polymers 0.000 description 2
- 229920005372 Plexiglas® Polymers 0.000 description 2
- 238000010521 absorption reaction Methods 0.000 description 2
- 230000004913 activation Effects 0.000 description 2
- 239000012965 benzophenone Substances 0.000 description 2
- IISBACLAFKSPIT-UHFFFAOYSA-N bisphenol A Chemical compound C=1C=C(O)C=CC=1C(C)(C)C1=CC=C(O)C=C1 IISBACLAFKSPIT-UHFFFAOYSA-N 0.000 description 2
- 230000000052 comparative effect Effects 0.000 description 2
- 238000000354 decomposition reaction Methods 0.000 description 2
- MCPKSFINULVDNX-UHFFFAOYSA-N drometrizole Chemical compound CC1=CC=C(O)C(N2N=C3C=CC=CC3=N2)=C1 MCPKSFINULVDNX-UHFFFAOYSA-N 0.000 description 2
- 239000011521 glass Substances 0.000 description 2
- 238000003475 lamination Methods 0.000 description 2
- 238000004519 manufacturing process Methods 0.000 description 2
- 239000000463 material Substances 0.000 description 2
- 230000003287 optical effect Effects 0.000 description 2
- DXGLGDHPHMLXJC-UHFFFAOYSA-N oxybenzone Chemical compound OC1=CC(OC)=CC=C1C(=O)C1=CC=CC=C1 DXGLGDHPHMLXJC-UHFFFAOYSA-N 0.000 description 2
- 239000000047 product Substances 0.000 description 2
- 230000009467 reduction Effects 0.000 description 2
- 239000003381 stabilizer Substances 0.000 description 2
- PFEFOYRSMXVNEL-UHFFFAOYSA-N 2,4,6-tritert-butylphenol Chemical compound CC(C)(C)C1=CC(C(C)(C)C)=C(O)C(C(C)(C)C)=C1 PFEFOYRSMXVNEL-UHFFFAOYSA-N 0.000 description 1
- OPLCSTZDXXUYDU-UHFFFAOYSA-N 2,4-dimethyl-6-tert-butylphenol Chemical compound CC1=CC(C)=C(O)C(C(C)(C)C)=C1 OPLCSTZDXXUYDU-UHFFFAOYSA-N 0.000 description 1
- MHCGTEBQHSVRDP-UHFFFAOYSA-N 3-(3',3'-dimethyl-6-nitrospiro[chromene-2,2'-indole]-1'-yl)propanoic acid Chemical compound O1C2=CC=C([N+]([O-])=O)C=C2C=CC21N(CCC(O)=O)C1=CC=CC=C1C2(C)C MHCGTEBQHSVRDP-UHFFFAOYSA-N 0.000 description 1
- LJNZCZXDZXZEBU-UHFFFAOYSA-N 9-methoxy-1',3',3',4',5'-pentamethylspiro[benzo[f][1,4]benzoxazine-3,2'-indole] Chemical compound CN1C2=CC=C(C)C(C)=C2C(C)(C)C11OC(C=CC2=CC=C(C=C22)OC)=C2N=C1 LJNZCZXDZXZEBU-UHFFFAOYSA-N 0.000 description 1
- LEFLOQWREHLINR-UHFFFAOYSA-N 9-methoxy-1',3',3',5',6'-pentamethylspiro[benzo[f][1,4]benzoxazine-3,2'-indole] Chemical compound CN1C2=CC(C)=C(C)C=C2C(C)(C)C11OC(C=CC2=CC=C(C=C22)OC)=C2N=C1 LEFLOQWREHLINR-UHFFFAOYSA-N 0.000 description 1
- VYZAMTAEIAYCRO-UHFFFAOYSA-N Chromium Chemical compound [Cr] VYZAMTAEIAYCRO-UHFFFAOYSA-N 0.000 description 1
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 1
- 229910019142 PO4 Inorganic materials 0.000 description 1
- YGYAWVDWMABLBF-UHFFFAOYSA-N Phosgene Chemical compound ClC(Cl)=O YGYAWVDWMABLBF-UHFFFAOYSA-N 0.000 description 1
- 241000158147 Sator Species 0.000 description 1
- 230000032912 absorption of UV light Effects 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 1
- RWCCWEUUXYIKHB-UHFFFAOYSA-N benzophenone Chemical compound C=1C=CC=CC=1C(=O)C1=CC=CC=C1 RWCCWEUUXYIKHB-UHFFFAOYSA-N 0.000 description 1
- 150000008366 benzophenones Chemical class 0.000 description 1
- QRUDEWIWKLJBPS-UHFFFAOYSA-N benzotriazole Chemical compound C1=CC=C2N[N][N]C2=C1 QRUDEWIWKLJBPS-UHFFFAOYSA-N 0.000 description 1
- 239000012964 benzotriazole Substances 0.000 description 1
- 150000001565 benzotriazoles Chemical class 0.000 description 1
- 229940106691 bisphenol a Drugs 0.000 description 1
- LNQMUHQVKMATKD-UHFFFAOYSA-N butan-1-amine;nickel Chemical compound [Ni].CCCCN LNQMUHQVKMATKD-UHFFFAOYSA-N 0.000 description 1
- 239000003054 catalyst Substances 0.000 description 1
- 230000008859 change Effects 0.000 description 1
- 239000011248 coating agent Substances 0.000 description 1
- XLJKHNWPARRRJB-UHFFFAOYSA-N cobalt(2+) Chemical compound [Co+2] XLJKHNWPARRRJB-UHFFFAOYSA-N 0.000 description 1
- JAWGVVJVYSANRY-UHFFFAOYSA-N cobalt(3+) Chemical compound [Co+3] JAWGVVJVYSANRY-UHFFFAOYSA-N 0.000 description 1
- 239000013065 commercial product Substances 0.000 description 1
- 239000007859 condensation product Substances 0.000 description 1
- 239000012990 dithiocarbamate Substances 0.000 description 1
- 230000005284 excitation Effects 0.000 description 1
- 230000002349 favourable effect Effects 0.000 description 1
- 239000011888 foil Substances 0.000 description 1
- 150000008282 halocarbons Chemical class 0.000 description 1
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 1
- 238000002347 injection Methods 0.000 description 1
- 239000007924 injection Substances 0.000 description 1
- 230000002427 irreversible effect Effects 0.000 description 1
- 239000011159 matrix material Substances 0.000 description 1
- 230000007246 mechanism Effects 0.000 description 1
- QSHDDOUJBYECFT-UHFFFAOYSA-N mercury Chemical compound [Hg] QSHDDOUJBYECFT-UHFFFAOYSA-N 0.000 description 1
- 229910052753 mercury Inorganic materials 0.000 description 1
- 238000000034 method Methods 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- 229910052760 oxygen Inorganic materials 0.000 description 1
- 239000001301 oxygen Substances 0.000 description 1
- ATGUVEKSASEFFO-UHFFFAOYSA-N p-aminodiphenylamine Chemical compound C1=CC(N)=CC=C1NC1=CC=CC=C1 ATGUVEKSASEFFO-UHFFFAOYSA-N 0.000 description 1
- 230000035699 permeability Effects 0.000 description 1
- 150000004707 phenolate Chemical class 0.000 description 1
- 150000002989 phenols Chemical class 0.000 description 1
- 239000010452 phosphate Substances 0.000 description 1
- 239000002985 plastic film Substances 0.000 description 1
- 229920006255 plastic film Polymers 0.000 description 1
- 229920000515 polycarbonate Polymers 0.000 description 1
- 239000004417 polycarbonate Substances 0.000 description 1
- 229920000098 polyolefin Polymers 0.000 description 1
- BWJUFXUULUEGMA-UHFFFAOYSA-N propan-2-yl propan-2-yloxycarbonyloxy carbonate Chemical compound CC(C)OC(=O)OOC(=O)OC(C)C BWJUFXUULUEGMA-UHFFFAOYSA-N 0.000 description 1
- TWIOETHNYAHVFS-UHFFFAOYSA-N propylcarbamodithioic acid Chemical compound CCCNC(S)=S TWIOETHNYAHVFS-UHFFFAOYSA-N 0.000 description 1
- 230000000191 radiation effect Effects 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
Classifications
-
- G—PHYSICS
- G03—PHOTOGRAPHY; CINEMATOGRAPHY; ANALOGOUS TECHNIQUES USING WAVES OTHER THAN OPTICAL WAVES; ELECTROGRAPHY; HOLOGRAPHY
- G03C—PHOTOSENSITIVE MATERIALS FOR PHOTOGRAPHIC PURPOSES; PHOTOGRAPHIC PROCESSES, e.g. CINE, X-RAY, COLOUR, STEREO-PHOTOGRAPHIC PROCESSES; AUXILIARY PROCESSES IN PHOTOGRAPHY
- G03C1/00—Photosensitive materials
- G03C1/72—Photosensitive compositions not covered by the groups G03C1/005 - G03C1/705
- G03C1/73—Photosensitive compositions not covered by the groups G03C1/005 - G03C1/705 containing organic compounds
-
- G—PHYSICS
- G03—PHOTOGRAPHY; CINEMATOGRAPHY; ANALOGOUS TECHNIQUES USING WAVES OTHER THAN OPTICAL WAVES; ELECTROGRAPHY; HOLOGRAPHY
- G03C—PHOTOSENSITIVE MATERIALS FOR PHOTOGRAPHIC PURPOSES; PHOTOGRAPHIC PROCESSES, e.g. CINE, X-RAY, COLOUR, STEREO-PHOTOGRAPHIC PROCESSES; AUXILIARY PROCESSES IN PHOTOGRAPHY
- G03C1/00—Photosensitive materials
- G03C1/685—Compositions containing spiro-condensed pyran compounds or derivatives thereof, as photosensitive substances
Landscapes
- Chemical & Material Sciences (AREA)
- Engineering & Computer Science (AREA)
- Materials Engineering (AREA)
- Physics & Mathematics (AREA)
- General Physics & Mathematics (AREA)
- Non-Silver Salt Photosensitive Materials And Non-Silver Salt Photography (AREA)
- Compositions Of Macromolecular Compounds (AREA)
- Optical Filters (AREA)
- Electrochromic Elements, Electrophoresis, Or Variable Reflection Or Absorption Elements (AREA)
- Anti-Oxidant Or Stabilizer Compositions (AREA)
- Eyeglasses (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US06/360,455 US4440672A (en) | 1982-03-22 | 1982-03-22 | Photochromic composition resistant to fatigue |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DE3310388A1 DE3310388A1 (de) | 1983-09-29 |
| DE3310388C2 true DE3310388C2 (enExample) | 1991-12-05 |
Family
ID=23418016
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19833310388 Granted DE3310388A1 (de) | 1982-03-22 | 1983-03-22 | Ermuedungsbestaendige photochrome zusammensetzungen und gegenstaende |
Country Status (9)
| Country | Link |
|---|---|
| US (1) | US4440672A (enExample) |
| JP (1) | JPS58173181A (enExample) |
| AU (1) | AU562283B2 (enExample) |
| CA (1) | CA1181978A (enExample) |
| CH (1) | CH656393A5 (enExample) |
| DE (1) | DE3310388A1 (enExample) |
| FR (1) | FR2523593B1 (enExample) |
| GB (1) | GB2117390B (enExample) |
| NL (1) | NL194614C (enExample) |
Families Citing this family (45)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| FR2520360A1 (fr) * | 1982-01-26 | 1983-07-29 | Nicoud Jean | Nouveaux derives de la paranitroaniline utilisables en optique non lineaire et en electro-optique et leur procede de preparation |
| US4720356A (en) * | 1982-03-22 | 1988-01-19 | American Optical Corporation | Photochromic composition resistant to fatigue |
| US4699473A (en) * | 1983-08-08 | 1987-10-13 | American Optical Corporation | Trifluoromethyl substituted spirooxazine photochromic dyes |
| US4637698A (en) * | 1983-11-04 | 1987-01-20 | Ppg Industries, Inc. | Photochromic compound and articles containing the same |
| CA1246565A (en) * | 1984-07-06 | 1988-12-13 | Shinichi Yamamoto | Spiro-oxazine compounds and preparation thereof and photochronic shaped article |
| JPS6122327A (ja) * | 1984-07-11 | 1986-01-30 | Toray Ind Inc | ホトクロミツク性成形品 |
| US4720547A (en) * | 1984-07-30 | 1988-01-19 | Ppg Industries, Inc. | Photochromic compound and articles containing the same |
| JPS61263982A (ja) * | 1985-01-25 | 1986-11-21 | Mitsubishi Chem Ind Ltd | 3,3−ジメチル−スピロ〔インドリノ−2,3′−ナフト〔2,1−b〕(1,4)オキサジン〕系化合物 |
| CA1268034A (en) * | 1985-01-31 | 1990-04-24 | Nori Y.C. Chu | Photochromic composition resistant to fatigue |
| AU564689B2 (en) * | 1985-07-09 | 1987-08-20 | Kureha Kagaku Kogyo K.K. | Photochromic lens |
| DE3525891A1 (de) * | 1985-07-19 | 1987-01-22 | Rodenstock Optik G | Photochrome verbindungen (iii) |
| GB8610709D0 (en) * | 1986-05-01 | 1986-06-04 | Plinkington Bros Plc | Photochromic lenses |
| US4909963A (en) * | 1986-09-26 | 1990-03-20 | Ppg Industries, Inc. | Photochromic article |
| US4816584A (en) * | 1986-11-12 | 1989-03-28 | Ppg Industries, Inc. | Photochromic spiro(indoline)benzoxazines |
| GB8627859D0 (en) * | 1986-11-21 | 1986-12-31 | Pilkington Brothers Plc | Spiro-oxazine compounds |
| JPH0794657B2 (ja) * | 1987-10-16 | 1995-10-11 | 日産自動車株式会社 | フォトクロミック感光性材料 |
| IT1223067B (it) * | 1987-11-05 | 1990-09-12 | Enichem Sintesi | Composto fotocromatico ed articoli fotocromatici che lo contengono |
| JPH01259327A (ja) * | 1988-04-08 | 1989-10-17 | Toyoda Gosei Co Ltd | エレクトロクロミック素子 |
| US5000878A (en) * | 1989-02-24 | 1991-03-19 | American Optical Corporation | Photochromic articles with thermally stable photocolorability |
| US5266447A (en) * | 1990-07-04 | 1993-11-30 | Lintec Corporation | Photochromic composition |
| US5699182A (en) * | 1995-05-25 | 1997-12-16 | Xytronyx, Inc. | Light fatigue resistant photochromic formulations |
| DE19643773A1 (de) * | 1996-10-23 | 1998-04-30 | Tschochner Rolfheinz | UV-sensitive Farbstoffe |
| FR2761694B1 (fr) * | 1997-04-04 | 1999-06-25 | Corning Inc | Polymere photochromique, intrinsequement stable a la lumiere sa preparation et les articles en renfermant |
| JP4157245B2 (ja) * | 2000-02-21 | 2008-10-01 | 株式会社トクヤマ | クロメン化合物 |
| US7077985B2 (en) * | 2000-05-30 | 2006-07-18 | Vision-Ease Lens | Injection molding of lens |
| US20040180211A1 (en) * | 2003-01-24 | 2004-09-16 | Vision-Ease Lens, Inc. | Photochromic polyurethane film of improved fatigue resistance |
| US20040145701A1 (en) * | 2003-01-29 | 2004-07-29 | Robert Miniutti | Solid color eyewear lenses |
| EP1673655B1 (en) | 2003-09-09 | 2015-05-06 | Insight Equity A.P.X., LP | Photochromic polyurethane laminate |
| US7858001B2 (en) * | 2003-09-09 | 2010-12-28 | Insight Equity A.P.X., L.P. | Photochromic lens |
| US7910022B2 (en) * | 2006-09-15 | 2011-03-22 | Performance Indicator, Llc | Phosphorescent compositions for identification |
| US20110140002A1 (en) * | 2004-12-20 | 2011-06-16 | Performance Indicator, Llc | Photoluminescent Compositions, Methods of Manufacture and Novel Uses |
| SG159492A1 (en) | 2004-12-20 | 2010-03-30 | Performance Indicator Llc | High-intensity, persistent photoluminescent formulations and objects, and methods for creating the same |
| EP1874984A2 (en) * | 2005-03-04 | 2008-01-09 | Vision-Ease Lens, Inc. | Forming method for polymeric laminated wafers comprising different film materials |
| US7547894B2 (en) | 2006-09-15 | 2009-06-16 | Performance Indicator, L.L.C. | Phosphorescent compositions and methods for identification using the same |
| US20080195072A1 (en) * | 2007-02-08 | 2008-08-14 | The Procter & Gamble Company | Disposable absorbent articles having photochromic ink based graphics |
| US7842128B2 (en) * | 2007-09-13 | 2010-11-30 | Performance Indicatior LLC | Tissue marking compositions |
| US8039193B2 (en) * | 2007-09-13 | 2011-10-18 | Performance Indicator Llc | Tissue markings and methods for reversibly marking tissue employing the same |
| US20210284778A1 (en) | 2020-03-11 | 2021-09-16 | Alcon Inc. | Photochromic polydiorganosiloxane vinylic crosslinkers |
| TWI785630B (zh) | 2020-06-02 | 2022-12-01 | 瑞士商愛爾康公司 | 光致變色矽酮水凝膠接觸鏡片及可聚合組合物及製造彼等之方法 |
| EP4237232B1 (en) | 2020-10-28 | 2024-11-27 | Alcon Inc. | Method for making photochromic contact lenses |
| US11886045B2 (en) | 2020-11-04 | 2024-01-30 | Alcon Inc. | Method for making photochromic contact lenses |
| HUE069913T2 (hu) | 2020-11-04 | 2025-04-28 | Alcon Inc | Eljárás fotokróm kontaktlencsék elõállítására |
| KR20230131494A (ko) | 2021-03-08 | 2023-09-13 | 알콘 인코포레이티드 | 광기능성 콘택트 렌즈의 제조 방법 |
| EP4313567B1 (en) | 2021-04-01 | 2025-01-29 | Alcon Inc. | Method for making photochromic contact lenses |
| US20230364832A1 (en) | 2022-04-28 | 2023-11-16 | Alcon Inc. | Method for making uv and hevl-absorbing ophthalmic lenses |
Family Cites Families (12)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US432668A (en) * | 1890-07-22 | Steam-boiler furnace | ||
| US3212898A (en) * | 1962-11-21 | 1965-10-19 | American Cyanamid Co | Photosensitive compositions of matter comprising photochromic materials suspended in polyester binders |
| GB1186987A (en) * | 1967-08-30 | 1970-04-08 | Fuji Photo Film Co Ltd | Photochromic Compounds |
| JPS4948631B1 (enExample) * | 1968-10-28 | 1974-12-23 | ||
| DE1927849A1 (de) * | 1969-05-31 | 1970-12-10 | Licentia Gmbh | Spiroverbindung |
| US3666352A (en) * | 1970-01-22 | 1972-05-30 | Charles A Wagner | Rate controlled photochromic lenses of vinyl chloride-vinyl acetate copolymer containing a mercury thiocarbazone compound |
| JPS5544790B2 (enExample) * | 1972-09-27 | 1980-11-14 | ||
| US3853810A (en) * | 1972-10-16 | 1974-12-10 | Exxon Research Engineering Co | Nickel salts of arylsulfonic acids as ultraviolet stabilizers for light sensitive polymers |
| JPS548498A (en) * | 1977-06-21 | 1979-01-22 | Sharp Corp | Electrode for display unit |
| US4215010A (en) * | 1978-09-08 | 1980-07-29 | American Optical Corporation | Photochromic compounds |
| US4342668A (en) * | 1978-09-08 | 1982-08-03 | American Optical Corporation | Photochromic compounds |
| GB2048278B (en) * | 1979-04-20 | 1983-11-30 | Wiggins Teape Group Ltd | Photographic base papers |
-
1982
- 1982-03-22 US US06/360,455 patent/US4440672A/en not_active Expired - Lifetime
-
1983
- 1983-01-17 CA CA000419555A patent/CA1181978A/en not_active Expired
- 1983-02-03 GB GB08302931A patent/GB2117390B/en not_active Expired
- 1983-02-17 AU AU11613/83A patent/AU562283B2/en not_active Expired
- 1983-03-16 CH CH1452/83A patent/CH656393A5/de not_active IP Right Cessation
- 1983-03-21 FR FR8304606A patent/FR2523593B1/fr not_active Expired
- 1983-03-22 NL NL8301016A patent/NL194614C/nl active Search and Examination
- 1983-03-22 DE DE19833310388 patent/DE3310388A1/de active Granted
- 1983-03-22 JP JP58047807A patent/JPS58173181A/ja active Granted
Also Published As
| Publication number | Publication date |
|---|---|
| CA1181978A (en) | 1985-02-05 |
| JPS58173181A (ja) | 1983-10-12 |
| GB8302931D0 (en) | 1983-03-09 |
| NL194614B (nl) | 2002-05-01 |
| AU1161383A (en) | 1983-09-29 |
| NL8301016A (nl) | 1983-10-17 |
| AU562283B2 (en) | 1987-06-04 |
| GB2117390A (en) | 1983-10-12 |
| NL194614C (nl) | 2002-09-03 |
| US4440672A (en) | 1984-04-03 |
| JPH0365397B2 (enExample) | 1991-10-11 |
| GB2117390B (en) | 1985-12-18 |
| FR2523593A1 (fr) | 1983-09-23 |
| CH656393A5 (de) | 1986-06-30 |
| FR2523593B1 (fr) | 1986-11-14 |
| DE3310388A1 (de) | 1983-09-29 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE3310388C2 (enExample) | ||
| DE69526246T3 (de) | Neuartiges photochromes, indeno-kondensiertes naphthopyran | |
| DE69726574T2 (de) | Neue photochrome indenokondensierte naphthopyrane | |
| DE69737827T2 (de) | Photochrome naphthopyranverbindungen neutraler farbe | |
| DE69327410T2 (de) | Photochrome zusammensetzungen mit verbesserter lichtermüdungsbeständigkeit | |
| DE69732372T2 (de) | Neuartige photochrome heterozyklische geschmolzene indenonaphthopyrane | |
| DE69507982T2 (de) | Photochromische Zusammensetzung und Herstellungsverfahren eines photochromischen gehärteten Produkts | |
| DE2936255C2 (enExample) | ||
| EP0508219B1 (de) | Photochrome Substanzen | |
| DE69821525T2 (de) | Photochrome pyrano-kondensierte naphthopyrane | |
| DE69106799T2 (de) | Photochrome Zusammensetzungen. | |
| DE4229233A1 (de) | Uv-absorber enthaltendes photographisches filmmaterial | |
| DE9321352U1 (de) | Photochrome Naphthopyrane | |
| DE3345639A1 (de) | Optisches element mit phototropem ueberzug | |
| DE1915118A1 (de) | Farbenphotographisches lichtempfindliches Material mit einem Gehalt an ultraviolettabsorbierenden Verbindungen | |
| DE69606146T2 (de) | Photochromische zusammensetzung und herstellungsverfahren eines photochromischen, gehärteten produkts | |
| DE69806792T2 (de) | Photochrome spiro(indolin) fluoranthenoxazine verbindungen | |
| EP0195898B1 (en) | A method of increasing the light fatigue resistance of a photochromic composition and photochromic composition | |
| DE69902493T2 (de) | Härtbare, photochromische Zusammensetzung | |
| DE2541267A1 (de) | Photographisches aufzeichnungsmaterial | |
| DE1949715A1 (de) | Photochromes Material | |
| DE60103847T2 (de) | Substituierte photochromische 2h-naphtho[1,2-b]pyran verbindungen | |
| EP3010924B1 (de) | Uv-härtungskompatible photochrome annellierte naphthopyrane | |
| IT8365211A1 (it) | Assorbitore di ultravioletto e materiale fotografico che lo comprende | |
| EP1461330B1 (de) | 3H-NAPHTHO[2,1-b]-PYRAN-DERIVATE SOWIE DEREN VERWENDUNG |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| 8110 | Request for examination paragraph 44 | ||
| D2 | Grant after examination | ||
| 8364 | No opposition during term of opposition |