DE3232959A1 - Substituierte benzolsulfonsaeureester, verfahren zu ihrer herstellung und ihre verwendung als arzneimittel - Google Patents
Substituierte benzolsulfonsaeureester, verfahren zu ihrer herstellung und ihre verwendung als arzneimittelInfo
- Publication number
- DE3232959A1 DE3232959A1 DE19823232959 DE3232959A DE3232959A1 DE 3232959 A1 DE3232959 A1 DE 3232959A1 DE 19823232959 DE19823232959 DE 19823232959 DE 3232959 A DE3232959 A DE 3232959A DE 3232959 A1 DE3232959 A1 DE 3232959A1
- Authority
- DE
- Germany
- Prior art keywords
- formula
- cooch
- carbon atoms
- coor
- alkyl
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Withdrawn
Links
- 238000000034 method Methods 0.000 title claims abstract description 19
- -1 Benzenesulfonic Acid Ester Chemical class 0.000 title claims description 35
- 229940092714 benzenesulfonic acid Drugs 0.000 title claims description 5
- 229940126601 medicinal product Drugs 0.000 title description 4
- 238000004519 manufacturing process Methods 0.000 title description 3
- 150000001875 compounds Chemical class 0.000 claims abstract description 23
- 238000002360 preparation method Methods 0.000 claims abstract description 6
- 244000000013 helminth Species 0.000 claims abstract description 4
- 125000004432 carbon atom Chemical group C* 0.000 claims description 16
- 125000000217 alkyl group Chemical group 0.000 claims description 14
- 239000000203 mixture Substances 0.000 claims description 13
- 229910052739 hydrogen Inorganic materials 0.000 claims description 12
- 239000001257 hydrogen Substances 0.000 claims description 12
- 239000002904 solvent Substances 0.000 claims description 9
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 8
- 239000000460 chlorine Substances 0.000 claims description 8
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 7
- 150000002828 nitro derivatives Chemical class 0.000 claims description 6
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 6
- XTHPWXDJESJLNJ-UHFFFAOYSA-N sulfurochloridic acid Chemical class OS(Cl)(=O)=O XTHPWXDJESJLNJ-UHFFFAOYSA-N 0.000 claims description 6
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 5
- 150000008107 benzenesulfonic acids Chemical class 0.000 claims description 5
- 229910052801 chlorine Inorganic materials 0.000 claims description 5
- 229910052736 halogen Inorganic materials 0.000 claims description 5
- 150000002367 halogens Chemical class 0.000 claims description 5
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims description 4
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 claims description 4
- 239000002253 acid Substances 0.000 claims description 4
- 125000004183 alkoxy alkyl group Chemical group 0.000 claims description 4
- DUIOPKIIICUYRZ-NJFSPNSNSA-N aminourea Chemical class NN[14C](N)=O DUIOPKIIICUYRZ-NJFSPNSNSA-N 0.000 claims description 4
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 claims description 4
- 229910052794 bromium Inorganic materials 0.000 claims description 4
- 125000000753 cycloalkyl group Chemical group 0.000 claims description 4
- 239000011737 fluorine Substances 0.000 claims description 4
- 229910052731 fluorine Inorganic materials 0.000 claims description 4
- UPJWAKUNQVOESN-UHFFFAOYSA-N carbonisothiocyanatidic acid Chemical compound OC(=O)N=C=S UPJWAKUNQVOESN-UHFFFAOYSA-N 0.000 claims description 3
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 3
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 claims description 2
- 125000000218 acetic acid group Chemical group C(C)(=O)* 0.000 claims description 2
- 125000003545 alkoxy group Chemical group 0.000 claims description 2
- 125000004644 alkyl sulfinyl group Chemical group 0.000 claims description 2
- 125000004390 alkyl sulfonyl group Chemical group 0.000 claims description 2
- 125000004414 alkyl thio group Chemical group 0.000 claims description 2
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims description 2
- 150000002431 hydrogen Chemical class 0.000 claims description 2
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 claims description 2
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims description 2
- 229910052760 oxygen Inorganic materials 0.000 claims description 2
- 239000001301 oxygen Substances 0.000 claims description 2
- 125000003170 phenylsulfonyl group Chemical class C1(=CC=CC=C1)S(=O)(=O)* 0.000 claims description 2
- 125000001424 substituent group Chemical group 0.000 claims description 2
- 229910052717 sulfur Inorganic materials 0.000 claims description 2
- 239000011593 sulfur Substances 0.000 claims description 2
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 claims description 2
- 239000003795 chemical substances by application Substances 0.000 claims 1
- 239000000546 pharmaceutical excipient Substances 0.000 claims 1
- 241001465754 Metazoa Species 0.000 abstract description 3
- 150000002148 esters Chemical class 0.000 abstract 1
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 66
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 29
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 27
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 15
- ZAFNJMIOTHYJRJ-UHFFFAOYSA-N Diisopropyl ether Chemical compound CC(C)OC(C)C ZAFNJMIOTHYJRJ-UHFFFAOYSA-N 0.000 description 15
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 15
- 238000001816 cooling Methods 0.000 description 13
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 12
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 12
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 11
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 10
- 238000002844 melting Methods 0.000 description 10
- 230000008018 melting Effects 0.000 description 10
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 10
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 9
- 239000000243 solution Substances 0.000 description 9
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 9
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 8
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 8
- 238000003756 stirring Methods 0.000 description 8
- XNWFRZJHXBZDAG-UHFFFAOYSA-N 2-METHOXYETHANOL Chemical compound COCCO XNWFRZJHXBZDAG-UHFFFAOYSA-N 0.000 description 7
- WFDIJRYMOXRFFG-UHFFFAOYSA-N Acetic anhydride Chemical compound CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 description 6
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 6
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 6
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 6
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 6
- 238000006243 chemical reaction Methods 0.000 description 6
- 229910052757 nitrogen Inorganic materials 0.000 description 6
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 5
- 239000007868 Raney catalyst Substances 0.000 description 5
- NPXOKRUENSOPAO-UHFFFAOYSA-N Raney nickel Chemical compound [Al].[Ni] NPXOKRUENSOPAO-UHFFFAOYSA-N 0.000 description 5
- 229910000564 Raney nickel Inorganic materials 0.000 description 5
- 239000003054 catalyst Substances 0.000 description 5
- 230000003197 catalytic effect Effects 0.000 description 5
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 4
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 4
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 4
- 229960000583 acetic acid Drugs 0.000 description 4
- MVPPADPHJFYWMZ-UHFFFAOYSA-N chlorobenzene Chemical compound ClC1=CC=CC=C1 MVPPADPHJFYWMZ-UHFFFAOYSA-N 0.000 description 4
- WRJWRGBVPUUDLA-UHFFFAOYSA-N chlorosulfonyl isocyanate Chemical compound ClS(=O)(=O)N=C=O WRJWRGBVPUUDLA-UHFFFAOYSA-N 0.000 description 4
- 125000004093 cyano group Chemical group *C#N 0.000 description 4
- 239000012442 inert solvent Substances 0.000 description 4
- BDAGIHXWWSANSR-UHFFFAOYSA-N methanoic acid Natural products OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 description 4
- 239000002244 precipitate Substances 0.000 description 4
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 4
- 238000010992 reflux Methods 0.000 description 4
- 239000011347 resin Substances 0.000 description 4
- 229920005989 resin Polymers 0.000 description 4
- VZGDMQKNWNREIO-UHFFFAOYSA-N tetrachloromethane Chemical compound ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 description 4
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 3
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- HLKRDPGZVNQQAG-UHFFFAOYSA-N [4-(carbamoylamino)-3-nitrophenyl] 3-(trifluoromethyl)benzenesulfonate Chemical compound C1=C([N+]([O-])=O)C(NC(=O)N)=CC=C1OS(=O)(=O)C1=CC=CC(C(F)(F)F)=C1 HLKRDPGZVNQQAG-UHFFFAOYSA-N 0.000 description 3
- 239000004480 active ingredient Substances 0.000 description 3
- 230000000507 anthelmentic effect Effects 0.000 description 3
- 150000007529 inorganic bases Chemical class 0.000 description 3
- LBFAAYMITJMZOC-UHFFFAOYSA-N methyl n-(sulfanylidenemethylidene)carbamate Chemical compound COC(=O)N=C=S LBFAAYMITJMZOC-UHFFFAOYSA-N 0.000 description 3
- 150000007522 mineralic acids Chemical class 0.000 description 3
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 3
- LQNUZADURLCDLV-UHFFFAOYSA-N nitrobenzene Substances [O-][N+](=O)C1=CC=CC=C1 LQNUZADURLCDLV-UHFFFAOYSA-N 0.000 description 3
- 150000007524 organic acids Chemical class 0.000 description 3
- 150000007530 organic bases Chemical class 0.000 description 3
- 239000003208 petroleum Substances 0.000 description 3
- YSAPYRFQLHBJSV-UHFFFAOYSA-N phenyl 3-amino-4-(carbamoylamino)benzenesulfonate Chemical compound C1=C(N)C(NC(=O)N)=CC=C1S(=O)(=O)OC1=CC=CC=C1 YSAPYRFQLHBJSV-UHFFFAOYSA-N 0.000 description 3
- SDILANDQXWIRDR-UHFFFAOYSA-N phenyl 4-(carbamoylamino)-3-nitrobenzenesulfonate Chemical compound C1=C([N+]([O-])=O)C(NC(=O)N)=CC=C1S(=O)(=O)OC1=CC=CC=C1 SDILANDQXWIRDR-UHFFFAOYSA-N 0.000 description 3
- 238000001556 precipitation Methods 0.000 description 3
- 239000000047 product Substances 0.000 description 3
- WSLDOOZREJYCGB-UHFFFAOYSA-N 1,2-Dichloroethane Chemical compound ClCCCl WSLDOOZREJYCGB-UHFFFAOYSA-N 0.000 description 2
- ZWEHNKRNPOVVGH-UHFFFAOYSA-N 2-Butanone Chemical compound CCC(C)=O ZWEHNKRNPOVVGH-UHFFFAOYSA-N 0.000 description 2
- OSWFIVFLDKOXQC-UHFFFAOYSA-N 4-(3-methoxyphenyl)aniline Chemical compound COC1=CC=CC(C=2C=CC(N)=CC=2)=C1 OSWFIVFLDKOXQC-UHFFFAOYSA-N 0.000 description 2
- VTYYLEPIZMXCLO-UHFFFAOYSA-L Calcium carbonate Chemical compound [Ca+2].[O-]C([O-])=O VTYYLEPIZMXCLO-UHFFFAOYSA-L 0.000 description 2
- 229920002134 Carboxymethyl cellulose Polymers 0.000 description 2
- XTHFKEDIFFGKHM-UHFFFAOYSA-N Dimethoxyethane Chemical compound COCCOC XTHFKEDIFFGKHM-UHFFFAOYSA-N 0.000 description 2
- ZRALSGWEFCBTJO-UHFFFAOYSA-N Guanidine Chemical compound NC(N)=N ZRALSGWEFCBTJO-UHFFFAOYSA-N 0.000 description 2
- AFVFQIVMOAPDHO-UHFFFAOYSA-N Methanesulfonic acid Chemical compound CS(O)(=O)=O AFVFQIVMOAPDHO-UHFFFAOYSA-N 0.000 description 2
- LRHPLDYGYMQRHN-UHFFFAOYSA-N N-Butanol Chemical compound CCCCO LRHPLDYGYMQRHN-UHFFFAOYSA-N 0.000 description 2
- GRYLNZFGIOXLOG-UHFFFAOYSA-N Nitric acid Chemical compound O[N+]([O-])=O GRYLNZFGIOXLOG-UHFFFAOYSA-N 0.000 description 2
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 2
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 2
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 2
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 2
- DTQVDTLACAAQTR-UHFFFAOYSA-N Trifluoroacetic acid Chemical compound OC(=O)C(F)(F)F DTQVDTLACAAQTR-UHFFFAOYSA-N 0.000 description 2
- CBQNJOWKUBLTSF-UHFFFAOYSA-N [3-amino-4-(carbamoylamino)phenyl] 3-(trifluoromethyl)benzenesulfonate Chemical compound C1=C(N)C(NC(=O)N)=CC=C1OS(=O)(=O)C1=CC=CC(C(F)(F)F)=C1 CBQNJOWKUBLTSF-UHFFFAOYSA-N 0.000 description 2
- GEJKWYASTLGMMY-UHFFFAOYSA-N [4-(acetylcarbamoylamino)-3-aminophenyl] 3-(trifluoromethyl)benzenesulfonate Chemical compound C1=C(N)C(NC(=O)NC(=O)C)=CC=C1OS(=O)(=O)C1=CC=CC(C(F)(F)F)=C1 GEJKWYASTLGMMY-UHFFFAOYSA-N 0.000 description 2
- FBDPJMGDZLLRNZ-UHFFFAOYSA-N [4-(acetylcarbamoylamino)-3-nitrophenyl] 3-(trifluoromethyl)benzenesulfonate Chemical compound C1=C([N+]([O-])=O)C(NC(=O)NC(=O)C)=CC=C1OS(=O)(=O)C1=CC=CC(C(F)(F)F)=C1 FBDPJMGDZLLRNZ-UHFFFAOYSA-N 0.000 description 2
- 235000011054 acetic acid Nutrition 0.000 description 2
- 150000008065 acid anhydrides Chemical class 0.000 description 2
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 2
- 229910021529 ammonia Inorganic materials 0.000 description 2
- 229940124339 anthelmintic agent Drugs 0.000 description 2
- 239000000921 anthelmintic agent Substances 0.000 description 2
- 239000002585 base Substances 0.000 description 2
- HQABUPZFAYXKJW-UHFFFAOYSA-N butan-1-amine Chemical compound CCCCN HQABUPZFAYXKJW-UHFFFAOYSA-N 0.000 description 2
- 239000001768 carboxy methyl cellulose Substances 0.000 description 2
- 235000010948 carboxy methyl cellulose Nutrition 0.000 description 2
- 239000008112 carboxymethyl-cellulose Substances 0.000 description 2
- 238000000354 decomposition reaction Methods 0.000 description 2
- 235000014113 dietary fatty acids Nutrition 0.000 description 2
- XBDQKXXYIPTUBI-UHFFFAOYSA-N dimethylselenoniopropionate Natural products CCC(O)=O XBDQKXXYIPTUBI-UHFFFAOYSA-N 0.000 description 2
- 239000003814 drug Substances 0.000 description 2
- 239000000194 fatty acid Substances 0.000 description 2
- 229930195729 fatty acid Natural products 0.000 description 2
- 235000019253 formic acid Nutrition 0.000 description 2
- 239000012362 glacial acetic acid Substances 0.000 description 2
- HQKMJHAJHXVSDF-UHFFFAOYSA-L magnesium stearate Chemical compound [Mg+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O HQKMJHAJHXVSDF-UHFFFAOYSA-L 0.000 description 2
- 230000007935 neutral effect Effects 0.000 description 2
- 229910017604 nitric acid Inorganic materials 0.000 description 2
- 239000003921 oil Substances 0.000 description 2
- 235000019198 oils Nutrition 0.000 description 2
- UVNDUFUGVWNRIP-UHFFFAOYSA-N phenyl 4-(acetylcarbamoylamino)-3-aminobenzenesulfonate Chemical compound C1=C(N)C(NC(=O)NC(=O)C)=CC=C1S(=O)(=O)OC1=CC=CC=C1 UVNDUFUGVWNRIP-UHFFFAOYSA-N 0.000 description 2
- 239000011591 potassium Substances 0.000 description 2
- 229910052700 potassium Inorganic materials 0.000 description 2
- 238000001953 recrystallisation Methods 0.000 description 2
- 230000000630 rising effect Effects 0.000 description 2
- 238000007127 saponification reaction Methods 0.000 description 2
- 239000008096 xylene Substances 0.000 description 2
- ZFFMLCVRJBZUDZ-UHFFFAOYSA-N 2,3-dimethylbutane Chemical group CC(C)C(C)C ZFFMLCVRJBZUDZ-UHFFFAOYSA-N 0.000 description 1
- RTZZCYNQPHTPPL-UHFFFAOYSA-N 3-nitrophenol Chemical compound OC1=CC=CC([N+]([O-])=O)=C1 RTZZCYNQPHTPPL-UHFFFAOYSA-N 0.000 description 1
- SEWNAJIUKSTYOP-UHFFFAOYSA-N 4-chloro-3-nitrobenzenesulfonyl chloride Chemical compound [O-][N+](=O)C1=CC(S(Cl)(=O)=O)=CC=C1Cl SEWNAJIUKSTYOP-UHFFFAOYSA-N 0.000 description 1
- 241001147657 Ancylostoma Species 0.000 description 1
- 241000244186 Ascaris Species 0.000 description 1
- LSNNMFCWUKXFEE-UHFFFAOYSA-M Bisulfite Chemical compound OS([O-])=O LSNNMFCWUKXFEE-UHFFFAOYSA-M 0.000 description 1
- 241000893172 Chabertia Species 0.000 description 1
- 241001126268 Cooperia Species 0.000 description 1
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 description 1
- 241000242711 Fasciola hepatica Species 0.000 description 1
- 239000001828 Gelatine Substances 0.000 description 1
- 241000243976 Haemonchus Species 0.000 description 1
- 241000920462 Heterakis Species 0.000 description 1
- 241001547406 Hyostrongylus Species 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- 241000243789 Metastrongyloidea Species 0.000 description 1
- JGFZNNIVVJXRND-UHFFFAOYSA-N N,N-Diisopropylethylamine (DIPEA) Chemical compound CCN(C(C)C)C(C)C JGFZNNIVVJXRND-UHFFFAOYSA-N 0.000 description 1
- CHJJGSNFBQVOTG-UHFFFAOYSA-N N-methyl-guanidine Natural products CNC(N)=N CHJJGSNFBQVOTG-UHFFFAOYSA-N 0.000 description 1
- 241000510960 Oesophagostomum Species 0.000 description 1
- 241000243795 Ostertagia Species 0.000 description 1
- 208000030852 Parasitic disease Diseases 0.000 description 1
- 239000002202 Polyethylene glycol Substances 0.000 description 1
- 229920002472 Starch Polymers 0.000 description 1
- 241000244174 Strongyloides Species 0.000 description 1
- 241000242541 Trematoda Species 0.000 description 1
- 241000243797 Trichostrongylus Species 0.000 description 1
- OGGHVHSDYTZSOA-UHFFFAOYSA-N [4-(carbamoylamino)-3-(methoxycarbonylcarbamothioylamino)phenyl] 3-(trifluoromethyl)benzenesulfonate Chemical compound C1=C(NC(N)=O)C(NC(=S)NC(=O)OC)=CC(OS(=O)(=O)C=2C=C(C=CC=2)C(F)(F)F)=C1 OGGHVHSDYTZSOA-UHFFFAOYSA-N 0.000 description 1
- QMAOHNMMWCBEDB-UHFFFAOYSA-N [4-(chlorosulfonylcarbamoylamino)-3-nitrophenyl] 3-(trifluoromethyl)benzenesulfonate Chemical compound C1=C(NC(=O)NS(Cl)(=O)=O)C([N+](=O)[O-])=CC(OS(=O)(=O)C=2C=C(C=CC=2)C(F)(F)F)=C1 QMAOHNMMWCBEDB-UHFFFAOYSA-N 0.000 description 1
- 230000010933 acylation Effects 0.000 description 1
- 238000005917 acylation reaction Methods 0.000 description 1
- 239000000654 additive Substances 0.000 description 1
- 230000000996 additive effect Effects 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- 239000002246 antineoplastic agent Substances 0.000 description 1
- 239000003963 antioxidant agent Substances 0.000 description 1
- 230000003078 antioxidant effect Effects 0.000 description 1
- 239000000010 aprotic solvent Substances 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 239000007900 aqueous suspension Substances 0.000 description 1
- AYJRCSIUFZENHW-DEQYMQKBSA-L barium(2+);oxomethanediolate Chemical compound [Ba+2].[O-][14C]([O-])=O AYJRCSIUFZENHW-DEQYMQKBSA-L 0.000 description 1
- CSKNSYBAZOQPLR-UHFFFAOYSA-N benzenesulfonyl chloride Chemical class ClS(=O)(=O)C1=CC=CC=C1 CSKNSYBAZOQPLR-UHFFFAOYSA-N 0.000 description 1
- 230000037396 body weight Effects 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 229910000019 calcium carbonate Inorganic materials 0.000 description 1
- 235000010216 calcium carbonate Nutrition 0.000 description 1
- 239000002775 capsule Substances 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 150000004649 carbonic acid derivatives Chemical class 0.000 description 1
- 125000006297 carbonyl amino group Chemical group [H]N([*:2])C([*:1])=O 0.000 description 1
- 239000000969 carrier Substances 0.000 description 1
- 150000008280 chlorinated hydrocarbons Chemical class 0.000 description 1
- 238000002425 crystallisation Methods 0.000 description 1
- 230000008025 crystallization Effects 0.000 description 1
- 229940127089 cytotoxic agent Drugs 0.000 description 1
- GVJHHUAWPYXKBD-UHFFFAOYSA-N d-alpha-tocopherol Natural products OC1=C(C)C(C)=C2OC(CCCC(C)CCCC(C)CCCC(C)C)(C)CCC2=C1C GVJHHUAWPYXKBD-UHFFFAOYSA-N 0.000 description 1
- 125000004177 diethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- SWSQBOPZIKWTGO-UHFFFAOYSA-N dimethylaminoamidine Natural products CN(C)C(N)=N SWSQBOPZIKWTGO-UHFFFAOYSA-N 0.000 description 1
- 150000002170 ethers Chemical class 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 208000006275 fascioliasis Diseases 0.000 description 1
- 230000002496 gastric effect Effects 0.000 description 1
- 229920000159 gelatin Polymers 0.000 description 1
- 235000019322 gelatine Nutrition 0.000 description 1
- 239000008187 granular material Substances 0.000 description 1
- 229940093915 gynecological organic acid Drugs 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 229930195733 hydrocarbon Natural products 0.000 description 1
- 150000002430 hydrocarbons Chemical class 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-M hydroxide Chemical compound [OH-] XLYOFNOQVPJJNP-UHFFFAOYSA-M 0.000 description 1
- 150000004679 hydroxides Chemical class 0.000 description 1
- 239000000543 intermediate Substances 0.000 description 1
- 235000019359 magnesium stearate Nutrition 0.000 description 1
- 229940098779 methanesulfonic acid Drugs 0.000 description 1
- KHBXLYPOXVQKJG-UHFFFAOYSA-N methyl n-[(methoxycarbonylamino)-methylsulfanylmethylidene]carbamate Chemical compound COC(=O)NC(SC)=NC(=O)OC KHBXLYPOXVQKJG-UHFFFAOYSA-N 0.000 description 1
- MMZDUHCTUSJDHW-UHFFFAOYSA-N methyl n-[amino-(methoxycarbonylamino)methylidene]carbamate Chemical compound COC(=O)NC(=N)NC(=O)OC MMZDUHCTUSJDHW-UHFFFAOYSA-N 0.000 description 1
- SFDJOSRHYKHMOK-UHFFFAOYSA-N nitramide Chemical class N[N+]([O-])=O SFDJOSRHYKHMOK-UHFFFAOYSA-N 0.000 description 1
- 150000002825 nitriles Chemical class 0.000 description 1
- 239000004006 olive oil Substances 0.000 description 1
- 235000008390 olive oil Nutrition 0.000 description 1
- 235000005985 organic acids Nutrition 0.000 description 1
- 238000007911 parenteral administration Methods 0.000 description 1
- 239000006072 paste Substances 0.000 description 1
- 150000002989 phenols Chemical class 0.000 description 1
- OBDGKNCCNSQGPC-UHFFFAOYSA-N phenyl 4-(acetylcarbamoylamino)-3-nitrobenzenesulfonate Chemical compound C1=C([N+]([O-])=O)C(NC(=O)NC(=O)C)=CC=C1S(=O)(=O)OC1=CC=CC=C1 OBDGKNCCNSQGPC-UHFFFAOYSA-N 0.000 description 1
- JXBMHGKZPCOWBL-UHFFFAOYSA-N phenyl 4-(chlorosulfonylcarbamoylamino)-3-nitrobenzenesulfonate Chemical compound C1=C(NC(=O)NS(Cl)(=O)=O)C([N+](=O)[O-])=CC(S(=O)(=O)OC=2C=CC=CC=2)=C1 JXBMHGKZPCOWBL-UHFFFAOYSA-N 0.000 description 1
- NEZIKMJTIOLUGU-UHFFFAOYSA-N phenyl 4-amino-3-nitrobenzenesulfonate Chemical compound C1=C([N+]([O-])=O)C(N)=CC=C1S(=O)(=O)OC1=CC=CC=C1 NEZIKMJTIOLUGU-UHFFFAOYSA-N 0.000 description 1
- 235000011007 phosphoric acid Nutrition 0.000 description 1
- 239000002798 polar solvent Substances 0.000 description 1
- 229920001223 polyethylene glycol Polymers 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- 235000019260 propionic acid Nutrition 0.000 description 1
- IUVKMZGDUIUOCP-BTNSXGMBSA-N quinbolone Chemical compound O([C@H]1CC[C@H]2[C@H]3[C@@H]([C@]4(C=CC(=O)C=C4CC3)C)CC[C@@]21C)C1=CCCC1 IUVKMZGDUIUOCP-BTNSXGMBSA-N 0.000 description 1
- 239000011541 reaction mixture Substances 0.000 description 1
- 150000003839 salts Chemical class 0.000 description 1
- 239000008159 sesame oil Substances 0.000 description 1
- 235000011803 sesame oil Nutrition 0.000 description 1
- 239000000377 silicon dioxide Substances 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 239000008107 starch Substances 0.000 description 1
- 235000019698 starch Nutrition 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 235000000346 sugar Nutrition 0.000 description 1
- 239000004094 surface-active agent Substances 0.000 description 1
- 239000000454 talc Substances 0.000 description 1
- 229910052623 talc Inorganic materials 0.000 description 1
- 235000012222 talc Nutrition 0.000 description 1
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 1
- 239000002562 thickening agent Substances 0.000 description 1
- UMGDCJDMYOKAJW-UHFFFAOYSA-N thiourea Chemical compound NC(N)=S UMGDCJDMYOKAJW-UHFFFAOYSA-N 0.000 description 1
- 229960001295 tocopherol Drugs 0.000 description 1
- 229930003799 tocopherol Natural products 0.000 description 1
- 235000010384 tocopherol Nutrition 0.000 description 1
- 239000011732 tocopherol Substances 0.000 description 1
- 150000003626 triacylglycerols Chemical class 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
- GVJHHUAWPYXKBD-IEOSBIPESA-N α-tocopherol Chemical compound OC1=C(C)C(C)=C2O[C@@](CCC[C@H](C)CCC[C@H](C)CCCC(C)C)(C)CCC2=C1C GVJHHUAWPYXKBD-IEOSBIPESA-N 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C335/00—Thioureas, i.e. compounds containing any of the groups, the nitrogen atoms not being part of nitro or nitroso groups
- C07C335/04—Derivatives of thiourea
- C07C335/16—Derivatives of thiourea having nitrogen atoms of thiourea groups bound to carbon atoms of six-membered aromatic rings of a carbon skeleton
- C07C335/22—Derivatives of thiourea having nitrogen atoms of thiourea groups bound to carbon atoms of six-membered aromatic rings of a carbon skeleton being further substituted by carboxyl groups
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C309/00—Sulfonic acids; Halides, esters, or anhydrides thereof
- C07C309/63—Esters of sulfonic acids
- C07C309/72—Esters of sulfonic acids having sulfur atoms of esterified sulfo groups bound to carbon atoms of six-membered aromatic rings of a carbon skeleton
- C07C309/73—Esters of sulfonic acids having sulfur atoms of esterified sulfo groups bound to carbon atoms of six-membered aromatic rings of a carbon skeleton to carbon atoms of non-condensed six-membered aromatic rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C309/00—Sulfonic acids; Halides, esters, or anhydrides thereof
- C07C309/63—Esters of sulfonic acids
- C07C309/72—Esters of sulfonic acids having sulfur atoms of esterified sulfo groups bound to carbon atoms of six-membered aromatic rings of a carbon skeleton
- C07C309/75—Esters of sulfonic acids having sulfur atoms of esterified sulfo groups bound to carbon atoms of six-membered aromatic rings of a carbon skeleton containing singly-bound oxygen atoms bound to the carbon skeleton
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C309/00—Sulfonic acids; Halides, esters, or anhydrides thereof
- C07C309/63—Esters of sulfonic acids
- C07C309/72—Esters of sulfonic acids having sulfur atoms of esterified sulfo groups bound to carbon atoms of six-membered aromatic rings of a carbon skeleton
- C07C309/76—Esters of sulfonic acids having sulfur atoms of esterified sulfo groups bound to carbon atoms of six-membered aromatic rings of a carbon skeleton containing nitrogen atoms, not being part of nitro or nitroso groups, bound to the carbon skeleton
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C317/00—Sulfones; Sulfoxides
- C07C317/14—Sulfones; Sulfoxides having sulfone or sulfoxide groups bound to carbon atoms of six-membered aromatic rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C323/00—Thiols, sulfides, hydropolysulfides or polysulfides substituted by halogen, oxygen or nitrogen atoms, or by sulfur atoms not being part of thio groups
- C07C323/64—Thiols, sulfides, hydropolysulfides or polysulfides substituted by halogen, oxygen or nitrogen atoms, or by sulfur atoms not being part of thio groups containing thio groups and sulfur atoms, not being part of thio groups, bound to the same carbon skeleton
- C07C323/66—Thiols, sulfides, hydropolysulfides or polysulfides substituted by halogen, oxygen or nitrogen atoms, or by sulfur atoms not being part of thio groups containing thio groups and sulfur atoms, not being part of thio groups, bound to the same carbon skeleton containing sulfur atoms of sulfo, esterified sulfo or halosulfonyl groups, bound to the carbon skeleton
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C335/00—Thioureas, i.e. compounds containing any of the groups, the nitrogen atoms not being part of nitro or nitroso groups
- C07C335/04—Derivatives of thiourea
- C07C335/24—Derivatives of thiourea containing any of the groups, X being a hetero atom, Y being any atom
- C07C335/28—Y being a hetero atom, e.g. thiobiuret
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Acyclic And Carbocyclic Compounds In Medicinal Compositions (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Medicines Containing Antibodies Or Antigens For Use As Internal Diagnostic Agents (AREA)
- Steroid Compounds (AREA)
- Medicinal Preparation (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
Priority Applications (22)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19823232959 DE3232959A1 (de) | 1982-09-04 | 1982-09-04 | Substituierte benzolsulfonsaeureester, verfahren zu ihrer herstellung und ihre verwendung als arzneimittel |
| AT83108570T ATE28630T1 (de) | 1982-09-04 | 1983-08-31 | Substituierte benzolsulfonsaeureester, verfahren zu ihrer herstellung und ihre verwendung als arzneimittel. |
| DE8383108570T DE3372756D1 (en) | 1982-09-04 | 1983-08-31 | Substituted benzenesulfonic acid esters, preparation thereof and their use as medicaments |
| EP83108570A EP0105196B1 (de) | 1982-09-04 | 1983-08-31 | Substituierte Benzolsulfonsäureester, Verfahren zu ihrer Herstellung und ihre Verwendung als Arzneimittel |
| FI833119A FI833119A7 (fi) | 1982-09-04 | 1983-09-01 | Substituerade bensensulfonylsyraestrar, foerfaranden foer deras framstaellning och anvaendning daersom laekemedel |
| CA000435946A CA1214182A (en) | 1982-09-04 | 1983-09-02 | Substituted benzenesulfonic esters, a process for their preparation and their use as medicaments |
| NZ205468A NZ205468A (en) | 1982-09-04 | 1983-09-02 | Benzenesulphonic esters and pharmaceutical compositions |
| PH29485A PH19980A (en) | 1982-09-04 | 1983-09-02 | Benzenesulfonic esters of 2-uriidophenylthioureas,guanidines and substituted guanidines and pharmaceutical compositions containing them |
| DK401683A DK401683A (da) | 1982-09-04 | 1983-09-02 | Substituerede benzensulfonsyreestere, fremgangsmaade til deres fremstilling og deres anvendelse som laegemidler |
| AU18679/83A AU1867983A (en) | 1982-09-04 | 1983-09-02 | Substituted benzenesulfonic esters |
| HU833068A HU193531B (en) | 1982-09-04 | 1983-09-02 | Process for preparing benzene-sulphonic acid derivatives and pharmaceutical compositions containing them |
| JP58160602A JPS5976050A (ja) | 1982-09-04 | 1983-09-02 | 置換されたベンゼンスルホン酸エステルおよびそれらの製造法 |
| GR72361A GR78941B (enExample) | 1982-09-04 | 1983-09-02 | |
| KR1019830004133A KR840006335A (ko) | 1982-09-04 | 1983-09-02 | 치환된 벤젠설폰산 에스테르의 제조방법 |
| IL69640A IL69640A0 (en) | 1982-09-04 | 1983-09-02 | Substituted benzenesulfonic esters,a process for their preparation and their use as medicaments |
| ES525335A ES525335A0 (es) | 1982-09-04 | 1983-09-02 | Procedimiento para preparar esteres de acidos benzosulfonicos substituidos. |
| US06/528,842 US4504490A (en) | 1982-09-04 | 1983-09-02 | Substituted benzenesulfonic esters and their use as medicaments for combatting helminths |
| NO833158A NO833158L (no) | 1982-09-04 | 1983-09-02 | Substituerte benzensulfonsyreestere, fremgangsmaate til deres fremstilling og deres anvendelse som legemiddel |
| ZA836515A ZA836515B (en) | 1982-09-04 | 1983-09-02 | Substituted benzenesulfonic esters,a process for their preparation and their use as medicaments |
| PT77285A PT77285B (en) | 1982-09-04 | 1983-09-02 | Process for preparing substituted benzenosulphonates and pharmaceutical compositions containing the same |
| MA20115A MA19892A1 (fr) | 1982-09-04 | 1983-09-03 | Procede de preparation d'esters d'acide benzene sulfonique substitue. |
| ES533932A ES8503649A1 (es) | 1982-09-04 | 1984-07-02 | Procedimiento para preparar esteres de acidos benzosulfonicos substituidos |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19823232959 DE3232959A1 (de) | 1982-09-04 | 1982-09-04 | Substituierte benzolsulfonsaeureester, verfahren zu ihrer herstellung und ihre verwendung als arzneimittel |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE3232959A1 true DE3232959A1 (de) | 1984-03-08 |
Family
ID=6172503
Family Applications (2)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19823232959 Withdrawn DE3232959A1 (de) | 1982-09-04 | 1982-09-04 | Substituierte benzolsulfonsaeureester, verfahren zu ihrer herstellung und ihre verwendung als arzneimittel |
| DE8383108570T Expired DE3372756D1 (en) | 1982-09-04 | 1983-08-31 | Substituted benzenesulfonic acid esters, preparation thereof and their use as medicaments |
Family Applications After (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE8383108570T Expired DE3372756D1 (en) | 1982-09-04 | 1983-08-31 | Substituted benzenesulfonic acid esters, preparation thereof and their use as medicaments |
Country Status (20)
| Country | Link |
|---|---|
| US (1) | US4504490A (enExample) |
| EP (1) | EP0105196B1 (enExample) |
| JP (1) | JPS5976050A (enExample) |
| KR (1) | KR840006335A (enExample) |
| AT (1) | ATE28630T1 (enExample) |
| AU (1) | AU1867983A (enExample) |
| CA (1) | CA1214182A (enExample) |
| DE (2) | DE3232959A1 (enExample) |
| DK (1) | DK401683A (enExample) |
| ES (2) | ES525335A0 (enExample) |
| FI (1) | FI833119A7 (enExample) |
| GR (1) | GR78941B (enExample) |
| HU (1) | HU193531B (enExample) |
| IL (1) | IL69640A0 (enExample) |
| MA (1) | MA19892A1 (enExample) |
| NO (1) | NO833158L (enExample) |
| NZ (1) | NZ205468A (enExample) |
| PH (1) | PH19980A (enExample) |
| PT (1) | PT77285B (enExample) |
| ZA (1) | ZA836515B (enExample) |
Families Citing this family (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE3713856A1 (de) * | 1987-04-25 | 1988-11-17 | Bayer Ag | Sulfonsaeurearylesterhaltige aromatische diamine, ein verfahren zu ihrer herstellung sowie ihre verwendung bei der herstellung von polyurethankunststoffen |
| SE9103745D0 (sv) * | 1991-12-18 | 1991-12-18 | Wikstroem Haakan | Aryl-triflates and related compounds |
| EP0742208A1 (en) * | 1995-05-05 | 1996-11-13 | Grelan Pharmaceutical Co., Ltd. | 2-Ureido-benzamide derivatives |
| HU228400B1 (en) | 2000-06-20 | 2013-03-28 | Novartis Ag | The use of bisphosphonates for treatment of osteoporosis |
| WO2012142698A1 (en) * | 2011-04-20 | 2012-10-26 | Universite Laval | Alkylurea derivatives active against cancer cells |
| DE102020112411B3 (de) * | 2020-05-07 | 2021-05-27 | Papierfabrik August Koehler Se | Wärmeempfindliches Aufzeichnungsmaterial |
Family Cites Families (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2441201C2 (de) * | 1974-08-28 | 1986-08-07 | Hoechst Ag, 6230 Frankfurt | Anthelminthisch wirksame 2-Carbalkoxyamino-5(6)-phenyl-sulfonyloxy-benzimidazole und Verfahren zu ihrer Herstellung |
| DE2441202C2 (de) * | 1974-08-28 | 1986-05-28 | Hoechst Ag, 6230 Frankfurt | 2-Carbalkoxyamino-benzimidazolyl-5(6)-sulfonsäure-phenylester, Verfahren zu ihrer Herstellung und diese enthaltende anthelmintische Mittel |
| DE2608238A1 (de) * | 1976-02-28 | 1977-09-08 | Hoechst Ag | Substituierte phenylguanidine und verfahren zu ihrer herstellung |
| DE2653766A1 (de) * | 1976-11-26 | 1978-06-01 | Bayer Ag | Substituierte benzolsulfonsaeureester, verfahren zu ihrer herstellung sowie ihre verwendung als arzneimittel |
| DE2836385A1 (de) * | 1978-08-19 | 1980-03-06 | Hoechst Ag | Monocarboxylate von phenylguanidinsulfonsaeureestern, verfahren zu ihrer herstellung und ihre verwendung als arzneimittel |
-
1982
- 1982-09-04 DE DE19823232959 patent/DE3232959A1/de not_active Withdrawn
-
1983
- 1983-08-31 EP EP83108570A patent/EP0105196B1/de not_active Expired
- 1983-08-31 DE DE8383108570T patent/DE3372756D1/de not_active Expired
- 1983-08-31 AT AT83108570T patent/ATE28630T1/de not_active IP Right Cessation
- 1983-09-01 FI FI833119A patent/FI833119A7/fi not_active Application Discontinuation
- 1983-09-02 US US06/528,842 patent/US4504490A/en not_active Expired - Fee Related
- 1983-09-02 AU AU18679/83A patent/AU1867983A/en not_active Abandoned
- 1983-09-02 NZ NZ205468A patent/NZ205468A/xx unknown
- 1983-09-02 PT PT77285A patent/PT77285B/pt unknown
- 1983-09-02 ES ES525335A patent/ES525335A0/es active Granted
- 1983-09-02 PH PH29485A patent/PH19980A/en unknown
- 1983-09-02 GR GR72361A patent/GR78941B/el unknown
- 1983-09-02 HU HU833068A patent/HU193531B/hu unknown
- 1983-09-02 ZA ZA836515A patent/ZA836515B/xx unknown
- 1983-09-02 NO NO833158A patent/NO833158L/no unknown
- 1983-09-02 DK DK401683A patent/DK401683A/da not_active Application Discontinuation
- 1983-09-02 CA CA000435946A patent/CA1214182A/en not_active Expired
- 1983-09-02 KR KR1019830004133A patent/KR840006335A/ko not_active Withdrawn
- 1983-09-02 JP JP58160602A patent/JPS5976050A/ja active Pending
- 1983-09-02 IL IL69640A patent/IL69640A0/xx unknown
- 1983-09-03 MA MA20115A patent/MA19892A1/fr unknown
-
1984
- 1984-07-02 ES ES533932A patent/ES8503649A1/es not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| DE3372756D1 (en) | 1987-09-03 |
| US4504490A (en) | 1985-03-12 |
| DK401683A (da) | 1984-03-05 |
| EP0105196B1 (de) | 1987-07-29 |
| IL69640A0 (en) | 1983-12-30 |
| AU1867983A (en) | 1984-03-08 |
| HU193531B (en) | 1987-10-28 |
| PH19980A (en) | 1986-08-26 |
| DK401683D0 (da) | 1983-09-02 |
| ES533932A0 (es) | 1985-03-16 |
| MA19892A1 (fr) | 1984-04-01 |
| KR840006335A (ko) | 1984-11-29 |
| ES8503649A1 (es) | 1985-03-16 |
| NO833158L (no) | 1984-03-05 |
| GR78941B (enExample) | 1984-10-02 |
| EP0105196A2 (de) | 1984-04-11 |
| CA1214182A (en) | 1986-11-18 |
| ES8500898A1 (es) | 1984-11-01 |
| PT77285A (en) | 1983-10-01 |
| JPS5976050A (ja) | 1984-04-28 |
| EP0105196A3 (en) | 1985-04-03 |
| FI833119A7 (fi) | 1984-03-05 |
| ATE28630T1 (de) | 1987-08-15 |
| ES525335A0 (es) | 1984-11-01 |
| PT77285B (en) | 1986-04-09 |
| NZ205468A (en) | 1985-07-31 |
| ZA836515B (en) | 1984-04-25 |
| FI833119A0 (fi) | 1983-09-01 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2363351A1 (de) | Neue 2-carboalkoxyaminobenzimidazole und verfahren zu ihrer herstellung | |
| DE3247615A1 (de) | Substituierte phenylsulfonyloxybenzimidazolcarbaminate, verfahren zu ihrer herstellung und ihre verwendung als arzneimittel | |
| DE1518874C3 (de) | Benzolsulfonylharnstoffe und Verfahren zu ihrer Herstellung | |
| DE3232959A1 (de) | Substituierte benzolsulfonsaeureester, verfahren zu ihrer herstellung und ihre verwendung als arzneimittel | |
| DE3613065A1 (de) | Verwendung von 3-carbamoyl-4-hydroxy-cumarinen zur bekaempfung von parasitaeren helminthen, neue 3-carbamoyl-4-hydroxy-cumarine und ihre herstellung | |
| EP0428860B1 (de) | Substituierte (Chinolin-2-yl-methoxy)phenyl-carbonyl-harnstoffe | |
| DE2300447C2 (de) | Substituierte 3-Cyanobenzolsulfonamide, Verfahren zu deren Herstellung und diese Verbindungen enthaltende Arzneimittel | |
| DD296913A5 (de) | Substituierte (chinolin-2-yl-methoxy)phenyl-n,n'-sulfonylharnstoffe, verfahren zu ihrer herstellung und ihre verwendung in arzneimitteln | |
| CH619688A5 (enExample) | ||
| DE1181208B (de) | Verfahren zur Herstellung von N-Benzolsulfonyl-N'-cyclohexyl-harnstoffen | |
| CH630341A5 (en) | Process for the preparation of novel cyanoacetic anilide derivatives. | |
| EP0012435A2 (de) | Isoxazolderivate, Verfahren zu ihrer Herstellung, diese Verbindungen enthaltende Arzneimittel und bei dem Verfahren benötigte Zwischenprodukte | |
| DE1939895A1 (de) | Carbonamidgruppen enthaltende Arylsulfonylharnstoffe und Arylsulfonylsemicarbazide mi blutzuckersenkender Wirkung | |
| DE2230543A1 (de) | Benzolsulfonylharnstoffe und verfahren zu ihrer herstellung | |
| EP0424722B1 (de) | Substituierte (Chinolin-2-yl-methoxy)phenyl-thioharnstoffe | |
| AT395004B (de) | Verfahren zur herstellung von neuen nitrodiarylsulfoxiden | |
| DE2718871A1 (de) | Salidiuretisch wirksame 5-sulfamoyl- orthanilsaeuren und verfahren zu ihrer herstellung | |
| EP0135860A2 (de) | 6-Sulfoxyphenolderivate, ihre Herstellung und ihre Verwendung als Cytoprotektiva; Verwendung von Salicylaldehydabkömmlingen als Cytoprotektiva | |
| DE2845537A1 (de) | Benzimidazolylcarbamidsaeureester, verfahren zu ihrer herstellung sowie ihre verwendung als arzneimittel | |
| DE2304764A1 (de) | Benzoylphenylguanidine, ein verfahren zu ihrer herstellung sowie ihre verwendung als arzneimittel | |
| AT375346B (de) | Verfahren zur herstellung von neuen substituierten 1-benzoyl-2-phenylimino-imidazolidinen und von deren salzen | |
| AT395005B (de) | Verfahren zur herstellung von nitroaminodiarylsulfoxiden | |
| AT201608B (de) | Verfahren zur Herstellung von neuen Sulfonylharnstoffen | |
| AT360520B (de) | Verfahren zur herstellung von neuen thiazoli- dinderivaten und ihren salzen | |
| CH441274A (de) | Verfahren zur Herstellung von Benzolsulfonylharnstoffen |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| 8139 | Disposal/non-payment of the annual fee |