DE3210284A1 - Polycarbonatabmischungen - Google Patents
PolycarbonatabmischungenInfo
- Publication number
- DE3210284A1 DE3210284A1 DE19823210284 DE3210284A DE3210284A1 DE 3210284 A1 DE3210284 A1 DE 3210284A1 DE 19823210284 DE19823210284 DE 19823210284 DE 3210284 A DE3210284 A DE 3210284A DE 3210284 A1 DE3210284 A1 DE 3210284A1
- Authority
- DE
- Germany
- Prior art keywords
- weight
- component
- parts
- graft
- monomers
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Withdrawn
Links
- 239000000203 mixture Substances 0.000 title claims description 52
- 229920000515 polycarbonate Polymers 0.000 title claims description 32
- 239000004417 polycarbonate Substances 0.000 title claims description 32
- 239000000178 monomer Substances 0.000 claims description 45
- 229920001971 elastomer Polymers 0.000 claims description 37
- 239000005060 rubber Substances 0.000 claims description 36
- 229920000578 graft copolymer Polymers 0.000 claims description 27
- VVQNEPGJFQJSBK-UHFFFAOYSA-N Methyl methacrylate Chemical compound COC(=O)C(C)=C VVQNEPGJFQJSBK-UHFFFAOYSA-N 0.000 claims description 20
- NIXOWILDQLNWCW-UHFFFAOYSA-M Acrylate Chemical compound [O-]C(=O)C=C NIXOWILDQLNWCW-UHFFFAOYSA-M 0.000 claims description 16
- 150000001875 compounds Chemical class 0.000 claims description 13
- 229920001169 thermoplastic Polymers 0.000 claims description 13
- 229920003244 diene elastomer Polymers 0.000 claims description 12
- 239000004416 thermosoftening plastic Substances 0.000 claims description 11
- 229920001577 copolymer Polymers 0.000 claims description 10
- 125000003118 aryl group Chemical group 0.000 claims description 7
- 239000011347 resin Substances 0.000 claims description 7
- 229920005989 resin Polymers 0.000 claims description 7
- NIXOWILDQLNWCW-UHFFFAOYSA-N 2-Propenoic acid Natural products OC(=O)C=C NIXOWILDQLNWCW-UHFFFAOYSA-N 0.000 claims description 3
- CERQOIWHTDAKMF-UHFFFAOYSA-N Methacrylic acid Chemical compound CC(=C)C(O)=O CERQOIWHTDAKMF-UHFFFAOYSA-N 0.000 claims description 3
- 150000002734 metacrylic acid derivatives Chemical class 0.000 claims description 2
- 238000009757 thermoplastic moulding Methods 0.000 claims description 2
- 230000000379 polymerizing effect Effects 0.000 claims 1
- 229920000642 polymer Polymers 0.000 description 29
- 239000002245 particle Substances 0.000 description 18
- 125000005250 alkyl acrylate group Chemical group 0.000 description 16
- PPBRXRYQALVLMV-UHFFFAOYSA-N Styrene Chemical compound C=CC1=CC=CC=C1 PPBRXRYQALVLMV-UHFFFAOYSA-N 0.000 description 15
- 238000000465 moulding Methods 0.000 description 15
- 229920000126 latex Polymers 0.000 description 13
- 238000004519 manufacturing process Methods 0.000 description 12
- 239000004816 latex Substances 0.000 description 11
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 9
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 9
- -1 bis (hydroxyphenyl) ethers Bis (hydroxyphenyl) ketones bis (hydroxyphenyl) sulfoxides bis (hydroxyphenyl) sulfones Chemical class 0.000 description 9
- KAKZBPTYRLMSJV-UHFFFAOYSA-N vinyl-ethylene Natural products C=CC=C KAKZBPTYRLMSJV-UHFFFAOYSA-N 0.000 description 9
- 229920000122 acrylonitrile butadiene styrene Polymers 0.000 description 8
- 239000000839 emulsion Substances 0.000 description 8
- 238000000034 method Methods 0.000 description 8
- 230000032683 aging Effects 0.000 description 7
- 239000000243 solution Substances 0.000 description 7
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 7
- NLHHRLWOUZZQLW-UHFFFAOYSA-N Acrylonitrile Chemical compound C=CC#N NLHHRLWOUZZQLW-UHFFFAOYSA-N 0.000 description 6
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 description 6
- 229920002554 vinyl polymer Polymers 0.000 description 6
- BJELTSYBAHKXRW-UHFFFAOYSA-N 2,4,6-triallyloxy-1,3,5-triazine Chemical compound C=CCOC1=NC(OCC=C)=NC(OCC=C)=N1 BJELTSYBAHKXRW-UHFFFAOYSA-N 0.000 description 5
- 238000010559 graft polymerization reaction Methods 0.000 description 5
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 5
- 229920003229 poly(methyl methacrylate) Polymers 0.000 description 5
- 238000006116 polymerization reaction Methods 0.000 description 5
- MYRTYDVEIRVNKP-UHFFFAOYSA-N 1,2-Divinylbenzene Chemical compound C=CC1=CC=CC=C1C=C MYRTYDVEIRVNKP-UHFFFAOYSA-N 0.000 description 4
- KOMNUTZXSVSERR-UHFFFAOYSA-N 1,3,5-tris(prop-2-enyl)-1,3,5-triazinane-2,4,6-trione Chemical compound C=CCN1C(=O)N(CC=C)C(=O)N(CC=C)C1=O KOMNUTZXSVSERR-UHFFFAOYSA-N 0.000 description 4
- 150000001252 acrylic acid derivatives Chemical class 0.000 description 4
- 150000001298 alcohols Chemical class 0.000 description 4
- IISBACLAFKSPIT-UHFFFAOYSA-N bisphenol A Chemical compound C=1C=C(O)C=CC=1C(C)(C)C1=CC=C(O)C=C1 IISBACLAFKSPIT-UHFFFAOYSA-N 0.000 description 4
- 238000006243 chemical reaction Methods 0.000 description 4
- 150000001993 dienes Chemical class 0.000 description 4
- 150000002148 esters Chemical class 0.000 description 4
- 238000001746 injection moulding Methods 0.000 description 4
- 239000004926 polymethyl methacrylate Substances 0.000 description 4
- 238000002360 preparation method Methods 0.000 description 4
- 150000003839 salts Chemical class 0.000 description 4
- 238000003860 storage Methods 0.000 description 4
- FYBFGAFWCBMEDG-UHFFFAOYSA-N 1-[3,5-di(prop-2-enoyl)-1,3,5-triazinan-1-yl]prop-2-en-1-one Chemical compound C=CC(=O)N1CN(C(=O)C=C)CN(C(=O)C=C)C1 FYBFGAFWCBMEDG-UHFFFAOYSA-N 0.000 description 3
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- YGYAWVDWMABLBF-UHFFFAOYSA-N Phosgene Chemical compound ClC(Cl)=O YGYAWVDWMABLBF-UHFFFAOYSA-N 0.000 description 3
- XTXRWKRVRITETP-UHFFFAOYSA-N Vinyl acetate Chemical compound CC(=O)OC=C XTXRWKRVRITETP-UHFFFAOYSA-N 0.000 description 3
- 230000015572 biosynthetic process Effects 0.000 description 3
- 150000001735 carboxylic acids Chemical class 0.000 description 3
- 238000004132 cross linking Methods 0.000 description 3
- 239000003999 initiator Substances 0.000 description 3
- 239000000155 melt Substances 0.000 description 3
- 125000005397 methacrylic acid ester group Chemical group 0.000 description 3
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N phenol group Chemical group C1(=CC=CC=C1)O ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 3
- 229920000193 polymethacrylate Polymers 0.000 description 3
- USHAGKDGDHPEEY-UHFFFAOYSA-L potassium persulfate Chemical compound [K+].[K+].[O-]S(=O)(=O)OOS([O-])(=O)=O USHAGKDGDHPEEY-UHFFFAOYSA-L 0.000 description 3
- 150000003254 radicals Chemical class 0.000 description 3
- 238000003756 stirring Methods 0.000 description 3
- 239000000126 substance Substances 0.000 description 3
- UIAFKZKHHVMJGS-UHFFFAOYSA-N 2,4-dihydroxybenzoic acid Chemical compound OC(=O)C1=CC=C(O)C=C1O UIAFKZKHHVMJGS-UHFFFAOYSA-N 0.000 description 2
- VPWNQTHUCYMVMZ-UHFFFAOYSA-N 4,4'-sulfonyldiphenol Chemical class C1=CC(O)=CC=C1S(=O)(=O)C1=CC=C(O)C=C1 VPWNQTHUCYMVMZ-UHFFFAOYSA-N 0.000 description 2
- DBCAQXHNJOFNGC-UHFFFAOYSA-N 4-bromo-1,1,1-trifluorobutane Chemical compound FC(F)(F)CCCBr DBCAQXHNJOFNGC-UHFFFAOYSA-N 0.000 description 2
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- 229930185605 Bisphenol Natural products 0.000 description 2
- SOGAXMICEFXMKE-UHFFFAOYSA-N Butylmethacrylate Chemical compound CCCCOC(=O)C(C)=C SOGAXMICEFXMKE-UHFFFAOYSA-N 0.000 description 2
- QIGBRXMKCJKVMJ-UHFFFAOYSA-N Hydroquinone Chemical compound OC1=CC=C(O)C=C1 QIGBRXMKCJKVMJ-UHFFFAOYSA-N 0.000 description 2
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 2
- IMNFDUFMRHMDMM-UHFFFAOYSA-N N-Heptane Chemical compound CCCCCCC IMNFDUFMRHMDMM-UHFFFAOYSA-N 0.000 description 2
- ATUOYWHBWRKTHZ-UHFFFAOYSA-N Propane Chemical compound CCC ATUOYWHBWRKTHZ-UHFFFAOYSA-N 0.000 description 2
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 2
- 239000002253 acid Substances 0.000 description 2
- 125000005396 acrylic acid ester group Chemical group 0.000 description 2
- 125000005907 alkyl ester group Chemical group 0.000 description 2
- 238000000149 argon plasma sintering Methods 0.000 description 2
- 239000002585 base Substances 0.000 description 2
- QMKYBPDZANOJGF-UHFFFAOYSA-N benzene-1,3,5-tricarboxylic acid Chemical compound OC(=O)C1=CC(C(O)=O)=CC(C(O)=O)=C1 QMKYBPDZANOJGF-UHFFFAOYSA-N 0.000 description 2
- CQEYYJKEWSMYFG-UHFFFAOYSA-N butyl acrylate Chemical compound CCCCOC(=O)C=C CQEYYJKEWSMYFG-UHFFFAOYSA-N 0.000 description 2
- 230000015271 coagulation Effects 0.000 description 2
- 238000005345 coagulation Methods 0.000 description 2
- 238000013329 compounding Methods 0.000 description 2
- 238000007720 emulsion polymerization reaction Methods 0.000 description 2
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 2
- STVZJERGLQHEKB-UHFFFAOYSA-N ethylene glycol dimethacrylate Substances CC(=C)C(=O)OCCOC(=O)C(C)=C STVZJERGLQHEKB-UHFFFAOYSA-N 0.000 description 2
- 238000001125 extrusion Methods 0.000 description 2
- 230000009477 glass transition Effects 0.000 description 2
- 239000008187 granular material Substances 0.000 description 2
- 229920001519 homopolymer Polymers 0.000 description 2
- 229930195733 hydrocarbon Natural products 0.000 description 2
- 150000002430 hydrocarbons Chemical class 0.000 description 2
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 2
- 125000004464 hydroxyphenyl group Chemical group 0.000 description 2
- 239000003960 organic solvent Substances 0.000 description 2
- 239000011541 reaction mixture Substances 0.000 description 2
- GHMLBKRAJCXXBS-UHFFFAOYSA-N resorcinol Chemical compound OC1=CC=CC(O)=C1 GHMLBKRAJCXXBS-UHFFFAOYSA-N 0.000 description 2
- 239000011734 sodium Substances 0.000 description 2
- 239000007787 solid Substances 0.000 description 2
- XHGIFBQQEGRTPB-UHFFFAOYSA-N tris(prop-2-enyl) phosphate Chemical compound C=CCOP(=O)(OCC=C)OCC=C XHGIFBQQEGRTPB-UHFFFAOYSA-N 0.000 description 2
- 229920001567 vinyl ester resin Polymers 0.000 description 2
- RSWGJHLUYNHPMX-OZNCTZQZSA-N (1r)-1,4a-dimethyl-7-propan-2-yl-2,3,4,4b,5,6,10,10a-octahydrophenanthrene-1-carboxylic acid Chemical compound C12CCC(C(C)C)=CC2=CCC2C1(C)CCC[C@@]2(C)C(O)=O RSWGJHLUYNHPMX-OZNCTZQZSA-N 0.000 description 1
- VPVTXVHUJHGOCM-UHFFFAOYSA-N 2,4-bis[2-(4-hydroxyphenyl)propan-2-yl]phenol Chemical compound C=1C=C(O)C(C(C)(C)C=2C=CC(O)=CC=2)=CC=1C(C)(C)C1=CC=C(O)C=C1 VPVTXVHUJHGOCM-UHFFFAOYSA-N 0.000 description 1
- BLDLRWQLBOJPEB-UHFFFAOYSA-N 2-(2-hydroxyphenyl)sulfanylphenol Chemical class OC1=CC=CC=C1SC1=CC=CC=C1O BLDLRWQLBOJPEB-UHFFFAOYSA-N 0.000 description 1
- WHBAYNMEIXUTJV-UHFFFAOYSA-N 2-chloroethyl prop-2-enoate Chemical compound ClCCOC(=O)C=C WHBAYNMEIXUTJV-UHFFFAOYSA-N 0.000 description 1
- JJYWRQLLQAKNAD-UHFFFAOYSA-N 2-methylpent-2-enoic acid Chemical compound CCC=C(C)C(O)=O JJYWRQLLQAKNAD-UHFFFAOYSA-N 0.000 description 1
- AGBXYHCHUYARJY-UHFFFAOYSA-N 2-phenylethenesulfonic acid Chemical compound OS(=O)(=O)C=CC1=CC=CC=C1 AGBXYHCHUYARJY-UHFFFAOYSA-N 0.000 description 1
- HPSGLFKWHYAKSF-UHFFFAOYSA-N 2-phenylethyl prop-2-enoate Chemical compound C=CC(=O)OCCC1=CC=CC=C1 HPSGLFKWHYAKSF-UHFFFAOYSA-N 0.000 description 1
- VEORPZCZECFIRK-UHFFFAOYSA-N 3,3',5,5'-tetrabromobisphenol A Chemical compound C=1C(Br)=C(O)C(Br)=CC=1C(C)(C)C1=CC(Br)=C(O)C(Br)=C1 VEORPZCZECFIRK-UHFFFAOYSA-N 0.000 description 1
- ZEKCYPANSOJWDH-UHFFFAOYSA-N 3,3-bis(4-hydroxy-3-methylphenyl)-1H-indol-2-one Chemical compound C1=C(O)C(C)=CC(C2(C3=CC=CC=C3NC2=O)C=2C=C(C)C(O)=CC=2)=C1 ZEKCYPANSOJWDH-UHFFFAOYSA-N 0.000 description 1
- BRPSWMCDEYMRPE-UHFFFAOYSA-N 4-[1,1-bis(4-hydroxyphenyl)ethyl]phenol Chemical compound C=1C=C(O)C=CC=1C(C=1C=CC(O)=CC=1)(C)C1=CC=C(O)C=C1 BRPSWMCDEYMRPE-UHFFFAOYSA-N 0.000 description 1
- JSPTXDCKISSGBM-UHFFFAOYSA-N 4-[2-(4,4-dihydroxycyclohexa-1,5-dien-1-yl)-1,1-diphenylpropan-2-yl]cyclohexa-2,4-diene-1,1-diol;4-[1-(4-hydroxyphenyl)cyclohexyl]phenol;4-[3-(4-hydroxyphenyl)-3-methylbutyl]phenol Chemical compound C=1C=C(O)C=CC=1C(C)(C)CCC1=CC=C(O)C=C1.C1=CC(O)=CC=C1C1(C=2C=CC(O)=CC=2)CCCCC1.C=1CC(O)(O)C=CC=1C(C=1C=CC(O)(O)CC=1)(C)C(C=1C=CC=CC=1)C1=CC=CC=C1 JSPTXDCKISSGBM-UHFFFAOYSA-N 0.000 description 1
- XXOBZOBRMJZVDG-UHFFFAOYSA-N 4-[3,4-bis(4-hydroxyphenyl)phenyl]phenol Chemical compound C1=CC(O)=CC=C1C(C=C1C=2C=CC(O)=CC=2)=CC=C1C1=CC=C(O)C=C1 XXOBZOBRMJZVDG-UHFFFAOYSA-N 0.000 description 1
- BOCLKUCIZOXUEY-UHFFFAOYSA-N 4-[tris(4-hydroxyphenyl)methyl]phenol Chemical compound C1=CC(O)=CC=C1C(C=1C=CC(O)=CC=1)(C=1C=CC(O)=CC=1)C1=CC=C(O)C=C1 BOCLKUCIZOXUEY-UHFFFAOYSA-N 0.000 description 1
- 125000004203 4-hydroxyphenyl group Chemical group [H]OC1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 1
- SDDLEVPIDBLVHC-UHFFFAOYSA-N Bisphenol Z Chemical compound C1=CC(O)=CC=C1C1(C=2C=CC(O)=CC=2)CCCCC1 SDDLEVPIDBLVHC-UHFFFAOYSA-N 0.000 description 1
- 239000004971 Cross linker Substances 0.000 description 1
- RWSOTUBLDIXVET-UHFFFAOYSA-N Dihydrogen sulfide Chemical class S RWSOTUBLDIXVET-UHFFFAOYSA-N 0.000 description 1
- KCXVZYZYPLLWCC-UHFFFAOYSA-N EDTA Chemical compound OC(=O)CN(CC(O)=O)CCN(CC(O)=O)CC(O)=O KCXVZYZYPLLWCC-UHFFFAOYSA-N 0.000 description 1
- CERQOIWHTDAKMF-UHFFFAOYSA-M Methacrylate Chemical compound CC(=C)C([O-])=O CERQOIWHTDAKMF-UHFFFAOYSA-M 0.000 description 1
- JPYHHZQJCSQRJY-UHFFFAOYSA-N Phloroglucinol Natural products CCC=CCC=CCC=CCC=CCCCCC(=O)C1=C(O)C=C(O)C=C1O JPYHHZQJCSQRJY-UHFFFAOYSA-N 0.000 description 1
- 229920001283 Polyalkylene terephthalate Polymers 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 1
- 239000012963 UV stabilizer Substances 0.000 description 1
- YMOONIIMQBGTDU-VOTSOKGWSA-N [(e)-2-bromoethenyl]benzene Chemical compound Br\C=C\C1=CC=CC=C1 YMOONIIMQBGTDU-VOTSOKGWSA-N 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 229920000800 acrylic rubber Polymers 0.000 description 1
- 239000012190 activator Substances 0.000 description 1
- 150000001335 aliphatic alkanes Chemical class 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- 125000000217 alkyl group Chemical group 0.000 description 1
- 125000001118 alkylidene group Chemical group 0.000 description 1
- 125000005399 allylmethacrylate group Chemical group 0.000 description 1
- 239000003963 antioxidant agent Substances 0.000 description 1
- 239000008346 aqueous phase Substances 0.000 description 1
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 1
- GCTPMLUUWLLESL-UHFFFAOYSA-N benzyl prop-2-enoate Chemical compound C=CC(=O)OCC1=CC=CC=C1 GCTPMLUUWLLESL-UHFFFAOYSA-N 0.000 description 1
- 229940114055 beta-resorcylic acid Drugs 0.000 description 1
- 238000009529 body temperature measurement Methods 0.000 description 1
- 238000012662 bulk polymerization Methods 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- 239000004927 clay Substances 0.000 description 1
- 230000000052 comparative effect Effects 0.000 description 1
- 239000008139 complexing agent Substances 0.000 description 1
- 239000002131 composite material Substances 0.000 description 1
- 229940125904 compound 1 Drugs 0.000 description 1
- 238000010276 construction Methods 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 150000007973 cyanuric acids Chemical class 0.000 description 1
- MGNCLNQXLYJVJD-UHFFFAOYSA-N cyanuric chloride Chemical compound ClC1=NC(Cl)=NC(Cl)=N1 MGNCLNQXLYJVJD-UHFFFAOYSA-N 0.000 description 1
- 150000001923 cyclic compounds Chemical class 0.000 description 1
- 150000001924 cycloalkanes Chemical class 0.000 description 1
- ROORDVPLFPIABK-UHFFFAOYSA-N diphenyl carbonate Chemical compound C=1C=CC=CC=1OC(=O)OC1=CC=CC=C1 ROORDVPLFPIABK-UHFFFAOYSA-N 0.000 description 1
- 239000006185 dispersion Substances 0.000 description 1
- WNAHIZMDSQCWRP-UHFFFAOYSA-N dodecane-1-thiol Chemical compound CCCCCCCCCCCCS WNAHIZMDSQCWRP-UHFFFAOYSA-N 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 239000000975 dye Substances 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 239000000806 elastomer Substances 0.000 description 1
- 238000001941 electron spectroscopy Methods 0.000 description 1
- 239000003995 emulsifying agent Substances 0.000 description 1
- SUPCQIBBMFXVTL-UHFFFAOYSA-N ethyl 2-methylprop-2-enoate Chemical compound CCOC(=O)C(C)=C SUPCQIBBMFXVTL-UHFFFAOYSA-N 0.000 description 1
- 229940071106 ethylenediaminetetraacetate Drugs 0.000 description 1
- 238000010528 free radical solution polymerization reaction Methods 0.000 description 1
- 239000007789 gas Substances 0.000 description 1
- 125000001188 haloalkyl group Chemical group 0.000 description 1
- LNMQRPPRQDGUDR-UHFFFAOYSA-N hexyl prop-2-enoate Chemical compound CCCCCCOC(=O)C=C LNMQRPPRQDGUDR-UHFFFAOYSA-N 0.000 description 1
- 238000004898 kneading Methods 0.000 description 1
- 239000000314 lubricant Substances 0.000 description 1
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 1
- 235000019341 magnesium sulphate Nutrition 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- VIJMMQUAJQEELS-UHFFFAOYSA-N n,n-bis(ethenyl)ethenamine Chemical compound C=CN(C=C)C=C VIJMMQUAJQEELS-UHFFFAOYSA-N 0.000 description 1
- 229910052757 nitrogen Inorganic materials 0.000 description 1
- QJGQUHMNIGDVPM-UHFFFAOYSA-N nitrogen group Chemical group [N] QJGQUHMNIGDVPM-UHFFFAOYSA-N 0.000 description 1
- 125000002347 octyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 239000012074 organic phase Substances 0.000 description 1
- 239000001301 oxygen Substances 0.000 description 1
- 229910052760 oxygen Inorganic materials 0.000 description 1
- PNJWIWWMYCMZRO-UHFFFAOYSA-N pent‐4‐en‐2‐one Natural products CC(=O)CC=C PNJWIWWMYCMZRO-UHFFFAOYSA-N 0.000 description 1
- 150000002978 peroxides Chemical class 0.000 description 1
- 239000012071 phase Substances 0.000 description 1
- QIWKUEJZZCOPFV-UHFFFAOYSA-N phenyl 2-methylprop-2-enoate Chemical compound CC(=C)C(=O)OC1=CC=CC=C1 QIWKUEJZZCOPFV-UHFFFAOYSA-N 0.000 description 1
- QCDYQQDYXPDABM-UHFFFAOYSA-N phloroglucinol Chemical compound OC1=CC(O)=CC(O)=C1 QCDYQQDYXPDABM-UHFFFAOYSA-N 0.000 description 1
- 229960001553 phloroglucinol Drugs 0.000 description 1
- 150000003014 phosphoric acid esters Chemical class 0.000 description 1
- 239000000049 pigment Substances 0.000 description 1
- 239000004014 plasticizer Substances 0.000 description 1
- 229920000058 polyacrylate Polymers 0.000 description 1
- 229920002857 polybutadiene Polymers 0.000 description 1
- 229920000728 polyester Polymers 0.000 description 1
- 229920002959 polymer blend Polymers 0.000 description 1
- 229920005862 polyol Polymers 0.000 description 1
- 150000003077 polyols Chemical class 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- FBCQUCJYYPMKRO-UHFFFAOYSA-N prop-2-enyl 2-methylprop-2-enoate Chemical compound CC(=C)C(=O)OCC=C FBCQUCJYYPMKRO-UHFFFAOYSA-N 0.000 description 1
- 239000001294 propane Substances 0.000 description 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 238000010526 radical polymerization reaction Methods 0.000 description 1
- 230000001105 regulatory effect Effects 0.000 description 1
- 238000001694 spray drying Methods 0.000 description 1
- 239000003381 stabilizer Substances 0.000 description 1
- BDHFUVZGWQCTTF-UHFFFAOYSA-M sulfonate Chemical compound [O-]S(=O)=O BDHFUVZGWQCTTF-UHFFFAOYSA-M 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 1
- 238000012719 thermal polymerization Methods 0.000 description 1
- 239000003017 thermal stabilizer Substances 0.000 description 1
- 239000012815 thermoplastic material Substances 0.000 description 1
- 238000005809 transesterification reaction Methods 0.000 description 1
- NLVXSWCKKBEXTG-UHFFFAOYSA-N vinylsulfonic acid Chemical compound OS(=O)(=O)C=C NLVXSWCKKBEXTG-UHFFFAOYSA-N 0.000 description 1
- 238000009736 wetting Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08L—COMPOSITIONS OF MACROMOLECULAR COMPOUNDS
- C08L69/00—Compositions of polycarbonates; Compositions of derivatives of polycarbonates
-
- Y—GENERAL TAGGING OF NEW TECHNOLOGICAL DEVELOPMENTS; GENERAL TAGGING OF CROSS-SECTIONAL TECHNOLOGIES SPANNING OVER SEVERAL SECTIONS OF THE IPC; TECHNICAL SUBJECTS COVERED BY FORMER USPC CROSS-REFERENCE ART COLLECTIONS [XRACs] AND DIGESTS
- Y10—TECHNICAL SUBJECTS COVERED BY FORMER USPC
- Y10S—TECHNICAL SUBJECTS COVERED BY FORMER USPC CROSS-REFERENCE ART COLLECTIONS [XRACs] AND DIGESTS
- Y10S525/00—Synthetic resins or natural rubbers -- part of the class 520 series
- Y10S525/902—Core-shell
Landscapes
- Chemical & Material Sciences (AREA)
- Health & Medical Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Medicinal Chemistry (AREA)
- Polymers & Plastics (AREA)
- Organic Chemistry (AREA)
- Compositions Of Macromolecular Compounds (AREA)
- Graft Or Block Polymers (AREA)
Priority Applications (7)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19823210284 DE3210284A1 (de) | 1982-03-20 | 1982-03-20 | Polycarbonatabmischungen |
| EP83102203A EP0089540A1 (de) | 1982-03-20 | 1983-03-07 | Polycarbonatabmischungen |
| US06/473,756 US4461868A (en) | 1982-03-20 | 1983-03-09 | Mixture of a thermoplastic polymer of an alkyl methacrylate and a graft polymer of methyl methacrylate onto crosslinked alkyl acrylate rubber |
| AU12461/83A AU551201B2 (en) | 1982-03-20 | 1983-03-15 | Polycarbonate mixtures |
| JP58042473A JPS58168652A (ja) | 1982-03-20 | 1983-03-16 | ポリカ−ボネ−ト混合物 |
| ES520779A ES520779A0 (es) | 1982-03-20 | 1983-03-18 | Procedimiento para la obtencion de composiciones de moldeo termoplasticas a base de policarbonatos. |
| CA000423901A CA1189217A (en) | 1982-03-20 | 1983-03-18 | Polycarbonate mixtures containing thermoplastic alkyl methacrylate polymer and a graft of methyl methacrylate onto a particulate acrylate rubber |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19823210284 DE3210284A1 (de) | 1982-03-20 | 1982-03-20 | Polycarbonatabmischungen |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE3210284A1 true DE3210284A1 (de) | 1983-09-29 |
Family
ID=6158837
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19823210284 Withdrawn DE3210284A1 (de) | 1982-03-20 | 1982-03-20 | Polycarbonatabmischungen |
Country Status (7)
| Country | Link |
|---|---|
| US (1) | US4461868A (OSRAM) |
| EP (1) | EP0089540A1 (OSRAM) |
| JP (1) | JPS58168652A (OSRAM) |
| AU (1) | AU551201B2 (OSRAM) |
| CA (1) | CA1189217A (OSRAM) |
| DE (1) | DE3210284A1 (OSRAM) |
| ES (1) | ES520779A0 (OSRAM) |
Cited By (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE3325702A1 (de) * | 1982-07-26 | 1984-01-26 | Mobay Chemical Corp., 15205 Pittsburgh, Pa. | Gemische aus polycarbonat und acrylnitril/butadien/styrol mit verbesserter schlagzaehigkeit |
| DE3424554A1 (de) * | 1983-07-13 | 1985-01-24 | Mobay Chemical Corp., Pittsburgh, Pa. | Polycarbonat und ein bestimmtes abs-harz enthaltende formmassen |
Families Citing this family (29)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4503183A (en) * | 1982-01-29 | 1985-03-05 | Martin B. Barancik | Polycarbonate resin molding composition |
| US4554309A (en) * | 1982-12-27 | 1985-11-19 | General Electric Company | Polycarbonate from cycloalkylidene tetra alkyl substituted diphenol |
| IE57758B1 (en) * | 1983-08-31 | 1993-03-24 | Mitsubishi Rayon Co | Impact modifier and thermoplastic resin compositions using the same |
| DE3414119A1 (de) * | 1984-04-14 | 1985-10-24 | Basf Ag, 6700 Ludwigshafen | Thermoplastische formmassen |
| DE3414118A1 (de) * | 1984-04-14 | 1985-10-24 | Basf Ag, 6700 Ludwigshafen | Thermoplastische formmassen |
| EP0164477A1 (en) * | 1984-06-14 | 1985-12-18 | General Electric Company | Polycarbonates exhibiting improved heat resistance |
| NL8402555A (nl) * | 1984-08-20 | 1986-03-17 | Gen Electric | Polymeermengsel, dat een aromatisch polycarbonaat hars en een slagsterkte verbeterend middel bevat. |
| DE3447249A1 (de) * | 1984-12-22 | 1986-07-03 | Bayer Ag, 5090 Leverkusen | Kerbschlagzaehe thermoplastformmassen |
| DE3622736A1 (de) * | 1986-07-05 | 1988-01-07 | Bayer Ag | Thermoplastische formmassen aus vinylchloridpolymerisaten und pfropfpolymerisaten mit verbesserten eigenschaften |
| CA1332992C (en) * | 1986-08-27 | 1994-11-08 | Susan Marie Liwak | Impact-strength modifiers for thermoplastic polymers |
| DE3631539A1 (de) * | 1986-09-17 | 1988-03-24 | Bayer Ag | Alterungsbestaendige thermoplastische formmassen mit guter zaehigkeit |
| US4745029A (en) * | 1986-10-06 | 1988-05-17 | General Electric Company | Transparent blends of polymethyl methacrylate and BPA polycarbonate |
| DE3737637A1 (de) * | 1987-11-06 | 1989-05-18 | Bayer Ag | Mischungen von polycarbonaten mit siloxanhaltigen pfropfpolymerisaten |
| US4866125A (en) * | 1988-12-19 | 1989-09-12 | Polysar Financial Services S.A. | Styrenic polycarbonate alloys |
| US4940752A (en) * | 1988-12-19 | 1990-07-10 | Polysar Financial Services S.A. | Styrenic polycarbonate alloys |
| US5049619A (en) * | 1989-04-14 | 1991-09-17 | Edison Polymer Innovation Corporation | Polymeric alloys |
| US5112909A (en) * | 1989-05-04 | 1992-05-12 | Cyro Industries | Blends of polymers particularly polycarbonates acrylate-modified rubber compositions and additional polyacrylates |
| US5128409A (en) * | 1989-06-21 | 1992-07-07 | General Electric Company | Polycarbonate/graft ABS blends with improved weld line strength |
| DE3939046A1 (de) * | 1989-11-25 | 1991-05-29 | Basf Ag | Thermoplastische formmassen mit hoher kaeltezaehigkeit |
| MX9102498A (es) * | 1990-12-14 | 1993-01-01 | Cyro Ind | Mezclas de multipolimeros de acrilico modificados con caucho, u policarbonatos; y metodo para la fabricacion de las mismas. |
| JPH0712767U (ja) * | 1993-06-30 | 1995-03-03 | 象印マホービン株式会社 | 蓄熱装置 |
| ES2290309T3 (es) | 2001-06-13 | 2008-02-16 | Beta Technologie Ag | Reactores de polimerizacion en masa y metodos de polimerizacion. |
| US20050245645A1 (en) * | 2004-05-03 | 2005-11-03 | General Electric Company | Special visual effect thermoplastic compositions, articles made therefrom, and method |
| US7365125B2 (en) * | 2004-08-16 | 2008-04-29 | General Electric Company | Polycarbonate compositions, articles, and method of manufacture |
| US7432327B2 (en) * | 2004-12-30 | 2008-10-07 | Sabic Innovative Plastics Ip B.V. | Transparent polymeric compositions comprising polysiloxane-polycarbonate copolymer, articles made therefrom and methods of making same |
| US8030400B2 (en) * | 2006-08-01 | 2011-10-04 | Sabic Innovative Plastics Ip B.V. | Thermoplastic polycarbonate compositions with improved chemical and scratch resistance |
| US8871865B2 (en) * | 2006-08-01 | 2014-10-28 | Sabic Global Technologies B.V. | Flame retardant thermoplastic polycarbonate compositions |
| US20090124749A1 (en) * | 2007-11-09 | 2009-05-14 | Sabic Innovative Plastics Ip Bv | Scratch resistant polycarbonate compositions |
| JP6314549B2 (ja) * | 2014-03-06 | 2018-04-25 | ユーエムジー・エービーエス株式会社 | 熱可塑性樹脂組成物及び樹脂成形品 |
Family Cites Families (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB1182807A (en) * | 1967-08-03 | 1970-03-04 | Ici Ltd | Thermoplastic Polymeric Compositions |
| JPS4829308B1 (OSRAM) * | 1969-07-31 | 1973-09-08 | ||
| US3742088A (en) * | 1971-01-07 | 1973-06-26 | Texaco Inc | Polycarbonate resins blended with elastomers for improved impact strength |
| US3988389A (en) * | 1972-12-06 | 1976-10-26 | Bayer Aktiengesellschaft | Moulding compositions contain polycarbonate and graft copolymer of a resin forming monomer on a rubber |
| DE3006804A1 (de) * | 1980-02-23 | 1981-09-10 | Bayer Ag, 5090 Leverkusen | Kerbschlagzaehe polymerisate mit verbesserter witterungsbestaendigkeit |
| US4299928A (en) * | 1980-03-14 | 1981-11-10 | Mobay Chemical Corporation | Impact modified polycarbonates |
-
1982
- 1982-03-20 DE DE19823210284 patent/DE3210284A1/de not_active Withdrawn
-
1983
- 1983-03-07 EP EP83102203A patent/EP0089540A1/de not_active Withdrawn
- 1983-03-09 US US06/473,756 patent/US4461868A/en not_active Expired - Fee Related
- 1983-03-15 AU AU12461/83A patent/AU551201B2/en not_active Ceased
- 1983-03-16 JP JP58042473A patent/JPS58168652A/ja active Granted
- 1983-03-18 ES ES520779A patent/ES520779A0/es active Granted
- 1983-03-18 CA CA000423901A patent/CA1189217A/en not_active Expired
Cited By (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE3325702A1 (de) * | 1982-07-26 | 1984-01-26 | Mobay Chemical Corp., 15205 Pittsburgh, Pa. | Gemische aus polycarbonat und acrylnitril/butadien/styrol mit verbesserter schlagzaehigkeit |
| DE3424554A1 (de) * | 1983-07-13 | 1985-01-24 | Mobay Chemical Corp., Pittsburgh, Pa. | Polycarbonat und ein bestimmtes abs-harz enthaltende formmassen |
Also Published As
| Publication number | Publication date |
|---|---|
| AU551201B2 (en) | 1986-04-17 |
| JPS58168652A (ja) | 1983-10-05 |
| US4461868A (en) | 1984-07-24 |
| ES8402007A1 (es) | 1984-01-01 |
| ES520779A0 (es) | 1984-01-01 |
| AU1246183A (en) | 1983-09-22 |
| CA1189217A (en) | 1985-06-18 |
| JPS6218578B2 (OSRAM) | 1987-04-23 |
| EP0089540A1 (de) | 1983-09-28 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE3210284A1 (de) | Polycarbonatabmischungen | |
| EP0164513B1 (de) | Thermoplastische Formmassen | |
| DE2329585C2 (de) | Polycarbonat-Formmassen | |
| DE2653143C2 (de) | Thermoplastische Formmassen | |
| DE2712171A1 (de) | Thermoplastische formmassen | |
| DE2329646A1 (de) | Transparente formmassen | |
| DE2653146A1 (de) | Thermoplastische formmassen | |
| DE69920200T2 (de) | Kompatibilisierte abs-polycarbonat-formmasse | |
| EP0445601A1 (de) | Teilchenförmiges Pfropfpolymerisat mit verbesserter Haftung zwischen Pfropfgrundlage und Pfropfhülle | |
| DE3039115A1 (de) | Thermoplastische polyester-formmassen mit verbesserter zaehigkeit | |
| EP0312929A2 (de) | Thermoplastische Formmasse, Verfahren zu ihrer Herstellung und deren Verwendung | |
| EP0535456A1 (de) | Mehrschaliges Pfropfcopolymerisat | |
| DE4342045A1 (de) | Dreistufige Pfropfcopolymerisate und solche enthaltende witterungsbeständige, matte thermoplastische Formmassen mit hoher Kältezähigkeit | |
| DE3325702C2 (OSRAM) | ||
| DE4342048A1 (de) | Dreistufige Pfropfcopolymerisate und solche enthaltende thermoplastische Formmassen mit hoher Zähigkeit | |
| EP0548762A1 (de) | Schlagzähmodifier und diesen enthaltende Formmasse | |
| DE2116653A1 (de) | Mehrphasiges Verbundcopolymeres und daraus herstellbare schlagzähe thermoplastische Massen mit geringer Trübungsneigung | |
| DE2717165A1 (de) | Thermoplastische formmassen aus polycarbonaten und abs-polymerisaten | |
| EP0174503B1 (de) | Acrylnitrilfreie Blends aus Polycarbonat, Methylmethacrylat, Pfropfkautschuk und einem Terpolymerisatharz | |
| EP0096301A2 (de) | Einphasige Polymermischungen | |
| EP0725091B1 (de) | Formmassen mit verbesserter Tieftemperaturzähigkeit | |
| DE3430688A1 (de) | Acrylnitrilfreie polycarbonat blends | |
| EP0659196B1 (de) | Formmasse | |
| EP0601473B1 (de) | Thermoplastische Formmassen auf der Basis von Polycarbonaten, Pfropfpolymerisaten und Styrol/Acrylnitril-Copolymerisaten | |
| DE3326562A1 (de) | Polycarbonat-gemische mit verbesserter schlagzaehigkeit |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| 8130 | Withdrawal |