DE3124410A1 - Verfahren zur herstellung von isosorbid-2-nitrat - Google Patents
Verfahren zur herstellung von isosorbid-2-nitratInfo
- Publication number
- DE3124410A1 DE3124410A1 DE19813124410 DE3124410A DE3124410A1 DE 3124410 A1 DE3124410 A1 DE 3124410A1 DE 19813124410 DE19813124410 DE 19813124410 DE 3124410 A DE3124410 A DE 3124410A DE 3124410 A1 DE3124410 A1 DE 3124410A1
- Authority
- DE
- Germany
- Prior art keywords
- isosorbide
- acylate
- nitrate
- anhydride
- carboxylic acid
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Withdrawn
Links
- YWXYYJSYQOXTPL-JGWLITMVSA-N [(3r,3ar,6s,6as)-3-hydroxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] nitrate Chemical compound [O-][N+](=O)O[C@H]1CO[C@@H]2[C@H](O)CO[C@@H]21 YWXYYJSYQOXTPL-JGWLITMVSA-N 0.000 title claims abstract description 12
- 238000004519 manufacturing process Methods 0.000 title claims description 10
- 229960002479 isosorbide Drugs 0.000 claims abstract description 53
- KLDXJTOLSGUMSJ-JGWLITMVSA-N Isosorbide Chemical compound O[C@@H]1CO[C@@H]2[C@@H](O)CO[C@@H]21 KLDXJTOLSGUMSJ-JGWLITMVSA-N 0.000 claims abstract description 41
- 238000000034 method Methods 0.000 claims abstract description 32
- 229910002651 NO3 Inorganic materials 0.000 claims abstract description 15
- 150000003839 salts Chemical class 0.000 claims abstract description 13
- 150000001244 carboxylic acid anhydrides Chemical class 0.000 claims abstract description 10
- GRYLNZFGIOXLOG-UHFFFAOYSA-N Nitric acid Chemical compound O[N+]([O-])=O GRYLNZFGIOXLOG-UHFFFAOYSA-N 0.000 claims abstract description 8
- 229910052751 metal Inorganic materials 0.000 claims abstract description 8
- 239000002184 metal Substances 0.000 claims abstract description 8
- 229910017604 nitric acid Inorganic materials 0.000 claims abstract description 8
- 229910052783 alkali metal Inorganic materials 0.000 claims abstract description 3
- 150000001340 alkali metals Chemical class 0.000 claims abstract description 3
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 claims description 18
- 238000006243 chemical reaction Methods 0.000 claims description 18
- -1 aromatic carboxylic acids Chemical class 0.000 claims description 17
- 230000010933 acylation Effects 0.000 claims description 16
- 238000005917 acylation reaction Methods 0.000 claims description 16
- 238000005809 transesterification reaction Methods 0.000 claims description 10
- 150000008064 anhydrides Chemical class 0.000 claims description 9
- 239000003054 catalyst Substances 0.000 claims description 7
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 claims description 6
- 230000015572 biosynthetic process Effects 0.000 claims description 6
- 238000006396 nitration reaction Methods 0.000 claims description 5
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 claims description 4
- 125000004432 carbon atom Chemical group C* 0.000 claims description 4
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 claims description 3
- 229910052788 barium Inorganic materials 0.000 claims description 3
- DSAJWYNOEDNPEQ-UHFFFAOYSA-N barium atom Chemical compound [Ba] DSAJWYNOEDNPEQ-UHFFFAOYSA-N 0.000 claims description 3
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid Chemical compound OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 claims description 3
- 229910052797 bismuth Inorganic materials 0.000 claims description 3
- JCXGWMGPZLAOME-UHFFFAOYSA-N bismuth atom Chemical compound [Bi] JCXGWMGPZLAOME-UHFFFAOYSA-N 0.000 claims description 3
- 238000000605 extraction Methods 0.000 claims description 3
- QSHDDOUJBYECFT-UHFFFAOYSA-N mercury Chemical compound [Hg] QSHDDOUJBYECFT-UHFFFAOYSA-N 0.000 claims description 3
- 229910052753 mercury Inorganic materials 0.000 claims description 3
- 238000001953 recrystallisation Methods 0.000 claims description 3
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 claims description 2
- BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate Chemical compound [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 claims description 2
- NHNBFGGVMKEFGY-UHFFFAOYSA-N Nitrate Chemical compound [O-][N+]([O-])=O NHNBFGGVMKEFGY-UHFFFAOYSA-N 0.000 claims description 2
- 229910019142 PO4 Inorganic materials 0.000 claims description 2
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 claims description 2
- ATJFFYVFTNAWJD-UHFFFAOYSA-N Tin Chemical compound [Sn] ATJFFYVFTNAWJD-UHFFFAOYSA-N 0.000 claims description 2
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 claims description 2
- 229910052793 cadmium Inorganic materials 0.000 claims description 2
- BDOSMKKIYDKNTQ-UHFFFAOYSA-N cadmium atom Chemical compound [Cd] BDOSMKKIYDKNTQ-UHFFFAOYSA-N 0.000 claims description 2
- 229910052791 calcium Inorganic materials 0.000 claims description 2
- 239000011575 calcium Substances 0.000 claims description 2
- 150000001735 carboxylic acids Chemical class 0.000 claims description 2
- 229910017052 cobalt Inorganic materials 0.000 claims description 2
- 239000010941 cobalt Substances 0.000 claims description 2
- GUTLYIVDDKVIGB-UHFFFAOYSA-N cobalt atom Chemical compound [Co] GUTLYIVDDKVIGB-UHFFFAOYSA-N 0.000 claims description 2
- 238000004821 distillation Methods 0.000 claims description 2
- 229910052738 indium Inorganic materials 0.000 claims description 2
- APFVFJFRJDLVQX-UHFFFAOYSA-N indium atom Chemical compound [In] APFVFJFRJDLVQX-UHFFFAOYSA-N 0.000 claims description 2
- 229910052742 iron Inorganic materials 0.000 claims description 2
- 229910052747 lanthanoid Inorganic materials 0.000 claims description 2
- 150000002602 lanthanoids Chemical class 0.000 claims description 2
- 150000002739 metals Chemical class 0.000 claims description 2
- 230000000737 periodic effect Effects 0.000 claims description 2
- 229910052700 potassium Inorganic materials 0.000 claims description 2
- 239000011591 potassium Substances 0.000 claims description 2
- 229910052708 sodium Inorganic materials 0.000 claims description 2
- 239000011734 sodium Substances 0.000 claims description 2
- 229910052712 strontium Inorganic materials 0.000 claims description 2
- CIOAGBVUUVVLOB-UHFFFAOYSA-N strontium atom Chemical compound [Sr] CIOAGBVUUVVLOB-UHFFFAOYSA-N 0.000 claims description 2
- 229910052716 thallium Inorganic materials 0.000 claims description 2
- BKVIYDNLLOSFOA-UHFFFAOYSA-N thallium Chemical compound [Tl] BKVIYDNLLOSFOA-UHFFFAOYSA-N 0.000 claims description 2
- 229910052718 tin Inorganic materials 0.000 claims description 2
- 229910052725 zinc Inorganic materials 0.000 claims description 2
- 239000011701 zinc Substances 0.000 claims description 2
- 150000007933 aliphatic carboxylic acids Chemical class 0.000 claims 3
- JRQMCPMJDNVZDZ-UHFFFAOYSA-N (2,3,4-trimethylbenzoyl) 2,3,4-trimethylbenzoate Chemical compound CC1=C(C)C(C)=CC=C1C(=O)OC(=O)C1=CC=C(C)C(C)=C1C JRQMCPMJDNVZDZ-UHFFFAOYSA-N 0.000 claims 1
- AXHLTKQEAUZHIO-UHFFFAOYSA-N (2,3-dimethylbenzoyl) 2,3-dimethylbenzoate Chemical compound CC1=CC=CC(C(=O)OC(=O)C=2C(=C(C)C=CC=2)C)=C1C AXHLTKQEAUZHIO-UHFFFAOYSA-N 0.000 claims 1
- SOFDTMPXXZJJMJ-UHFFFAOYSA-N (2-nitrobenzoyl) 2-nitrobenzoate Chemical compound [O-][N+](=O)C1=CC=CC=C1C(=O)OC(=O)C1=CC=CC=C1[N+]([O-])=O SOFDTMPXXZJJMJ-UHFFFAOYSA-N 0.000 claims 1
- NOGFHTGYPKWWRX-UHFFFAOYSA-N 2,2,6,6-tetramethyloxan-4-one Chemical compound CC1(C)CC(=O)CC(C)(C)O1 NOGFHTGYPKWWRX-UHFFFAOYSA-N 0.000 claims 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 claims 1
- 150000008065 acid anhydrides Chemical class 0.000 claims 1
- 125000005587 carbonate group Chemical group 0.000 claims 1
- NBIIXXVUZAFLBC-UHFFFAOYSA-K phosphate Chemical compound [O-]P([O-])([O-])=O NBIIXXVUZAFLBC-UHFFFAOYSA-K 0.000 claims 1
- 239000010452 phosphate Substances 0.000 claims 1
- 238000002360 preparation method Methods 0.000 abstract description 2
- 125000005233 alkylalcohol group Chemical group 0.000 abstract 1
- 239000000203 mixture Substances 0.000 description 28
- WFDIJRYMOXRFFG-UHFFFAOYSA-N Acetic anhydride Chemical compound CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 description 15
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 15
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 11
- 239000000047 product Substances 0.000 description 10
- 238000002955 isolation Methods 0.000 description 8
- 229960000201 isosorbide dinitrate Drugs 0.000 description 8
- MOYKHGMNXAOIAT-JGWLITMVSA-N isosorbide dinitrate Chemical compound [O-][N+](=O)O[C@H]1CO[C@@H]2[C@H](O[N+](=O)[O-])CO[C@@H]21 MOYKHGMNXAOIAT-JGWLITMVSA-N 0.000 description 8
- 239000002904 solvent Substances 0.000 description 8
- 239000000126 substance Substances 0.000 description 8
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 6
- FERIUCNNQQJTOY-UHFFFAOYSA-N Butyric acid Chemical compound CCCC(O)=O FERIUCNNQQJTOY-UHFFFAOYSA-N 0.000 description 6
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 6
- XBDQKXXYIPTUBI-UHFFFAOYSA-N dimethylselenoniopropionate Natural products CCC(O)=O XBDQKXXYIPTUBI-UHFFFAOYSA-N 0.000 description 6
- 239000002253 acid Substances 0.000 description 5
- 238000001816 cooling Methods 0.000 description 5
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 5
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 4
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 4
- WQDUMFSSJAZKTM-UHFFFAOYSA-N Sodium methoxide Chemical compound [Na+].[O-]C WQDUMFSSJAZKTM-UHFFFAOYSA-N 0.000 description 4
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 4
- 230000000694 effects Effects 0.000 description 4
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 3
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 3
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 3
- 230000002378 acidificating effect Effects 0.000 description 3
- 125000002252 acyl group Chemical group 0.000 description 3
- 239000007795 chemical reaction product Substances 0.000 description 3
- 150000001875 compounds Chemical class 0.000 description 3
- 238000009826 distribution Methods 0.000 description 3
- 230000032050 esterification Effects 0.000 description 3
- 238000005886 esterification reaction Methods 0.000 description 3
- 125000005440 p-toluyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1C(*)=O)C([H])([H])[H] 0.000 description 3
- IUVKMZGDUIUOCP-BTNSXGMBSA-N quinbolone Chemical compound O([C@H]1CC[C@H]2[C@H]3[C@@H]([C@]4(C=CC(=O)C=C4CC3)C)CC[C@@]21C)C1=CCCC1 IUVKMZGDUIUOCP-BTNSXGMBSA-N 0.000 description 3
- 238000003756 stirring Methods 0.000 description 3
- KLDXJTOLSGUMSJ-BXKVDMCESA-N (3s,3as,6s,6as)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3,6-diol Chemical compound O[C@H]1CO[C@H]2[C@@H](O)CO[C@H]21 KLDXJTOLSGUMSJ-BXKVDMCESA-N 0.000 description 2
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 2
- ZWEHNKRNPOVVGH-UHFFFAOYSA-N 2-Butanone Chemical compound CCC(C)=O ZWEHNKRNPOVVGH-UHFFFAOYSA-N 0.000 description 2
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonium chloride Substances [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 2
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 2
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 2
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 2
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 2
- PXHVJJICTQNCMI-UHFFFAOYSA-N Nickel Chemical compound [Ni] PXHVJJICTQNCMI-UHFFFAOYSA-N 0.000 description 2
- 150000007513 acids Chemical class 0.000 description 2
- QGZKDVFQNNGYKY-UHFFFAOYSA-N ammonia Natural products N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 2
- 235000011114 ammonium hydroxide Nutrition 0.000 description 2
- 239000000470 constituent Substances 0.000 description 2
- 239000012043 crude product Substances 0.000 description 2
- LYCAIKOWRPUZTN-UHFFFAOYSA-N ethylene glycol Natural products OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 2
- 150000004820 halides Chemical class 0.000 description 2
- 230000007062 hydrolysis Effects 0.000 description 2
- 238000006460 hydrolysis reaction Methods 0.000 description 2
- 239000013067 intermediate product Substances 0.000 description 2
- 238000011835 investigation Methods 0.000 description 2
- KQNPFQTWMSNSAP-UHFFFAOYSA-N isobutyric acid Chemical compound CC(C)C(O)=O KQNPFQTWMSNSAP-UHFFFAOYSA-N 0.000 description 2
- 229940046892 lead acetate Drugs 0.000 description 2
- 150000002823 nitrates Chemical class 0.000 description 2
- 230000000802 nitrating effect Effects 0.000 description 2
- 239000012074 organic phase Substances 0.000 description 2
- 239000002244 precipitate Substances 0.000 description 2
- 235000019260 propionic acid Nutrition 0.000 description 2
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 2
- 238000000926 separation method Methods 0.000 description 2
- HEMHJVSKTPXQMS-UHFFFAOYSA-M sodium hydroxide Inorganic materials [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 2
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 2
- 238000002560 therapeutic procedure Methods 0.000 description 2
- YQTCQNIPQMJNTI-UHFFFAOYSA-N 2,2-dimethylpropan-1-one Chemical group CC(C)(C)[C]=O YQTCQNIPQMJNTI-UHFFFAOYSA-N 0.000 description 1
- PYMXLKTVVVYMAE-UHFFFAOYSA-N 2,2-dimethylpropanoic acid;3-methylbutanoic acid Chemical compound CC(C)CC(O)=O.CC(C)(C)C(O)=O PYMXLKTVVVYMAE-UHFFFAOYSA-N 0.000 description 1
- XRHGYUZYPHTUJZ-UHFFFAOYSA-N 4-chlorobenzoic acid Chemical compound OC(=O)C1=CC=C(Cl)C=C1 XRHGYUZYPHTUJZ-UHFFFAOYSA-N 0.000 description 1
- 125000000242 4-chlorobenzoyl group Chemical group ClC1=CC=C(C(=O)*)C=C1 0.000 description 1
- 206010002383 Angina Pectoris Diseases 0.000 description 1
- FXHOOIRPVKKKFG-UHFFFAOYSA-N N,N-Dimethylacetamide Chemical compound CN(C)C(C)=O FXHOOIRPVKKKFG-UHFFFAOYSA-N 0.000 description 1
- SNIOPGDIGTZGOP-UHFFFAOYSA-N Nitroglycerin Chemical compound [O-][N+](=O)OCC(O[N+]([O-])=O)CO[N+]([O-])=O SNIOPGDIGTZGOP-UHFFFAOYSA-N 0.000 description 1
- 239000000006 Nitroglycerin Substances 0.000 description 1
- VJMAITQRABEEKP-UHFFFAOYSA-N [6-(phenylmethoxymethyl)-1,4-dioxan-2-yl]methyl acetate Chemical compound O1C(COC(=O)C)COCC1COCC1=CC=CC=C1 VJMAITQRABEEKP-UHFFFAOYSA-N 0.000 description 1
- 238000010521 absorption reaction Methods 0.000 description 1
- 150000001242 acetic acid derivatives Chemical class 0.000 description 1
- 125000002777 acetyl group Chemical group [H]C([H])([H])C(*)=O 0.000 description 1
- 230000021736 acetylation Effects 0.000 description 1
- 238000006640 acetylation reaction Methods 0.000 description 1
- 239000008186 active pharmaceutical agent Substances 0.000 description 1
- 150000001266 acyl halides Chemical class 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- 125000001931 aliphatic group Chemical group 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- 238000005904 alkaline hydrolysis reaction Methods 0.000 description 1
- 125000000217 alkyl group Chemical group 0.000 description 1
- 229910052787 antimony Inorganic materials 0.000 description 1
- WATWJIUSRGPENY-UHFFFAOYSA-N antimony atom Chemical compound [Sb] WATWJIUSRGPENY-UHFFFAOYSA-N 0.000 description 1
- 239000008346 aqueous phase Substances 0.000 description 1
- 150000001558 benzoic acid derivatives Chemical class 0.000 description 1
- 125000003236 benzoyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C(*)=O 0.000 description 1
- 230000036983 biotransformation Effects 0.000 description 1
- 125000004063 butyryl group Chemical group O=C([*])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 239000006227 byproduct Substances 0.000 description 1
- 150000001720 carbohydrates Chemical class 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 150000001721 carbon Chemical group 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-N carbonic acid Chemical compound OC(O)=O BVKZGUZCCUSVTD-UHFFFAOYSA-N 0.000 description 1
- 150000004649 carbonic acid derivatives Chemical class 0.000 description 1
- 150000001732 carboxylic acid derivatives Chemical group 0.000 description 1
- 230000003197 catalytic effect Effects 0.000 description 1
- 150000001805 chlorine compounds Chemical class 0.000 description 1
- 238000013375 chromatographic separation Methods 0.000 description 1
- 238000004140 cleaning Methods 0.000 description 1
- 238000003776 cleavage reaction Methods 0.000 description 1
- 238000004440 column chromatography Methods 0.000 description 1
- 208000029078 coronary artery disease Diseases 0.000 description 1
- 125000004122 cyclic group Chemical group 0.000 description 1
- NKLCHDQGUHMCGL-UHFFFAOYSA-N cyclohexylidenemethanone Chemical group O=C=C1CCCCC1 NKLCHDQGUHMCGL-UHFFFAOYSA-N 0.000 description 1
- 238000001514 detection method Methods 0.000 description 1
- 125000003963 dichloro group Chemical group Cl* 0.000 description 1
- 125000000118 dimethyl group Chemical group [H]C([H])([H])* 0.000 description 1
- 150000002009 diols Chemical class 0.000 description 1
- 230000002255 enzymatic effect Effects 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- 238000002474 experimental method Methods 0.000 description 1
- 239000002360 explosive Substances 0.000 description 1
- 239000000706 filtrate Substances 0.000 description 1
- 238000009472 formulation Methods 0.000 description 1
- 229960003711 glyceryl trinitrate Drugs 0.000 description 1
- 125000006331 halo benzoyl group Chemical group 0.000 description 1
- 229910052736 halogen Inorganic materials 0.000 description 1
- 150000002367 halogens Chemical class 0.000 description 1
- DMEGYFMYUHOHGS-UHFFFAOYSA-N heptamethylene Natural products C1CCCCCC1 DMEGYFMYUHOHGS-UHFFFAOYSA-N 0.000 description 1
- MBEGHXRSTJGPKQ-UHFFFAOYSA-N hexanoic acid;pentanoic acid Chemical compound CCCCC(O)=O.CCCCCC(O)=O MBEGHXRSTJGPKQ-UHFFFAOYSA-N 0.000 description 1
- 239000012442 inert solvent Substances 0.000 description 1
- 150000007529 inorganic bases Chemical class 0.000 description 1
- 150000002500 ions Chemical class 0.000 description 1
- 229960003827 isosorbide mononitrate Drugs 0.000 description 1
- YWXYYJSYQOXTPL-SLPGGIOYSA-N isosorbide mononitrate Chemical compound [O-][N+](=O)O[C@@H]1CO[C@@H]2[C@@H](O)CO[C@@H]21 YWXYYJSYQOXTPL-SLPGGIOYSA-N 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 210000004185 liver Anatomy 0.000 description 1
- 230000007774 longterm Effects 0.000 description 1
- 238000002844 melting Methods 0.000 description 1
- 230000008018 melting Effects 0.000 description 1
- 230000004060 metabolic process Effects 0.000 description 1
- 239000002207 metabolite Substances 0.000 description 1
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 description 1
- 150000007522 mineralic acids Chemical class 0.000 description 1
- 238000006386 neutralization reaction Methods 0.000 description 1
- 229910052759 nickel Inorganic materials 0.000 description 1
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 description 1
- 125000005441 o-toluyl group Chemical group [H]C1=C([H])C(C(*)=O)=C(C([H])=C1[H])C([H])([H])[H] 0.000 description 1
- 229940082615 organic nitrates used in cardiac disease Drugs 0.000 description 1
- 125000003232 p-nitrobenzoyl group Chemical group [N+](=O)([O-])C1=CC=C(C(=O)*)C=C1 0.000 description 1
- 239000003208 petroleum Substances 0.000 description 1
- 239000012071 phase Substances 0.000 description 1
- 235000021317 phosphate Nutrition 0.000 description 1
- 150000003013 phosphoric acid derivatives Chemical class 0.000 description 1
- 238000012545 processing Methods 0.000 description 1
- 238000011321 prophylaxis Methods 0.000 description 1
- 125000001501 propionyl group Chemical group O=C([*])C([H])([H])C([H])([H])[H] 0.000 description 1
- 238000000746 purification Methods 0.000 description 1
- 230000036632 reaction speed Effects 0.000 description 1
- 230000035484 reaction time Effects 0.000 description 1
- 230000007017 scission Effects 0.000 description 1
- 238000007086 side reaction Methods 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 125000001424 substituent group Chemical group 0.000 description 1
- 238000013268 sustained release Methods 0.000 description 1
- 239000012730 sustained-release form Substances 0.000 description 1
- 238000003786 synthesis reaction Methods 0.000 description 1
- 230000009897 systematic effect Effects 0.000 description 1
- 238000010998 test method Methods 0.000 description 1
- 230000001225 therapeutic effect Effects 0.000 description 1
- 238000004809 thin layer chromatography Methods 0.000 description 1
- ITMCEJHCFYSIIV-UHFFFAOYSA-N triflic acid Chemical compound OS(=O)(=O)C(F)(F)F ITMCEJHCFYSIIV-UHFFFAOYSA-N 0.000 description 1
- 125000003774 valeryl group Chemical group O=C([*])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 238000010792 warming Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D493/00—Heterocyclic compounds containing oxygen atoms as the only ring hetero atoms in the condensed system
- C07D493/02—Heterocyclic compounds containing oxygen atoms as the only ring hetero atoms in the condensed system in which the condensed system contains two hetero rings
- C07D493/04—Ortho-condensed systems
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Heterocyclic Carbon Compounds Containing A Hetero Ring Having Oxygen Or Sulfur (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Low-Molecular Organic Synthesis Reactions Using Catalysts (AREA)
- Acyclic And Carbocyclic Compounds In Medicinal Compositions (AREA)
Priority Applications (12)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19813124410 DE3124410A1 (de) | 1981-06-22 | 1981-06-22 | Verfahren zur herstellung von isosorbid-2-nitrat |
| DE8282104366T DE3262856D1 (en) | 1981-06-22 | 1982-05-18 | Process for the preparation of 2-isosorbide nitrate |
| EP82104366A EP0067964B1 (de) | 1981-06-22 | 1982-05-18 | Verfahren zur Herstellung von Isosorbid-2-nitrat |
| AT82104366T ATE12500T1 (de) | 1981-06-22 | 1982-05-18 | Verfahren zur herstellung von isosorbid-2-nitrat. |
| US06/381,124 US4417065A (en) | 1981-06-22 | 1982-05-24 | Process for the preparation of isosorbide 2-nitrate |
| CS824025A CS224648B2 (en) | 1981-06-22 | 1982-05-31 | Method for producing isosorbitol-nitrate |
| PL1982236706A PL130910B1 (en) | 1981-06-22 | 1982-06-01 | Process for preparing isosorbite 2-nitrate |
| DD82240885A DD202719A5 (de) | 1981-06-22 | 1982-06-18 | Verfahren zur herstellung von isosorbid-2-nitrat |
| DK278082A DK149155C (da) | 1981-06-22 | 1982-06-21 | Fremgangsmaade til fremstilling af isosorbid-2-nitrat |
| IE1460/82A IE53323B1 (en) | 1981-06-22 | 1982-06-21 | Process for the preparation of isosorbide-2-nitrate |
| JP57106634A JPS584785A (ja) | 1981-06-22 | 1982-06-21 | イソソルバイド−2−ニトレ−トの製造方法 |
| GR68514A GR75951B (https=) | 1981-06-22 | 1982-06-22 |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19813124410 DE3124410A1 (de) | 1981-06-22 | 1981-06-22 | Verfahren zur herstellung von isosorbid-2-nitrat |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE3124410A1 true DE3124410A1 (de) | 1983-01-05 |
Family
ID=6135078
Family Applications (2)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19813124410 Withdrawn DE3124410A1 (de) | 1981-06-22 | 1981-06-22 | Verfahren zur herstellung von isosorbid-2-nitrat |
| DE8282104366T Expired DE3262856D1 (en) | 1981-06-22 | 1982-05-18 | Process for the preparation of 2-isosorbide nitrate |
Family Applications After (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE8282104366T Expired DE3262856D1 (en) | 1981-06-22 | 1982-05-18 | Process for the preparation of 2-isosorbide nitrate |
Country Status (11)
| Country | Link |
|---|---|
| US (1) | US4417065A (https=) |
| EP (1) | EP0067964B1 (https=) |
| JP (1) | JPS584785A (https=) |
| AT (1) | ATE12500T1 (https=) |
| CS (1) | CS224648B2 (https=) |
| DD (1) | DD202719A5 (https=) |
| DE (2) | DE3124410A1 (https=) |
| DK (1) | DK149155C (https=) |
| GR (1) | GR75951B (https=) |
| IE (1) | IE53323B1 (https=) |
| PL (1) | PL130910B1 (https=) |
Cited By (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| EP0150063B1 (en) * | 1984-01-18 | 1990-07-11 | Eisai Co., Ltd. | Therapeutic and/or preventive ophthalmic solution for intraocular hypertension and glaucoma |
| EP0530671A3 (en) * | 1991-09-02 | 1994-06-29 | Boehringer Mannheim Gmbh | Process for the enzymatic preparation of pure isosorbide-2 or 5-monoester-isomers and conversion to isosorbide-2- and 5-nitrate |
| DE4410997A1 (de) * | 1994-03-30 | 1995-10-26 | Isis Pharma Gmbh | Pharmazeutische Zubereitungen und Arzneistoffe zur Prävention und Behandlung endothelialer Dysfunktionen |
| DE102008050597A1 (de) | 2008-10-09 | 2010-04-15 | Actavis Deutschland Gmbh & Co. Kg | Pharmazeutische Zubereitungen zur Anwendung in einem Verfahren zur therapeutischen Behandlung von Hörsturz |
Families Citing this family (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| EP0143507B1 (en) * | 1983-11-25 | 1989-09-20 | TOSHIN CHEMICAL CO., Ltd. | A method for the preparation of isosorbide-5-nitrate and sodium isosorbide-5-nitrate hydrate as a precursor thereof |
| DE3683500D1 (de) * | 1986-11-05 | 1992-02-27 | Consiglio Nazionale Ricerche | Verfahren zur selektiven herstellung von isosorbid-2-nitrat, ausgehend vom isosorbid-2,5-dinitrat. |
| IT1204571B (it) * | 1987-05-08 | 1989-03-10 | Chiesi Farma Spa | Esteri di 1,4:3,6-dianidrosorbitolo-2-mononitrato e 5-mononitrato,loro procedimento di preparazione e loro composizioni farmaceutiche |
| US5538891A (en) * | 1991-09-02 | 1996-07-23 | Boehringer Mannheim Gmbh | Process for enzymatic production of isomerically pure isosorbide-2 and 5-monoesters and their conversion to isosorbide-2 and -5 nitrate |
| IT1303671B1 (it) * | 1998-07-28 | 2001-02-23 | Nicox Sa | Sali dell'acido nitrico con farmaci attivi nel trattamento dipatologie del sistema respiratorio |
| JP7837270B2 (ja) | 2019-09-23 | 2026-03-30 | ビーエーエスエフ ソシエタス・ヨーロピア | ジアンヒドロヘキシトール異性体の混合物の選択的エステル化を含む、イソイジドを製造及び/又は単離する方法 |
| CN112390808B (zh) * | 2020-11-26 | 2021-11-16 | 连云港鹏辰特种新材料有限公司 | 一种捕集纯化均苯四甲酸二酐的方法 |
Family Cites Families (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4065488A (en) * | 1977-02-24 | 1977-12-27 | American Home Products Corporation | Process for preparing 1,4:3,6-dianhydro-D-glucitol 2-nitrate |
| DE2903983A1 (de) * | 1979-02-02 | 1980-09-04 | Sanol Arznei Schwarz Gmbh | Verfahren zur selektiven herstellung von isosorbid-2-nitrat |
| DE3028873C2 (de) * | 1980-07-30 | 1983-10-27 | Boehringer Mannheim Gmbh, 6800 Mannheim | Verfahren zur Herstellung von 1,4 zu 3,6-Dianhydro-D-glucit-5-nitrat (Isosorbid-5-nitrat) |
| DE3102947A1 (de) * | 1981-01-29 | 1982-09-02 | Heinrich Mack Nachf., 7918 Illertissen | Verfahren zur herstellung von isosorbid-5-nitrat |
| FR2500835A1 (fr) * | 1981-02-27 | 1982-09-03 | Poudres & Explosifs Ste Nale | Procede de synthese des mononitrates d'isosorbide |
| JPH1026755A (ja) * | 1992-07-07 | 1998-01-27 | Seiko Instr Inc | 液晶電気光学デバイス |
-
1981
- 1981-06-22 DE DE19813124410 patent/DE3124410A1/de not_active Withdrawn
-
1982
- 1982-05-18 EP EP82104366A patent/EP0067964B1/de not_active Expired
- 1982-05-18 DE DE8282104366T patent/DE3262856D1/de not_active Expired
- 1982-05-18 AT AT82104366T patent/ATE12500T1/de not_active IP Right Cessation
- 1982-05-24 US US06/381,124 patent/US4417065A/en not_active Expired - Fee Related
- 1982-05-31 CS CS824025A patent/CS224648B2/cs unknown
- 1982-06-01 PL PL1982236706A patent/PL130910B1/pl unknown
- 1982-06-18 DD DD82240885A patent/DD202719A5/de not_active IP Right Cessation
- 1982-06-21 DK DK278082A patent/DK149155C/da not_active IP Right Cessation
- 1982-06-21 IE IE1460/82A patent/IE53323B1/en not_active IP Right Cessation
- 1982-06-21 JP JP57106634A patent/JPS584785A/ja active Granted
- 1982-06-22 GR GR68514A patent/GR75951B/el unknown
Cited By (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| EP0150063B1 (en) * | 1984-01-18 | 1990-07-11 | Eisai Co., Ltd. | Therapeutic and/or preventive ophthalmic solution for intraocular hypertension and glaucoma |
| EP0530671A3 (en) * | 1991-09-02 | 1994-06-29 | Boehringer Mannheim Gmbh | Process for the enzymatic preparation of pure isosorbide-2 or 5-monoester-isomers and conversion to isosorbide-2- and 5-nitrate |
| DE4410997A1 (de) * | 1994-03-30 | 1995-10-26 | Isis Pharma Gmbh | Pharmazeutische Zubereitungen und Arzneistoffe zur Prävention und Behandlung endothelialer Dysfunktionen |
| DE102008050597A1 (de) | 2008-10-09 | 2010-04-15 | Actavis Deutschland Gmbh & Co. Kg | Pharmazeutische Zubereitungen zur Anwendung in einem Verfahren zur therapeutischen Behandlung von Hörsturz |
Also Published As
| Publication number | Publication date |
|---|---|
| IE821460L (en) | 1982-12-22 |
| EP0067964A3 (en) | 1983-01-19 |
| CS224648B2 (en) | 1984-01-16 |
| GR75951B (https=) | 1984-08-02 |
| ATE12500T1 (de) | 1985-04-15 |
| JPH0129191B2 (https=) | 1989-06-08 |
| DD202719A5 (de) | 1983-09-28 |
| PL130910B1 (en) | 1984-09-29 |
| IE53323B1 (en) | 1988-10-12 |
| DK278082A (da) | 1982-12-23 |
| DK149155C (da) | 1986-07-28 |
| EP0067964B1 (de) | 1985-04-03 |
| US4417065A (en) | 1983-11-22 |
| DK149155B (da) | 1986-02-17 |
| EP0067964A2 (de) | 1982-12-29 |
| DE3262856D1 (en) | 1985-05-09 |
| JPS584785A (ja) | 1983-01-11 |
| PL236706A1 (en) | 1983-01-03 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2707336C2 (https=) | ||
| DE1545760C3 (de) | Vincaleukoblastinderivate | |
| EP0067964B1 (de) | Verfahren zur Herstellung von Isosorbid-2-nitrat | |
| EP0057847B1 (de) | Verfahren zur Herstellung von Isosorbid-5-nitrat | |
| DE1804691C3 (de) | Taurocholensäurederivate | |
| DE1801750A1 (de) | Von Prostaglandinen abgeleitete Verbindungen und Verfahren zu ihrer Herstellung | |
| CH649296A5 (de) | Verfahren zur selektiven herstellung von isosorbid-5-nitrat. | |
| EP0045076B1 (de) | Verfahren zur Herstellung von 1,4:3,6-Dianhydro-D-glucit-5-nitrat (Isosorbid-5-nitrat) | |
| DE3226921A1 (de) | Neue bicyclische verbindungen und verfahren zu ihrer herstellung | |
| DE2005959A1 (de) | 7-Nitro-8-hydroxychinolinester, ihre Verwendung und Verfahren zur Herstellung derselben | |
| DE1468890B1 (de) | Verfahren zur Herstellung von Tetrahydroindan-Zwischenprodukten fuer Steroidderivate | |
| DE1695500C3 (de) | Verfahren zum Herstellen von 1-Methyl-S-nitrobnidazolverbindungen | |
| DE2318767A1 (de) | Triamcinolon-derivat, verfahren zu seiner herstellung und dieses enthaltende arzneimittel | |
| EP1919888A2 (de) | Verfahren zur herstellung nebivolol | |
| DE2754759C2 (de) | 3α-Hydroxy-5β-cholest-24-en | |
| DE2950436A1 (de) | 1 alpha -aethyl-1 beta - eckige klammer auf 2'-(methoxycarbonyl)-aethyl eckige klammer zu -9-brom-1,2,3,4,6,7,12,12b -octahydroindolo eckige klammer auf 2,3-a eckige klammer zu chinolizinderivate, verfahren zur herstellung derselben bzw. von 10-bromvincamin und 10-brom-14-epivincamin, erstere enthaltende arzneimittel sowie 1-aethyl-1- eckige klammer auf 2'- (acetoxy)-2'-(methoxycarbonyl)-aethyl eckige klammer zu -9-brom-1,2,3,4,6,7- hexahydro-12h-indolo eckige klammer auf 2,3-a eckige klammer zu chinolizin-5- iumperchlorat und 1-aethyl-1- eckige klammer auf 2'-(hydroxy)-2'-(methoxycarbonyl)- aethyl eckige klammer zu -9-brom-1,2,3,4, 6,7-hexahydro-12h-indolo eckige klammer auf 2,3-a eckige klammer zu chinolizin- 5-iumperchlorat | |
| AT357696B (de) | Verfahren zur herstellung von 16alpha- und 16beta-methyl-9alpha-chlor- oder -fluor-21- -desoxyprednisolonestern und -aethern | |
| DE1543522B2 (de) | Acylaminophenolalkanole, verfahren zu ihrer herstellung und diese acylaminophenolalkanole enthaltende pharmazeutische mittel | |
| DE1418945C3 (de) | Verfahren zur Herstellung von 16 alpha Methyl 17alpha hydroxy 20 oxo pregnandenvaten | |
| DE1543522C3 (de) | Acylaminophenolalkanole, Verfahren zu ihrer Herstellung und diese Acylaminophenolalkanole enthaltende pharmazeutische Mittel | |
| EP0046488A2 (de) | Substituierte 2,5,7-Trioxa-bicyclo(2.2.2)octan-6-one, 3,6,8-Trioxa-bicyclo(3.2.1)octan-4-one sowie 1,3-Dioxan-2-carbonsäure- und 1,3-Dioxolan-2-carbonsäureverbindungen und Verfahren zu deren Herstellung | |
| LU86486A1 (de) | Verfahren zur herstellung von 10 -methoxy-6-methylergolin-derivaten und ihren saeureadditionssalzen | |
| DD244555A5 (de) | Verfahren zur herstellung von eburnamenin-derivaten | |
| DE3500023A1 (de) | 4'-desoxyanthracyclinester | |
| DE1148548B (de) | Verfahren zur Herstellung von ?-16-Hydroxyverbindungen der Pregnanreihe |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| 8139 | Disposal/non-payment of the annual fee |