DE3020689C2 - - Google Patents
Info
- Publication number
- DE3020689C2 DE3020689C2 DE3020689A DE3020689A DE3020689C2 DE 3020689 C2 DE3020689 C2 DE 3020689C2 DE 3020689 A DE3020689 A DE 3020689A DE 3020689 A DE3020689 A DE 3020689A DE 3020689 C2 DE3020689 C2 DE 3020689C2
- Authority
- DE
- Germany
- Prior art keywords
- water
- cellulose
- ether
- soluble
- modified
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired - Lifetime
Links
- 229920003086 cellulose ether Polymers 0.000 claims description 37
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 28
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 claims description 19
- -1 hydroxypropyl residues Chemical group 0.000 claims description 19
- 229930195733 hydrocarbon Natural products 0.000 claims description 12
- 239000004215 Carbon black (E152) Substances 0.000 claims description 11
- 150000002148 esters Chemical class 0.000 claims description 5
- 238000006116 polymerization reaction Methods 0.000 claims description 5
- 238000006467 substitution reaction Methods 0.000 claims description 5
- GAWIXWVDTYZWAW-UHFFFAOYSA-N C[CH]O Chemical group C[CH]O GAWIXWVDTYZWAW-UHFFFAOYSA-N 0.000 claims description 3
- 125000004432 carbon atom Chemical group C* 0.000 claims description 3
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 2
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 27
- 239000000047 product Substances 0.000 description 18
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 16
- 239000004094 surface-active agent Substances 0.000 description 15
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 14
- 238000006243 chemical reaction Methods 0.000 description 14
- 239000000243 solution Substances 0.000 description 13
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 12
- 239000004354 Hydroxyethyl cellulose Substances 0.000 description 12
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 12
- 229920000642 polymer Polymers 0.000 description 12
- 229920000663 Hydroxyethyl cellulose Polymers 0.000 description 11
- 235000019447 hydroxyethyl cellulose Nutrition 0.000 description 11
- 238000000034 method Methods 0.000 description 10
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 8
- 150000002430 hydrocarbons Chemical class 0.000 description 8
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 6
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 6
- DNIAPMSPPWPWGF-UHFFFAOYSA-N Propylene glycol Chemical compound CC(O)CO DNIAPMSPPWPWGF-UHFFFAOYSA-N 0.000 description 6
- 125000000217 alkyl group Chemical group 0.000 description 6
- 230000004048 modification Effects 0.000 description 6
- 238000012986 modification Methods 0.000 description 6
- 229920002153 Hydroxypropyl cellulose Polymers 0.000 description 5
- 239000003513 alkali Substances 0.000 description 5
- 239000003795 chemical substances by application Substances 0.000 description 5
- 239000001863 hydroxypropyl cellulose Substances 0.000 description 5
- 235000010977 hydroxypropyl cellulose Nutrition 0.000 description 5
- 239000000203 mixture Substances 0.000 description 5
- 239000000463 material Substances 0.000 description 4
- 229920000609 methyl cellulose Polymers 0.000 description 4
- 239000001923 methylcellulose Substances 0.000 description 4
- 235000010981 methylcellulose Nutrition 0.000 description 4
- 235000021395 porridge Nutrition 0.000 description 4
- 239000002453 shampoo Substances 0.000 description 4
- 238000003756 stirring Methods 0.000 description 4
- 239000000758 substrate Substances 0.000 description 4
- HSHXDCVZWHOWCS-UHFFFAOYSA-N N'-hexadecylthiophene-2-carbohydrazide Chemical compound CCCCCCCCCCCCCCCCNNC(=O)c1cccs1 HSHXDCVZWHOWCS-UHFFFAOYSA-N 0.000 description 3
- GRYLNZFGIOXLOG-UHFFFAOYSA-N Nitric acid Chemical compound O[N+]([O-])=O GRYLNZFGIOXLOG-UHFFFAOYSA-N 0.000 description 3
- 239000003153 chemical reaction reagent Substances 0.000 description 3
- 235000014113 dietary fatty acids Nutrition 0.000 description 3
- 239000006185 dispersion Substances 0.000 description 3
- 150000002118 epoxides Chemical class 0.000 description 3
- 238000006266 etherification reaction Methods 0.000 description 3
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 3
- 239000000194 fatty acid Substances 0.000 description 3
- 229930195729 fatty acid Natural products 0.000 description 3
- 230000002209 hydrophobic effect Effects 0.000 description 3
- 239000001866 hydroxypropyl methyl cellulose Substances 0.000 description 3
- 229920003088 hydroxypropyl methyl cellulose Polymers 0.000 description 3
- 235000010979 hydroxypropyl methyl cellulose Nutrition 0.000 description 3
- 239000004615 ingredient Substances 0.000 description 3
- 229910017604 nitric acid Inorganic materials 0.000 description 3
- 229910052757 nitrogen Inorganic materials 0.000 description 3
- 235000013772 propylene glycol Nutrition 0.000 description 3
- 239000011347 resin Substances 0.000 description 3
- 229920005989 resin Polymers 0.000 description 3
- 150000003839 salts Chemical class 0.000 description 3
- 229960000776 sodium tetradecyl sulfate Drugs 0.000 description 3
- UPUIQOIQVMNQAP-UHFFFAOYSA-M sodium;tetradecyl sulfate Chemical compound [Na+].CCCCCCCCCCCCCCOS([O-])(=O)=O UPUIQOIQVMNQAP-UHFFFAOYSA-M 0.000 description 3
- JNYAEWCLZODPBN-JGWLITMVSA-N (2r,3r,4s)-2-[(1r)-1,2-dihydroxyethyl]oxolane-3,4-diol Chemical compound OC[C@@H](O)[C@H]1OC[C@H](O)[C@H]1O JNYAEWCLZODPBN-JGWLITMVSA-N 0.000 description 2
- XKRFYHLGVUSROY-UHFFFAOYSA-N Argon Chemical compound [Ar] XKRFYHLGVUSROY-UHFFFAOYSA-N 0.000 description 2
- 239000004593 Epoxy Substances 0.000 description 2
- 229920000896 Ethulose Polymers 0.000 description 2
- 239000001859 Ethyl hydroxyethyl cellulose Substances 0.000 description 2
- PEDCQBHIVMGVHV-UHFFFAOYSA-N Glycerine Chemical class OCC(O)CO PEDCQBHIVMGVHV-UHFFFAOYSA-N 0.000 description 2
- 229920003091 Methocel™ Polymers 0.000 description 2
- 229920003171 Poly (ethylene oxide) Chemical class 0.000 description 2
- 239000002253 acid Substances 0.000 description 2
- 229910052783 alkali metal Inorganic materials 0.000 description 2
- 239000007864 aqueous solution Substances 0.000 description 2
- 230000027455 binding Effects 0.000 description 2
- 238000009739 binding Methods 0.000 description 2
- 229920002678 cellulose Polymers 0.000 description 2
- 239000001913 cellulose Substances 0.000 description 2
- 239000000839 emulsion Substances 0.000 description 2
- 150000002170 ethers Chemical class 0.000 description 2
- 235000019326 ethyl hydroxyethyl cellulose Nutrition 0.000 description 2
- 230000006855 networking Effects 0.000 description 2
- 230000008569 process Effects 0.000 description 2
- 239000007858 starting material Substances 0.000 description 2
- DNIAPMSPPWPWGF-GSVOUGTGSA-N (R)-(-)-Propylene glycol Chemical compound C[C@@H](O)CO DNIAPMSPPWPWGF-GSVOUGTGSA-N 0.000 description 1
- ZZNDQCACFUJAKJ-UHFFFAOYSA-N 1-phenyltridecan-1-one Chemical compound CCCCCCCCCCCCC(=O)C1=CC=CC=C1 ZZNDQCACFUJAKJ-UHFFFAOYSA-N 0.000 description 1
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 description 1
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 1
- 229920000742 Cotton Polymers 0.000 description 1
- VGGSQFUCUMXWEO-UHFFFAOYSA-N Ethene Chemical compound C=C VGGSQFUCUMXWEO-UHFFFAOYSA-N 0.000 description 1
- 239000005977 Ethylene Substances 0.000 description 1
- 206010015946 Eye irritation Diseases 0.000 description 1
- CPELXLSAUQHCOX-UHFFFAOYSA-N Hydrogen bromide Chemical compound Br CPELXLSAUQHCOX-UHFFFAOYSA-N 0.000 description 1
- 229920001479 Hydroxyethyl methyl cellulose Polymers 0.000 description 1
- 239000004166 Lanolin Substances 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 150000001263 acyl chlorides Chemical class 0.000 description 1
- 150000008044 alkali metal hydroxides Chemical class 0.000 description 1
- 150000001340 alkali metals Chemical class 0.000 description 1
- 150000001408 amides Chemical class 0.000 description 1
- 239000002280 amphoteric surfactant Substances 0.000 description 1
- 125000000129 anionic group Chemical group 0.000 description 1
- 239000003945 anionic surfactant Substances 0.000 description 1
- 229910052786 argon Inorganic materials 0.000 description 1
- 125000005228 aryl sulfonate group Chemical group 0.000 description 1
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 1
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 125000002091 cationic group Chemical group 0.000 description 1
- 239000003093 cationic surfactant Substances 0.000 description 1
- 239000003518 caustics Substances 0.000 description 1
- 230000008859 change Effects 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 239000002537 cosmetic Substances 0.000 description 1
- 239000013078 crystal Substances 0.000 description 1
- 230000008021 deposition Effects 0.000 description 1
- 239000003599 detergent Substances 0.000 description 1
- 239000003085 diluting agent Substances 0.000 description 1
- POULHZVOKOAJMA-UHFFFAOYSA-M dodecanoate Chemical compound CCCCCCCCCCCC([O-])=O POULHZVOKOAJMA-UHFFFAOYSA-M 0.000 description 1
- JZKFHQMONDVVNF-UHFFFAOYSA-N dodecyl sulfate;tris(2-hydroxyethyl)azanium Chemical compound OCCN(CCO)CCO.CCCCCCCCCCCCOS(O)(=O)=O JZKFHQMONDVVNF-UHFFFAOYSA-N 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 239000003995 emulsifying agent Substances 0.000 description 1
- 230000007717 exclusion Effects 0.000 description 1
- 231100000013 eye irritation Toxicity 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 235000011187 glycerol Nutrition 0.000 description 1
- 238000000227 grinding Methods 0.000 description 1
- 150000004820 halides Chemical class 0.000 description 1
- 230000036571 hydration Effects 0.000 description 1
- 238000006703 hydration reaction Methods 0.000 description 1
- 125000001165 hydrophobic group Chemical group 0.000 description 1
- 239000003701 inert diluent Substances 0.000 description 1
- 239000012948 isocyanate Substances 0.000 description 1
- 150000002513 isocyanates Chemical class 0.000 description 1
- 150000002576 ketones Chemical class 0.000 description 1
- 229940039717 lanolin Drugs 0.000 description 1
- 235000019388 lanolin Nutrition 0.000 description 1
- 229940070765 laurate Drugs 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 239000003607 modifier Substances 0.000 description 1
- 239000012299 nitrogen atmosphere Substances 0.000 description 1
- 239000002736 nonionic surfactant Substances 0.000 description 1
- 239000001301 oxygen Substances 0.000 description 1
- 229910052760 oxygen Inorganic materials 0.000 description 1
- LPNYRYFBWFDTMA-UHFFFAOYSA-N potassium tert-butoxide Chemical compound [K+].CC(C)(C)[O-] LPNYRYFBWFDTMA-UHFFFAOYSA-N 0.000 description 1
- 238000001556 precipitation Methods 0.000 description 1
- 238000002360 preparation method Methods 0.000 description 1
- 238000010926 purge Methods 0.000 description 1
- 239000012429 reaction media Substances 0.000 description 1
- 239000011541 reaction mixture Substances 0.000 description 1
- 230000009467 reduction Effects 0.000 description 1
- 239000002002 slurry Substances 0.000 description 1
- 238000007613 slurry method Methods 0.000 description 1
- 238000002791 soaking Methods 0.000 description 1
- 239000000344 soap Substances 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 150000003467 sulfuric acid derivatives Chemical class 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
- 230000008961 swelling Effects 0.000 description 1
- 230000008719 thickening Effects 0.000 description 1
- 239000002562 thickening agent Substances 0.000 description 1
- 230000001960 triggered effect Effects 0.000 description 1
- 235000021122 unsaturated fatty acids Nutrition 0.000 description 1
- 238000003828 vacuum filtration Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08B—POLYSACCHARIDES; DERIVATIVES THEREOF
- C08B11/00—Preparation of cellulose ethers
- C08B11/193—Mixed ethers, i.e. ethers with two or more different etherifying groups
Landscapes
- Chemical & Material Sciences (AREA)
- Life Sciences & Earth Sciences (AREA)
- Engineering & Computer Science (AREA)
- Biochemistry (AREA)
- Materials Engineering (AREA)
- Health & Medical Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Medicinal Chemistry (AREA)
- Polymers & Plastics (AREA)
- Organic Chemistry (AREA)
- Polysaccharides And Polysaccharide Derivatives (AREA)
- Cosmetics (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US06/045,819 US4243802A (en) | 1979-06-06 | 1979-06-06 | Surfactant-soluble cellulose derivatives |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DE3020689A1 DE3020689A1 (de) | 1981-01-22 |
| DE3020689C2 true DE3020689C2 (en:Method) | 1991-07-11 |
Family
ID=21940046
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19803020689 Granted DE3020689A1 (de) | 1979-06-06 | 1980-05-30 | Celluloseaether |
Country Status (6)
| Country | Link |
|---|---|
| US (1) | US4243802A (en:Method) |
| JP (1) | JPS56801A (en:Method) |
| CA (1) | CA1137080A (en:Method) |
| DE (1) | DE3020689A1 (en:Method) |
| GB (1) | GB2053225B (en:Method) |
| NL (1) | NL190121C (en:Method) |
Families Citing this family (56)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4529523A (en) * | 1982-06-08 | 1985-07-16 | Hercules Incorporated | Hydrophobically modified polymers |
| US4458068A (en) * | 1983-03-25 | 1984-07-03 | The Dow Chemical Company | Water-soluble, ternary cellulose ethers |
| US4663159A (en) | 1985-02-01 | 1987-05-05 | Union Carbide Corporation | Hydrophobe substituted, water-soluble cationic polysaccharides |
| US4683004A (en) * | 1985-08-20 | 1987-07-28 | Union Carbide Corporation | Foamable compositions and processes for use thereof |
| US4939192A (en) * | 1987-06-17 | 1990-07-03 | Aqualon Company | Building composition containing 3-alkoxy-2-hydroxypropylhydroxyethyl cellulose |
| US4845207A (en) * | 1987-06-17 | 1989-07-04 | Aqualon Company | 3-alkoxy-2-hydroxypropylhydroxyethylcellulose and building composition containing the same |
| US4826970A (en) * | 1987-09-17 | 1989-05-02 | Hercules Incorporated | Carboxymethyl hydrophobically modified hydroxyethylcellulose |
| US4892589A (en) * | 1987-10-30 | 1990-01-09 | Aqualon Company | Composition comprising water-soluble, nonionic hydrophobically modified hydroxyethyl cellulose and water-soluble, nonionic hydroxyethyl cellulose |
| ATE108190T1 (de) | 1989-01-31 | 1994-07-15 | Union Carbide Chem Plastic | Polysaccharide mit alkaryl- oder aralkyl- hydrophoben und latexzusammensetzungen, die die polysaccharide enthalten. |
| SE463313B (sv) * | 1989-03-10 | 1990-11-05 | Berol Nobel Stenungssund Ab | Vattenloesliga, nonjoniska cellulosaetrar och deras anvaendning i maalarfaerger |
| US5062969A (en) * | 1989-05-22 | 1991-11-05 | Halliburton Company | Crosslinkable interpolymers |
| US5100658A (en) * | 1989-08-07 | 1992-03-31 | The Procter & Gamble Company | Vehicle systems for use in cosmetic compositions |
| US5106609A (en) * | 1990-05-01 | 1992-04-21 | The Procter & Gamble Company | Vehicle systems for use in cosmetic compositions |
| US5104646A (en) * | 1989-08-07 | 1992-04-14 | The Procter & Gamble Company | Vehicle systems for use in cosmetic compositions |
| US5093142A (en) * | 1989-09-19 | 1992-03-03 | Nabisco Brands, Inc. | Alcohol amine esters as low calorie fat mimetics |
| US5120838A (en) * | 1989-10-30 | 1992-06-09 | Aqualon Company | Alkylaryl hydrophobically modified cellulose ethers |
| US5124445A (en) * | 1989-10-30 | 1992-06-23 | Aqualon Company | Alkylaryl hydrophobically modified cellulose ethers |
| US4994112A (en) * | 1989-10-30 | 1991-02-19 | Aqualon Company | Hydrophobically modified cellulosic thickeners for paper coating |
| US5100657A (en) * | 1990-05-01 | 1992-03-31 | The Procter & Gamble Company | Clean conditioning compositions for hair |
| US5512091A (en) * | 1990-08-13 | 1996-04-30 | Steiner; Carol A. | Associative polymer hydrogels |
| DK0576578T3 (da) * | 1991-03-19 | 1996-05-06 | Procter & Gamble | Kosmetiske sammensætninger indeholdende hydrofobt modificeret ikke-ionisk polymer og umættet kvaternært ammoniumoverfladeaktivt middel |
| US5807543A (en) * | 1993-08-27 | 1998-09-15 | The Procter & Gamble Co. | Cosmetic compositions containing hydrophobically modified nonionic polymer and unsaturated quaternary ammonium surfactant |
| DE69212476T2 (de) | 1991-06-07 | 1997-03-06 | Procter & Gamble | Haar-styling-wirkstoffe und hydrophobe haar-styling-polymere enthaltende zusammensetzung |
| US5277899A (en) * | 1991-10-15 | 1994-01-11 | The Procter & Gamble Company | Hair setting composition with combination of cationic conditioners |
| ES2113646T3 (es) * | 1993-04-15 | 1998-05-01 | Akzo Nobel Nv | Metodo de preparar polisacaridos que contienen carboxilo modificados con amida y polisacaridos asi obtenidos. |
| CN1174567A (zh) * | 1994-12-03 | 1998-02-25 | 普罗克特和甘保尔公司 | 清洁组合物 |
| GB9424476D0 (en) * | 1994-12-03 | 1995-01-18 | Procter & Gamble | Cleansing compositions |
| US5612397A (en) * | 1994-12-19 | 1997-03-18 | Rohm And Haas Company | Composition having wet state clarity |
| US5504123A (en) * | 1994-12-20 | 1996-04-02 | Union Carbide Chemicals & Plastics Technology Corporation | Dual functional cellulosic additives for latex compositions |
| EP0879826B1 (en) * | 1996-11-27 | 2002-10-23 | Kao Corporation | Polysaccharide derivatives and hydraulic compositions |
| US6093217A (en) * | 1997-02-05 | 2000-07-25 | Akzo Nobel N.V. | Sizing of paper |
| US5804166A (en) * | 1997-05-09 | 1998-09-08 | Hercules Incorporated | Low VOC hair sprays containing cellulose ethers |
| AU8338798A (en) | 1997-06-13 | 1998-12-30 | Akzo Nobel N.V. | Hydrophobically modified anionic cellulose ethers |
| SE514347C2 (sv) * | 1998-08-06 | 2001-02-12 | Akzo Nobel Nv | Nonjonisk cellulosaeter och dess användning som förtjockningsmedel i färgkompositioner |
| US6162877A (en) * | 1998-12-04 | 2000-12-19 | Hercules Incorporated | Hydrophobically modified comb copolymers |
| MXPA02000366A (es) * | 1999-07-28 | 2002-07-02 | Kimberly Clark Co | Notejido de tipo de pano extensible en la direccion transversal para recubrimiento y forro. |
| US6417268B1 (en) | 1999-12-06 | 2002-07-09 | Hercules Incorporated | Method for making hydrophobically associative polymers, methods of use and compositions |
| US20030045844A1 (en) * | 2000-04-14 | 2003-03-06 | Taylor Jack Draper | Dimensionally stable, breathable, stretch-thinned, elastic films |
| US6405801B1 (en) * | 2000-12-08 | 2002-06-18 | Halliburton Energy Services, Inc. | Environmentally acceptable well cement fluid loss control additives, compositions and methods |
| FR2818539B1 (fr) † | 2000-12-22 | 2004-04-30 | Oreal | Composition pour la teinture d'oxydation des fibres keratiniques comprenant au moins 4,5 ou 3,4 diamino pyrazole ou triamino pyrazole et au moins un compose cellulosique particulier, et procede de teinture |
| US7018945B2 (en) * | 2002-07-02 | 2006-03-28 | Kimberly-Clark Worldwide, Inc. | Composition and method for treating fibers and nonwoven substrates |
| US20040110442A1 (en) * | 2002-08-30 | 2004-06-10 | Hannong Rhim | Stretchable nonwoven materials with controlled retraction force and methods of making same |
| US20040043214A1 (en) * | 2002-08-30 | 2004-03-04 | Kimberly-Clark Worldwide, Inc. | Method of forming a 3-dimensional fiber and a web formed from such fibers |
| AU2003268150A1 (en) * | 2002-08-30 | 2004-03-19 | Kimberly-Clark Worldwide, Inc. | Device and process for treating flexible web by stretching between intermeshing forming surfaces |
| US6896843B2 (en) * | 2002-08-30 | 2005-05-24 | Kimberly-Clark Worldwide, Inc. | Method of making a web which is extensible in at least one direction |
| US6881375B2 (en) * | 2002-08-30 | 2005-04-19 | Kimberly-Clark Worldwide, Inc. | Method of forming a 3-dimensional fiber into a web |
| US20040121675A1 (en) * | 2002-12-23 | 2004-06-24 | Kimberly-Clark Worklwide, Inc. | Treatment of substrates for improving ink adhesion to the substrates |
| US7226880B2 (en) * | 2002-12-31 | 2007-06-05 | Kimberly-Clark Worldwide, Inc. | Breathable, extensible films made with two-component single resins |
| US7220478B2 (en) * | 2003-08-22 | 2007-05-22 | Kimberly-Clark Worldwide, Inc. | Microporous breathable elastic films, methods of making same, and limited use or disposable product applications |
| US7932196B2 (en) | 2003-08-22 | 2011-04-26 | Kimberly-Clark Worldwide, Inc. | Microporous stretch thinned film/nonwoven laminates and limited use or disposable product applications |
| US7270723B2 (en) | 2003-11-07 | 2007-09-18 | Kimberly-Clark Worldwide, Inc. | Microporous breathable elastic film laminates, methods of making same, and limited use or disposable product applications |
| US20060147716A1 (en) * | 2004-12-30 | 2006-07-06 | Jaime Braverman | Elastic films with reduced roll blocking capability, methods of making same, and limited use or disposable product applications incorporating same |
| US8236385B2 (en) * | 2005-04-29 | 2012-08-07 | Kimberly Clark Corporation | Treatment of substrates for improving ink adhesion to the substrates |
| JP5696740B2 (ja) * | 2012-12-13 | 2015-04-08 | キヤノンマーケティングジャパン株式会社 | 滅菌装置、滅菌方法、プログラム |
| EP2969019A1 (en) | 2013-03-15 | 2016-01-20 | Hercules Incorporated | Composition and method of producing personal care compositions with improved deposition properties |
| JP2021063228A (ja) * | 2020-12-24 | 2021-04-22 | 花王株式会社 | エーテル化セルロース繊維及び水を含有する組成物 |
Family Cites Families (11)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2010818A (en) * | 1932-06-02 | 1935-08-13 | Du Pont | Etherification of cellulose |
| US3091542A (en) * | 1960-09-20 | 1963-05-28 | Dow Chemical Co | Insolubilization of water-soluble cellulose ethers |
| US3272640A (en) * | 1960-12-22 | 1966-09-13 | Hercules Powder Co Ltd | Water insolubilizing and insensitizing process |
| US3435027A (en) * | 1965-12-13 | 1969-03-25 | Hercules Inc | Cellulose ether-esters and process |
| SE366760B (en:Method) * | 1967-12-18 | 1974-05-06 | J Sjoevall | |
| US3824085A (en) * | 1972-02-01 | 1974-07-16 | Anheuser Busch | Esters of polymeric hydroxypropyl carbohydrates and method of using same as gelling agent for organic solvents |
| US3894839A (en) * | 1972-09-21 | 1975-07-15 | Us Of Amercia As Represented B | Process for acylating functional groups bearing active hydrogen with isopropenyl esters of long chain fatty acids |
| US3960514A (en) * | 1974-04-01 | 1976-06-01 | Anheuser-Busch, Incorporated | Synergistic organic solvent gellant |
| US4107426A (en) * | 1976-07-06 | 1978-08-15 | Roy Gerald Gordon | Process for treating cellulose |
| JPS5515906A (en) * | 1978-07-12 | 1980-02-04 | Toshiba Corp | Glass joining method |
| US4228277A (en) * | 1979-02-12 | 1980-10-14 | Hercules Incorporated | Modified nonionic cellulose ethers |
-
1979
- 1979-06-06 US US06/045,819 patent/US4243802A/en not_active Expired - Lifetime
-
1980
- 1980-03-25 CA CA000348330A patent/CA1137080A/en not_active Expired
- 1980-05-30 DE DE19803020689 patent/DE3020689A1/de active Granted
- 1980-06-04 NL NLAANVRAGE8003241,A patent/NL190121C/xx not_active IP Right Cessation
- 1980-06-05 GB GB8018468A patent/GB2053225B/en not_active Expired
- 1980-06-06 JP JP7653680A patent/JPS56801A/ja active Granted
Also Published As
| Publication number | Publication date |
|---|---|
| JPH0128042B2 (en:Method) | 1989-05-31 |
| NL190121B (nl) | 1993-06-01 |
| CA1137080A (en) | 1982-12-07 |
| US4243802A (en) | 1981-01-06 |
| GB2053225B (en) | 1983-03-02 |
| GB2053225A (en) | 1981-02-04 |
| NL8003241A (nl) | 1980-12-09 |
| JPS56801A (en) | 1981-01-07 |
| NL190121C (nl) | 1993-11-01 |
| DE3020689A1 (de) | 1981-01-22 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE3020689C2 (en:Method) | ||
| DE3004161C2 (en:Method) | ||
| DE2358150C2 (de) | Verfahren zum Herstellen von Wasser aufnehmenden, aber darin zu mehr als 50% unlöslichen Celluloseethern | |
| EP0080976B1 (de) | Gemische aus quaternären, polymeren Ammoniumsalzen auf Acrylbasis, aus quaternären, mono- bis oligomeren Ammoniumsalzen und aus Tensiden, deren Herstellung und Verwendung in kosmetischen Mitteln | |
| DE69129608T2 (de) | Niedrigviskose-Polysaccharidzusammensetzung mit hohem Festkörpergehalt | |
| DE69408454T3 (de) | Verfahren zur herstellung von amid-modifiziertem carboxyl enthaltenden polysaccharid und so erzeugtes fettsäureamid modifiziertes polysaccharid | |
| EP0147685B1 (de) | Ether des beta-Cyclodextrins und ein Verfahren zu ihrer Herstellung | |
| DE3883561T2 (de) | Hydrophobisch modifizierte, nichtionische Polygalaktomannanäther. | |
| DE3687142T2 (de) | Herstellung von wasserloeslichen chitin-oligomeren durch teilweise hydrolyse von chitin. | |
| EP0382150B1 (de) | Verfahren zur Herstellung von aktivierten Chitosanen und deren Verwendung bei der Herstellung von Chitosanderivaten | |
| DE69400928T2 (de) | Verwendung von beta-Cylodextrin und Verfahren zur Verbesserung von Verdickungsmitteln für Wässrige Systeme | |
| DE1215123B (de) | Verfahren zur Herstellung feinzerkleinerter, wasserunloeslicher Polysaccharidderivate von kolloidaler Teilchengroesse | |
| DE69521170T2 (de) | Guargummizusammensetzung und Verfahren zur deren Herstellung | |
| DE2412014A1 (de) | Nichtionische zelluloseaether | |
| DE3140637A1 (de) | Polymerhaltiges gemisch zum verdicken von waessrigen systemen, verfahren zu seiner herstellung sowie bohrfluessigkeit | |
| WO1998056828A1 (de) | Verfahren zur herstellung von reinem guarkernmehl | |
| EP0319867B1 (de) | Verfahren zur Herstellung von Sulfoethylcellulose mit hervorragender Lösungsqualität | |
| DE3025094A1 (de) | Vernetzte cellulosesulfatester, deren herstellung und verwendung | |
| EP0638589B1 (de) | Verfahren zur Herstellung von Inulinderivaten | |
| DE69528194T2 (de) | Verfahren zur herstellung einer wässrigen celluloseethersuspension und trockenmischung geeignet zur verwendung bei der herstellung der suspension | |
| EP1002804B1 (de) | Wasserlösliche sulfoalkylgruppenhaltige hydrophob modifizierte Celluloseether, Verfahren zu deren Herstellung sowie deren Verwendung als Schutzkolloide bei Polymerisationen | |
| DE3820030C1 (en:Method) | ||
| DE69018440T2 (de) | Verfahren zur herstellung von hyaluronsäure mit niedrigem molekulargewicht. | |
| EP0319865B1 (de) | Carboxymethylsulfoethylcellulose und Verfahren zu ihrer Herstellung | |
| DE3872346T2 (de) | Ionenaustauscher aus basis von vernetztem glukomannan. |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| 8128 | New person/name/address of the agent |
Representative=s name: LEDERER, F., DIPL.-CHEM. DR., PAT.-ANW., 8000 MUEN |
|
| 8110 | Request for examination paragraph 44 | ||
| 8125 | Change of the main classification |
Ipc: C08B 11/193 |
|
| D2 | Grant after examination | ||
| 8363 | Opposition against the patent | ||
| 8365 | Fully valid after opposition proceedings |