DE2942846C2 - - Google Patents
Info
- Publication number
- DE2942846C2 DE2942846C2 DE2942846A DE2942846A DE2942846C2 DE 2942846 C2 DE2942846 C2 DE 2942846C2 DE 2942846 A DE2942846 A DE 2942846A DE 2942846 A DE2942846 A DE 2942846A DE 2942846 C2 DE2942846 C2 DE 2942846C2
- Authority
- DE
- Germany
- Prior art keywords
- discharge vessel
- protuberance
- lamp
- outer bulb
- annular plate
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- QSHDDOUJBYECFT-UHFFFAOYSA-N mercury Chemical compound [Hg] QSHDDOUJBYECFT-UHFFFAOYSA-N 0.000 claims description 13
- 239000000463 material Substances 0.000 claims description 3
- 238000007142 ring opening reaction Methods 0.000 claims description 3
- 230000005855 radiation Effects 0.000 description 5
- 239000011521 glass Substances 0.000 description 4
- 229910052751 metal Inorganic materials 0.000 description 4
- 239000002184 metal Substances 0.000 description 4
- 229910003437 indium oxide Inorganic materials 0.000 description 3
- PJXISJQVUVHSOJ-UHFFFAOYSA-N indium(iii) oxide Chemical compound [O-2].[O-2].[O-2].[In+3].[In+3] PJXISJQVUVHSOJ-UHFFFAOYSA-N 0.000 description 3
- XKRFYHLGVUSROY-UHFFFAOYSA-N Argon Chemical compound [Ar] XKRFYHLGVUSROY-UHFFFAOYSA-N 0.000 description 2
- OAICVXFJPJFONN-UHFFFAOYSA-N Phosphorus Chemical compound [P] OAICVXFJPJFONN-UHFFFAOYSA-N 0.000 description 2
- 229910052753 mercury Inorganic materials 0.000 description 2
- 229910000497 Amalgam Inorganic materials 0.000 description 1
- 229910052693 Europium Inorganic materials 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- 229910052771 Terbium Inorganic materials 0.000 description 1
- GWEVSGVZZGPLCZ-UHFFFAOYSA-N Titan oxide Chemical compound O=[Ti]=O GWEVSGVZZGPLCZ-UHFFFAOYSA-N 0.000 description 1
- 150000004645 aluminates Chemical class 0.000 description 1
- 229910052782 aluminium Inorganic materials 0.000 description 1
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 description 1
- 229910052786 argon Inorganic materials 0.000 description 1
- 238000000149 argon plasma sintering Methods 0.000 description 1
- 238000005452 bending Methods 0.000 description 1
- 238000006243 chemical reaction Methods 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- OGPBJKLSAFTDLK-UHFFFAOYSA-N europium atom Chemical compound [Eu] OGPBJKLSAFTDLK-UHFFFAOYSA-N 0.000 description 1
- 239000004744 fabric Substances 0.000 description 1
- 230000002349 favourable effect Effects 0.000 description 1
- 239000011888 foil Substances 0.000 description 1
- 230000001939 inductive effect Effects 0.000 description 1
- 239000000203 mixture Substances 0.000 description 1
- SIWVEOZUMHYXCS-UHFFFAOYSA-N oxo(oxoyttriooxy)yttrium Chemical compound O=[Y]O[Y]=O SIWVEOZUMHYXCS-UHFFFAOYSA-N 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- GZCRRIHWUXGPOV-UHFFFAOYSA-N terbium atom Chemical compound [Tb] GZCRRIHWUXGPOV-UHFFFAOYSA-N 0.000 description 1
- OGIDPMRJRNCKJF-UHFFFAOYSA-N titanium oxide Inorganic materials [Ti]=O OGIDPMRJRNCKJF-UHFFFAOYSA-N 0.000 description 1
- 238000009423 ventilation Methods 0.000 description 1
Classifications
-
- H—ELECTRICITY
- H01—ELECTRIC ELEMENTS
- H01J—ELECTRIC DISCHARGE TUBES OR DISCHARGE LAMPS
- H01J61/00—Gas-discharge or vapour-discharge lamps
- H01J61/02—Details
- H01J61/52—Cooling arrangements; Heating arrangements; Means for circulating gas or vapour within the discharge space
Landscapes
- Vessels And Coating Films For Discharge Lamps (AREA)
- Discharge Lamps And Accessories Thereof (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| NL7810672A NL7810672A (nl) | 1978-10-26 | 1978-10-26 | Lagedrukkwikdampontladingslamp. |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DE2942846A1 DE2942846A1 (de) | 1980-05-08 |
| DE2942846C2 true DE2942846C2 (enExample) | 1988-07-07 |
Family
ID=19831781
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19792942846 Granted DE2942846A1 (de) | 1978-10-26 | 1979-10-24 | Niederdruckquecksilberdampfentladungslampe |
Country Status (8)
| Country | Link |
|---|---|
| US (1) | US4546284A (enExample) |
| JP (1) | JPS5559648A (enExample) |
| BE (1) | BE879612A (enExample) |
| CA (1) | CA1139818A (enExample) |
| DE (1) | DE2942846A1 (enExample) |
| FR (1) | FR2440074A1 (enExample) |
| GB (1) | GB2033653B (enExample) |
| NL (1) | NL7810672A (enExample) |
Cited By (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE9414514U1 (de) * | 1994-09-07 | 1994-11-03 | Anka-Handelsgesellschaft mbH Import-Export, 59757 Arnsberg | Niederdruckentladungslampe |
| DE29500786U1 (de) * | 1995-01-19 | 1995-04-06 | Piruzram, Mansur, 95180 Berg | Energiesparlampe |
| DE19501500A1 (de) * | 1995-01-19 | 1996-07-25 | Mansur Piruzram | Energiesparlampe |
Families Citing this family (24)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS5583147A (en) * | 1978-12-18 | 1980-06-23 | Toshiba Corp | Low-pressure mercury vapour discharge lamp |
| US4319162A (en) * | 1979-02-13 | 1982-03-09 | Westinghouse Electric Corp. | Fluorescent lamp having a convoluted tubular envelope of compact tridimensional configuration |
| US4871944A (en) * | 1979-02-13 | 1989-10-03 | North American Philips Corp. | Compact lighting unit having a convoluted fluorescent lamp with integral mercury-vapor pressure-regulating means, and method of phosphor-coating the convoluted envelope for such a lamp |
| US4300073A (en) * | 1979-02-13 | 1981-11-10 | Westinghouse Electric Corp. | Screw-in type lighting unit having a convoluted tridimensional fluorescent lamp |
| JPS5821379B2 (ja) * | 1979-06-11 | 1983-04-28 | 株式会社東芝 | けい光ランプ装置 |
| AU529323B2 (en) * | 1979-09-29 | 1983-06-02 | K.K. Toshiba | Fluorescent lamp |
| JPS5719959A (en) * | 1980-07-11 | 1982-02-02 | Toshiba Corp | Fluorescent lamp device |
| US4456854A (en) * | 1980-07-15 | 1984-06-26 | Tokyo Shibaura Denki Kabushiki Kaisha | Compact fluorescent lamp |
| JPS5727557A (en) * | 1980-07-28 | 1982-02-13 | Toshiba Corp | Fluorescent lamp device |
| EP0057974B1 (en) * | 1981-01-27 | 1985-01-30 | THORN EMI plc | Discharge lamp |
| DE3112878A1 (de) * | 1981-03-31 | 1982-10-14 | Patent-Treuhand-Gesellschaft für elektrische Glühlampen mbH, 8000 München | Quecksilberdampf-niederdruckentladungslampe und verfahren zur herstellung |
| DE3172957D1 (en) * | 1981-04-10 | 1986-01-02 | Toshiba Kk | A method of manufacturing a fluorescent lamp and a fluorescent lamp obtained by this method |
| JPS57202056A (en) * | 1981-06-05 | 1982-12-10 | Toshiba Corp | Fluorescent lamp unit |
| JPS57202638A (en) * | 1981-06-09 | 1982-12-11 | Toshiba Corp | Fluorescent lamp |
| USD277412S (en) | 1982-07-26 | 1985-01-29 | North American Philips Electric Corp. | Compact electric discharge lamp |
| GB2137407B (en) * | 1983-03-24 | 1986-09-24 | Emi Plc Thorn | Low pressure discharge lamps |
| NL8501340A (nl) * | 1985-05-10 | 1986-12-01 | Philips Nv | Lagedrukkwikdampontladingslamp. |
| JPS6276149A (ja) * | 1985-09-28 | 1987-04-08 | Toshiba Corp | けい光ランプ装置 |
| NL8600049A (nl) * | 1986-01-13 | 1987-08-03 | Philips Nv | Lagedrukkwikdampontladingslamp. |
| US4835442A (en) * | 1987-01-29 | 1989-05-30 | Kabushiki Kaisha Toshiba | Lamp for generating ultraviolet radiation |
| DE4133077C2 (de) * | 1991-10-02 | 1994-12-01 | Narva Gluehlampen | Kompakte Leuchtstofflampe |
| US5581157A (en) * | 1992-05-20 | 1996-12-03 | Diablo Research Corporation | Discharge lamps and methods for making discharge lamps |
| CN2378828Y (zh) * | 1999-05-26 | 2000-05-17 | 马士科技有限公司 | 低压汞蒸汽放电灯的冷端装置 |
| US20020145378A1 (en) * | 2001-04-04 | 2002-10-10 | Hui Ron Shu Yuen | Novel structures for electronically-controlled compact fluorescent lamps |
Family Cites Families (8)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB817100A (en) * | 1955-12-22 | 1959-07-22 | Gen Electric Co Ltd | Improvements in or relating to electric discharge lamps |
| NL42087C (enExample) * | 1933-11-06 | |||
| NL38910C (enExample) * | 1934-04-19 | |||
| DE837892C (de) * | 1950-06-14 | 1952-05-02 | Dominitwerke | Leuchtstoff- beziehungsweise Quecksilberdampflampe in Form einer gewoehnlichen Gluehlampe |
| GB835183A (en) * | 1957-05-07 | 1960-05-18 | Philips Electrical Ind Ltd | Improvements in or relating to low-pressure mercury vapour discharge tubes |
| GB845617A (en) * | 1958-05-02 | 1960-08-24 | Gen Electric Co Ltd | Improvements in or relating to sodium vapour electric discharge lamps |
| US3209188A (en) * | 1961-02-21 | 1965-09-28 | Westinghouse Electric Corp | Iodine-containing electric incandescent lamp with heat conserving envelope |
| NL180156C (nl) * | 1976-10-29 | 1987-01-02 | Philips Nv | Gas- en/of dampontladingslamp. |
-
1978
- 1978-10-26 NL NL7810672A patent/NL7810672A/nl not_active Application Discontinuation
-
1979
- 1979-09-28 FR FR7924162A patent/FR2440074A1/fr active Granted
- 1979-10-17 US US06/085,460 patent/US4546284A/en not_active Expired - Lifetime
- 1979-10-18 CA CA000337899A patent/CA1139818A/en not_active Expired
- 1979-10-23 GB GB7936791A patent/GB2033653B/en not_active Expired
- 1979-10-23 JP JP13604379A patent/JPS5559648A/ja active Granted
- 1979-10-24 BE BE0/197806A patent/BE879612A/fr not_active IP Right Cessation
- 1979-10-24 DE DE19792942846 patent/DE2942846A1/de active Granted
Cited By (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE9414514U1 (de) * | 1994-09-07 | 1994-11-03 | Anka-Handelsgesellschaft mbH Import-Export, 59757 Arnsberg | Niederdruckentladungslampe |
| DE29500786U1 (de) * | 1995-01-19 | 1995-04-06 | Piruzram, Mansur, 95180 Berg | Energiesparlampe |
| DE19501500A1 (de) * | 1995-01-19 | 1996-07-25 | Mansur Piruzram | Energiesparlampe |
Also Published As
| Publication number | Publication date |
|---|---|
| FR2440074A1 (fr) | 1980-05-23 |
| BE879612A (fr) | 1980-04-24 |
| CA1139818A (en) | 1983-01-18 |
| GB2033653A (en) | 1980-05-21 |
| DE2942846A1 (de) | 1980-05-08 |
| NL7810672A (nl) | 1980-04-29 |
| GB2033653B (en) | 1982-12-15 |
| US4546284A (en) | 1985-10-08 |
| FR2440074B1 (enExample) | 1982-04-23 |
| JPS6221222B2 (enExample) | 1987-05-12 |
| JPS5559648A (en) | 1980-05-06 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2942846C2 (enExample) | ||
| DE3232207C2 (enExample) | ||
| EP0338637B1 (de) | Hochdruck-Quecksilberdampfentladungslampe | |
| DE2835574A1 (de) | Niederdruckquecksilberdampfentladungslampe | |
| DE2809957C3 (de) | Leuchtstofflampe | |
| DE3011382A1 (de) | Niederdruckgasentladungslampe | |
| DE3111836A1 (de) | Niederdruckquecksilberdampfentladungslampe | |
| DE2906383C2 (de) | Hochdrucknatriumdampfentladungslampe | |
| EP0474065B1 (de) | Gasentladungsgefäss für Kompaktlampen | |
| DE3005017A1 (de) | Elektrische lampeneinheit | |
| DD248223A5 (de) | Niederdruckquecksilberdampfentladungslampe | |
| DE3133642A1 (de) | "hochdruckentladungslampe" | |
| DE10243867A1 (de) | Quecksilberfreie Bogenentladungsröhre für Entladungslampeneinheit | |
| DE69010258T2 (de) | Niederdruckquecksilberdampfentladungslampe. | |
| DE2616893A1 (de) | Bestrahlungslampe | |
| DE2619674C2 (de) | Halogen-Metalldampfentladungslampe | |
| DE1937938B2 (de) | Quecksilberdampfniederdruckentladungslampe mit Haupt- und Nebenamalgam | |
| DE10204691C1 (de) | Quecksilberfreie Hochdruckgasentladungslampe und Beleuchtungseinheit mit einer solchen Hochdruckgasentladungslampe | |
| DE69807020T2 (de) | Niederdruckquecksilberentladungslampe | |
| DE2725412A1 (de) | Niederdruckgasentladungslampe | |
| DE3109538A1 (de) | Leuchtstofflampe mit leuchtstoffkombination | |
| DE3810383A1 (de) | Elektrische kocheinheit und damit versehenes elektrisches kochgeraet | |
| DD284103A5 (de) | Elektrische lampe | |
| EP0040812A1 (de) | Niederdruck-Entladungslampe | |
| DE3140839A1 (de) | Flaechenfoermige quecksilberdampf-niederdruckentladungslampe |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| 8110 | Request for examination paragraph 44 | ||
| D2 | Grant after examination | ||
| 8364 | No opposition during term of opposition | ||
| 8339 | Ceased/non-payment of the annual fee |