DE2924663C2 - Verfahren zur Herstellung einer wäßrigen Dispersion aus wasserlöslicher Polymermasse - Google Patents
Verfahren zur Herstellung einer wäßrigen Dispersion aus wasserlöslicher PolymermasseInfo
- Publication number
- DE2924663C2 DE2924663C2 DE2924663A DE2924663A DE2924663C2 DE 2924663 C2 DE2924663 C2 DE 2924663C2 DE 2924663 A DE2924663 A DE 2924663A DE 2924663 A DE2924663 A DE 2924663A DE 2924663 C2 DE2924663 C2 DE 2924663C2
- Authority
- DE
- Germany
- Prior art keywords
- water
- polymerization
- viscosity
- soluble
- weight
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 239000006185 dispersion Substances 0.000 title claims description 125
- 229920003169 water-soluble polymer Polymers 0.000 title claims description 36
- 238000000034 method Methods 0.000 title claims description 32
- 238000002360 preparation method Methods 0.000 title claims description 6
- 239000000203 mixture Substances 0.000 title description 13
- 238000006116 polymerization reaction Methods 0.000 claims description 86
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 81
- 229920000642 polymer Polymers 0.000 claims description 74
- 239000007864 aqueous solution Substances 0.000 claims description 52
- 239000000178 monomer Substances 0.000 claims description 44
- 239000002202 Polyethylene glycol Substances 0.000 claims description 29
- 229920001223 polyethylene glycol Polymers 0.000 claims description 29
- HRPVXLWXLXDGHG-UHFFFAOYSA-N Acrylamide Chemical compound NC(=O)C=C HRPVXLWXLXDGHG-UHFFFAOYSA-N 0.000 claims description 18
- 125000004432 carbon atom Chemical group C* 0.000 claims description 17
- 238000006243 chemical reaction Methods 0.000 claims description 17
- 239000003960 organic solvent Substances 0.000 claims description 16
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 15
- NIXOWILDQLNWCW-UHFFFAOYSA-N 2-Propenoic acid Natural products OC(=O)C=C NIXOWILDQLNWCW-UHFFFAOYSA-N 0.000 claims description 12
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 claims description 12
- SMZOUWXMTYCWNB-UHFFFAOYSA-N 2-(2-methoxy-5-methylphenyl)ethanamine Chemical compound COC1=CC=C(C)C=C1CCN SMZOUWXMTYCWNB-UHFFFAOYSA-N 0.000 claims description 11
- 239000004372 Polyvinyl alcohol Substances 0.000 claims description 10
- 229920002451 polyvinyl alcohol Polymers 0.000 claims description 10
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 9
- 229920000036 polyvinylpyrrolidone Polymers 0.000 claims description 9
- 239000001267 polyvinylpyrrolidone Substances 0.000 claims description 9
- 235000013855 polyvinylpyrrolidone Nutrition 0.000 claims description 9
- 229920003171 Poly (ethylene oxide) Polymers 0.000 claims description 8
- DNIAPMSPPWPWGF-UHFFFAOYSA-N Propylene glycol Chemical compound CC(O)CO DNIAPMSPPWPWGF-UHFFFAOYSA-N 0.000 claims description 8
- 150000003839 salts Chemical class 0.000 claims description 8
- 125000000217 alkyl group Chemical group 0.000 claims description 7
- 239000003999 initiator Substances 0.000 claims description 7
- JKNCOURZONDCGV-UHFFFAOYSA-N 2-(dimethylamino)ethyl 2-methylprop-2-enoate Chemical compound CN(C)CCOC(=O)C(C)=C JKNCOURZONDCGV-UHFFFAOYSA-N 0.000 claims description 6
- 229920002472 Starch Polymers 0.000 claims description 6
- 125000005843 halogen group Chemical group 0.000 claims description 6
- 235000019698 starch Nutrition 0.000 claims description 6
- 239000008107 starch Substances 0.000 claims description 6
- CERQOIWHTDAKMF-UHFFFAOYSA-N Methacrylic acid Chemical compound CC(=C)C(O)=O CERQOIWHTDAKMF-UHFFFAOYSA-N 0.000 claims description 5
- 229920002873 Polyethylenimine Polymers 0.000 claims description 5
- 229920001451 polypropylene glycol Polymers 0.000 claims description 5
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 claims description 4
- WHNPOQXWAMXPTA-UHFFFAOYSA-N 3-methylbut-2-enamide Chemical class CC(C)=CC(N)=O WHNPOQXWAMXPTA-UHFFFAOYSA-N 0.000 claims description 3
- 229910052783 alkali metal Inorganic materials 0.000 claims description 3
- 150000001340 alkali metals Chemical class 0.000 claims description 3
- 229920001577 copolymer Polymers 0.000 claims description 3
- 125000002768 hydroxyalkyl group Chemical group 0.000 claims description 3
- 229920002717 polyvinylpyridine Polymers 0.000 claims description 3
- QHVBLSNVXDSMEB-UHFFFAOYSA-N 2-(diethylamino)ethyl prop-2-enoate Chemical compound CCN(CC)CCOC(=O)C=C QHVBLSNVXDSMEB-UHFFFAOYSA-N 0.000 claims description 2
- 229910019142 PO4 Inorganic materials 0.000 claims description 2
- 125000002947 alkylene group Chemical group 0.000 claims description 2
- 229910021529 ammonia Inorganic materials 0.000 claims description 2
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 claims description 2
- 150000001875 compounds Chemical class 0.000 claims description 2
- 229910052751 metal Inorganic materials 0.000 claims description 2
- 239000002184 metal Substances 0.000 claims description 2
- 150000002739 metals Chemical class 0.000 claims description 2
- UUORTJUPDJJXST-UHFFFAOYSA-N n-(2-hydroxyethyl)prop-2-enamide Chemical compound OCCNC(=O)C=C UUORTJUPDJJXST-UHFFFAOYSA-N 0.000 claims description 2
- 150000002823 nitrates Chemical class 0.000 claims description 2
- 235000021317 phosphate Nutrition 0.000 claims description 2
- 150000003013 phosphoric acid derivatives Chemical class 0.000 claims description 2
- 150000003467 sulfuric acid derivatives Chemical class 0.000 claims description 2
- 239000003513 alkali Substances 0.000 claims 2
- 150000001252 acrylic acid derivatives Chemical class 0.000 claims 1
- 150000003841 chloride salts Chemical class 0.000 claims 1
- 150000002734 metacrylic acid derivatives Chemical class 0.000 claims 1
- 125000000896 monocarboxylic acid group Chemical group 0.000 claims 1
- 239000000243 solution Substances 0.000 description 59
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 21
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 15
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 12
- 238000003756 stirring Methods 0.000 description 10
- 239000003505 polymerization initiator Substances 0.000 description 8
- NLHHRLWOUZZQLW-UHFFFAOYSA-N Acrylonitrile Chemical compound C=CC#N NLHHRLWOUZZQLW-UHFFFAOYSA-N 0.000 description 7
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 7
- 239000011541 reaction mixture Substances 0.000 description 7
- 230000000052 comparative effect Effects 0.000 description 6
- 239000000843 powder Substances 0.000 description 6
- 239000000047 product Substances 0.000 description 6
- 239000011780 sodium chloride Substances 0.000 description 6
- 239000004094 surface-active agent Substances 0.000 description 6
- MHAJPDPJQMAIIY-UHFFFAOYSA-N Hydrogen peroxide Chemical compound OO MHAJPDPJQMAIIY-UHFFFAOYSA-N 0.000 description 5
- WHNWPMSKXPGLAX-UHFFFAOYSA-N N-Vinyl-2-pyrrolidone Chemical compound C=CN1CCCC1=O WHNWPMSKXPGLAX-UHFFFAOYSA-N 0.000 description 5
- ROOXNKNUYICQNP-UHFFFAOYSA-N ammonium persulfate Chemical compound [NH4+].[NH4+].[O-]S(=O)(=O)OOS([O-])(=O)=O ROOXNKNUYICQNP-UHFFFAOYSA-N 0.000 description 5
- 229910001873 dinitrogen Inorganic materials 0.000 description 5
- 229920001495 poly(sodium acrylate) polymer Polymers 0.000 description 5
- 229920002401 polyacrylamide Polymers 0.000 description 5
- XTXRWKRVRITETP-UHFFFAOYSA-N Vinyl acetate Chemical compound CC(=O)OC=C XTXRWKRVRITETP-UHFFFAOYSA-N 0.000 description 4
- 230000015572 biosynthetic process Effects 0.000 description 4
- 238000010790 dilution Methods 0.000 description 4
- 239000012895 dilution Substances 0.000 description 4
- 229910017053 inorganic salt Inorganic materials 0.000 description 4
- 239000002245 particle Substances 0.000 description 4
- 150000003254 radicals Chemical class 0.000 description 4
- ZWEHNKRNPOVVGH-UHFFFAOYSA-N 2-Butanone Chemical compound CCC(C)=O ZWEHNKRNPOVVGH-UHFFFAOYSA-N 0.000 description 3
- 239000005995 Aluminium silicate Substances 0.000 description 3
- PEDCQBHIVMGVHV-UHFFFAOYSA-N Glycerine Chemical compound OCC(O)CO PEDCQBHIVMGVHV-UHFFFAOYSA-N 0.000 description 3
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 3
- DWAQJAXMDSEUJJ-UHFFFAOYSA-M Sodium bisulfite Chemical compound [Na+].OS([O-])=O DWAQJAXMDSEUJJ-UHFFFAOYSA-M 0.000 description 3
- -1 alkylene radical Chemical class 0.000 description 3
- 235000012211 aluminium silicate Nutrition 0.000 description 3
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 3
- 239000003795 chemical substances by application Substances 0.000 description 3
- 230000000977 initiatory effect Effects 0.000 description 3
- NLYAJNPCOHFWQQ-UHFFFAOYSA-N kaolin Chemical compound O.O.O=[Al]O[Si](=O)O[Si](=O)O[Al]=O NLYAJNPCOHFWQQ-UHFFFAOYSA-N 0.000 description 3
- 238000004811 liquid chromatography Methods 0.000 description 3
- 238000006386 neutralization reaction Methods 0.000 description 3
- 239000007764 o/w emulsion Substances 0.000 description 3
- 238000005191 phase separation Methods 0.000 description 3
- 235000010267 sodium hydrogen sulphite Nutrition 0.000 description 3
- OZFIGURLAJSLIR-UHFFFAOYSA-N 1-ethenyl-2h-pyridine Chemical compound C=CN1CC=CC=C1 OZFIGURLAJSLIR-UHFFFAOYSA-N 0.000 description 2
- QLIBJPGWWSHWBF-UHFFFAOYSA-N 2-aminoethyl methacrylate Chemical compound CC(=C)C(=O)OCCN QLIBJPGWWSHWBF-UHFFFAOYSA-N 0.000 description 2
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 2
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 2
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 2
- CERQOIWHTDAKMF-UHFFFAOYSA-M Methacrylate Chemical compound CC(=C)C([O-])=O CERQOIWHTDAKMF-UHFFFAOYSA-M 0.000 description 2
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 2
- GSEJCLTVZPLZKY-UHFFFAOYSA-N Triethanolamine Chemical compound OCCN(CCO)CCO GSEJCLTVZPLZKY-UHFFFAOYSA-N 0.000 description 2
- YZCKVEUIGOORGS-NJFSPNSNSA-N Tritium Chemical compound [3H] YZCKVEUIGOORGS-NJFSPNSNSA-N 0.000 description 2
- 239000000654 additive Substances 0.000 description 2
- 229910001870 ammonium persulfate Inorganic materials 0.000 description 2
- ZCCIPPOKBCJFDN-UHFFFAOYSA-N calcium nitrate Chemical compound [Ca+2].[O-][N+]([O-])=O.[O-][N+]([O-])=O ZCCIPPOKBCJFDN-UHFFFAOYSA-N 0.000 description 2
- 239000003093 cationic surfactant Substances 0.000 description 2
- 239000007795 chemical reaction product Substances 0.000 description 2
- 238000007865 diluting Methods 0.000 description 2
- 239000004815 dispersion polymer Substances 0.000 description 2
- 238000001035 drying Methods 0.000 description 2
- 238000000605 extraction Methods 0.000 description 2
- 239000010419 fine particle Substances 0.000 description 2
- 239000008394 flocculating agent Substances 0.000 description 2
- 238000005189 flocculation Methods 0.000 description 2
- 230000016615 flocculation Effects 0.000 description 2
- 238000011010 flushing procedure Methods 0.000 description 2
- 238000010528 free radical solution polymerization reaction Methods 0.000 description 2
- 229920006158 high molecular weight polymer Polymers 0.000 description 2
- 238000004519 manufacturing process Methods 0.000 description 2
- 239000000463 material Substances 0.000 description 2
- FQPSGWSUVKBHSU-UHFFFAOYSA-N methacrylamide Chemical compound CC(=C)C(N)=O FQPSGWSUVKBHSU-UHFFFAOYSA-N 0.000 description 2
- YPHQUSNPXDGUHL-UHFFFAOYSA-N n-methylprop-2-enamide Chemical compound CNC(=O)C=C YPHQUSNPXDGUHL-UHFFFAOYSA-N 0.000 description 2
- 229910052757 nitrogen Inorganic materials 0.000 description 2
- 239000002736 nonionic surfactant Substances 0.000 description 2
- 238000010992 reflux Methods 0.000 description 2
- VWDWKYIASSYTQR-UHFFFAOYSA-N sodium nitrate Chemical compound [Na+].[O-][N+]([O-])=O VWDWKYIASSYTQR-UHFFFAOYSA-N 0.000 description 2
- SONHXMAHPHADTF-UHFFFAOYSA-M sodium;2-methylprop-2-enoate Chemical compound [Na+].CC(=C)C([O-])=O SONHXMAHPHADTF-UHFFFAOYSA-M 0.000 description 2
- 239000002904 solvent Substances 0.000 description 2
- 238000003860 storage Methods 0.000 description 2
- 239000002562 thickening agent Substances 0.000 description 2
- 239000007762 w/o emulsion Substances 0.000 description 2
- BNGXYYYYKUGPPF-UHFFFAOYSA-M (3-methylphenyl)methyl-triphenylphosphanium;chloride Chemical compound [Cl-].CC1=CC=CC(C[P+](C=2C=CC=CC=2)(C=2C=CC=CC=2)C=2C=CC=CC=2)=C1 BNGXYYYYKUGPPF-UHFFFAOYSA-M 0.000 description 1
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 1
- PQUXFUBNSYCQAL-UHFFFAOYSA-N 1-(2,3-difluorophenyl)ethanone Chemical compound CC(=O)C1=CC=CC(F)=C1F PQUXFUBNSYCQAL-UHFFFAOYSA-N 0.000 description 1
- PAWQVTBBRAZDMG-UHFFFAOYSA-N 2-(3-bromo-2-fluorophenyl)acetic acid Chemical compound OC(=O)CC1=CC=CC(Br)=C1F PAWQVTBBRAZDMG-UHFFFAOYSA-N 0.000 description 1
- DPBJAVGHACCNRL-UHFFFAOYSA-N 2-(dimethylamino)ethyl prop-2-enoate Chemical compound CN(C)CCOC(=O)C=C DPBJAVGHACCNRL-UHFFFAOYSA-N 0.000 description 1
- HMENQNSSJFLQOP-UHFFFAOYSA-N 2-bromoprop-2-enoic acid Chemical compound OC(=O)C(Br)=C HMENQNSSJFLQOP-UHFFFAOYSA-N 0.000 description 1
- SZTBMYHIYNGYIA-UHFFFAOYSA-N 2-chloroacrylic acid Chemical compound OC(=O)C(Cl)=C SZTBMYHIYNGYIA-UHFFFAOYSA-N 0.000 description 1
- VAPQAGMSICPBKJ-UHFFFAOYSA-N 2-nitroacridine Chemical compound C1=CC=CC2=CC3=CC([N+](=O)[O-])=CC=C3N=C21 VAPQAGMSICPBKJ-UHFFFAOYSA-N 0.000 description 1
- KGIGUEBEKRSTEW-UHFFFAOYSA-N 2-vinylpyridine Chemical compound C=CC1=CC=CC=N1 KGIGUEBEKRSTEW-UHFFFAOYSA-N 0.000 description 1
- SLRMQYXOBQWXCR-UHFFFAOYSA-N 2154-56-5 Chemical compound [CH2]C1=CC=CC=C1 SLRMQYXOBQWXCR-UHFFFAOYSA-N 0.000 description 1
- 239000004160 Ammonium persulphate Substances 0.000 description 1
- UXVMQQNJUSDDNG-UHFFFAOYSA-L Calcium chloride Chemical compound [Cl-].[Cl-].[Ca+2] UXVMQQNJUSDDNG-UHFFFAOYSA-L 0.000 description 1
- FXHOOIRPVKKKFG-UHFFFAOYSA-N N,N-Dimethylacetamide Chemical compound CN(C)C(C)=O FXHOOIRPVKKKFG-UHFFFAOYSA-N 0.000 description 1
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 1
- 241000220317 Rosa Species 0.000 description 1
- 238000005147 X-ray Weissenberg Methods 0.000 description 1
- OBHBXMOWIKWQNI-UHFFFAOYSA-N [3-(dimethylamino)-2-hydroxypropyl] 2-methylprop-2-enoate Chemical compound CN(C)CC(O)COC(=O)C(C)=C OBHBXMOWIKWQNI-UHFFFAOYSA-N 0.000 description 1
- 239000000853 adhesive Substances 0.000 description 1
- 230000001070 adhesive effect Effects 0.000 description 1
- 238000013019 agitation Methods 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- PNEYBMLMFCGWSK-UHFFFAOYSA-N aluminium oxide Inorganic materials [O-2].[O-2].[O-2].[Al+3].[Al+3] PNEYBMLMFCGWSK-UHFFFAOYSA-N 0.000 description 1
- 150000001408 amides Chemical class 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- 235000019395 ammonium persulphate Nutrition 0.000 description 1
- 125000000129 anionic group Chemical group 0.000 description 1
- 239000012736 aqueous medium Substances 0.000 description 1
- 239000008346 aqueous phase Substances 0.000 description 1
- 239000007900 aqueous suspension Substances 0.000 description 1
- 239000012298 atmosphere Substances 0.000 description 1
- 229910001570 bauxite Inorganic materials 0.000 description 1
- 239000011324 bead Substances 0.000 description 1
- 230000009286 beneficial effect Effects 0.000 description 1
- 239000001110 calcium chloride Substances 0.000 description 1
- 229910001628 calcium chloride Inorganic materials 0.000 description 1
- 239000001506 calcium phosphate Substances 0.000 description 1
- 229910000389 calcium phosphate Inorganic materials 0.000 description 1
- 235000011010 calcium phosphates Nutrition 0.000 description 1
- 239000003638 chemical reducing agent Substances 0.000 description 1
- 150000001805 chlorine compounds Chemical class 0.000 description 1
- 238000005345 coagulation Methods 0.000 description 1
- 230000015271 coagulation Effects 0.000 description 1
- 239000003086 colorant Substances 0.000 description 1
- 239000012141 concentrate Substances 0.000 description 1
- 230000003750 conditioning effect Effects 0.000 description 1
- 238000011109 contamination Methods 0.000 description 1
- 239000013256 coordination polymer Substances 0.000 description 1
- 230000000875 corresponding effect Effects 0.000 description 1
- 239000002537 cosmetic Substances 0.000 description 1
- 239000003599 detergent Substances 0.000 description 1
- HIEJNBWZYPLLFE-UHFFFAOYSA-N diazanium;2-methylprop-2-enoate;prop-2-enoate Chemical compound [NH4+].[NH4+].[O-]C(=O)C=C.CC(=C)C([O-])=O HIEJNBWZYPLLFE-UHFFFAOYSA-N 0.000 description 1
- 239000002270 dispersing agent Substances 0.000 description 1
- 239000003814 drug Substances 0.000 description 1
- 229940079593 drug Drugs 0.000 description 1
- 239000000975 dye Substances 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 239000003995 emulsifying agent Substances 0.000 description 1
- 150000002170 ethers Chemical class 0.000 description 1
- DJLHXXNSHHGFLB-UHFFFAOYSA-N ethyl 2-methylprop-2-enoate;n-methylmethanamine Chemical compound CNC.CCOC(=O)C(C)=C DJLHXXNSHHGFLB-UHFFFAOYSA-N 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 230000009969 flowable effect Effects 0.000 description 1
- 235000013305 food Nutrition 0.000 description 1
- 235000013373 food additive Nutrition 0.000 description 1
- 239000002778 food additive Substances 0.000 description 1
- 229910052739 hydrogen Inorganic materials 0.000 description 1
- 230000002209 hydrophobic effect Effects 0.000 description 1
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 1
- RUTXIHLAWFEWGM-UHFFFAOYSA-H iron(3+) sulfate Chemical compound [Fe+3].[Fe+3].[O-]S([O-])(=O)=O.[O-]S([O-])(=O)=O.[O-]S([O-])(=O)=O RUTXIHLAWFEWGM-UHFFFAOYSA-H 0.000 description 1
- 229910000360 iron(III) sulfate Inorganic materials 0.000 description 1
- 150000002576 ketones Chemical class 0.000 description 1
- 229920000126 latex Polymers 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- FPYJFEHAWHCUMM-UHFFFAOYSA-N maleic anhydride Chemical compound O=C1OC(=O)C=C1 FPYJFEHAWHCUMM-UHFFFAOYSA-N 0.000 description 1
- 239000002609 medium Substances 0.000 description 1
- WFKDPJRCBCBQNT-UHFFFAOYSA-N n,2-dimethylprop-2-enamide Chemical compound CNC(=O)C(C)=C WFKDPJRCBCBQNT-UHFFFAOYSA-N 0.000 description 1
- BSCJIBOZTKGXQP-UHFFFAOYSA-N n-(2-hydroxyethyl)-2-methylprop-2-enamide Chemical compound CC(=C)C(=O)NCCO BSCJIBOZTKGXQP-UHFFFAOYSA-N 0.000 description 1
- 239000012053 oil suspension Substances 0.000 description 1
- 239000002304 perfume Substances 0.000 description 1
- 239000000049 pigment Substances 0.000 description 1
- 230000000379 polymerizing effect Effects 0.000 description 1
- USHAGKDGDHPEEY-UHFFFAOYSA-L potassium persulfate Chemical compound [K+].[K+].[O-]S(=O)(=O)OOS([O-])(=O)=O USHAGKDGDHPEEY-UHFFFAOYSA-L 0.000 description 1
- OTYBMLCTZGSZBG-UHFFFAOYSA-L potassium sulfate Chemical compound [K+].[K+].[O-]S([O-])(=O)=O OTYBMLCTZGSZBG-UHFFFAOYSA-L 0.000 description 1
- 229910052939 potassium sulfate Inorganic materials 0.000 description 1
- 235000011151 potassium sulphates Nutrition 0.000 description 1
- LLLCSBYSPJHDJX-UHFFFAOYSA-M potassium;2-methylprop-2-enoate Chemical compound [K+].CC(=C)C([O-])=O LLLCSBYSPJHDJX-UHFFFAOYSA-M 0.000 description 1
- 238000001556 precipitation Methods 0.000 description 1
- 238000012673 precipitation polymerization Methods 0.000 description 1
- 230000000750 progressive effect Effects 0.000 description 1
- BDERNNFJNOPAEC-UHFFFAOYSA-N propan-1-ol Chemical compound CCCO BDERNNFJNOPAEC-UHFFFAOYSA-N 0.000 description 1
- 238000010298 pulverizing process Methods 0.000 description 1
- 238000010926 purge Methods 0.000 description 1
- 239000012429 reaction media Substances 0.000 description 1
- 238000011084 recovery Methods 0.000 description 1
- 235000013580 sausages Nutrition 0.000 description 1
- 238000000926 separation method Methods 0.000 description 1
- 229940047670 sodium acrylate Drugs 0.000 description 1
- 235000010344 sodium nitrate Nutrition 0.000 description 1
- 239000004317 sodium nitrate Substances 0.000 description 1
- 229910052979 sodium sulfide Inorganic materials 0.000 description 1
- GRVFOGOEDUUMBP-UHFFFAOYSA-N sodium sulfide (anhydrous) Chemical compound [Na+].[Na+].[S-2] GRVFOGOEDUUMBP-UHFFFAOYSA-N 0.000 description 1
- 239000002689 soil Substances 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 230000000087 stabilizing effect Effects 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
- 238000010557 suspension polymerization reaction Methods 0.000 description 1
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 1
- QORWJWZARLRLPR-UHFFFAOYSA-H tricalcium bis(phosphate) Chemical compound [Ca+2].[Ca+2].[Ca+2].[O-]P([O-])([O-])=O.[O-]P([O-])([O-])=O QORWJWZARLRLPR-UHFFFAOYSA-H 0.000 description 1
- 238000004065 wastewater treatment Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08F—MACROMOLECULAR COMPOUNDS OBTAINED BY REACTIONS ONLY INVOLVING CARBON-TO-CARBON UNSATURATED BONDS
- C08F2/00—Processes of polymerisation
- C08F2/04—Polymerisation in solution
- C08F2/10—Aqueous solvent
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08F—MACROMOLECULAR COMPOUNDS OBTAINED BY REACTIONS ONLY INVOLVING CARBON-TO-CARBON UNSATURATED BONDS
- C08F291/00—Macromolecular compounds obtained by polymerising monomers on to macromolecular compounds according to more than one of the groups C08F251/00 - C08F289/00
Landscapes
- Chemical & Material Sciences (AREA)
- Health & Medical Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Medicinal Chemistry (AREA)
- Polymers & Plastics (AREA)
- Organic Chemistry (AREA)
- Compositions Of Macromolecular Compounds (AREA)
- Addition Polymer Or Copolymer, Post-Treatments, Or Chemical Modifications (AREA)
- Graft Or Block Polymers (AREA)
- Cosmetics (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| JP7323278A JPS55721A (en) | 1978-06-19 | 1978-06-19 | Aqueous dispersion of water-soluble high polymer complex |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DE2924663A1 DE2924663A1 (de) | 1979-12-20 |
| DE2924663C2 true DE2924663C2 (de) | 1983-08-04 |
Family
ID=13512224
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE2924663A Expired DE2924663C2 (de) | 1978-06-19 | 1979-06-19 | Verfahren zur Herstellung einer wäßrigen Dispersion aus wasserlöslicher Polymermasse |
Country Status (4)
| Country | Link |
|---|---|
| US (1) | US4380600A (enExample) |
| JP (1) | JPS55721A (enExample) |
| DE (1) | DE2924663C2 (enExample) |
| FR (1) | FR2429225A1 (enExample) |
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US7608208B2 (en) | 2001-04-10 | 2009-10-27 | Evonik Stockhausen Gmbh | Additives for water for fire protection |
Families Citing this family (81)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| NL190611C (nl) * | 1979-12-21 | 1994-05-16 | Hercules Inc | Entcopolymeer in deeltjesvorm en werkwijze voor het bereiden van papier waarbij een dergelijk entcopolymeer wordt toegepast. |
| DE3265276D1 (en) * | 1981-11-23 | 1985-09-12 | Agfa Gevaert Nv | Method for the preparation of stable aqueous dispersions of polymer beads and the use of these dispersions in photographic elements |
| NZ204799A (en) * | 1982-07-12 | 1986-01-24 | Dulux Australia Ltd | Aqueous dispersion of particles of film-forming addition polymer,at least one comonomer of which is amphipathic |
| DE3318218A1 (de) * | 1983-05-19 | 1984-11-22 | Basf Ag, 6700 Ludwigshafen | Verfahren zur herstellung von wasser-in-wasser-sekundaerdispersionen von wasserloeslichen polymerisaten und deren verwendung als flockungsmittel |
| GB8416454D0 (en) * | 1984-06-28 | 1984-08-01 | Allied Colloids Ltd | Polymer powders |
| GB8416453D0 (en) * | 1984-06-28 | 1984-08-01 | Allied Colloids Ltd | Aqueous polymer dispersions |
| CA1267483A (en) * | 1984-11-19 | 1990-04-03 | Hisao Takeda | Process for the production of a water-soluble polymer dispersion |
| GB8602649D0 (en) * | 1986-02-04 | 1986-03-12 | Allied Colloids Ltd | Polymers |
| JP2698370B2 (ja) * | 1988-04-01 | 1998-01-19 | 三井東圧化学株式会社 | ポリビニルアルコール系グラフト共重合体からなる繊維および膜 |
| JPH0651755B2 (ja) * | 1988-10-14 | 1994-07-06 | ハイモ株式会社 | 水溶性カチオンポリマー分散液の製造方法 |
| US5055541A (en) * | 1989-06-27 | 1991-10-08 | Sequa Chemicals, Inc. | Starch polymer graft composition and method of preparation |
| DE4111334A1 (de) * | 1990-11-14 | 1992-05-21 | Henkel Kgaa | Neue wasser-in-oel-emulsionen |
| US5200459A (en) * | 1991-05-31 | 1993-04-06 | Lord Corporation | Stable butadiene heteropolymer latices |
| US5118752A (en) * | 1991-10-15 | 1992-06-02 | Ppg Industries, Inc. | Vinyl polymer latex systems |
| DE4216167A1 (de) * | 1992-05-18 | 1993-11-25 | Roehm Gmbh | Wasserlösliche Polymerdispersionen |
| US5225474A (en) * | 1992-08-18 | 1993-07-06 | Isp Investments Inc. | Emulsion polymerization composition |
| DE4316200A1 (de) * | 1993-05-14 | 1994-11-17 | Roehm Gmbh | Verfahren zur Herstellung niedrigviskoser, wasserlöslicher Polymerdispersionen |
| DE4318033C2 (de) * | 1993-05-29 | 1996-08-29 | Hoechst Ag | Carboxylgruppenhaltige Copolymerisate in wäßriger Dispersionsform oder redispergierbarer Pulverform und ihre wasserlöslichen Salze, Verfahren zu ihrer Herstellung und ihre Verwendung als Verdicker in wäßrigen Zubereitungen |
| US5705553A (en) * | 1993-05-29 | 1998-01-06 | Hoechst Aktiengesellschaft | Copolymers containing carboxyl groups in aqueous dispersion form or redispersible powder form and their water-soluble salts, processes for their preparation and their use as thickeners in aqueous formulations |
| US5597858A (en) * | 1993-06-10 | 1997-01-28 | Nalco Chemical Company | Hydrophobically associating dispersants used in forming polymer dispersions |
| DE4335567A1 (de) * | 1993-10-19 | 1995-04-20 | Roehm Gmbh | Verfahren zur Herstellung von wasserlöslichen Polymerdispersionen mit hohem Polymeranteil |
| US5643460A (en) * | 1994-01-14 | 1997-07-01 | Nalco/Exxon Energy Chemicals, L. P. | Method for separating oil from water in petroleum production |
| DE4406624A1 (de) * | 1994-03-01 | 1995-09-07 | Roehm Gmbh | Vernetzte wasserlösliche Polymerdispersionen |
| US5708071A (en) * | 1994-12-15 | 1998-01-13 | Hymo Corporation | Aqueous dispersion of an amphoteric water-soluble polymer, a method of manufacturing the same, and a treating agent comprising the same |
| FR2729089A1 (fr) * | 1995-01-10 | 1996-07-12 | Snf Sa | Procede pour preparer des emulsions stables de polyelectrolytes de haut poids moleculaire en emulsion-inverse |
| SE9502522D0 (sv) * | 1995-07-07 | 1995-07-07 | Eka Nobel Ab | A process for the production of paper |
| DE19532229A1 (de) * | 1995-08-31 | 1997-03-06 | Roehm Gmbh | Vernetzte wasserlösliche Polymerdispersionen |
| US5686024A (en) * | 1995-12-18 | 1997-11-11 | Rhone-Poulenc Surfactants & Specialties, L.P. | Aqueous dispersion of a surface active polymer having enhanced performance properties |
| DE19606899C2 (de) * | 1996-02-13 | 2002-11-21 | Fraunhofer Ges Forschung | Verfahren zur Herstellung von Dispersionen wasserlöslicher Vinylpolymere und Stabilisator zur Durchführung des Verfahrens |
| US5696228A (en) * | 1996-10-03 | 1997-12-09 | Cytec Technology Corp. | Process for producing substantially dry polymer particles from aqueous dispersions |
| US6013708A (en) * | 1996-10-03 | 2000-01-11 | Cytec Technology Corp. | Cationic water-soluble polymer precipitation in salt solutions |
| US5792366A (en) * | 1996-10-03 | 1998-08-11 | Cytec Technology Corp. | Aqueous dispersions |
| US6664326B1 (en) | 1996-10-03 | 2003-12-16 | Cytec Technology Corp. | Aqueous dispersions |
| US5843320A (en) * | 1996-10-03 | 1998-12-01 | Cytec Technology Corp. | Aqueous dispersions |
| US5733462A (en) * | 1996-10-03 | 1998-03-31 | Cytec Technology Corp. | Cationic water-soluble polymer precipitation in salt solutions |
| US6702946B1 (en) | 1996-10-03 | 2004-03-09 | Cytec Technology Corp. | Aqueous dispersions |
| US6608124B1 (en) | 1996-10-03 | 2003-08-19 | Cytec Technology Corp. | Aqueous dispersions |
| US5725779A (en) * | 1996-10-03 | 1998-03-10 | Cytec Technology Corp. | Anionic water-soluble polymer precipitation in salt solution |
| US5738794A (en) * | 1996-10-03 | 1998-04-14 | Cytec Technology Corp. | Cationic water-soluble polymer preciptation in salt solutions |
| US6310124B1 (en) * | 1996-10-03 | 2001-10-30 | Cytec Technology, Corp. | Aqueous dispersions |
| US5889097A (en) * | 1996-10-03 | 1999-03-30 | Cytec Technology Corp. | Anionic water-soluble polymer precipitation in salt solution |
| US5919854A (en) * | 1996-10-03 | 1999-07-06 | Cytec Technology Corp. | Process for preparing aqueous dispersions |
| US6020422A (en) * | 1996-11-15 | 2000-02-01 | Betzdearborn Inc. | Aqueous dispersion polymers |
| MY120719A (en) * | 1997-01-20 | 2005-11-30 | Ciba Spec Chem Water Treat Ltd | Polymeric compositions and their production and uses |
| MY118538A (en) * | 1997-01-20 | 2004-12-31 | Ciba Spec Chem Water Treat Ltd | Polymeric compositions and their production and uses |
| EP0989799B1 (en) * | 1997-06-18 | 2005-11-23 | Ciba Specialty Chemicals Water Treatments Limited | Irrigation method |
| US5985992A (en) * | 1997-12-10 | 1999-11-16 | Cytec Technology Corp. | Anionic polymer products and processes |
| US6262168B1 (en) | 1998-03-11 | 2001-07-17 | Cytec Technology Corp. | Aqueous dispersions |
| FR2777011B1 (fr) * | 1998-04-01 | 2000-05-19 | Atochem Elf Sa | Emulsions eau dans eau, stables et de faible taille de particules leur procede de synthese et application en tant qu'epaississants |
| US7850401B1 (en) * | 2000-01-18 | 2010-12-14 | Hamblet Jr Tracy E | Method for stabilizing soil against erosion |
| DE10041395A1 (de) | 2000-08-23 | 2002-03-07 | Stockhausen Chem Fab Gmbh | Polymerdispersionen zur Feuerverhütung und -bekämpfung mit verbesserter Umweltverträglichkeit |
| DE10160720A1 (de) | 2001-12-11 | 2003-06-18 | Basf Ag | Kosmetisches Mittel enthaltend wenigstens ein Copolymer mit N-Vinyllactameinheiten |
| ATE363890T1 (de) * | 2002-03-21 | 2007-06-15 | Basf Ag | Kationische polymerisate und deren verwendung in kosmetischen formulierungen |
| DE60311467T2 (de) * | 2002-06-21 | 2007-11-08 | Hymo Corp. | Dispersion von wasserlöslichem polymer, herstellungsverfahren dafür und verwendungsverfahren dafür |
| WO2004050715A2 (en) * | 2002-11-27 | 2004-06-17 | Isp Investments Inc. | Tough polymers |
| DE10261197A1 (de) * | 2002-12-20 | 2004-07-08 | Basf Ag | Wässrige Polymerdispersion |
| EP1651693B1 (de) * | 2003-07-25 | 2006-12-20 | Basf Aktiengesellschaft | Wässrige dispersionen von wasserlöslichen polymerisaten von ethylenisch ungesättigten anionischen monomeren, verfahren zu ihrer herstellung und ihre verwendung |
| GB0405505D0 (en) * | 2004-03-12 | 2004-04-21 | Ciba Spec Chem Water Treat Ltd | Dewatering process |
| DE102004019179A1 (de) * | 2004-04-16 | 2005-11-10 | Basf Ag | Verfahren zur Herstellung einer Wasser-in-Wasser-Dispersion von Polyvinyllactam mit einem K-Wert von > 120 |
| US20070231354A1 (en) * | 2005-04-21 | 2007-10-04 | Atsushi Sogabe | Water-Soluble Thickener and Cosmetic Preparation Containing Same |
| DE102004038983A1 (de) * | 2004-08-10 | 2006-02-23 | Basf Ag | Wässrige Dispersionen von wasserlöslichen und/oder in Wasser quellbaren anionischen Polymerisaten, Verfahren zu ihrer Herstellung und ihre Verwendung |
| DE102004042946A1 (de) * | 2004-09-02 | 2006-03-09 | Basf Ag | Verfahren zur Herstellung von Polymeren durch Sprühpolymerisation |
| ATE380220T1 (de) | 2004-11-05 | 2007-12-15 | Tibor Duris | Verwendung von wässrigen dispersionen von wasserlöslichen (co)polymerisaten von mindestens einem ethylenisch ungesättigten monomer mon zur herstellung von textilhilfsmitteln |
| US8299183B2 (en) * | 2004-12-28 | 2012-10-30 | Akzo Nobel N.V. | Polymer dispersion and process for preparing a polymer dispersion |
| DE102005003569A1 (de) * | 2005-01-25 | 2006-08-03 | Basf Ag | Verwendung von wässrigen Dispersionen zur tertiären Erdölförderung |
| BRPI0607038A2 (pt) * | 2005-01-28 | 2009-12-01 | Basf Ag | uso de polìmeros composições cosméticas para cabelo, e para pele, e, composição dermatólogica |
| US20070197721A1 (en) * | 2005-04-14 | 2007-08-23 | Basf Aktiengesellschaft | Method for Producing Aqueous Polyvinyllactam Dispersions |
| DE102005023800A1 (de) * | 2005-05-19 | 2006-11-23 | Basf Ag | Verwendung von wässrigen Dispersionen von wasserlöslichen und/oder in Wasser quellbaren Polymeren in Löschmitteln und Verfahren zur Bekämpfung von Bränden |
| DE102005023799A1 (de) * | 2005-05-19 | 2006-11-23 | Basf Ag | Wässrige Dispersionen von wasserlöslichen und/oder in Wasser quellbaren anionischen Polymerisaten, Verfahren zu ihrer Herstellung und ihre Verwendung |
| DE102005063376B4 (de) | 2005-11-26 | 2018-10-11 | Tougas Oilfield Solutions Gmbh | Pfropfcopolymere und deren Verwendung |
| DE102005056436B4 (de) * | 2005-11-26 | 2009-06-25 | Allessachemie Gmbh | Wasserfreie Dispersionen, Verfahren zu deren Herstellung sowie deren Verwendung |
| KR100811212B1 (ko) * | 2005-12-16 | 2008-03-07 | 주식회사 그린테크놀로지 | 수용성 음이온성 고분자 분산액 및 그 제조방법 |
| FR2908135B1 (fr) * | 2006-11-03 | 2009-02-27 | Limousine D Applic Biolog Dite | Procede d'obtention d'un polymere saccharidique, polymeres saccharidiques et compositions cosmetiques |
| ES2369159T3 (es) * | 2006-12-11 | 2011-11-25 | Basf Se | Procedimiento para la reducción de la viscosidad de dispersiones acuosas de polímero de polímeros hidrosolubles. |
| CN102076722A (zh) * | 2008-06-24 | 2011-05-25 | 巴斯夫欧洲公司 | 含有水溶性共聚物的水分散体的含金属盐颜料的纸张涂布剂 |
| WO2010084896A1 (ja) * | 2009-01-21 | 2010-07-29 | 日本パーカライジング株式会社 | アルミニウム含有金属材用親水化処理剤、親水化処理方法及び親水化処理されたアルミニウム含有金属材 |
| US9238749B2 (en) * | 2011-02-14 | 2016-01-19 | Basf Se | Aqueous binder for granular and/or fibrous substrates |
| US9095730B2 (en) | 2011-06-07 | 2015-08-04 | Basf Se | Associative thickeners based on methacrylate |
| EP2532691A1 (de) | 2011-06-07 | 2012-12-12 | Basf Se | Assoziativverdicker auf Basis von Methacrylat |
| US12227643B2 (en) * | 2021-10-22 | 2025-02-18 | Psmg, Llc | Liquid chloride salt-based polymer suspension fluids with polyethylene glycol dispersants and application to drag reduction |
| CN119285822A (zh) * | 2024-10-11 | 2025-01-10 | 济南大学 | 一种高效去除微塑料的聚镁-甲基丙烯酰胺混凝剂的制备方法 |
Family Cites Families (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| FR2197895B1 (enExample) * | 1972-08-31 | 1975-03-07 | Sumitomo Chemical Co | |
| JPS5246276B2 (enExample) * | 1974-01-16 | 1977-11-22 | ||
| US4042529A (en) * | 1974-07-11 | 1977-08-16 | The Dow Chemical Company | Composition and method for enhancing dispersibility of water soluble polymers |
| JPS5243891A (en) * | 1975-10-03 | 1977-04-06 | Japan Exlan Co Ltd | Process for preparing stable polymer emulsions |
| JPS5493089A (en) * | 1977-06-28 | 1979-07-23 | Nitto Chem Ind Co Ltd | Preparation of acrylamide polymer |
| IE47143B1 (en) * | 1977-08-15 | 1983-12-28 | Dulux Australia Ltd | Aqueous polymer dispersion |
| NZ189084A (en) * | 1977-12-23 | 1981-02-11 | Dulux Australia Ltd | Aqueous dispersion of film-forming addition polymer comprising units of acrylamide or methacrylamide |
-
1978
- 1978-06-19 JP JP7323278A patent/JPS55721A/ja active Granted
-
1979
- 1979-06-19 DE DE2924663A patent/DE2924663C2/de not_active Expired
- 1979-06-19 FR FR7915664A patent/FR2429225A1/fr active Granted
-
1981
- 1981-05-15 US US06/263,921 patent/US4380600A/en not_active Expired - Lifetime
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US7608208B2 (en) | 2001-04-10 | 2009-10-27 | Evonik Stockhausen Gmbh | Additives for water for fire protection |
Also Published As
| Publication number | Publication date |
|---|---|
| DE2924663A1 (de) | 1979-12-20 |
| FR2429225B1 (enExample) | 1985-02-22 |
| JPS625170B2 (enExample) | 1987-02-03 |
| JPS55721A (en) | 1980-01-07 |
| FR2429225A1 (fr) | 1980-01-18 |
| US4380600A (en) | 1983-04-19 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2924663C2 (de) | Verfahren zur Herstellung einer wäßrigen Dispersion aus wasserlöslicher Polymermasse | |
| EP1353975B1 (de) | Verfahren zur herstellung von wasser-in-wasser-polymerdispersionen | |
| DE3686057T2 (de) | Verfahren zur herstellung von polymerteilchen, diese polymerteilchen und ihre verwendung. | |
| DE3851132T2 (de) | Polymerteilchen und ihre Herstellung. | |
| EP0670333B1 (de) | Vernetzte wasserlösliche Polymerdispersionen | |
| DE1795126C3 (de) | Verfahren zur Gewinnung von wasserlöslichen Acrylamidpolymerisaten | |
| EP1727853B1 (de) | Anionische wasser-in-wasser-polymerdispersionen, verfahren zu deren herstellung sowie deren verwendung | |
| DE2800520A1 (de) | Verfahren zur herstellung eines wasserloeslichen perlenpolymeren | |
| DE2823640B2 (de) | Flüssige Polymerzusammensetzung | |
| DE1300244B (de) | Verfahren zur Herstellung gekoernter wasserloeslicher Polymerisate und Mischpolymerisate | |
| DE1720988B1 (de) | Verfahren zur herstellung einer russ-kunstharz-masse | |
| DD153879A5 (de) | Verfahren zur herstellung eines wasserloeslichen copolymerisats | |
| EP0081083A2 (de) | Verfahren zur Herstellung von wässrigen, hochkonzentrierten bimodalen Kunststoffdispersionen | |
| DE2840010B2 (de) | Pfropfmischpolymerisate | |
| DE2602917C2 (de) | Verfahren zur Herstellung eines festen Polymeren aus Vinylpyrrolidon und seine Verwendung | |
| EP0123297B1 (de) | Vernetzte hydrophile Copolymerisate, ihre Herstellung und Verwendung | |
| DE69421937T2 (de) | Multimodale emulsionen und verfahren zur herstellung multimodaler emulsionen | |
| DE3137524A1 (de) | Verfahren zur herstellung von hochmolekularen hydrophilen polymergelen | |
| EP0250896B1 (de) | Herstellung eines geruchsarmen wasserlöslichen Polymerisats oder Copolymerisats | |
| DE3021767A1 (de) | Verfahren zur herstellung von acrylamidpolymeren | |
| DE3402182A1 (de) | Verfahren zur herstellung von kationischen polymeren | |
| EP0025979A1 (de) | Wässrige Lösung oder Dispersion eines Styrol/Maleinsäureanhydrid-Copolymers, Verfahren zu ihrer Herstellung und ihre Verwendung | |
| EP0065136B1 (de) | Oberflächenaktive Azoverbindungen und ihre Verwendung | |
| EP0664302A2 (de) | Ein- oder mehrstufiges Verfahren zur Herstellung niedrigviskoser, wasserlöslicher Polymerdispersionen | |
| EP0761701A1 (de) | Vernetzte wasserlösliche Polymerdispersionen |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| OAP | Request for examination filed | ||
| OD | Request for examination | ||
| 8125 | Change of the main classification |
Ipc: C08F 20/02 |
|
| D2 | Grant after examination | ||
| 8328 | Change in the person/name/address of the agent |
Free format text: KOHLER, M., DIPL.-CHEM. DR.RER.NAT., 8000 MUENCHEN GLAESER, J., DIPL.-ING., PAT.-ANW., 2000 HAMBURG |
|
| 8364 | No opposition during term of opposition |