DE2836084A1 - Verfahren zur herstellung von essigsaeureanhydrid - Google Patents
Verfahren zur herstellung von essigsaeureanhydridInfo
- Publication number
- DE2836084A1 DE2836084A1 DE19782836084 DE2836084A DE2836084A1 DE 2836084 A1 DE2836084 A1 DE 2836084A1 DE 19782836084 DE19782836084 DE 19782836084 DE 2836084 A DE2836084 A DE 2836084A DE 2836084 A1 DE2836084 A1 DE 2836084A1
- Authority
- DE
- Germany
- Prior art keywords
- acetic anhydride
- compound
- acetic acid
- compounds
- methyl
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Withdrawn
Links
- WFDIJRYMOXRFFG-UHFFFAOYSA-N Acetic anhydride Chemical compound CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 title claims description 92
- 238000004519 manufacturing process Methods 0.000 title claims description 6
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 claims description 72
- LCGLNKUTAGEVQW-UHFFFAOYSA-N Dimethyl ether Chemical compound COC LCGLNKUTAGEVQW-UHFFFAOYSA-N 0.000 claims description 15
- 150000001875 compounds Chemical class 0.000 claims description 15
- 239000003054 catalyst Substances 0.000 claims description 13
- 238000000034 method Methods 0.000 claims description 12
- 229910000510 noble metal Inorganic materials 0.000 claims description 10
- 229910002091 carbon monoxide Inorganic materials 0.000 claims description 8
- 229910052739 hydrogen Inorganic materials 0.000 claims description 8
- INQOMBQAUSQDDS-UHFFFAOYSA-N iodomethane Chemical compound IC INQOMBQAUSQDDS-UHFFFAOYSA-N 0.000 claims description 8
- 229910052757 nitrogen Inorganic materials 0.000 claims description 8
- UGFAIRIUMAVXCW-UHFFFAOYSA-N Carbon monoxide Chemical compound [O+]#[C-] UGFAIRIUMAVXCW-UHFFFAOYSA-N 0.000 claims description 7
- 238000006243 chemical reaction Methods 0.000 claims description 7
- 150000002391 heterocyclic compounds Chemical class 0.000 claims description 7
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 6
- 239000001257 hydrogen Substances 0.000 claims description 6
- 239000000203 mixture Substances 0.000 claims description 6
- 125000006615 aromatic heterocyclic group Chemical group 0.000 claims description 5
- 150000001732 carboxylic acid derivatives Chemical class 0.000 claims description 5
- 230000000737 periodic effect Effects 0.000 claims description 5
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 claims description 4
- 150000007933 aliphatic carboxylic acids Chemical class 0.000 claims description 4
- 125000004432 carbon atom Chemical group C* 0.000 claims description 4
- 125000005842 heteroatom Chemical group 0.000 claims description 4
- 239000011630 iodine Substances 0.000 claims description 4
- 229910052740 iodine Inorganic materials 0.000 claims description 4
- 238000002844 melting Methods 0.000 claims description 4
- 230000008018 melting Effects 0.000 claims description 4
- 125000004433 nitrogen atom Chemical group N* 0.000 claims description 4
- 238000009835 boiling Methods 0.000 claims description 3
- XBDQKXXYIPTUBI-UHFFFAOYSA-M Propionate Chemical compound CCC([O-])=O XBDQKXXYIPTUBI-UHFFFAOYSA-M 0.000 description 28
- KXKVLQRXCPHEJC-UHFFFAOYSA-N acetic acid trimethyl ester Natural products COC(C)=O KXKVLQRXCPHEJC-UHFFFAOYSA-N 0.000 description 28
- 229910000856 hastalloy Inorganic materials 0.000 description 20
- 239000010948 rhodium Substances 0.000 description 19
- 230000035484 reaction time Effects 0.000 description 13
- 239000011541 reaction mixture Substances 0.000 description 8
- BVUPLMFUPRCOEH-UHFFFAOYSA-M 1,3-dimethylpyridin-1-ium;iodide Chemical compound [I-].CC1=CC=C[N+](C)=C1 BVUPLMFUPRCOEH-UHFFFAOYSA-M 0.000 description 7
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 6
- XMBWDFGMSWQBCA-UHFFFAOYSA-N hydrogen iodide Chemical compound I XMBWDFGMSWQBCA-UHFFFAOYSA-N 0.000 description 4
- HLNJFEXZDGURGZ-UHFFFAOYSA-M 1-methylpyridin-1-ium;iodide Chemical compound [I-].C[N+]1=CC=CC=C1 HLNJFEXZDGURGZ-UHFFFAOYSA-M 0.000 description 3
- 239000007795 chemical reaction product Substances 0.000 description 3
- 238000004821 distillation Methods 0.000 description 3
- 239000007789 gas Substances 0.000 description 3
- YHUKQLJMHYAHOI-UHFFFAOYSA-M 1,1-dimethylimidazol-1-ium;iodide Chemical compound [I-].C[N+]1(C)C=CN=C1 YHUKQLJMHYAHOI-UHFFFAOYSA-M 0.000 description 2
- PFZPMLROUDTELO-UHFFFAOYSA-N 1-methyl-1h-imidazol-1-ium;acetate Chemical compound CC(O)=O.CN1C=CN=C1 PFZPMLROUDTELO-UHFFFAOYSA-N 0.000 description 2
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 2
- FERIUCNNQQJTOY-UHFFFAOYSA-N Butyric acid Chemical compound CCCC(O)=O FERIUCNNQQJTOY-UHFFFAOYSA-N 0.000 description 2
- VYZAMTAEIAYCRO-UHFFFAOYSA-N Chromium Chemical compound [Cr] VYZAMTAEIAYCRO-UHFFFAOYSA-N 0.000 description 2
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 description 2
- PXHVJJICTQNCMI-UHFFFAOYSA-N Nickel Chemical compound [Ni] PXHVJJICTQNCMI-UHFFFAOYSA-N 0.000 description 2
- OAICVXFJPJFONN-UHFFFAOYSA-N Phosphorus Chemical compound [P] OAICVXFJPJFONN-UHFFFAOYSA-N 0.000 description 2
- 150000008064 anhydrides Chemical class 0.000 description 2
- 230000015572 biosynthetic process Effects 0.000 description 2
- 229910052804 chromium Inorganic materials 0.000 description 2
- 239000011651 chromium Substances 0.000 description 2
- 238000010586 diagram Methods 0.000 description 2
- XBDQKXXYIPTUBI-UHFFFAOYSA-N dimethylselenoniopropionate Natural products CCC(O)=O XBDQKXXYIPTUBI-UHFFFAOYSA-N 0.000 description 2
- 230000000694 effects Effects 0.000 description 2
- 229910052751 metal Inorganic materials 0.000 description 2
- 239000002184 metal Substances 0.000 description 2
- BDAGIHXWWSANSR-UHFFFAOYSA-N methanoic acid Natural products OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 description 2
- QJGQUHMNIGDVPM-UHFFFAOYSA-N nitrogen group Chemical group [N] QJGQUHMNIGDVPM-UHFFFAOYSA-N 0.000 description 2
- 150000002903 organophosphorus compounds Chemical class 0.000 description 2
- 229910052698 phosphorus Inorganic materials 0.000 description 2
- 239000011574 phosphorus Substances 0.000 description 2
- GAPYKZAARZMMGP-UHFFFAOYSA-N pyridin-1-ium;acetate Chemical compound CC(O)=O.C1=CC=NC=C1 GAPYKZAARZMMGP-UHFFFAOYSA-N 0.000 description 2
- 150000003839 salts Chemical class 0.000 description 2
- 238000000926 separation method Methods 0.000 description 2
- RTQPKEOYPPMVGQ-UHFFFAOYSA-N 1-methylquinolin-1-ium Chemical compound C1=CC=C2[N+](C)=CC=CC2=C1 RTQPKEOYPPMVGQ-UHFFFAOYSA-N 0.000 description 1
- PNYRDWUKTXFTPN-UHFFFAOYSA-M 1-methylquinolin-1-ium;iodide Chemical compound [I-].C1=CC=C2[N+](C)=CC=CC2=C1 PNYRDWUKTXFTPN-UHFFFAOYSA-M 0.000 description 1
- SWMLTVAXDGUWMC-UHFFFAOYSA-N 3-methylpyridin-1-ium;acetate Chemical compound CC([O-])=O.CC1=CC=C[NH+]=C1 SWMLTVAXDGUWMC-UHFFFAOYSA-N 0.000 description 1
- GOKCJCODOLGYQD-UHFFFAOYSA-N 4,6-dichloro-2-imidazol-1-ylpyrimidine Chemical compound ClC1=CC(Cl)=NC(N2C=NC=C2)=N1 GOKCJCODOLGYQD-UHFFFAOYSA-N 0.000 description 1
- OSWFIVFLDKOXQC-UHFFFAOYSA-N 4-(3-methoxyphenyl)aniline Chemical compound COC1=CC=CC(C=2C=CC(N)=CC=2)=C1 OSWFIVFLDKOXQC-UHFFFAOYSA-N 0.000 description 1
- WAIPAZQMEIHHTJ-UHFFFAOYSA-N [Cr].[Co] Chemical compound [Cr].[Co] WAIPAZQMEIHHTJ-UHFFFAOYSA-N 0.000 description 1
- 229910045601 alloy Inorganic materials 0.000 description 1
- 239000000956 alloy Substances 0.000 description 1
- 230000006315 carbonylation Effects 0.000 description 1
- 238000005810 carbonylation reaction Methods 0.000 description 1
- 230000003197 catalytic effect Effects 0.000 description 1
- 229910017052 cobalt Inorganic materials 0.000 description 1
- 239000010941 cobalt Substances 0.000 description 1
- GUTLYIVDDKVIGB-UHFFFAOYSA-N cobalt atom Chemical compound [Co] GUTLYIVDDKVIGB-UHFFFAOYSA-N 0.000 description 1
- 238000010924 continuous production Methods 0.000 description 1
- 235000019253 formic acid Nutrition 0.000 description 1
- 150000004678 hydrides Chemical class 0.000 description 1
- 229910052742 iron Inorganic materials 0.000 description 1
- 239000000155 melt Substances 0.000 description 1
- 150000002736 metal compounds Chemical class 0.000 description 1
- 229910052759 nickel Inorganic materials 0.000 description 1
- -1 of chromium Chemical class 0.000 description 1
- 239000000047 product Substances 0.000 description 1
- 235000019260 propionic acid Nutrition 0.000 description 1
- IUVKMZGDUIUOCP-BTNSXGMBSA-N quinbolone Chemical compound O([C@H]1CC[C@H]2[C@H]3[C@@H]([C@]4(C=CC(=O)C=C4CC3)C)CC[C@@]21C)C1=CCCC1 IUVKMZGDUIUOCP-BTNSXGMBSA-N 0.000 description 1
- 238000004064 recycling Methods 0.000 description 1
- 229910052703 rhodium Inorganic materials 0.000 description 1
- MHOVAHRLVXNVSD-UHFFFAOYSA-N rhodium atom Chemical compound [Rh] MHOVAHRLVXNVSD-UHFFFAOYSA-N 0.000 description 1
- 239000002904 solvent Substances 0.000 description 1
- 238000010626 work up procedure Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C51/00—Preparation of carboxylic acids or their salts, halides or anhydrides
- C07C51/54—Preparation of carboxylic acid anhydrides
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C51/00—Preparation of carboxylic acids or their salts, halides or anhydrides
- C07C51/54—Preparation of carboxylic acid anhydrides
- C07C51/56—Preparation of carboxylic acid anhydrides from organic acids, their salts, their esters or their halides, e.g. by carboxylation
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Engineering & Computer Science (AREA)
- Oil, Petroleum & Natural Gas (AREA)
- Low-Molecular Organic Synthesis Reactions Using Catalysts (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Priority Applications (12)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19782836084 DE2836084A1 (de) | 1978-08-17 | 1978-08-17 | Verfahren zur herstellung von essigsaeureanhydrid |
| EP79102790A EP0008396B2 (de) | 1978-08-17 | 1979-08-03 | Verfahren zur Herstellung von Essigsäureanhydrid |
| DE7979102790T DE2961139D1 (en) | 1978-08-17 | 1979-08-03 | Process for the preparation of acetic acid anhydride |
| CA333,273A CA1111065A (en) | 1978-08-17 | 1979-08-07 | Production of acetic anhydride |
| SU792802995A SU1052155A3 (ru) | 1978-08-17 | 1979-08-13 | Способ получени уксусного ангидрида |
| JP10322379A JPS5528980A (en) | 1978-08-17 | 1979-08-15 | Manufacture of acetic anhydride |
| DD79214992A DD145530A5 (de) | 1978-08-17 | 1979-08-15 | Verfahren zur herstellung von essigsaeureanhydrid |
| MX178949A MX152224A (es) | 1978-08-17 | 1979-08-16 | Procedimiento mejorado para la obtencion de anhidrido acetico |
| ZA00794293A ZA794293B (en) | 1978-08-17 | 1979-08-16 | Production of acetic anhydride |
| AU49992/79A AU531718B2 (en) | 1978-08-17 | 1979-08-16 | Production of acetic anhydride |
| PL1979217793A PL115828B1 (en) | 1978-08-17 | 1979-08-16 | Method of manufacture of acetic anhydride |
| US06/366,344 US4430273A (en) | 1978-08-17 | 1982-04-07 | Production of acetic anhydride |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19782836084 DE2836084A1 (de) | 1978-08-17 | 1978-08-17 | Verfahren zur herstellung von essigsaeureanhydrid |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE2836084A1 true DE2836084A1 (de) | 1980-03-06 |
Family
ID=6047295
Family Applications (2)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19782836084 Withdrawn DE2836084A1 (de) | 1978-08-17 | 1978-08-17 | Verfahren zur herstellung von essigsaeureanhydrid |
| DE7979102790T Expired DE2961139D1 (en) | 1978-08-17 | 1979-08-03 | Process for the preparation of acetic acid anhydride |
Family Applications After (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE7979102790T Expired DE2961139D1 (en) | 1978-08-17 | 1979-08-03 | Process for the preparation of acetic acid anhydride |
Country Status (11)
| Country | Link |
|---|---|
| US (1) | US4430273A (enExample) |
| EP (1) | EP0008396B2 (enExample) |
| JP (1) | JPS5528980A (enExample) |
| AU (1) | AU531718B2 (enExample) |
| CA (1) | CA1111065A (enExample) |
| DD (1) | DD145530A5 (enExample) |
| DE (2) | DE2836084A1 (enExample) |
| MX (1) | MX152224A (enExample) |
| PL (1) | PL115828B1 (enExample) |
| SU (1) | SU1052155A3 (enExample) |
| ZA (1) | ZA794293B (enExample) |
Cited By (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4351972A (en) * | 1980-09-01 | 1982-09-28 | Hoechst Aktiengesellschaft | Process for making anhydrous alkyl iodides |
| JPH02104551A (ja) * | 1988-07-13 | 1990-04-17 | Hoechst Ag | 酢酸及び無水酢酸の製造法 |
| US6992212B2 (en) | 2001-08-07 | 2006-01-31 | Basf Aktiengesellschaft | Felxible method for the common production of formic acid, a carboxylic acid having at least two carbon atoms, and/or the derivatives of the same |
| US7253316B2 (en) | 2002-10-26 | 2007-08-07 | Basf Aktiengesellschaft | Flexible method for the joint production of (i) formic acid, (ii) a carboxylic acid comprising at least two carbon atoms and/or the derivatives thereof, and (iii) a carboxylic acid anhydride |
Families Citing this family (33)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2939839A1 (de) * | 1979-10-02 | 1981-04-23 | Hoechst Ag, 6000 Frankfurt | Verfahren zur herstellung von essigsaeureanhydrid |
| US4284585A (en) * | 1979-12-26 | 1981-08-18 | Halcon Research And Development Corp. | Process for the preparation of acetic anhydride |
| US4284586A (en) * | 1979-12-26 | 1981-08-18 | Halcon Research And Development Corp. | Process for the preparation of acetic anhydride |
| FR2507597B1 (fr) * | 1981-06-12 | 1985-12-13 | Rhone Poulenc Chim Base | Procede de carbonylation de l'acetate de methyle |
| EP0098689B1 (en) * | 1982-06-05 | 1986-12-17 | BP Chemicals Limited | Process for the production of monocarboxylic acid anhydrides |
| GB8319619D0 (en) * | 1983-07-20 | 1983-08-24 | Bp Chem Int Ltd | Acetic anhydride |
| DE3329781A1 (de) * | 1983-08-18 | 1985-02-28 | Hoechst Ag, 6230 Frankfurt | Verfahren zur abtrennung von jod und dessen verbindungen aus den bei der carbonylierung von dimethylether, methylacetat oder methanol erhaltenen carbonylierungsprodukten |
| JPS60203152A (ja) * | 1984-03-26 | 1985-10-14 | Yasushi Kuno | 乾燥餅の製造方法 |
| DE3429179A1 (de) * | 1984-08-08 | 1986-02-20 | Hoechst Ag, 6230 Frankfurt | Verfahren zur gemeinsamen herstellung von carbonsaeuren und carbonsaeureanhydriden sowie ggf. carbonsaeureestern |
| GB8705699D0 (en) * | 1987-03-11 | 1987-04-15 | Shell Int Research | Carbonylation of olefinically unsaturated compounds |
| DK158221C (da) * | 1987-06-30 | 1990-09-10 | Haldor Topsoe As | Fremgangsmaade til fremstilling af eddikesyre, metylacetat, eddikesyreanhydrid eller blandinger deraf |
| US5442107A (en) * | 1989-04-06 | 1995-08-15 | Bp Chemicals Limited | Preparing carboxylic acids |
| GB9021454D0 (en) * | 1990-10-03 | 1990-11-14 | Bp Chem Int Ltd | Process |
| JPH0468913U (enExample) * | 1990-10-17 | 1992-06-18 | ||
| JPH0468912U (enExample) * | 1990-10-17 | 1992-06-18 | ||
| US5097069A (en) * | 1991-04-08 | 1992-03-17 | Eastman Kodak Company | Process for decomposing α,β-unsaturated carbonyl compounds in refining acetic anhydride and/or acetic acid |
| GB9218346D0 (en) * | 1992-08-28 | 1992-10-14 | Bp Chem Int Ltd | Process |
| US5672743A (en) * | 1993-09-10 | 1997-09-30 | Bp Chemicals Limited | Process for the production of acetic acid |
| JPH07190821A (ja) * | 1993-12-24 | 1995-07-28 | Nippondenso Co Ltd | 流量計 |
| GB9806527D0 (en) | 1998-03-26 | 1998-05-27 | Bp Chem Int Ltd | Process |
| US5922911A (en) * | 1998-04-24 | 1999-07-13 | Eastman Chemical Company | Process for the manufacture of acetic anhydride |
| US6222070B1 (en) | 1999-09-07 | 2001-04-24 | Eastman Chemical Company | Method for reducing EDA in acetic anhydride production |
| JP4160555B2 (ja) * | 2002-05-06 | 2008-10-01 | イーストマン ケミカル カンパニー | 連続的カルボニル化方法 |
| US7737298B2 (en) | 2006-06-09 | 2010-06-15 | Eastman Chemical Company | Production of acetic acid and mixtures of acetic acid and acetic anhydride |
| US7582792B2 (en) | 2006-06-15 | 2009-09-01 | Eastman Chemical Company | Carbonylation process |
| US7253304B1 (en) | 2006-06-20 | 2007-08-07 | Eastman Chemical Company | Carbonylation process |
| US7629491B2 (en) | 2006-06-26 | 2009-12-08 | Eastman Chemical Company | Hydrocarboxylation process |
| US20090247783A1 (en) * | 2008-04-01 | 2009-10-01 | Eastman Chemical Company | Carbonylation process |
| TW201022202A (en) * | 2008-12-04 | 2010-06-16 | China Petrochemical Dev Corp | Method for producing carboxylic acid anhydride |
| TW201209034A (en) | 2010-08-31 | 2012-03-01 | China Petrochemical Dev Corp | Production method for carboxylic acid anhydride |
| US9012683B2 (en) | 2010-11-12 | 2015-04-21 | Eastman Chemical Company | Coproduction of acetic acid and acetic anhydride |
| BR112013011438A2 (pt) | 2010-11-12 | 2016-08-09 | Eastman Chem Co | processo para refinar uma mistura de acetilas bruta |
| US10988432B2 (en) | 2013-03-07 | 2021-04-27 | Ineos Acetyls Uk Limited | Process for the co-production of acetic acid and acetic anhydride |
Family Cites Families (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3852346A (en) | 1972-12-26 | 1974-12-03 | Monsanto Co | Production of carboxylic acid anhydrides |
| DE2450965C2 (de) * | 1974-10-26 | 1983-06-09 | Hoechst Ag, 6230 Frankfurt | Verfahren zur Herstellung von Essigsäureanhydrid |
| CA1058636A (en) * | 1975-03-10 | 1979-07-17 | Nabil Rizkalla | Process for preparing carboxylic acid anhydrides |
| US4115444A (en) | 1975-03-10 | 1978-09-19 | Halcon International, Inc. | Process for preparing carboxylic acid anhydrides |
| US4002678A (en) * | 1975-12-22 | 1977-01-11 | Halcon International, Inc. | Preparation of carboxylic acid anhydrides |
-
1978
- 1978-08-17 DE DE19782836084 patent/DE2836084A1/de not_active Withdrawn
-
1979
- 1979-08-03 DE DE7979102790T patent/DE2961139D1/de not_active Expired
- 1979-08-03 EP EP79102790A patent/EP0008396B2/de not_active Expired
- 1979-08-07 CA CA333,273A patent/CA1111065A/en not_active Expired
- 1979-08-13 SU SU792802995A patent/SU1052155A3/ru active
- 1979-08-15 JP JP10322379A patent/JPS5528980A/ja active Granted
- 1979-08-15 DD DD79214992A patent/DD145530A5/de unknown
- 1979-08-16 ZA ZA00794293A patent/ZA794293B/xx unknown
- 1979-08-16 MX MX178949A patent/MX152224A/es unknown
- 1979-08-16 PL PL1979217793A patent/PL115828B1/pl unknown
- 1979-08-16 AU AU49992/79A patent/AU531718B2/en not_active Expired
-
1982
- 1982-04-07 US US06/366,344 patent/US4430273A/en not_active Expired - Lifetime
Cited By (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4351972A (en) * | 1980-09-01 | 1982-09-28 | Hoechst Aktiengesellschaft | Process for making anhydrous alkyl iodides |
| JPH02104551A (ja) * | 1988-07-13 | 1990-04-17 | Hoechst Ag | 酢酸及び無水酢酸の製造法 |
| US5380929A (en) * | 1988-07-13 | 1995-01-10 | Hoechst Aktiengesellschaft | Process for the preparation of acetic acid and acetic anhydride |
| EP0350635B2 (de) † | 1988-07-13 | 2002-07-17 | Celanese Chemicals Europe GmbH | Verfahren zur Herstellung von Essigsäure und Essigsäureanhydrid |
| US6992212B2 (en) | 2001-08-07 | 2006-01-31 | Basf Aktiengesellschaft | Felxible method for the common production of formic acid, a carboxylic acid having at least two carbon atoms, and/or the derivatives of the same |
| US7253316B2 (en) | 2002-10-26 | 2007-08-07 | Basf Aktiengesellschaft | Flexible method for the joint production of (i) formic acid, (ii) a carboxylic acid comprising at least two carbon atoms and/or the derivatives thereof, and (iii) a carboxylic acid anhydride |
Also Published As
| Publication number | Publication date |
|---|---|
| DD145530A5 (de) | 1980-12-17 |
| PL115828B1 (en) | 1981-05-30 |
| CA1111065A (en) | 1981-10-20 |
| DE2961139D1 (en) | 1981-12-10 |
| AU4999279A (en) | 1980-02-21 |
| US4430273A (en) | 1984-02-07 |
| JPS5528980A (en) | 1980-02-29 |
| SU1052155A3 (ru) | 1983-10-30 |
| ZA794293B (en) | 1980-09-24 |
| JPS5715097B2 (enExample) | 1982-03-29 |
| EP0008396B2 (de) | 1987-05-27 |
| PL217793A1 (enExample) | 1980-04-21 |
| MX152224A (es) | 1985-06-12 |
| EP0008396B1 (de) | 1981-09-30 |
| EP0008396A1 (de) | 1980-03-05 |
| AU531718B2 (en) | 1983-09-01 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2836084A1 (de) | Verfahren zur herstellung von essigsaeureanhydrid | |
| EP0026280B1 (de) | Verfahren zur Herstellung von Essigsäureanhydrid | |
| DE3823645C1 (enExample) | ||
| DE69903865T2 (de) | Wasserfreies Carbonylierungsverfahren zur Herstellung von Essigsäure | |
| DE2733663C2 (enExample) | ||
| DE2930280A1 (de) | Verfahren zur herstellung von aliphatischen carbonsaeuren und deren estern | |
| DE3151495C2 (de) | Verfahren zur Herstellung von Carbonsäuren | |
| DE2658216A1 (de) | Verfahren zur herstellung von monocarbonsaeureanhydriden | |
| EP0081152B1 (de) | Verfahren zur Herstellung von Essigsäureanhydrid und/oder Essigsäure und/oder Ethylidendiacetat | |
| EP0483536B1 (de) | Kontinuierliches Verfahren zur gleichzeitigen Herstellung von Essigsäure und Essigsäuranhydrid | |
| EP0170964B1 (de) | Verfahren zur Herstellung von Essigsäureanhydrid und ggf. Essigsäure | |
| EP0079461B1 (de) | Verfahren zur Herstellung von Essigsäureanhydrid und ggf. Essigsäure | |
| DE2303271B2 (de) | Verfahren zur Herstellung von Essigsäure oder deren Gemisch mit Methylacetat | |
| EP0027501A1 (de) | Verfahren zur Herstellung von 1,1-Diacetoxiethan | |
| DE2037782A1 (de) | Verfahren zur Herstellung von Adipinsäure | |
| DE69407583T2 (de) | Homogenes katalysator system zur hydrodechlorierung von chlorkohlenwasserstoffen | |
| DE3509912A1 (de) | Verfahren zur herstellung von acetylverbindungen | |
| EP0046870B1 (de) | Verfahren zur Herstellung wasserfreier Alkyljodide | |
| DE3235051C2 (enExample) | ||
| DE4029917C2 (enExample) | ||
| DE69403831T2 (de) | Verfahren zur Carbonylierung der Allylbutenole und ihrer Ester | |
| EP0101581B1 (de) | Verfahren zur Herstellung von Essigsäureanhydrid | |
| DE2952517C2 (de) | Verfahren zur Herstellung von Acetaldehyd | |
| EP0039413A1 (de) | Verfahren zur Herstellung von Acetylchlorid | |
| DE921988C (de) | Verfahren zur Herstellung von Carbonsaeuren und deren funktionellen Abkoemmlingen |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| 8130 | Withdrawal |